` tag we check the equality\n * of the VNodes corresponding to the `
` tags and, since they are the\n * same tag in the same position, we'd be able to avoid completely\n * re-rendering the subtree under them with a new DOM element and would just\n * call out to `patch` to handle reconciling their children and so on.\n *\n * 3. Check, for both windows, to see if the element at the beginning of the\n * window corresponds to the element at the end of the other window. This is\n * a heuristic which will let us identify _some_ situations in which\n * elements have changed position, for instance it _should_ detect that the\n * children nodes themselves have not changed but merely moved in the\n * following example:\n *\n * oldVNode: `
`\n * newVNode: `
`\n *\n * If we find cases like this then we also need to move the concrete DOM\n * elements corresponding to the moved children to write the re-order to the\n * DOM.\n *\n * 4. Finally, if VNodes have the `key` attribute set on them we check for any\n * nodes in the old children which have the same key as the first element in\n * our window on the new children. If we find such a node we handle calling\n * out to `patch`, moving relevant DOM nodes, and so on, in accordance with\n * what we find.\n *\n * Finally, once we've narrowed our 'windows' to the point that either of them\n * collapse (i.e. they have length 0) we then handle any remaining VNode\n * insertion or deletion that needs to happen to get a DOM state that correctly\n * reflects the new child VNodes. If, for instance, after our window on the old\n * children has collapsed we still have more nodes on the new children that\n * we haven't dealt with yet then we need to add them, or if the new children\n * collapse but we still have unhandled _old_ children then we need to make\n * sure the corresponding DOM nodes are removed.\n *\n * @param parentElm the node into which the parent VNode is rendered\n * @param oldCh the old children of the parent node\n * @param newVNode the new VNode which will replace the parent\n * @param newCh the new children of the parent node\n */\nconst updateChildren = (parentElm, oldCh, newVNode, newCh) => {\n let oldStartIdx = 0;\n let newStartIdx = 0;\n let oldEndIdx = oldCh.length - 1;\n let oldStartVnode = oldCh[0];\n let oldEndVnode = oldCh[oldEndIdx];\n let newEndIdx = newCh.length - 1;\n let newStartVnode = newCh[0];\n let newEndVnode = newCh[newEndIdx];\n let node;\n while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {\n if (oldStartVnode == null) {\n // VNode might have been moved left\n oldStartVnode = oldCh[++oldStartIdx];\n }\n else if (oldEndVnode == null) {\n oldEndVnode = oldCh[--oldEndIdx];\n }\n else if (newStartVnode == null) {\n newStartVnode = newCh[++newStartIdx];\n }\n else if (newEndVnode == null) {\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newStartVnode)) {\n // if the start nodes are the same then we should patch the new VNode\n // onto the old one, and increment our `newStartIdx` and `oldStartIdx`\n // indices to reflect that. We don't need to move any DOM Nodes around\n // since things are matched up in order.\n patch(oldStartVnode, newStartVnode);\n oldStartVnode = oldCh[++oldStartIdx];\n newStartVnode = newCh[++newStartIdx];\n }\n else if (isSameVnode(oldEndVnode, newEndVnode)) {\n // likewise, if the end nodes are the same we patch new onto old and\n // decrement our end indices, and also likewise in this case we don't\n // need to move any DOM Nodes.\n patch(oldEndVnode, newEndVnode);\n oldEndVnode = oldCh[--oldEndIdx];\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newEndVnode)) {\n patch(oldStartVnode, newEndVnode);\n // We need to move the element for `oldStartVnode` into a position which\n // will be appropriate for `newEndVnode`. For this we can use\n // `.insertBefore` and `oldEndVnode.$elm$.nextSibling`. If there is a\n // sibling for `oldEndVnode.$elm$` then we want to move the DOM node for\n // `oldStartVnode` between `oldEndVnode` and it's sibling, like so:\n //\n //
\n //
\n //
\n // \n //
\n // \n // ```\n // In this case if we do not unshadow here and use the value of the shadowing property, attributeChangedCallback\n // will be called with `newValue = \"some-value\"` and will set the shadowed property (this.someAttribute = \"another-value\")\n // to the value that was set inline i.e. \"some-value\" from above example. When\n // the connectedCallback attempts to unshadow it will use \"some-value\" as the initial value rather than \"another-value\"\n //\n // The case where the attribute was NOT set inline but was not set programmatically shall be handled/unshadowed\n // by connectedCallback as this attributeChangedCallback will not fire.\n //\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n //\n // TODO(STENCIL-16) we should think about whether or not we actually want to be reflecting the attributes to\n // properties here given that this goes against best practices outlined here\n // https://developers.google.com/web/fundamentals/web-components/best-practices#avoid-reentrancy\n if (this.hasOwnProperty(propName)) {\n newValue = this[propName];\n delete this[propName];\n }\n else if (prototype.hasOwnProperty(propName) &&\n typeof this[propName] === 'number' &&\n this[propName] == newValue) {\n // if the propName exists on the prototype of `Cstr`, this update may be a result of Stencil using native\n // APIs to reflect props as attributes. Calls to `setAttribute(someElement, propName)` will result in\n // `propName` to be converted to a `DOMString`, which may not be what we want for other primitive props.\n return;\n }\n this[propName] = newValue === null && typeof this[propName] === 'boolean' ? false : newValue;\n });\n };\n // create an array of attributes to observe\n // and also create a map of html attribute name to js property name\n Cstr.observedAttributes = members\n .filter(([_, m]) => m[0] & 15 /* MEMBER_FLAGS.HasAttribute */) // filter to only keep props that should match attributes\n .map(([propName, m]) => {\n const attrName = m[1] || propName;\n attrNameToPropName.set(attrName, propName);\n return attrName;\n });\n }\n }\n return Cstr;\n};\nconst initializeComponent = async (elm, hostRef, cmpMeta, hmrVersionId, Cstr) => {\n // initializeComponent\n if ((hostRef.$flags$ & 32 /* HOST_FLAGS.hasInitializedComponent */) === 0) {\n // Let the runtime know that the component has been initialized\n hostRef.$flags$ |= 32 /* HOST_FLAGS.hasInitializedComponent */;\n {\n // lazy loaded components\n // request the component's implementation to be\n // wired up with the host element\n Cstr = loadModule(cmpMeta);\n if (Cstr.then) {\n // Await creates a micro-task avoid if possible\n const endLoad = uniqueTime();\n Cstr = await Cstr;\n endLoad();\n }\n if (!Cstr.isProxied) {\n proxyComponent(Cstr, cmpMeta, 2 /* PROXY_FLAGS.proxyState */);\n Cstr.isProxied = true;\n }\n const endNewInstance = createTime('createInstance', cmpMeta.$tagName$);\n // ok, time to construct the instance\n // but let's keep track of when we start and stop\n // so that the getters/setters don't incorrectly step on data\n {\n hostRef.$flags$ |= 8 /* HOST_FLAGS.isConstructingInstance */;\n }\n // construct the lazy-loaded component implementation\n // passing the hostRef is very important during\n // construction in order to directly wire together the\n // host element and the lazy-loaded instance\n try {\n new Cstr(hostRef);\n }\n catch (e) {\n consoleError(e);\n }\n {\n hostRef.$flags$ &= ~8 /* HOST_FLAGS.isConstructingInstance */;\n }\n endNewInstance();\n }\n if (Cstr.style) {\n // this component has styles but we haven't registered them yet\n let style = Cstr.style;\n const scopeId = getScopeId(cmpMeta);\n if (!styles.has(scopeId)) {\n const endRegisterStyles = createTime('registerStyles', cmpMeta.$tagName$);\n registerStyle(scopeId, style, !!(cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */));\n endRegisterStyles();\n }\n }\n }\n // we've successfully created a lazy instance\n const ancestorComponent = hostRef.$ancestorComponent$;\n const schedule = () => scheduleUpdate(hostRef, true);\n if (ancestorComponent && ancestorComponent['s-rc']) {\n // this is the initial load and this component it has an ancestor component\n // but the ancestor component has NOT fired its will update lifecycle yet\n // so let's just cool our jets and wait for the ancestor to continue first\n // this will get fired off when the ancestor component\n // finally gets around to rendering its lazy self\n // fire off the initial update\n ancestorComponent['s-rc'].push(schedule);\n }\n else {\n schedule();\n }\n};\nconst connectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const cmpMeta = hostRef.$cmpMeta$;\n const endConnected = createTime('connectedCallback', cmpMeta.$tagName$);\n if (!(hostRef.$flags$ & 1 /* HOST_FLAGS.hasConnected */)) {\n // first time this component has connected\n hostRef.$flags$ |= 1 /* HOST_FLAGS.hasConnected */;\n {\n // find the first ancestor component (if there is one) and register\n // this component as one of the actively loading child components for its ancestor\n let ancestorComponent = elm;\n while ((ancestorComponent = ancestorComponent.parentNode || ancestorComponent.host)) {\n // climb up the ancestors looking for the first\n // component that hasn't finished its lifecycle update yet\n if (ancestorComponent['s-p']) {\n // we found this components first ancestor component\n // keep a reference to this component's ancestor component\n attachToAncestor(hostRef, (hostRef.$ancestorComponent$ = ancestorComponent));\n break;\n }\n }\n }\n // Lazy properties\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n if (cmpMeta.$members$) {\n Object.entries(cmpMeta.$members$).map(([memberName, [memberFlags]]) => {\n if (memberFlags & 31 /* MEMBER_FLAGS.Prop */ && elm.hasOwnProperty(memberName)) {\n const value = elm[memberName];\n delete elm[memberName];\n elm[memberName] = value;\n }\n });\n }\n {\n initializeComponent(elm, hostRef, cmpMeta);\n }\n }\n else {\n // not the first time this has connected\n // reattach any event listeners to the host\n // since they would have been removed when disconnected\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n }\n endConnected();\n }\n};\nconst disconnectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const instance = hostRef.$lazyInstance$ ;\n {\n if (hostRef.$rmListeners$) {\n hostRef.$rmListeners$.map((rmListener) => rmListener());\n hostRef.$rmListeners$ = undefined;\n }\n }\n {\n safeCall(instance, 'disconnectedCallback');\n }\n }\n};\nconst bootstrapLazy = (lazyBundles, options = {}) => {\n var _a;\n const endBootstrap = createTime();\n const cmpTags = [];\n const exclude = options.exclude || [];\n const customElements = win.customElements;\n const head = doc.head;\n const metaCharset = /*@__PURE__*/ head.querySelector('meta[charset]');\n const visibilityStyle = /*@__PURE__*/ doc.createElement('style');\n const deferredConnectedCallbacks = [];\n let appLoadFallback;\n let isBootstrapping = true;\n Object.assign(plt, options);\n plt.$resourcesUrl$ = new URL(options.resourcesUrl || './', doc.baseURI).href;\n lazyBundles.map((lazyBundle) => {\n lazyBundle[1].map((compactMeta) => {\n const cmpMeta = {\n $flags$: compactMeta[0],\n $tagName$: compactMeta[1],\n $members$: compactMeta[2],\n $listeners$: compactMeta[3],\n };\n {\n cmpMeta.$members$ = compactMeta[2];\n }\n {\n cmpMeta.$listeners$ = compactMeta[3];\n }\n const tagName = cmpMeta.$tagName$;\n const HostElement = class extends HTMLElement {\n // StencilLazyHost\n constructor(self) {\n // @ts-ignore\n super(self);\n self = this;\n registerHost(self, cmpMeta);\n if (cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */) {\n // this component is using shadow dom\n // and this browser supports shadow dom\n // add the read-only property \"shadowRoot\" to the host element\n // adding the shadow root build conditionals to minimize runtime\n {\n {\n self.attachShadow({ mode: 'open' });\n }\n }\n }\n }\n connectedCallback() {\n if (appLoadFallback) {\n clearTimeout(appLoadFallback);\n appLoadFallback = null;\n }\n if (isBootstrapping) {\n // connectedCallback will be processed once all components have been registered\n deferredConnectedCallbacks.push(this);\n }\n else {\n plt.jmp(() => connectedCallback(this));\n }\n }\n disconnectedCallback() {\n plt.jmp(() => disconnectedCallback(this));\n }\n componentOnReady() {\n return getHostRef(this).$onReadyPromise$;\n }\n };\n cmpMeta.$lazyBundleId$ = lazyBundle[0];\n if (!exclude.includes(tagName) && !customElements.get(tagName)) {\n cmpTags.push(tagName);\n customElements.define(tagName, proxyComponent(HostElement, cmpMeta, 1 /* PROXY_FLAGS.isElementConstructor */));\n }\n });\n });\n {\n visibilityStyle.innerHTML = cmpTags + HYDRATED_CSS;\n visibilityStyle.setAttribute('data-styles', '');\n // Apply CSP nonce to the style tag if it exists\n const nonce = (_a = plt.$nonce$) !== null && _a !== void 0 ? _a : queryNonceMetaTagContent(doc);\n if (nonce != null) {\n visibilityStyle.setAttribute('nonce', nonce);\n }\n head.insertBefore(visibilityStyle, metaCharset ? metaCharset.nextSibling : head.firstChild);\n }\n // Process deferred connectedCallbacks now all components have been registered\n isBootstrapping = false;\n if (deferredConnectedCallbacks.length) {\n deferredConnectedCallbacks.map((host) => host.connectedCallback());\n }\n else {\n {\n plt.jmp(() => (appLoadFallback = setTimeout(appDidLoad, 30)));\n }\n }\n // Fallback appLoad event\n endBootstrap();\n};\nconst addHostEventListeners = (elm, hostRef, listeners, attachParentListeners) => {\n if (listeners) {\n listeners.map(([flags, name, method]) => {\n const target = getHostListenerTarget(elm, flags) ;\n const handler = hostListenerProxy(hostRef, method);\n const opts = hostListenerOpts(flags);\n plt.ael(target, name, handler, opts);\n (hostRef.$rmListeners$ = hostRef.$rmListeners$ || []).push(() => plt.rel(target, name, handler, opts));\n });\n }\n};\nconst hostListenerProxy = (hostRef, methodName) => (ev) => {\n try {\n {\n if (hostRef.$flags$ & 256 /* HOST_FLAGS.isListenReady */) {\n // instance is ready, let's call it's member method for this event\n hostRef.$lazyInstance$[methodName](ev);\n }\n else {\n (hostRef.$queuedListeners$ = hostRef.$queuedListeners$ || []).push([methodName, ev]);\n }\n }\n }\n catch (e) {\n consoleError(e);\n }\n};\nconst getHostListenerTarget = (elm, flags) => {\n if (flags & 16 /* LISTENER_FLAGS.TargetBody */)\n return doc.body;\n return elm;\n};\n// prettier-ignore\nconst hostListenerOpts = (flags) => (flags & 2 /* LISTENER_FLAGS.Capture */) !== 0;\n/**\n * Assigns the given value to the nonce property on the runtime platform object.\n * During runtime, this value is used to set the nonce attribute on all dynamically created script and style tags.\n * @param nonce The value to be assigned to the platform nonce property.\n * @returns void\n */\nconst setNonce = (nonce) => (plt.$nonce$ = nonce);\nconst hostRefs = /*@__PURE__*/ new WeakMap();\nconst getHostRef = (ref) => hostRefs.get(ref);\nconst registerInstance = (lazyInstance, hostRef) => hostRefs.set((hostRef.$lazyInstance$ = lazyInstance), hostRef);\nconst registerHost = (elm, cmpMeta) => {\n const hostRef = {\n $flags$: 0,\n $hostElement$: elm,\n $cmpMeta$: cmpMeta,\n $instanceValues$: new Map(),\n };\n {\n hostRef.$onInstancePromise$ = new Promise((r) => (hostRef.$onInstanceResolve$ = r));\n }\n {\n hostRef.$onReadyPromise$ = new Promise((r) => (hostRef.$onReadyResolve$ = r));\n elm['s-p'] = [];\n elm['s-rc'] = [];\n }\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n return hostRefs.set(elm, hostRef);\n};\nconst isMemberInElement = (elm, memberName) => memberName in elm;\nconst consoleError = (e, el) => (0, console.error)(e, el);\nconst cmpModules = /*@__PURE__*/ new Map();\nconst loadModule = (cmpMeta, hostRef, hmrVersionId) => {\n // loadModuleImport\n const exportName = cmpMeta.$tagName$.replace(/-/g, '_');\n const bundleId = cmpMeta.$lazyBundleId$;\n const module = cmpModules.get(bundleId) ;\n if (module) {\n return module[exportName];\n }\n \n if (!hmrVersionId || !BUILD.hotModuleReplacement) {\n const processMod = importedModule => {\n cmpModules.set(bundleId, importedModule);\n return importedModule[exportName];\n }\n switch(bundleId) {\n \n case 'pwa-action-sheet':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-action-sheet.entry.js').then(processMod, consoleError);\n case 'pwa-camera-modal':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera-modal.entry.js').then(processMod, consoleError);\n case 'pwa-toast':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-toast.entry.js').then(processMod, consoleError);\n case 'pwa-camera-modal-instance':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera-modal-instance.entry.js').then(processMod, consoleError);\n case 'pwa-camera':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera.entry.js').then(processMod, consoleError);\n }\n }\n return import(\n /* @vite-ignore */\n /* webpackInclude: /\\.entry\\.js$/ */\n /* webpackExclude: /\\.system\\.entry\\.js$/ */\n /* webpackMode: \"lazy\" */\n `./${bundleId}.entry.js${''}`).then((importedModule) => {\n {\n cmpModules.set(bundleId, importedModule);\n }\n return importedModule[exportName];\n }, consoleError);\n};\nconst styles = /*@__PURE__*/ new Map();\nconst win = typeof window !== 'undefined' ? window : {};\nconst doc = win.document || { head: {} };\nconst plt = {\n $flags$: 0,\n $resourcesUrl$: '',\n jmp: (h) => h(),\n raf: (h) => requestAnimationFrame(h),\n ael: (el, eventName, listener, opts) => el.addEventListener(eventName, listener, opts),\n rel: (el, eventName, listener, opts) => el.removeEventListener(eventName, listener, opts),\n ce: (eventName, opts) => new CustomEvent(eventName, opts),\n};\nconst promiseResolve = (v) => Promise.resolve(v);\nconst supportsConstructableStylesheets = /*@__PURE__*/ (() => {\n try {\n new CSSStyleSheet();\n return typeof new CSSStyleSheet().replaceSync === 'function';\n }\n catch (e) { }\n return false;\n })()\n ;\nconst queueDomReads = [];\nconst queueDomWrites = [];\nconst queueTask = (queue, write) => (cb) => {\n queue.push(cb);\n if (!queuePending) {\n queuePending = true;\n if (write && plt.$flags$ & 4 /* PLATFORM_FLAGS.queueSync */) {\n nextTick(flush);\n }\n else {\n plt.raf(flush);\n }\n }\n};\nconst consume = (queue) => {\n for (let i = 0; i < queue.length; i++) {\n try {\n queue[i](performance.now());\n }\n catch (e) {\n consoleError(e);\n }\n }\n queue.length = 0;\n};\nconst flush = () => {\n // always force a bunch of medium callbacks to run, but still have\n // a throttle on how many can run in a certain time\n // DOM READS!!!\n consume(queueDomReads);\n // DOM WRITES!!!\n {\n consume(queueDomWrites);\n if ((queuePending = queueDomReads.length > 0)) {\n // still more to do yet, but we've run out of time\n // let's let this thing cool off and try again in the next tick\n plt.raf(flush);\n }\n }\n};\nconst nextTick = /*@__PURE__*/ (cb) => promiseResolve().then(cb);\nconst writeTask = /*@__PURE__*/ queueTask(queueDomWrites, true);\n\nexport { Host as H, bootstrapLazy as b, createEvent as c, forceUpdate as f, getElement as g, h, promiseResolve as p, registerInstance as r, setNonce as s };\n","import { mergeAll } from '../operators/mergeAll';\nimport { innerFrom } from './innerFrom';\nimport { EMPTY } from './empty';\nimport { popNumber, popScheduler } from '../util/args';\nimport { from } from './from';\nexport function merge(...args) {\n const scheduler = popScheduler(args);\n const concurrent = popNumber(args, Infinity);\n const sources = args;\n return !sources.length\n ?\n EMPTY\n : sources.length === 1\n ?\n innerFrom(sources[0])\n :\n mergeAll(concurrent)(from(sources, scheduler));\n}\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = startOfUTCISOWeek;\nvar _index = _interopRequireDefault(require(\"../../toDate/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"../requiredArgs/index.js\"));\nfunction startOfUTCISOWeek(dirtyDate) {\n (0, _index2.default)(1, arguments);\n var weekStartsOn = 1;\n var date = (0, _index.default)(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}\nmodule.exports = exports.default;","import { createErrorClass } from './createErrorClass';\nexport const EmptyError = createErrorClass((_super) => function EmptyErrorImpl() {\n _super(this);\n this.name = 'EmptyError';\n this.message = 'no elements in sequence';\n});\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function defaultIfEmpty(defaultValue) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => {\n if (!hasValue) {\n subscriber.next(defaultValue);\n }\n subscriber.complete();\n }));\n });\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => (hasValue ? subscriber.complete() : subscriber.error(errorFactory()))));\n });\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { EMPTY } from '../observable/empty';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function takeLast(count) {\n return count <= 0\n ? () => EMPTY\n : operate((source, subscriber) => {\n let buffer = [];\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n buffer.push(value);\n count < buffer.length && buffer.shift();\n }, () => {\n for (const value of buffer) {\n subscriber.next(value);\n }\n subscriber.complete();\n }, undefined, () => {\n buffer = null;\n }));\n });\n}\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { ɵisPromise, ɵRuntimeError, Injectable, createEnvironmentInjector, ɵisNgModule, isStandalone, InjectionToken, EventEmitter, input, inject, ViewContainerRef, ChangeDetectorRef, Directive, Input, Output, reflectComponentType, ɵisInjectable, runInInjectionContext, Component, Compiler, NgModuleFactory, NgZone, afterNextRender, EnvironmentInjector, DestroyRef, ɵConsole, ɵPendingTasksInternal, ɵɵsanitizeUrlOrResourceUrl, booleanAttribute, Attribute, HostBinding, HostListener, Optional, ContentChildren, makeEnvironmentProviders, APP_BOOTSTRAP_LISTENER, ENVIRONMENT_INITIALIZER, Injector, ApplicationRef, InjectFlags, APP_INITIALIZER, SkipSelf, NgModule, Version, ɵpublishExternalGlobalUtil } from '@angular/core';\nimport { isObservable, from, of, BehaviorSubject, combineLatest, EmptyError, concat, defer, pipe, throwError, EMPTY, ConnectableObservable, Subject, Subscription } from 'rxjs';\nimport * as i3 from '@angular/common';\nimport { DOCUMENT, Location, ViewportScroller, LOCATION_INITIALIZED, LocationStrategy, HashLocationStrategy, PathLocationStrategy } from '@angular/common';\nimport { map, switchMap, take, startWith, filter, mergeMap, first, concatMap, tap, catchError, scan, defaultIfEmpty, last as last$1, takeLast, finalize, refCount, takeUntil, mergeAll } from 'rxjs/operators';\nimport * as i1 from '@angular/platform-browser';\n\n/**\n * The primary routing outlet.\n *\n * @publicApi\n */\nconst PRIMARY_OUTLET = 'primary';\n/**\n * A private symbol used to store the value of `Route.title` inside the `Route.data` if it is a\n * static string or `Route.resolve` if anything else. This allows us to reuse the existing route\n * data/resolvers to support the title feature without new instrumentation in the `Router` pipeline.\n */\nconst RouteTitleKey = /* @__PURE__ */ Symbol('RouteTitle');\nclass ParamsAsMap {\n params;\n constructor(params) {\n this.params = params || {};\n }\n has(name) {\n return Object.prototype.hasOwnProperty.call(this.params, name);\n }\n get(name) {\n if (this.has(name)) {\n const v = this.params[name];\n return Array.isArray(v) ? v[0] : v;\n }\n return null;\n }\n getAll(name) {\n if (this.has(name)) {\n const v = this.params[name];\n return Array.isArray(v) ? v : [v];\n }\n return [];\n }\n get keys() {\n return Object.keys(this.params);\n }\n}\n/**\n * Converts a `Params` instance to a `ParamMap`.\n * @param params The instance to convert.\n * @returns The new map instance.\n *\n * @publicApi\n */\nfunction convertToParamMap(params) {\n return new ParamsAsMap(params);\n}\n/**\n * Matches the route configuration (`route`) against the actual URL (`segments`).\n *\n * When no matcher is defined on a `Route`, this is the matcher used by the Router by default.\n *\n * @param segments The remaining unmatched segments in the current navigation\n * @param segmentGroup The current segment group being matched\n * @param route The `Route` to match against.\n *\n * @see {@link UrlMatchResult}\n * @see {@link Route}\n *\n * @returns The resulting match information or `null` if the `route` should not match.\n * @publicApi\n */\nfunction defaultUrlMatcher(segments, segmentGroup, route) {\n const parts = route.path.split('/');\n if (parts.length > segments.length) {\n // The actual URL is shorter than the config, no match\n return null;\n }\n if (route.pathMatch === 'full' &&\n (segmentGroup.hasChildren() || parts.length < segments.length)) {\n // The config is longer than the actual URL but we are looking for a full match, return null\n return null;\n }\n const posParams = {};\n // Check each config part against the actual URL\n for (let index = 0; index < parts.length; index++) {\n const part = parts[index];\n const segment = segments[index];\n const isParameter = part[0] === ':';\n if (isParameter) {\n posParams[part.substring(1)] = segment;\n }\n else if (part !== segment.path) {\n // The actual URL part does not match the config, no match\n return null;\n }\n }\n return { consumed: segments.slice(0, parts.length), posParams };\n}\n\nfunction shallowEqualArrays(a, b) {\n if (a.length !== b.length)\n return false;\n for (let i = 0; i < a.length; ++i) {\n if (!shallowEqual(a[i], b[i]))\n return false;\n }\n return true;\n}\nfunction shallowEqual(a, b) {\n // While `undefined` should never be possible, it would sometimes be the case in IE 11\n // and pre-chromium Edge. The check below accounts for this edge case.\n const k1 = a ? getDataKeys(a) : undefined;\n const k2 = b ? getDataKeys(b) : undefined;\n if (!k1 || !k2 || k1.length != k2.length) {\n return false;\n }\n let key;\n for (let i = 0; i < k1.length; i++) {\n key = k1[i];\n if (!equalArraysOrString(a[key], b[key])) {\n return false;\n }\n }\n return true;\n}\n/**\n * Gets the keys of an object, including `symbol` keys.\n */\nfunction getDataKeys(obj) {\n return [...Object.keys(obj), ...Object.getOwnPropertySymbols(obj)];\n}\n/**\n * Test equality for arrays of strings or a string.\n */\nfunction equalArraysOrString(a, b) {\n if (Array.isArray(a) && Array.isArray(b)) {\n if (a.length !== b.length)\n return false;\n const aSorted = [...a].sort();\n const bSorted = [...b].sort();\n return aSorted.every((val, index) => bSorted[index] === val);\n }\n else {\n return a === b;\n }\n}\n/**\n * Return the last element of an array.\n */\nfunction last(a) {\n return a.length > 0 ? a[a.length - 1] : null;\n}\nfunction wrapIntoObservable(value) {\n if (isObservable(value)) {\n return value;\n }\n if (ɵisPromise(value)) {\n // Use `Promise.resolve()` to wrap promise-like instances.\n // Required ie when a Resolver returns a AngularJS `$q` promise to correctly trigger the\n // change detection.\n return from(Promise.resolve(value));\n }\n return of(value);\n}\n\nconst pathCompareMap = {\n 'exact': equalSegmentGroups,\n 'subset': containsSegmentGroup,\n};\nconst paramCompareMap = {\n 'exact': equalParams,\n 'subset': containsParams,\n 'ignored': () => true,\n};\nfunction containsTree(container, containee, options) {\n return (pathCompareMap[options.paths](container.root, containee.root, options.matrixParams) &&\n paramCompareMap[options.queryParams](container.queryParams, containee.queryParams) &&\n !(options.fragment === 'exact' && container.fragment !== containee.fragment));\n}\nfunction equalParams(container, containee) {\n // TODO: This does not handle array params correctly.\n return shallowEqual(container, containee);\n}\nfunction equalSegmentGroups(container, containee, matrixParams) {\n if (!equalPath(container.segments, containee.segments))\n return false;\n if (!matrixParamsMatch(container.segments, containee.segments, matrixParams)) {\n return false;\n }\n if (container.numberOfChildren !== containee.numberOfChildren)\n return false;\n for (const c in containee.children) {\n if (!container.children[c])\n return false;\n if (!equalSegmentGroups(container.children[c], containee.children[c], matrixParams))\n return false;\n }\n return true;\n}\nfunction containsParams(container, containee) {\n return (Object.keys(containee).length <= Object.keys(container).length &&\n Object.keys(containee).every((key) => equalArraysOrString(container[key], containee[key])));\n}\nfunction containsSegmentGroup(container, containee, matrixParams) {\n return containsSegmentGroupHelper(container, containee, containee.segments, matrixParams);\n}\nfunction containsSegmentGroupHelper(container, containee, containeePaths, matrixParams) {\n if (container.segments.length > containeePaths.length) {\n const current = container.segments.slice(0, containeePaths.length);\n if (!equalPath(current, containeePaths))\n return false;\n if (containee.hasChildren())\n return false;\n if (!matrixParamsMatch(current, containeePaths, matrixParams))\n return false;\n return true;\n }\n else if (container.segments.length === containeePaths.length) {\n if (!equalPath(container.segments, containeePaths))\n return false;\n if (!matrixParamsMatch(container.segments, containeePaths, matrixParams))\n return false;\n for (const c in containee.children) {\n if (!container.children[c])\n return false;\n if (!containsSegmentGroup(container.children[c], containee.children[c], matrixParams)) {\n return false;\n }\n }\n return true;\n }\n else {\n const current = containeePaths.slice(0, container.segments.length);\n const next = containeePaths.slice(container.segments.length);\n if (!equalPath(container.segments, current))\n return false;\n if (!matrixParamsMatch(container.segments, current, matrixParams))\n return false;\n if (!container.children[PRIMARY_OUTLET])\n return false;\n return containsSegmentGroupHelper(container.children[PRIMARY_OUTLET], containee, next, matrixParams);\n }\n}\nfunction matrixParamsMatch(containerPaths, containeePaths, options) {\n return containeePaths.every((containeeSegment, i) => {\n return paramCompareMap[options](containerPaths[i].parameters, containeeSegment.parameters);\n });\n}\n/**\n * @description\n *\n * Represents the parsed URL.\n *\n * Since a router state is a tree, and the URL is nothing but a serialized state, the URL is a\n * serialized tree.\n * UrlTree is a data structure that provides a lot of affordances in dealing with URLs\n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const tree: UrlTree =\n * router.parseUrl('/team/33/(user/victor//support:help)?debug=true#fragment');\n * const f = tree.fragment; // return 'fragment'\n * const q = tree.queryParams; // returns {debug: 'true'}\n * const g: UrlSegmentGroup = tree.root.children[PRIMARY_OUTLET];\n * const s: UrlSegment[] = g.segments; // returns 2 segments 'team' and '33'\n * g.children[PRIMARY_OUTLET].segments; // returns 2 segments 'user' and 'victor'\n * g.children['support'].segments; // return 1 segment 'help'\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass UrlTree {\n root;\n queryParams;\n fragment;\n /** @internal */\n _queryParamMap;\n constructor(\n /** The root segment group of the URL tree */\n root = new UrlSegmentGroup([], {}), \n /** The query params of the URL */\n queryParams = {}, \n /** The fragment of the URL */\n fragment = null) {\n this.root = root;\n this.queryParams = queryParams;\n this.fragment = fragment;\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (root.segments.length > 0) {\n throw new ɵRuntimeError(4015 /* RuntimeErrorCode.INVALID_ROOT_URL_SEGMENT */, 'The root `UrlSegmentGroup` should not contain `segments`. ' +\n 'Instead, these segments belong in the `children` so they can be associated with a named outlet.');\n }\n }\n }\n get queryParamMap() {\n this._queryParamMap ??= convertToParamMap(this.queryParams);\n return this._queryParamMap;\n }\n /** @docsNotRequired */\n toString() {\n return DEFAULT_SERIALIZER.serialize(this);\n }\n}\n/**\n * @description\n *\n * Represents the parsed URL segment group.\n *\n * See `UrlTree` for more information.\n *\n * @publicApi\n */\nclass UrlSegmentGroup {\n segments;\n children;\n /** The parent node in the url tree */\n parent = null;\n constructor(\n /** The URL segments of this group. See `UrlSegment` for more information */\n segments, \n /** The list of children of this group */\n children) {\n this.segments = segments;\n this.children = children;\n Object.values(children).forEach((v) => (v.parent = this));\n }\n /** Whether the segment has child segments */\n hasChildren() {\n return this.numberOfChildren > 0;\n }\n /** Number of child segments */\n get numberOfChildren() {\n return Object.keys(this.children).length;\n }\n /** @docsNotRequired */\n toString() {\n return serializePaths(this);\n }\n}\n/**\n * @description\n *\n * Represents a single URL segment.\n *\n * A UrlSegment is a part of a URL between the two slashes. It contains a path and the matrix\n * parameters associated with the segment.\n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const tree: UrlTree = router.parseUrl('/team;id=33');\n * const g: UrlSegmentGroup = tree.root.children[PRIMARY_OUTLET];\n * const s: UrlSegment[] = g.segments;\n * s[0].path; // returns 'team'\n * s[0].parameters; // returns {id: 33}\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass UrlSegment {\n path;\n parameters;\n /** @internal */\n _parameterMap;\n constructor(\n /** The path part of a URL segment */\n path, \n /** The matrix parameters associated with a segment */\n parameters) {\n this.path = path;\n this.parameters = parameters;\n }\n get parameterMap() {\n this._parameterMap ??= convertToParamMap(this.parameters);\n return this._parameterMap;\n }\n /** @docsNotRequired */\n toString() {\n return serializePath(this);\n }\n}\nfunction equalSegments(as, bs) {\n return equalPath(as, bs) && as.every((a, i) => shallowEqual(a.parameters, bs[i].parameters));\n}\nfunction equalPath(as, bs) {\n if (as.length !== bs.length)\n return false;\n return as.every((a, i) => a.path === bs[i].path);\n}\nfunction mapChildrenIntoArray(segment, fn) {\n let res = [];\n Object.entries(segment.children).forEach(([childOutlet, child]) => {\n if (childOutlet === PRIMARY_OUTLET) {\n res = res.concat(fn(child, childOutlet));\n }\n });\n Object.entries(segment.children).forEach(([childOutlet, child]) => {\n if (childOutlet !== PRIMARY_OUTLET) {\n res = res.concat(fn(child, childOutlet));\n }\n });\n return res;\n}\n/**\n * @description\n *\n * Serializes and deserializes a URL string into a URL tree.\n *\n * The url serialization strategy is customizable. You can\n * make all URLs case insensitive by providing a custom UrlSerializer.\n *\n * See `DefaultUrlSerializer` for an example of a URL serializer.\n *\n * @publicApi\n */\nclass UrlSerializer {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, providedIn: 'root', useFactory: () => new DefaultUrlSerializer() });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => new DefaultUrlSerializer() }]\n }] });\n/**\n * @description\n *\n * A default implementation of the `UrlSerializer`.\n *\n * Example URLs:\n *\n * ```\n * /inbox/33(popup:compose)\n * /inbox/33;open=true/messages/44\n * ```\n *\n * DefaultUrlSerializer uses parentheses to serialize secondary segments (e.g., popup:compose), the\n * colon syntax to specify the outlet, and the ';parameter=value' syntax (e.g., open=true) to\n * specify route specific parameters.\n *\n * @publicApi\n */\nclass DefaultUrlSerializer {\n /** Parses a url into a `UrlTree` */\n parse(url) {\n const p = new UrlParser(url);\n return new UrlTree(p.parseRootSegment(), p.parseQueryParams(), p.parseFragment());\n }\n /** Converts a `UrlTree` into a url */\n serialize(tree) {\n const segment = `/${serializeSegment(tree.root, true)}`;\n const query = serializeQueryParams(tree.queryParams);\n const fragment = typeof tree.fragment === `string` ? `#${encodeUriFragment(tree.fragment)}` : '';\n return `${segment}${query}${fragment}`;\n }\n}\nconst DEFAULT_SERIALIZER = new DefaultUrlSerializer();\nfunction serializePaths(segment) {\n return segment.segments.map((p) => serializePath(p)).join('/');\n}\nfunction serializeSegment(segment, root) {\n if (!segment.hasChildren()) {\n return serializePaths(segment);\n }\n if (root) {\n const primary = segment.children[PRIMARY_OUTLET]\n ? serializeSegment(segment.children[PRIMARY_OUTLET], false)\n : '';\n const children = [];\n Object.entries(segment.children).forEach(([k, v]) => {\n if (k !== PRIMARY_OUTLET) {\n children.push(`${k}:${serializeSegment(v, false)}`);\n }\n });\n return children.length > 0 ? `${primary}(${children.join('//')})` : primary;\n }\n else {\n const children = mapChildrenIntoArray(segment, (v, k) => {\n if (k === PRIMARY_OUTLET) {\n return [serializeSegment(segment.children[PRIMARY_OUTLET], false)];\n }\n return [`${k}:${serializeSegment(v, false)}`];\n });\n // use no parenthesis if the only child is a primary outlet route\n if (Object.keys(segment.children).length === 1 && segment.children[PRIMARY_OUTLET] != null) {\n return `${serializePaths(segment)}/${children[0]}`;\n }\n return `${serializePaths(segment)}/(${children.join('//')})`;\n }\n}\n/**\n * Encodes a URI string with the default encoding. This function will only ever be called from\n * `encodeUriQuery` or `encodeUriSegment` as it's the base set of encodings to be used. We need\n * a custom encoding because encodeURIComponent is too aggressive and encodes stuff that doesn't\n * have to be encoded per https://url.spec.whatwg.org.\n */\nfunction encodeUriString(s) {\n return encodeURIComponent(s)\n .replace(/%40/g, '@')\n .replace(/%3A/gi, ':')\n .replace(/%24/g, '$')\n .replace(/%2C/gi, ',');\n}\n/**\n * This function should be used to encode both keys and values in a query string key/value. In\n * the following URL, you need to call encodeUriQuery on \"k\" and \"v\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriQuery(s) {\n return encodeUriString(s).replace(/%3B/gi, ';');\n}\n/**\n * This function should be used to encode a URL fragment. In the following URL, you need to call\n * encodeUriFragment on \"f\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriFragment(s) {\n return encodeURI(s);\n}\n/**\n * This function should be run on any URI segment as well as the key and value in a key/value\n * pair for matrix params. In the following URL, you need to call encodeUriSegment on \"html\",\n * \"mk\", and \"mv\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriSegment(s) {\n return encodeUriString(s).replace(/\\(/g, '%28').replace(/\\)/g, '%29').replace(/%26/gi, '&');\n}\nfunction decode(s) {\n return decodeURIComponent(s);\n}\n// Query keys/values should have the \"+\" replaced first, as \"+\" in a query string is \" \".\n// decodeURIComponent function will not decode \"+\" as a space.\nfunction decodeQuery(s) {\n return decode(s.replace(/\\+/g, '%20'));\n}\nfunction serializePath(path) {\n return `${encodeUriSegment(path.path)}${serializeMatrixParams(path.parameters)}`;\n}\nfunction serializeMatrixParams(params) {\n return Object.entries(params)\n .map(([key, value]) => `;${encodeUriSegment(key)}=${encodeUriSegment(value)}`)\n .join('');\n}\nfunction serializeQueryParams(params) {\n const strParams = Object.entries(params)\n .map(([name, value]) => {\n return Array.isArray(value)\n ? value.map((v) => `${encodeUriQuery(name)}=${encodeUriQuery(v)}`).join('&')\n : `${encodeUriQuery(name)}=${encodeUriQuery(value)}`;\n })\n .filter((s) => s);\n return strParams.length ? `?${strParams.join('&')}` : '';\n}\nconst SEGMENT_RE = /^[^\\/()?;#]+/;\nfunction matchSegments(str) {\n const match = str.match(SEGMENT_RE);\n return match ? match[0] : '';\n}\nconst MATRIX_PARAM_SEGMENT_RE = /^[^\\/()?;=#]+/;\nfunction matchMatrixKeySegments(str) {\n const match = str.match(MATRIX_PARAM_SEGMENT_RE);\n return match ? match[0] : '';\n}\nconst QUERY_PARAM_RE = /^[^=?]+/;\n// Return the name of the query param at the start of the string or an empty string\nfunction matchQueryParams(str) {\n const match = str.match(QUERY_PARAM_RE);\n return match ? match[0] : '';\n}\nconst QUERY_PARAM_VALUE_RE = /^[^]+/;\n// Return the value of the query param at the start of the string or an empty string\nfunction matchUrlQueryParamValue(str) {\n const match = str.match(QUERY_PARAM_VALUE_RE);\n return match ? match[0] : '';\n}\nclass UrlParser {\n url;\n remaining;\n constructor(url) {\n this.url = url;\n this.remaining = url;\n }\n parseRootSegment() {\n this.consumeOptional('/');\n if (this.remaining === '' || this.peekStartsWith('?') || this.peekStartsWith('#')) {\n return new UrlSegmentGroup([], {});\n }\n // The root segment group never has segments\n return new UrlSegmentGroup([], this.parseChildren());\n }\n parseQueryParams() {\n const params = {};\n if (this.consumeOptional('?')) {\n do {\n this.parseQueryParam(params);\n } while (this.consumeOptional('&'));\n }\n return params;\n }\n parseFragment() {\n return this.consumeOptional('#') ? decodeURIComponent(this.remaining) : null;\n }\n parseChildren() {\n if (this.remaining === '') {\n return {};\n }\n this.consumeOptional('/');\n const segments = [];\n if (!this.peekStartsWith('(')) {\n segments.push(this.parseSegment());\n }\n while (this.peekStartsWith('/') && !this.peekStartsWith('//') && !this.peekStartsWith('/(')) {\n this.capture('/');\n segments.push(this.parseSegment());\n }\n let children = {};\n if (this.peekStartsWith('/(')) {\n this.capture('/');\n children = this.parseParens(true);\n }\n let res = {};\n if (this.peekStartsWith('(')) {\n res = this.parseParens(false);\n }\n if (segments.length > 0 || Object.keys(children).length > 0) {\n res[PRIMARY_OUTLET] = new UrlSegmentGroup(segments, children);\n }\n return res;\n }\n // parse a segment with its matrix parameters\n // ie `name;k1=v1;k2`\n parseSegment() {\n const path = matchSegments(this.remaining);\n if (path === '' && this.peekStartsWith(';')) {\n throw new ɵRuntimeError(4009 /* RuntimeErrorCode.EMPTY_PATH_WITH_PARAMS */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Empty path url segment cannot have parameters: '${this.remaining}'.`);\n }\n this.capture(path);\n return new UrlSegment(decode(path), this.parseMatrixParams());\n }\n parseMatrixParams() {\n const params = {};\n while (this.consumeOptional(';')) {\n this.parseParam(params);\n }\n return params;\n }\n parseParam(params) {\n const key = matchMatrixKeySegments(this.remaining);\n if (!key) {\n return;\n }\n this.capture(key);\n let value = '';\n if (this.consumeOptional('=')) {\n const valueMatch = matchSegments(this.remaining);\n if (valueMatch) {\n value = valueMatch;\n this.capture(value);\n }\n }\n params[decode(key)] = decode(value);\n }\n // Parse a single query parameter `name[=value]`\n parseQueryParam(params) {\n const key = matchQueryParams(this.remaining);\n if (!key) {\n return;\n }\n this.capture(key);\n let value = '';\n if (this.consumeOptional('=')) {\n const valueMatch = matchUrlQueryParamValue(this.remaining);\n if (valueMatch) {\n value = valueMatch;\n this.capture(value);\n }\n }\n const decodedKey = decodeQuery(key);\n const decodedVal = decodeQuery(value);\n if (params.hasOwnProperty(decodedKey)) {\n // Append to existing values\n let currentVal = params[decodedKey];\n if (!Array.isArray(currentVal)) {\n currentVal = [currentVal];\n params[decodedKey] = currentVal;\n }\n currentVal.push(decodedVal);\n }\n else {\n // Create a new value\n params[decodedKey] = decodedVal;\n }\n }\n // parse `(a/b//outlet_name:c/d)`\n parseParens(allowPrimary) {\n const segments = {};\n this.capture('(');\n while (!this.consumeOptional(')') && this.remaining.length > 0) {\n const path = matchSegments(this.remaining);\n const next = this.remaining[path.length];\n // if is is not one of these characters, then the segment was unescaped\n // or the group was not closed\n if (next !== '/' && next !== ')' && next !== ';') {\n throw new ɵRuntimeError(4010 /* RuntimeErrorCode.UNPARSABLE_URL */, (typeof ngDevMode === 'undefined' || ngDevMode) && `Cannot parse url '${this.url}'`);\n }\n let outletName = undefined;\n if (path.indexOf(':') > -1) {\n outletName = path.slice(0, path.indexOf(':'));\n this.capture(outletName);\n this.capture(':');\n }\n else if (allowPrimary) {\n outletName = PRIMARY_OUTLET;\n }\n const children = this.parseChildren();\n segments[outletName] =\n Object.keys(children).length === 1\n ? children[PRIMARY_OUTLET]\n : new UrlSegmentGroup([], children);\n this.consumeOptional('//');\n }\n return segments;\n }\n peekStartsWith(str) {\n return this.remaining.startsWith(str);\n }\n // Consumes the prefix when it is present and returns whether it has been consumed\n consumeOptional(str) {\n if (this.peekStartsWith(str)) {\n this.remaining = this.remaining.substring(str.length);\n return true;\n }\n return false;\n }\n capture(str) {\n if (!this.consumeOptional(str)) {\n throw new ɵRuntimeError(4011 /* RuntimeErrorCode.UNEXPECTED_VALUE_IN_URL */, (typeof ngDevMode === 'undefined' || ngDevMode) && `Expected \"${str}\".`);\n }\n }\n}\nfunction createRoot(rootCandidate) {\n return rootCandidate.segments.length > 0\n ? new UrlSegmentGroup([], { [PRIMARY_OUTLET]: rootCandidate })\n : rootCandidate;\n}\n/**\n * Recursively\n * - merges primary segment children into their parents\n * - drops empty children (those which have no segments and no children themselves). This latter\n * prevents serializing a group into something like `/a(aux:)`, where `aux` is an empty child\n * segment.\n * - merges named outlets without a primary segment sibling into the children. This prevents\n * serializing a URL like `//(a:a)(b:b) instead of `/(a:a//b:b)` when the aux b route lives on the\n * root but the `a` route lives under an empty path primary route.\n */\nfunction squashSegmentGroup(segmentGroup) {\n const newChildren = {};\n for (const [childOutlet, child] of Object.entries(segmentGroup.children)) {\n const childCandidate = squashSegmentGroup(child);\n // moves named children in an empty path primary child into this group\n if (childOutlet === PRIMARY_OUTLET &&\n childCandidate.segments.length === 0 &&\n childCandidate.hasChildren()) {\n for (const [grandChildOutlet, grandChild] of Object.entries(childCandidate.children)) {\n newChildren[grandChildOutlet] = grandChild;\n }\n } // don't add empty children\n else if (childCandidate.segments.length > 0 || childCandidate.hasChildren()) {\n newChildren[childOutlet] = childCandidate;\n }\n }\n const s = new UrlSegmentGroup(segmentGroup.segments, newChildren);\n return mergeTrivialChildren(s);\n}\n/**\n * When possible, merges the primary outlet child into the parent `UrlSegmentGroup`.\n *\n * When a segment group has only one child which is a primary outlet, merges that child into the\n * parent. That is, the child segment group's segments are merged into the `s` and the child's\n * children become the children of `s`. Think of this like a 'squash', merging the child segment\n * group into the parent.\n */\nfunction mergeTrivialChildren(s) {\n if (s.numberOfChildren === 1 && s.children[PRIMARY_OUTLET]) {\n const c = s.children[PRIMARY_OUTLET];\n return new UrlSegmentGroup(s.segments.concat(c.segments), c.children);\n }\n return s;\n}\nfunction isUrlTree(v) {\n return v instanceof UrlTree;\n}\n\n/**\n * Creates a `UrlTree` relative to an `ActivatedRouteSnapshot`.\n *\n * @publicApi\n *\n *\n * @param relativeTo The `ActivatedRouteSnapshot` to apply the commands to\n * @param commands An array of URL fragments with which to construct the new URL tree.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the one provided in the `relativeTo` parameter.\n * @param queryParams The query parameters for the `UrlTree`. `null` if the `UrlTree` does not have\n * any query parameters.\n * @param fragment The fragment for the `UrlTree`. `null` if the `UrlTree` does not have a fragment.\n *\n * @usageNotes\n *\n * ```ts\n * // create /team/33/user/11\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, 'user', 11]);\n *\n * // create /team/33;expand=true/user/11\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {expand: true}, 'user', 11]);\n *\n * // you can collapse static segments like this (this works only with the first passed-in value):\n * createUrlTreeFromSnapshot(snapshot, ['/team/33/user', userId]);\n *\n * // If the first segment can contain slashes, and you do not want the router to split it,\n * // you can do the following:\n * createUrlTreeFromSnapshot(snapshot, [{segmentPath: '/one/two'}]);\n *\n * // create /team/33/(user/11//right:chat)\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {outlets: {primary: 'user/11', right:\n * 'chat'}}], null, null);\n *\n * // remove the right secondary node\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {outlets: {primary: 'user/11', right: null}}]);\n *\n * // For the examples below, assume the current URL is for the `/team/33/user/11` and the\n * `ActivatedRouteSnapshot` points to `user/11`:\n *\n * // navigate to /team/33/user/11/details\n * createUrlTreeFromSnapshot(snapshot, ['details']);\n *\n * // navigate to /team/33/user/22\n * createUrlTreeFromSnapshot(snapshot, ['../22']);\n *\n * // navigate to /team/44/user/22\n * createUrlTreeFromSnapshot(snapshot, ['../../team/44/user/22']);\n * ```\n */\nfunction createUrlTreeFromSnapshot(relativeTo, commands, queryParams = null, fragment = null) {\n const relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeTo);\n return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, queryParams, fragment);\n}\nfunction createSegmentGroupFromRoute(route) {\n let targetGroup;\n function createSegmentGroupFromRouteRecursive(currentRoute) {\n const childOutlets = {};\n for (const childSnapshot of currentRoute.children) {\n const root = createSegmentGroupFromRouteRecursive(childSnapshot);\n childOutlets[childSnapshot.outlet] = root;\n }\n const segmentGroup = new UrlSegmentGroup(currentRoute.url, childOutlets);\n if (currentRoute === route) {\n targetGroup = segmentGroup;\n }\n return segmentGroup;\n }\n const rootCandidate = createSegmentGroupFromRouteRecursive(route.root);\n const rootSegmentGroup = createRoot(rootCandidate);\n return targetGroup ?? rootSegmentGroup;\n}\nfunction createUrlTreeFromSegmentGroup(relativeTo, commands, queryParams, fragment) {\n let root = relativeTo;\n while (root.parent) {\n root = root.parent;\n }\n // There are no commands so the `UrlTree` goes to the same path as the one created from the\n // `UrlSegmentGroup`. All we need to do is update the `queryParams` and `fragment` without\n // applying any other logic.\n if (commands.length === 0) {\n return tree(root, root, root, queryParams, fragment);\n }\n const nav = computeNavigation(commands);\n if (nav.toRoot()) {\n return tree(root, root, new UrlSegmentGroup([], {}), queryParams, fragment);\n }\n const position = findStartingPositionForTargetGroup(nav, root, relativeTo);\n const newSegmentGroup = position.processChildren\n ? updateSegmentGroupChildren(position.segmentGroup, position.index, nav.commands)\n : updateSegmentGroup(position.segmentGroup, position.index, nav.commands);\n return tree(root, position.segmentGroup, newSegmentGroup, queryParams, fragment);\n}\nfunction isMatrixParams(command) {\n return typeof command === 'object' && command != null && !command.outlets && !command.segmentPath;\n}\n/**\n * Determines if a given command has an `outlets` map. When we encounter a command\n * with an outlets k/v map, we need to apply each outlet individually to the existing segment.\n */\nfunction isCommandWithOutlets(command) {\n return typeof command === 'object' && command != null && command.outlets;\n}\nfunction tree(oldRoot, oldSegmentGroup, newSegmentGroup, queryParams, fragment) {\n let qp = {};\n if (queryParams) {\n Object.entries(queryParams).forEach(([name, value]) => {\n qp[name] = Array.isArray(value) ? value.map((v) => `${v}`) : `${value}`;\n });\n }\n let rootCandidate;\n if (oldRoot === oldSegmentGroup) {\n rootCandidate = newSegmentGroup;\n }\n else {\n rootCandidate = replaceSegment(oldRoot, oldSegmentGroup, newSegmentGroup);\n }\n const newRoot = createRoot(squashSegmentGroup(rootCandidate));\n return new UrlTree(newRoot, qp, fragment);\n}\n/**\n * Replaces the `oldSegment` which is located in some child of the `current` with the `newSegment`.\n * This also has the effect of creating new `UrlSegmentGroup` copies to update references. This\n * shouldn't be necessary but the fallback logic for an invalid ActivatedRoute in the creation uses\n * the Router's current url tree. If we don't create new segment groups, we end up modifying that\n * value.\n */\nfunction replaceSegment(current, oldSegment, newSegment) {\n const children = {};\n Object.entries(current.children).forEach(([outletName, c]) => {\n if (c === oldSegment) {\n children[outletName] = newSegment;\n }\n else {\n children[outletName] = replaceSegment(c, oldSegment, newSegment);\n }\n });\n return new UrlSegmentGroup(current.segments, children);\n}\nclass Navigation {\n isAbsolute;\n numberOfDoubleDots;\n commands;\n constructor(isAbsolute, numberOfDoubleDots, commands) {\n this.isAbsolute = isAbsolute;\n this.numberOfDoubleDots = numberOfDoubleDots;\n this.commands = commands;\n if (isAbsolute && commands.length > 0 && isMatrixParams(commands[0])) {\n throw new ɵRuntimeError(4003 /* RuntimeErrorCode.ROOT_SEGMENT_MATRIX_PARAMS */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n 'Root segment cannot have matrix parameters');\n }\n const cmdWithOutlet = commands.find(isCommandWithOutlets);\n if (cmdWithOutlet && cmdWithOutlet !== last(commands)) {\n throw new ɵRuntimeError(4004 /* RuntimeErrorCode.MISPLACED_OUTLETS_COMMAND */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n '{outlets:{}} has to be the last command');\n }\n }\n toRoot() {\n return this.isAbsolute && this.commands.length === 1 && this.commands[0] == '/';\n }\n}\n/** Transforms commands to a normalized `Navigation` */\nfunction computeNavigation(commands) {\n if (typeof commands[0] === 'string' && commands.length === 1 && commands[0] === '/') {\n return new Navigation(true, 0, commands);\n }\n let numberOfDoubleDots = 0;\n let isAbsolute = false;\n const res = commands.reduce((res, cmd, cmdIdx) => {\n if (typeof cmd === 'object' && cmd != null) {\n if (cmd.outlets) {\n const outlets = {};\n Object.entries(cmd.outlets).forEach(([name, commands]) => {\n outlets[name] = typeof commands === 'string' ? commands.split('/') : commands;\n });\n return [...res, { outlets }];\n }\n if (cmd.segmentPath) {\n return [...res, cmd.segmentPath];\n }\n }\n if (!(typeof cmd === 'string')) {\n return [...res, cmd];\n }\n if (cmdIdx === 0) {\n cmd.split('/').forEach((urlPart, partIndex) => {\n if (partIndex == 0 && urlPart === '.') {\n // skip './a'\n }\n else if (partIndex == 0 && urlPart === '') {\n // '/a'\n isAbsolute = true;\n }\n else if (urlPart === '..') {\n // '../a'\n numberOfDoubleDots++;\n }\n else if (urlPart != '') {\n res.push(urlPart);\n }\n });\n return res;\n }\n return [...res, cmd];\n }, []);\n return new Navigation(isAbsolute, numberOfDoubleDots, res);\n}\nclass Position {\n segmentGroup;\n processChildren;\n index;\n constructor(segmentGroup, processChildren, index) {\n this.segmentGroup = segmentGroup;\n this.processChildren = processChildren;\n this.index = index;\n }\n}\nfunction findStartingPositionForTargetGroup(nav, root, target) {\n if (nav.isAbsolute) {\n return new Position(root, true, 0);\n }\n if (!target) {\n // `NaN` is used only to maintain backwards compatibility with incorrectly mocked\n // `ActivatedRouteSnapshot` in tests. In prior versions of this code, the position here was\n // determined based on an internal property that was rarely mocked, resulting in `NaN`. In\n // reality, this code path should _never_ be touched since `target` is not allowed to be falsey.\n return new Position(root, false, NaN);\n }\n if (target.parent === null) {\n return new Position(target, true, 0);\n }\n const modifier = isMatrixParams(nav.commands[0]) ? 0 : 1;\n const index = target.segments.length - 1 + modifier;\n return createPositionApplyingDoubleDots(target, index, nav.numberOfDoubleDots);\n}\nfunction createPositionApplyingDoubleDots(group, index, numberOfDoubleDots) {\n let g = group;\n let ci = index;\n let dd = numberOfDoubleDots;\n while (dd > ci) {\n dd -= ci;\n g = g.parent;\n if (!g) {\n throw new ɵRuntimeError(4005 /* RuntimeErrorCode.INVALID_DOUBLE_DOTS */, (typeof ngDevMode === 'undefined' || ngDevMode) && \"Invalid number of '../'\");\n }\n ci = g.segments.length;\n }\n return new Position(g, false, ci - dd);\n}\nfunction getOutlets(commands) {\n if (isCommandWithOutlets(commands[0])) {\n return commands[0].outlets;\n }\n return { [PRIMARY_OUTLET]: commands };\n}\nfunction updateSegmentGroup(segmentGroup, startIndex, commands) {\n segmentGroup ??= new UrlSegmentGroup([], {});\n if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {\n return updateSegmentGroupChildren(segmentGroup, startIndex, commands);\n }\n const m = prefixedWith(segmentGroup, startIndex, commands);\n const slicedCommands = commands.slice(m.commandIndex);\n if (m.match && m.pathIndex < segmentGroup.segments.length) {\n const g = new UrlSegmentGroup(segmentGroup.segments.slice(0, m.pathIndex), {});\n g.children[PRIMARY_OUTLET] = new UrlSegmentGroup(segmentGroup.segments.slice(m.pathIndex), segmentGroup.children);\n return updateSegmentGroupChildren(g, 0, slicedCommands);\n }\n else if (m.match && slicedCommands.length === 0) {\n return new UrlSegmentGroup(segmentGroup.segments, {});\n }\n else if (m.match && !segmentGroup.hasChildren()) {\n return createNewSegmentGroup(segmentGroup, startIndex, commands);\n }\n else if (m.match) {\n return updateSegmentGroupChildren(segmentGroup, 0, slicedCommands);\n }\n else {\n return createNewSegmentGroup(segmentGroup, startIndex, commands);\n }\n}\nfunction updateSegmentGroupChildren(segmentGroup, startIndex, commands) {\n if (commands.length === 0) {\n return new UrlSegmentGroup(segmentGroup.segments, {});\n }\n else {\n const outlets = getOutlets(commands);\n const children = {};\n // If the set of commands applies to anything other than the primary outlet and the child\n // segment is an empty path primary segment on its own, we want to apply the commands to the\n // empty child path rather than here. The outcome is that the empty primary child is effectively\n // removed from the final output UrlTree. Imagine the following config:\n //\n // {path: '', children: [{path: '**', outlet: 'popup'}]}.\n //\n // Navigation to /(popup:a) will activate the child outlet correctly Given a follow-up\n // navigation with commands\n // ['/', {outlets: {'popup': 'b'}}], we _would not_ want to apply the outlet commands to the\n // root segment because that would result in\n // //(popup:a)(popup:b) since the outlet command got applied one level above where it appears in\n // the `ActivatedRoute` rather than updating the existing one.\n //\n // Because empty paths do not appear in the URL segments and the fact that the segments used in\n // the output `UrlTree` are squashed to eliminate these empty paths where possible\n // https://github.com/angular/angular/blob/13f10de40e25c6900ca55bd83b36bd533dacfa9e/packages/router/src/url_tree.ts#L755\n // it can be hard to determine what is the right thing to do when applying commands to a\n // `UrlSegmentGroup` that is created from an \"unsquashed\"/expanded `ActivatedRoute` tree.\n // This code effectively \"squashes\" empty path primary routes when they have no siblings on\n // the same level of the tree.\n if (Object.keys(outlets).some((o) => o !== PRIMARY_OUTLET) &&\n segmentGroup.children[PRIMARY_OUTLET] &&\n segmentGroup.numberOfChildren === 1 &&\n segmentGroup.children[PRIMARY_OUTLET].segments.length === 0) {\n const childrenOfEmptyChild = updateSegmentGroupChildren(segmentGroup.children[PRIMARY_OUTLET], startIndex, commands);\n return new UrlSegmentGroup(segmentGroup.segments, childrenOfEmptyChild.children);\n }\n Object.entries(outlets).forEach(([outlet, commands]) => {\n if (typeof commands === 'string') {\n commands = [commands];\n }\n if (commands !== null) {\n children[outlet] = updateSegmentGroup(segmentGroup.children[outlet], startIndex, commands);\n }\n });\n Object.entries(segmentGroup.children).forEach(([childOutlet, child]) => {\n if (outlets[childOutlet] === undefined) {\n children[childOutlet] = child;\n }\n });\n return new UrlSegmentGroup(segmentGroup.segments, children);\n }\n}\nfunction prefixedWith(segmentGroup, startIndex, commands) {\n let currentCommandIndex = 0;\n let currentPathIndex = startIndex;\n const noMatch = { match: false, pathIndex: 0, commandIndex: 0 };\n while (currentPathIndex < segmentGroup.segments.length) {\n if (currentCommandIndex >= commands.length)\n return noMatch;\n const path = segmentGroup.segments[currentPathIndex];\n const command = commands[currentCommandIndex];\n // Do not try to consume command as part of the prefixing if it has outlets because it can\n // contain outlets other than the one being processed. Consuming the outlets command would\n // result in other outlets being ignored.\n if (isCommandWithOutlets(command)) {\n break;\n }\n const curr = `${command}`;\n const next = currentCommandIndex < commands.length - 1 ? commands[currentCommandIndex + 1] : null;\n if (currentPathIndex > 0 && curr === undefined)\n break;\n if (curr && next && typeof next === 'object' && next.outlets === undefined) {\n if (!compare(curr, next, path))\n return noMatch;\n currentCommandIndex += 2;\n }\n else {\n if (!compare(curr, {}, path))\n return noMatch;\n currentCommandIndex++;\n }\n currentPathIndex++;\n }\n return { match: true, pathIndex: currentPathIndex, commandIndex: currentCommandIndex };\n}\nfunction createNewSegmentGroup(segmentGroup, startIndex, commands) {\n const paths = segmentGroup.segments.slice(0, startIndex);\n let i = 0;\n while (i < commands.length) {\n const command = commands[i];\n if (isCommandWithOutlets(command)) {\n const children = createNewSegmentChildren(command.outlets);\n return new UrlSegmentGroup(paths, children);\n }\n // if we start with an object literal, we need to reuse the path part from the segment\n if (i === 0 && isMatrixParams(commands[0])) {\n const p = segmentGroup.segments[startIndex];\n paths.push(new UrlSegment(p.path, stringify(commands[0])));\n i++;\n continue;\n }\n const curr = isCommandWithOutlets(command) ? command.outlets[PRIMARY_OUTLET] : `${command}`;\n const next = i < commands.length - 1 ? commands[i + 1] : null;\n if (curr && next && isMatrixParams(next)) {\n paths.push(new UrlSegment(curr, stringify(next)));\n i += 2;\n }\n else {\n paths.push(new UrlSegment(curr, {}));\n i++;\n }\n }\n return new UrlSegmentGroup(paths, {});\n}\nfunction createNewSegmentChildren(outlets) {\n const children = {};\n Object.entries(outlets).forEach(([outlet, commands]) => {\n if (typeof commands === 'string') {\n commands = [commands];\n }\n if (commands !== null) {\n children[outlet] = createNewSegmentGroup(new UrlSegmentGroup([], {}), 0, commands);\n }\n });\n return children;\n}\nfunction stringify(params) {\n const res = {};\n Object.entries(params).forEach(([k, v]) => (res[k] = `${v}`));\n return res;\n}\nfunction compare(path, params, segment) {\n return path == segment.path && shallowEqual(params, segment.parameters);\n}\n\nconst IMPERATIVE_NAVIGATION = 'imperative';\n/**\n * Identifies the type of a router event.\n *\n * @publicApi\n */\nvar EventType;\n(function (EventType) {\n EventType[EventType[\"NavigationStart\"] = 0] = \"NavigationStart\";\n EventType[EventType[\"NavigationEnd\"] = 1] = \"NavigationEnd\";\n EventType[EventType[\"NavigationCancel\"] = 2] = \"NavigationCancel\";\n EventType[EventType[\"NavigationError\"] = 3] = \"NavigationError\";\n EventType[EventType[\"RoutesRecognized\"] = 4] = \"RoutesRecognized\";\n EventType[EventType[\"ResolveStart\"] = 5] = \"ResolveStart\";\n EventType[EventType[\"ResolveEnd\"] = 6] = \"ResolveEnd\";\n EventType[EventType[\"GuardsCheckStart\"] = 7] = \"GuardsCheckStart\";\n EventType[EventType[\"GuardsCheckEnd\"] = 8] = \"GuardsCheckEnd\";\n EventType[EventType[\"RouteConfigLoadStart\"] = 9] = \"RouteConfigLoadStart\";\n EventType[EventType[\"RouteConfigLoadEnd\"] = 10] = \"RouteConfigLoadEnd\";\n EventType[EventType[\"ChildActivationStart\"] = 11] = \"ChildActivationStart\";\n EventType[EventType[\"ChildActivationEnd\"] = 12] = \"ChildActivationEnd\";\n EventType[EventType[\"ActivationStart\"] = 13] = \"ActivationStart\";\n EventType[EventType[\"ActivationEnd\"] = 14] = \"ActivationEnd\";\n EventType[EventType[\"Scroll\"] = 15] = \"Scroll\";\n EventType[EventType[\"NavigationSkipped\"] = 16] = \"NavigationSkipped\";\n})(EventType || (EventType = {}));\n/**\n * Base for events the router goes through, as opposed to events tied to a specific\n * route. Fired one time for any given navigation.\n *\n * The following code shows how a class subscribes to router events.\n *\n * ```ts\n * import {Event, RouterEvent, Router} from '@angular/router';\n *\n * class MyService {\n * constructor(public router: Router) {\n * router.events.pipe(\n * filter((e: Event | RouterEvent): e is RouterEvent => e instanceof RouterEvent)\n * ).subscribe((e: RouterEvent) => {\n * // Do something\n * });\n * }\n * }\n * ```\n *\n * @see {@link Event}\n * @see [Router events summary](guide/routing/router-reference#router-events)\n * @publicApi\n */\nclass RouterEvent {\n id;\n url;\n constructor(\n /** A unique ID that the router assigns to every router navigation. */\n id, \n /** The URL that is the destination for this navigation. */\n url) {\n this.id = id;\n this.url = url;\n }\n}\n/**\n * An event triggered when a navigation starts.\n *\n * @publicApi\n */\nclass NavigationStart extends RouterEvent {\n type = EventType.NavigationStart;\n /**\n * Identifies the call or event that triggered the navigation.\n * An `imperative` trigger is a call to `router.navigateByUrl()` or `router.navigate()`.\n *\n * @see {@link NavigationEnd}\n * @see {@link NavigationCancel}\n * @see {@link NavigationError}\n */\n navigationTrigger;\n /**\n * The navigation state that was previously supplied to the `pushState` call,\n * when the navigation is triggered by a `popstate` event. Otherwise null.\n *\n * The state object is defined by `NavigationExtras`, and contains any\n * developer-defined state value, as well as a unique ID that\n * the router assigns to every router transition/navigation.\n *\n * From the perspective of the router, the router never \"goes back\".\n * When the user clicks on the back button in the browser,\n * a new navigation ID is created.\n *\n * Use the ID in this previous-state object to differentiate between a newly created\n * state and one returned to by a `popstate` event, so that you can restore some\n * remembered state, such as scroll position.\n *\n */\n restoredState;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n navigationTrigger = 'imperative', \n /** @docsNotRequired */\n restoredState = null) {\n super(id, url);\n this.navigationTrigger = navigationTrigger;\n this.restoredState = restoredState;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationStart(id: ${this.id}, url: '${this.url}')`;\n }\n}\n/**\n * An event triggered when a navigation ends successfully.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationCancel}\n * @see {@link NavigationError}\n *\n * @publicApi\n */\nclass NavigationEnd extends RouterEvent {\n urlAfterRedirects;\n type = EventType.NavigationEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}')`;\n }\n}\n/**\n * A code for the `NavigationCancel` event of the `Router` to indicate the\n * reason a navigation failed.\n *\n * @publicApi\n */\nvar NavigationCancellationCode;\n(function (NavigationCancellationCode) {\n /**\n * A navigation failed because a guard returned a `UrlTree` to redirect.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"Redirect\"] = 0] = \"Redirect\";\n /**\n * A navigation failed because a more recent navigation started.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"SupersededByNewNavigation\"] = 1] = \"SupersededByNewNavigation\";\n /**\n * A navigation failed because one of the resolvers completed without emitting a value.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"NoDataFromResolver\"] = 2] = \"NoDataFromResolver\";\n /**\n * A navigation failed because a guard returned `false`.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"GuardRejected\"] = 3] = \"GuardRejected\";\n})(NavigationCancellationCode || (NavigationCancellationCode = {}));\n/**\n * A code for the `NavigationSkipped` event of the `Router` to indicate the\n * reason a navigation was skipped.\n *\n * @publicApi\n */\nvar NavigationSkippedCode;\n(function (NavigationSkippedCode) {\n /**\n * A navigation was skipped because the navigation URL was the same as the current Router URL.\n */\n NavigationSkippedCode[NavigationSkippedCode[\"IgnoredSameUrlNavigation\"] = 0] = \"IgnoredSameUrlNavigation\";\n /**\n * A navigation was skipped because the configured `UrlHandlingStrategy` return `false` for both\n * the current Router URL and the target of the navigation.\n *\n * @see {@link UrlHandlingStrategy}\n */\n NavigationSkippedCode[NavigationSkippedCode[\"IgnoredByUrlHandlingStrategy\"] = 1] = \"IgnoredByUrlHandlingStrategy\";\n})(NavigationSkippedCode || (NavigationSkippedCode = {}));\n/**\n * An event triggered when a navigation is canceled, directly or indirectly.\n * This can happen for several reasons including when a route guard\n * returns `false` or initiates a redirect by returning a `UrlTree`.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationEnd}\n * @see {@link NavigationError}\n *\n * @publicApi\n */\nclass NavigationCancel extends RouterEvent {\n reason;\n code;\n type = EventType.NavigationCancel;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /**\n * A description of why the navigation was cancelled. For debug purposes only. Use `code`\n * instead for a stable cancellation reason that can be used in production.\n */\n reason, \n /**\n * A code to indicate why the navigation was canceled. This cancellation code is stable for\n * the reason and can be relied on whereas the `reason` string could change and should not be\n * used in production.\n */\n code) {\n super(id, url);\n this.reason = reason;\n this.code = code;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationCancel(id: ${this.id}, url: '${this.url}')`;\n }\n}\n/**\n * An event triggered when a navigation is skipped.\n * This can happen for a couple reasons including onSameUrlHandling\n * is set to `ignore` and the navigation URL is not different than the\n * current state.\n *\n * @publicApi\n */\nclass NavigationSkipped extends RouterEvent {\n reason;\n code;\n type = EventType.NavigationSkipped;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /**\n * A description of why the navigation was skipped. For debug purposes only. Use `code`\n * instead for a stable skipped reason that can be used in production.\n */\n reason, \n /**\n * A code to indicate why the navigation was skipped. This code is stable for\n * the reason and can be relied on whereas the `reason` string could change and should not be\n * used in production.\n */\n code) {\n super(id, url);\n this.reason = reason;\n this.code = code;\n }\n}\n/**\n * An event triggered when a navigation fails due to an unexpected error.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationEnd}\n * @see {@link NavigationCancel}\n *\n * @publicApi\n */\nclass NavigationError extends RouterEvent {\n error;\n target;\n type = EventType.NavigationError;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n error, \n /**\n * The target of the navigation when the error occurred.\n *\n * Note that this can be `undefined` because an error could have occurred before the\n * `RouterStateSnapshot` was created for the navigation.\n */\n target) {\n super(id, url);\n this.error = error;\n this.target = target;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationError(id: ${this.id}, url: '${this.url}', error: ${this.error})`;\n }\n}\n/**\n * An event triggered when routes are recognized.\n *\n * @publicApi\n */\nclass RoutesRecognized extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.RoutesRecognized;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n /** @docsNotRequired */\n toString() {\n return `RoutesRecognized(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the start of the Guard phase of routing.\n *\n * @see {@link GuardsCheckEnd}\n *\n * @publicApi\n */\nclass GuardsCheckStart extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.GuardsCheckStart;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `GuardsCheckStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the end of the Guard phase of routing.\n *\n * @see {@link GuardsCheckStart}\n *\n * @publicApi\n */\nclass GuardsCheckEnd extends RouterEvent {\n urlAfterRedirects;\n state;\n shouldActivate;\n type = EventType.GuardsCheckEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state, \n /** @docsNotRequired */\n shouldActivate) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n this.shouldActivate = shouldActivate;\n }\n toString() {\n return `GuardsCheckEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state}, shouldActivate: ${this.shouldActivate})`;\n }\n}\n/**\n * An event triggered at the start of the Resolve phase of routing.\n *\n * Runs in the \"resolve\" phase whether or not there is anything to resolve.\n * In future, may change to only run when there are things to be resolved.\n *\n * @see {@link ResolveEnd}\n *\n * @publicApi\n */\nclass ResolveStart extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.ResolveStart;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `ResolveStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the end of the Resolve phase of routing.\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ResolveEnd extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.ResolveEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `ResolveEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered before lazy loading a route configuration.\n *\n * @see {@link RouteConfigLoadEnd}\n *\n * @publicApi\n */\nclass RouteConfigLoadStart {\n route;\n type = EventType.RouteConfigLoadStart;\n constructor(\n /** @docsNotRequired */\n route) {\n this.route = route;\n }\n toString() {\n return `RouteConfigLoadStart(path: ${this.route.path})`;\n }\n}\n/**\n * An event triggered when a route has been lazy loaded.\n *\n * @see {@link RouteConfigLoadStart}\n *\n * @publicApi\n */\nclass RouteConfigLoadEnd {\n route;\n type = EventType.RouteConfigLoadEnd;\n constructor(\n /** @docsNotRequired */\n route) {\n this.route = route;\n }\n toString() {\n return `RouteConfigLoadEnd(path: ${this.route.path})`;\n }\n}\n/**\n * An event triggered at the start of the child-activation\n * part of the Resolve phase of routing.\n * @see {@link ChildActivationEnd}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ChildActivationStart {\n snapshot;\n type = EventType.ChildActivationStart;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ChildActivationStart(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the end of the child-activation part\n * of the Resolve phase of routing.\n * @see {@link ChildActivationStart}\n * @see {@link ResolveStart}\n * @publicApi\n */\nclass ChildActivationEnd {\n snapshot;\n type = EventType.ChildActivationEnd;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ChildActivationEnd(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the start of the activation part\n * of the Resolve phase of routing.\n * @see {@link ActivationEnd}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ActivationStart {\n snapshot;\n type = EventType.ActivationStart;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ActivationStart(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the end of the activation part\n * of the Resolve phase of routing.\n * @see {@link ActivationStart}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ActivationEnd {\n snapshot;\n type = EventType.ActivationEnd;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ActivationEnd(path: '${path}')`;\n }\n}\n/**\n * An event triggered by scrolling.\n *\n * @publicApi\n */\nclass Scroll {\n routerEvent;\n position;\n anchor;\n type = EventType.Scroll;\n constructor(\n /** @docsNotRequired */\n routerEvent, \n /** @docsNotRequired */\n position, \n /** @docsNotRequired */\n anchor) {\n this.routerEvent = routerEvent;\n this.position = position;\n this.anchor = anchor;\n }\n toString() {\n const pos = this.position ? `${this.position[0]}, ${this.position[1]}` : null;\n return `Scroll(anchor: '${this.anchor}', position: '${pos}')`;\n }\n}\nclass BeforeActivateRoutes {\n}\nclass RedirectRequest {\n url;\n navigationBehaviorOptions;\n constructor(url, navigationBehaviorOptions) {\n this.url = url;\n this.navigationBehaviorOptions = navigationBehaviorOptions;\n }\n}\nfunction stringifyEvent(routerEvent) {\n switch (routerEvent.type) {\n case EventType.ActivationEnd:\n return `ActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ActivationStart:\n return `ActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ChildActivationEnd:\n return `ChildActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ChildActivationStart:\n return `ChildActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.GuardsCheckEnd:\n return `GuardsCheckEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state}, shouldActivate: ${routerEvent.shouldActivate})`;\n case EventType.GuardsCheckStart:\n return `GuardsCheckStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.NavigationCancel:\n return `NavigationCancel(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.NavigationSkipped:\n return `NavigationSkipped(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.NavigationEnd:\n return `NavigationEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}')`;\n case EventType.NavigationError:\n return `NavigationError(id: ${routerEvent.id}, url: '${routerEvent.url}', error: ${routerEvent.error})`;\n case EventType.NavigationStart:\n return `NavigationStart(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.ResolveEnd:\n return `ResolveEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.ResolveStart:\n return `ResolveStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.RouteConfigLoadEnd:\n return `RouteConfigLoadEnd(path: ${routerEvent.route.path})`;\n case EventType.RouteConfigLoadStart:\n return `RouteConfigLoadStart(path: ${routerEvent.route.path})`;\n case EventType.RoutesRecognized:\n return `RoutesRecognized(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.Scroll:\n const pos = routerEvent.position\n ? `${routerEvent.position[0]}, ${routerEvent.position[1]}`\n : null;\n return `Scroll(anchor: '${routerEvent.anchor}', position: '${pos}')`;\n }\n}\n\n/**\n * Creates an `EnvironmentInjector` if the `Route` has providers and one does not already exist\n * and returns the injector. Otherwise, if the `Route` does not have `providers`, returns the\n * `currentInjector`.\n *\n * @param route The route that might have providers\n * @param currentInjector The parent injector of the `Route`\n */\nfunction getOrCreateRouteInjectorIfNeeded(route, currentInjector) {\n if (route.providers && !route._injector) {\n route._injector = createEnvironmentInjector(route.providers, currentInjector, `Route: ${route.path}`);\n }\n return route._injector ?? currentInjector;\n}\nfunction getLoadedRoutes$1(route) {\n return route._loadedRoutes;\n}\nfunction getLoadedInjector(route) {\n return route._loadedInjector;\n}\nfunction getLoadedComponent(route) {\n return route._loadedComponent;\n}\nfunction getProvidersInjector(route) {\n return route._injector;\n}\nfunction validateConfig(config, parentPath = '', requireStandaloneComponents = false) {\n // forEach doesn't iterate undefined values\n for (let i = 0; i < config.length; i++) {\n const route = config[i];\n const fullPath = getFullPath(parentPath, route);\n validateNode(route, fullPath, requireStandaloneComponents);\n }\n}\nfunction assertStandalone(fullPath, component) {\n if (component && ɵisNgModule(component)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. You are using 'loadComponent' with a module, ` +\n `but it must be used with standalone components. Use 'loadChildren' instead.`);\n }\n else if (component && !isStandalone(component)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. The component must be standalone.`);\n }\n}\nfunction validateNode(route, fullPath, requireStandaloneComponents) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!route) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `\n Invalid configuration of route '${fullPath}': Encountered undefined route.\n The reason might be an extra comma.\n\n Example:\n const routes: Routes = [\n { path: '', redirectTo: '/dashboard', pathMatch: 'full' },\n { path: 'dashboard', component: DashboardComponent },, << two commas\n { path: 'detail/:id', component: HeroDetailComponent }\n ];\n `);\n }\n if (Array.isArray(route)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': Array cannot be specified`);\n }\n if (!route.redirectTo &&\n !route.component &&\n !route.loadComponent &&\n !route.children &&\n !route.loadChildren &&\n route.outlet &&\n route.outlet !== PRIMARY_OUTLET) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': a componentless route without children or loadChildren cannot have a named outlet set`);\n }\n if (route.redirectTo && route.children) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and children cannot be used together`);\n }\n if (route.redirectTo && route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and loadChildren cannot be used together`);\n }\n if (route.children && route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': children and loadChildren cannot be used together`);\n }\n if (route.redirectTo && (route.component || route.loadComponent)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and component/loadComponent cannot be used together`);\n }\n if (route.component && route.loadComponent) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': component and loadComponent cannot be used together`);\n }\n if (route.redirectTo && route.canActivate) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and canActivate cannot be used together. Redirects happen before activation ` +\n `so canActivate will never be executed.`);\n }\n if (route.path && route.matcher) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': path and matcher cannot be used together`);\n }\n if (route.redirectTo === void 0 &&\n !route.component &&\n !route.loadComponent &&\n !route.children &&\n !route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. One of the following must be provided: component, loadComponent, redirectTo, children or loadChildren`);\n }\n if (route.path === void 0 && route.matcher === void 0) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': routes must have either a path or a matcher specified`);\n }\n if (typeof route.path === 'string' && route.path.charAt(0) === '/') {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': path cannot start with a slash`);\n }\n if (route.path === '' && route.redirectTo !== void 0 && route.pathMatch === void 0) {\n const exp = `The default value of 'pathMatch' is 'prefix', but often the intent is to use 'full'.`;\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '{path: \"${fullPath}\", redirectTo: \"${route.redirectTo}\"}': please provide 'pathMatch'. ${exp}`);\n }\n if (requireStandaloneComponents) {\n assertStandalone(fullPath, route.component);\n }\n }\n if (route.children) {\n validateConfig(route.children, fullPath, requireStandaloneComponents);\n }\n}\nfunction getFullPath(parentPath, currentRoute) {\n if (!currentRoute) {\n return parentPath;\n }\n if (!parentPath && !currentRoute.path) {\n return '';\n }\n else if (parentPath && !currentRoute.path) {\n return `${parentPath}/`;\n }\n else if (!parentPath && currentRoute.path) {\n return currentRoute.path;\n }\n else {\n return `${parentPath}/${currentRoute.path}`;\n }\n}\n/** Returns the `route.outlet` or PRIMARY_OUTLET if none exists. */\nfunction getOutlet(route) {\n return route.outlet || PRIMARY_OUTLET;\n}\n/**\n * Sorts the `routes` such that the ones with an outlet matching `outletName` come first.\n * The order of the configs is otherwise preserved.\n */\nfunction sortByMatchingOutlets(routes, outletName) {\n const sortedConfig = routes.filter((r) => getOutlet(r) === outletName);\n sortedConfig.push(...routes.filter((r) => getOutlet(r) !== outletName));\n return sortedConfig;\n}\n/**\n * Gets the first injector in the snapshot's parent tree.\n *\n * If the `Route` has a static list of providers, the returned injector will be the one created from\n * those. If it does not exist, the returned injector may come from the parents, which may be from a\n * loaded config or their static providers.\n *\n * Returns `null` if there is neither this nor any parents have a stored injector.\n *\n * Generally used for retrieving the injector to use for getting tokens for guards/resolvers and\n * also used for getting the correct injector to use for creating components.\n */\nfunction getClosestRouteInjector(snapshot) {\n if (!snapshot)\n return null;\n // If the current route has its own injector, which is created from the static providers on the\n // route itself, we should use that. Otherwise, we start at the parent since we do not want to\n // include the lazy loaded injector from this route.\n if (snapshot.routeConfig?._injector) {\n return snapshot.routeConfig._injector;\n }\n for (let s = snapshot.parent; s; s = s.parent) {\n const route = s.routeConfig;\n // Note that the order here is important. `_loadedInjector` stored on the route with\n // `loadChildren: () => NgModule` so it applies to child routes with priority. The `_injector`\n // is created from the static providers on that parent route, so it applies to the children as\n // well, but only if there is no lazy loaded NgModuleRef injector.\n if (route?._loadedInjector)\n return route._loadedInjector;\n if (route?._injector)\n return route._injector;\n }\n return null;\n}\n\n/**\n * Store contextual information about a `RouterOutlet`\n *\n * @publicApi\n */\nclass OutletContext {\n rootInjector;\n outlet = null;\n route = null;\n children;\n attachRef = null;\n get injector() {\n return getClosestRouteInjector(this.route?.snapshot) ?? this.rootInjector;\n }\n constructor(rootInjector) {\n this.rootInjector = rootInjector;\n this.children = new ChildrenOutletContexts(this.rootInjector);\n }\n}\n/**\n * Store contextual information about the children (= nested) `RouterOutlet`\n *\n * @publicApi\n */\nclass ChildrenOutletContexts {\n rootInjector;\n // contexts for child outlets, by name.\n contexts = new Map();\n /** @nodoc */\n constructor(rootInjector) {\n this.rootInjector = rootInjector;\n }\n /** Called when a `RouterOutlet` directive is instantiated */\n onChildOutletCreated(childName, outlet) {\n const context = this.getOrCreateContext(childName);\n context.outlet = outlet;\n this.contexts.set(childName, context);\n }\n /**\n * Called when a `RouterOutlet` directive is destroyed.\n * We need to keep the context as the outlet could be destroyed inside a NgIf and might be\n * re-created later.\n */\n onChildOutletDestroyed(childName) {\n const context = this.getContext(childName);\n if (context) {\n context.outlet = null;\n context.attachRef = null;\n }\n }\n /**\n * Called when the corresponding route is deactivated during navigation.\n * Because the component get destroyed, all children outlet are destroyed.\n */\n onOutletDeactivated() {\n const contexts = this.contexts;\n this.contexts = new Map();\n return contexts;\n }\n onOutletReAttached(contexts) {\n this.contexts = contexts;\n }\n getOrCreateContext(childName) {\n let context = this.getContext(childName);\n if (!context) {\n context = new OutletContext(this.rootInjector);\n this.contexts.set(childName, context);\n }\n return context;\n }\n getContext(childName) {\n return this.contexts.get(childName) || null;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, deps: [{ token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i0.EnvironmentInjector }] });\n\nclass Tree {\n /** @internal */\n _root;\n constructor(root) {\n this._root = root;\n }\n get root() {\n return this._root.value;\n }\n /**\n * @internal\n */\n parent(t) {\n const p = this.pathFromRoot(t);\n return p.length > 1 ? p[p.length - 2] : null;\n }\n /**\n * @internal\n */\n children(t) {\n const n = findNode(t, this._root);\n return n ? n.children.map((t) => t.value) : [];\n }\n /**\n * @internal\n */\n firstChild(t) {\n const n = findNode(t, this._root);\n return n && n.children.length > 0 ? n.children[0].value : null;\n }\n /**\n * @internal\n */\n siblings(t) {\n const p = findPath(t, this._root);\n if (p.length < 2)\n return [];\n const c = p[p.length - 2].children.map((c) => c.value);\n return c.filter((cc) => cc !== t);\n }\n /**\n * @internal\n */\n pathFromRoot(t) {\n return findPath(t, this._root).map((s) => s.value);\n }\n}\n// DFS for the node matching the value\nfunction findNode(value, node) {\n if (value === node.value)\n return node;\n for (const child of node.children) {\n const node = findNode(value, child);\n if (node)\n return node;\n }\n return null;\n}\n// Return the path to the node with the given value using DFS\nfunction findPath(value, node) {\n if (value === node.value)\n return [node];\n for (const child of node.children) {\n const path = findPath(value, child);\n if (path.length) {\n path.unshift(node);\n return path;\n }\n }\n return [];\n}\nclass TreeNode {\n value;\n children;\n constructor(value, children) {\n this.value = value;\n this.children = children;\n }\n toString() {\n return `TreeNode(${this.value})`;\n }\n}\n// Return the list of T indexed by outlet name\nfunction nodeChildrenAsMap(node) {\n const map = {};\n if (node) {\n node.children.forEach((child) => (map[child.value.outlet] = child));\n }\n return map;\n}\n\n/**\n * Represents the state of the router as a tree of activated routes.\n *\n * @usageNotes\n *\n * Every node in the route tree is an `ActivatedRoute` instance\n * that knows about the \"consumed\" URL segments, the extracted parameters,\n * and the resolved data.\n * Use the `ActivatedRoute` properties to traverse the tree from any node.\n *\n * The following fragment shows how a component gets the root node\n * of the current state to establish its own route tree:\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const state: RouterState = router.routerState;\n * const root: ActivatedRoute = state.root;\n * const child = root.firstChild;\n * const id: Observable
= child.params.map(p => p.id);\n * //...\n * }\n * }\n * ```\n *\n * @see {@link ActivatedRoute}\n * @see [Getting route information](guide/routing/common-router-tasks#getting-route-information)\n *\n * @publicApi\n */\nclass RouterState extends Tree {\n snapshot;\n /** @internal */\n constructor(root, \n /** The current snapshot of the router state */\n snapshot) {\n super(root);\n this.snapshot = snapshot;\n setRouterState(this, root);\n }\n toString() {\n return this.snapshot.toString();\n }\n}\nfunction createEmptyState(rootComponent) {\n const snapshot = createEmptyStateSnapshot(rootComponent);\n const emptyUrl = new BehaviorSubject([new UrlSegment('', {})]);\n const emptyParams = new BehaviorSubject({});\n const emptyData = new BehaviorSubject({});\n const emptyQueryParams = new BehaviorSubject({});\n const fragment = new BehaviorSubject('');\n const activated = new ActivatedRoute(emptyUrl, emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, snapshot.root);\n activated.snapshot = snapshot.root;\n return new RouterState(new TreeNode(activated, []), snapshot);\n}\nfunction createEmptyStateSnapshot(rootComponent) {\n const emptyParams = {};\n const emptyData = {};\n const emptyQueryParams = {};\n const fragment = '';\n const activated = new ActivatedRouteSnapshot([], emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, null, {});\n return new RouterStateSnapshot('', new TreeNode(activated, []));\n}\n/**\n * Provides access to information about a route associated with a component\n * that is loaded in an outlet.\n * Use to traverse the `RouterState` tree and extract information from nodes.\n *\n * The following example shows how to construct a component using information from a\n * currently activated route.\n *\n * Note: the observables in this class only emit when the current and previous values differ based\n * on shallow equality. For example, changing deeply nested properties in resolved `data` will not\n * cause the `ActivatedRoute.data` `Observable` to emit a new value.\n *\n * {@example router/activated-route/module.ts region=\"activated-route\"\n * header=\"activated-route.component.ts\"}\n *\n * @see [Getting route information](guide/routing/common-router-tasks#getting-route-information)\n *\n * @publicApi\n */\nclass ActivatedRoute {\n urlSubject;\n paramsSubject;\n queryParamsSubject;\n fragmentSubject;\n dataSubject;\n outlet;\n component;\n /** The current snapshot of this route */\n snapshot;\n /** @internal */\n _futureSnapshot;\n /** @internal */\n _routerState;\n /** @internal */\n _paramMap;\n /** @internal */\n _queryParamMap;\n /** An Observable of the resolved route title */\n title;\n /** An observable of the URL segments matched by this route. */\n url;\n /** An observable of the matrix parameters scoped to this route. */\n params;\n /** An observable of the query parameters shared by all the routes. */\n queryParams;\n /** An observable of the URL fragment shared by all the routes. */\n fragment;\n /** An observable of the static and resolved data of this route. */\n data;\n /** @internal */\n constructor(\n /** @internal */\n urlSubject, \n /** @internal */\n paramsSubject, \n /** @internal */\n queryParamsSubject, \n /** @internal */\n fragmentSubject, \n /** @internal */\n dataSubject, \n /** The outlet name of the route, a constant. */\n outlet, \n /** The component of the route, a constant. */\n component, futureSnapshot) {\n this.urlSubject = urlSubject;\n this.paramsSubject = paramsSubject;\n this.queryParamsSubject = queryParamsSubject;\n this.fragmentSubject = fragmentSubject;\n this.dataSubject = dataSubject;\n this.outlet = outlet;\n this.component = component;\n this._futureSnapshot = futureSnapshot;\n this.title = this.dataSubject?.pipe(map((d) => d[RouteTitleKey])) ?? of(undefined);\n // TODO(atscott): Verify that these can be changed to `.asObservable()` with TGP.\n this.url = urlSubject;\n this.params = paramsSubject;\n this.queryParams = queryParamsSubject;\n this.fragment = fragmentSubject;\n this.data = dataSubject;\n }\n /** The configuration used to match this route. */\n get routeConfig() {\n return this._futureSnapshot.routeConfig;\n }\n /** The root of the router state. */\n get root() {\n return this._routerState.root;\n }\n /** The parent of this route in the router state tree. */\n get parent() {\n return this._routerState.parent(this);\n }\n /** The first child of this route in the router state tree. */\n get firstChild() {\n return this._routerState.firstChild(this);\n }\n /** The children of this route in the router state tree. */\n get children() {\n return this._routerState.children(this);\n }\n /** The path from the root of the router state tree to this route. */\n get pathFromRoot() {\n return this._routerState.pathFromRoot(this);\n }\n /**\n * An Observable that contains a map of the required and optional parameters\n * specific to the route.\n * The map supports retrieving single and multiple values from the same parameter.\n */\n get paramMap() {\n this._paramMap ??= this.params.pipe(map((p) => convertToParamMap(p)));\n return this._paramMap;\n }\n /**\n * An Observable that contains a map of the query parameters available to all routes.\n * The map supports retrieving single and multiple values from the query parameter.\n */\n get queryParamMap() {\n this._queryParamMap ??= this.queryParams.pipe(map((p) => convertToParamMap(p)));\n return this._queryParamMap;\n }\n toString() {\n return this.snapshot ? this.snapshot.toString() : `Future(${this._futureSnapshot})`;\n }\n}\n/**\n * Returns the inherited params, data, and resolve for a given route.\n *\n * By default, we do not inherit parent data unless the current route is path-less or the parent\n * route is component-less.\n */\nfunction getInherited(route, parent, paramsInheritanceStrategy = 'emptyOnly') {\n let inherited;\n const { routeConfig } = route;\n if (parent !== null &&\n (paramsInheritanceStrategy === 'always' ||\n // inherit parent data if route is empty path\n routeConfig?.path === '' ||\n // inherit parent data if parent was componentless\n (!parent.component && !parent.routeConfig?.loadComponent))) {\n inherited = {\n params: { ...parent.params, ...route.params },\n data: { ...parent.data, ...route.data },\n resolve: {\n // Snapshots are created with data inherited from parent and guards (i.e. canActivate) can\n // change data because it's not frozen...\n // This first line could be deleted chose to break/disallow mutating the `data` object in\n // guards.\n // Note that data from parents still override this mutated data so anyone relying on this\n // might be surprised that it doesn't work if parent data is inherited but otherwise does.\n ...route.data,\n // Ensure inherited resolved data overrides inherited static data\n ...parent.data,\n // static data from the current route overrides any inherited data\n ...routeConfig?.data,\n // resolved data from current route overrides everything\n ...route._resolvedData,\n },\n };\n }\n else {\n inherited = {\n params: { ...route.params },\n data: { ...route.data },\n resolve: { ...route.data, ...(route._resolvedData ?? {}) },\n };\n }\n if (routeConfig && hasStaticTitle(routeConfig)) {\n inherited.resolve[RouteTitleKey] = routeConfig.title;\n }\n return inherited;\n}\n/**\n * @description\n *\n * Contains the information about a route associated with a component loaded in an\n * outlet at a particular moment in time. ActivatedRouteSnapshot can also be used to\n * traverse the router state tree.\n *\n * The following example initializes a component with route information extracted\n * from the snapshot of the root node at the time of creation.\n *\n * ```ts\n * @Component({templateUrl:'./my-component.html'})\n * class MyComponent {\n * constructor(route: ActivatedRoute) {\n * const id: string = route.snapshot.params.id;\n * const url: string = route.snapshot.url.join('');\n * const user = route.snapshot.data.user;\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass ActivatedRouteSnapshot {\n url;\n params;\n queryParams;\n fragment;\n data;\n outlet;\n component;\n /** The configuration used to match this route **/\n routeConfig;\n /** @internal */\n _resolve;\n /** @internal */\n _resolvedData;\n /** @internal */\n _routerState;\n /** @internal */\n _paramMap;\n /** @internal */\n _queryParamMap;\n /** The resolved route title */\n get title() {\n // Note: This _must_ be a getter because the data is mutated in the resolvers. Title will not be\n // available at the time of class instantiation.\n return this.data?.[RouteTitleKey];\n }\n /** @internal */\n constructor(\n /** The URL segments matched by this route */\n url, \n /**\n * The matrix parameters scoped to this route.\n *\n * You can compute all params (or data) in the router state or to get params outside\n * of an activated component by traversing the `RouterState` tree as in the following\n * example:\n * ```ts\n * collectRouteParams(router: Router) {\n * let params = {};\n * let stack: ActivatedRouteSnapshot[] = [router.routerState.snapshot.root];\n * while (stack.length > 0) {\n * const route = stack.pop()!;\n * params = {...params, ...route.params};\n * stack.push(...route.children);\n * }\n * return params;\n * }\n * ```\n */\n params, \n /** The query parameters shared by all the routes */\n queryParams, \n /** The URL fragment shared by all the routes */\n fragment, \n /** The static and resolved data of this route */\n data, \n /** The outlet name of the route */\n outlet, \n /** The component of the route */\n component, routeConfig, resolve) {\n this.url = url;\n this.params = params;\n this.queryParams = queryParams;\n this.fragment = fragment;\n this.data = data;\n this.outlet = outlet;\n this.component = component;\n this.routeConfig = routeConfig;\n this._resolve = resolve;\n }\n /** The root of the router state */\n get root() {\n return this._routerState.root;\n }\n /** The parent of this route in the router state tree */\n get parent() {\n return this._routerState.parent(this);\n }\n /** The first child of this route in the router state tree */\n get firstChild() {\n return this._routerState.firstChild(this);\n }\n /** The children of this route in the router state tree */\n get children() {\n return this._routerState.children(this);\n }\n /** The path from the root of the router state tree to this route */\n get pathFromRoot() {\n return this._routerState.pathFromRoot(this);\n }\n get paramMap() {\n this._paramMap ??= convertToParamMap(this.params);\n return this._paramMap;\n }\n get queryParamMap() {\n this._queryParamMap ??= convertToParamMap(this.queryParams);\n return this._queryParamMap;\n }\n toString() {\n const url = this.url.map((segment) => segment.toString()).join('/');\n const matched = this.routeConfig ? this.routeConfig.path : '';\n return `Route(url:'${url}', path:'${matched}')`;\n }\n}\n/**\n * @description\n *\n * Represents the state of the router at a moment in time.\n *\n * This is a tree of activated route snapshots. Every node in this tree knows about\n * the \"consumed\" URL segments, the extracted parameters, and the resolved data.\n *\n * The following example shows how a component is initialized with information\n * from the snapshot of the root node's state at the time of creation.\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const state: RouterState = router.routerState;\n * const snapshot: RouterStateSnapshot = state.snapshot;\n * const root: ActivatedRouteSnapshot = snapshot.root;\n * const child = root.firstChild;\n * const id: Observable = child.params.map(p => p.id);\n * //...\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass RouterStateSnapshot extends Tree {\n url;\n /** @internal */\n constructor(\n /** The url from which this snapshot was created */\n url, root) {\n super(root);\n this.url = url;\n setRouterState(this, root);\n }\n toString() {\n return serializeNode(this._root);\n }\n}\nfunction setRouterState(state, node) {\n node.value._routerState = state;\n node.children.forEach((c) => setRouterState(state, c));\n}\nfunction serializeNode(node) {\n const c = node.children.length > 0 ? ` { ${node.children.map(serializeNode).join(', ')} } ` : '';\n return `${node.value}${c}`;\n}\n/**\n * The expectation is that the activate route is created with the right set of parameters.\n * So we push new values into the observables only when they are not the initial values.\n * And we detect that by checking if the snapshot field is set.\n */\nfunction advanceActivatedRoute(route) {\n if (route.snapshot) {\n const currentSnapshot = route.snapshot;\n const nextSnapshot = route._futureSnapshot;\n route.snapshot = nextSnapshot;\n if (!shallowEqual(currentSnapshot.queryParams, nextSnapshot.queryParams)) {\n route.queryParamsSubject.next(nextSnapshot.queryParams);\n }\n if (currentSnapshot.fragment !== nextSnapshot.fragment) {\n route.fragmentSubject.next(nextSnapshot.fragment);\n }\n if (!shallowEqual(currentSnapshot.params, nextSnapshot.params)) {\n route.paramsSubject.next(nextSnapshot.params);\n }\n if (!shallowEqualArrays(currentSnapshot.url, nextSnapshot.url)) {\n route.urlSubject.next(nextSnapshot.url);\n }\n if (!shallowEqual(currentSnapshot.data, nextSnapshot.data)) {\n route.dataSubject.next(nextSnapshot.data);\n }\n }\n else {\n route.snapshot = route._futureSnapshot;\n // this is for resolved data\n route.dataSubject.next(route._futureSnapshot.data);\n }\n}\nfunction equalParamsAndUrlSegments(a, b) {\n const equalUrlParams = shallowEqual(a.params, b.params) && equalSegments(a.url, b.url);\n const parentsMismatch = !a.parent !== !b.parent;\n return (equalUrlParams &&\n !parentsMismatch &&\n (!a.parent || equalParamsAndUrlSegments(a.parent, b.parent)));\n}\nfunction hasStaticTitle(config) {\n return typeof config.title === 'string' || config.title === null;\n}\n\n/**\n * An `InjectionToken` provided by the `RouterOutlet` and can be set using the `routerOutletData`\n * input.\n *\n * When unset, this value is `null` by default.\n *\n * @usageNotes\n *\n * To set the data from the template of the component with `router-outlet`:\n * ```html\n * \n * ```\n *\n * To read the data in the routed component:\n * ```ts\n * data = inject(ROUTER_OUTLET_DATA) as Signal<{name: string}>;\n * ```\n *\n * @publicApi\n */\nconst ROUTER_OUTLET_DATA = new InjectionToken(ngDevMode ? 'RouterOutlet data' : '');\n/**\n * @description\n *\n * Acts as a placeholder that Angular dynamically fills based on the current router state.\n *\n * Each outlet can have a unique name, determined by the optional `name` attribute.\n * The name cannot be set or changed dynamically. If not set, default value is \"primary\".\n *\n * ```html\n * \n * \n * \n * ```\n *\n * Named outlets can be the targets of secondary routes.\n * The `Route` object for a secondary route has an `outlet` property to identify the target outlet:\n *\n * `{path: , component: , outlet: }`\n *\n * Using named outlets and secondary routes, you can target multiple outlets in\n * the same `RouterLink` directive.\n *\n * The router keeps track of separate branches in a navigation tree for each named outlet and\n * generates a representation of that tree in the URL.\n * The URL for a secondary route uses the following syntax to specify both the primary and secondary\n * routes at the same time:\n *\n * `http://base-path/primary-route-path(outlet-name:route-path)`\n *\n * A router outlet emits an activate event when a new component is instantiated,\n * deactivate event when a component is destroyed.\n * An attached event emits when the `RouteReuseStrategy` instructs the outlet to reattach the\n * subtree, and the detached event emits when the `RouteReuseStrategy` instructs the outlet to\n * detach the subtree.\n *\n * ```html\n * \n * ```\n *\n * @see {@link RouterLink}\n * @see {@link Route}\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterOutlet {\n activated = null;\n /** @internal */\n get activatedComponentRef() {\n return this.activated;\n }\n _activatedRoute = null;\n /**\n * The name of the outlet\n *\n */\n name = PRIMARY_OUTLET;\n activateEvents = new EventEmitter();\n deactivateEvents = new EventEmitter();\n /**\n * Emits an attached component instance when the `RouteReuseStrategy` instructs to re-attach a\n * previously detached subtree.\n **/\n attachEvents = new EventEmitter();\n /**\n * Emits a detached component instance when the `RouteReuseStrategy` instructs to detach the\n * subtree.\n */\n detachEvents = new EventEmitter();\n /**\n * Data that will be provided to the child injector through the `ROUTER_OUTLET_DATA` token.\n *\n * When unset, the value of the token is `undefined` by default.\n */\n routerOutletData = input(undefined);\n parentContexts = inject(ChildrenOutletContexts);\n location = inject(ViewContainerRef);\n changeDetector = inject(ChangeDetectorRef);\n inputBinder = inject(INPUT_BINDER, { optional: true });\n /** @nodoc */\n supportsBindingToComponentInputs = true;\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['name']) {\n const { firstChange, previousValue } = changes['name'];\n if (firstChange) {\n // The first change is handled by ngOnInit. Because ngOnChanges doesn't get called when no\n // input is set at all, we need to centrally handle the first change there.\n return;\n }\n // unregister with the old name\n if (this.isTrackedInParentContexts(previousValue)) {\n this.deactivate();\n this.parentContexts.onChildOutletDestroyed(previousValue);\n }\n // register the new name\n this.initializeOutletWithName();\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n // Ensure that the registered outlet is this one before removing it on the context.\n if (this.isTrackedInParentContexts(this.name)) {\n this.parentContexts.onChildOutletDestroyed(this.name);\n }\n this.inputBinder?.unsubscribeFromRouteData(this);\n }\n isTrackedInParentContexts(outletName) {\n return this.parentContexts.getContext(outletName)?.outlet === this;\n }\n /** @nodoc */\n ngOnInit() {\n this.initializeOutletWithName();\n }\n initializeOutletWithName() {\n this.parentContexts.onChildOutletCreated(this.name, this);\n if (this.activated) {\n return;\n }\n // If the outlet was not instantiated at the time the route got activated we need to populate\n // the outlet when it is initialized (ie inside a NgIf)\n const context = this.parentContexts.getContext(this.name);\n if (context?.route) {\n if (context.attachRef) {\n // `attachRef` is populated when there is an existing component to mount\n this.attach(context.attachRef, context.route);\n }\n else {\n // otherwise the component defined in the configuration is created\n this.activateWith(context.route, context.injector);\n }\n }\n }\n get isActivated() {\n return !!this.activated;\n }\n /**\n * @returns The currently activated component instance.\n * @throws An error if the outlet is not activated.\n */\n get component() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n return this.activated.instance;\n }\n get activatedRoute() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n return this._activatedRoute;\n }\n get activatedRouteData() {\n if (this._activatedRoute) {\n return this._activatedRoute.snapshot.data;\n }\n return {};\n }\n /**\n * Called when the `RouteReuseStrategy` instructs to detach the subtree\n */\n detach() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n this.location.detach();\n const cmp = this.activated;\n this.activated = null;\n this._activatedRoute = null;\n this.detachEvents.emit(cmp.instance);\n return cmp;\n }\n /**\n * Called when the `RouteReuseStrategy` instructs to re-attach a previously detached subtree\n */\n attach(ref, activatedRoute) {\n this.activated = ref;\n this._activatedRoute = activatedRoute;\n this.location.insert(ref.hostView);\n this.inputBinder?.bindActivatedRouteToOutletComponent(this);\n this.attachEvents.emit(ref.instance);\n }\n deactivate() {\n if (this.activated) {\n const c = this.component;\n this.activated.destroy();\n this.activated = null;\n this._activatedRoute = null;\n this.deactivateEvents.emit(c);\n }\n }\n activateWith(activatedRoute, environmentInjector) {\n if (this.isActivated) {\n throw new ɵRuntimeError(4013 /* RuntimeErrorCode.OUTLET_ALREADY_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n 'Cannot activate an already activated outlet');\n }\n this._activatedRoute = activatedRoute;\n const location = this.location;\n const snapshot = activatedRoute.snapshot;\n const component = snapshot.component;\n const childContexts = this.parentContexts.getOrCreateContext(this.name).children;\n const injector = new OutletInjector(activatedRoute, childContexts, location.injector, this.routerOutletData);\n this.activated = location.createComponent(component, {\n index: location.length,\n injector,\n environmentInjector: environmentInjector,\n });\n // Calling `markForCheck` to make sure we will run the change detection when the\n // `RouterOutlet` is inside a `ChangeDetectionStrategy.OnPush` component.\n this.changeDetector.markForCheck();\n this.inputBinder?.bindActivatedRouteToOutletComponent(this);\n this.activateEvents.emit(this.activated.instance);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterOutlet, deps: [], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"17.1.0\", version: \"19.2.1\", type: RouterOutlet, isStandalone: true, selector: \"router-outlet\", inputs: { name: { classPropertyName: \"name\", publicName: \"name\", isSignal: false, isRequired: false, transformFunction: null }, routerOutletData: { classPropertyName: \"routerOutletData\", publicName: \"routerOutletData\", isSignal: true, isRequired: false, transformFunction: null } }, outputs: { activateEvents: \"activate\", deactivateEvents: \"deactivate\", attachEvents: \"attach\", detachEvents: \"detach\" }, exportAs: [\"outlet\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: 'router-outlet',\n exportAs: 'outlet',\n }]\n }], propDecorators: { name: [{\n type: Input\n }], activateEvents: [{\n type: Output,\n args: ['activate']\n }], deactivateEvents: [{\n type: Output,\n args: ['deactivate']\n }], attachEvents: [{\n type: Output,\n args: ['attach']\n }], detachEvents: [{\n type: Output,\n args: ['detach']\n }] } });\nclass OutletInjector {\n route;\n childContexts;\n parent;\n outletData;\n /**\n * This injector has a special handing for the `ActivatedRoute` and\n * `ChildrenOutletContexts` tokens: it returns corresponding values for those\n * tokens dynamically. This behavior is different from the regular injector logic,\n * when we initialize and store a value, which is later returned for all inject\n * requests.\n *\n * In some cases (e.g. when using `@defer`), this dynamic behavior requires special\n * handling. This function allows to identify an instance of the `OutletInjector` and\n * create an instance of it without referring to the class itself (so this logic can\n * be invoked from the `core` package). This helps to retain dynamic behavior for the\n * mentioned tokens.\n *\n * Note: it's a temporary solution and we should explore how to support this case better.\n */\n __ngOutletInjector(parentInjector) {\n return new OutletInjector(this.route, this.childContexts, parentInjector, this.outletData);\n }\n constructor(route, childContexts, parent, outletData) {\n this.route = route;\n this.childContexts = childContexts;\n this.parent = parent;\n this.outletData = outletData;\n }\n get(token, notFoundValue) {\n if (token === ActivatedRoute) {\n return this.route;\n }\n if (token === ChildrenOutletContexts) {\n return this.childContexts;\n }\n if (token === ROUTER_OUTLET_DATA) {\n return this.outletData;\n }\n return this.parent.get(token, notFoundValue);\n }\n}\nconst INPUT_BINDER = new InjectionToken('');\n/**\n * Injectable used as a tree-shakable provider for opting in to binding router data to component\n * inputs.\n *\n * The RouterOutlet registers itself with this service when an `ActivatedRoute` is attached or\n * activated. When this happens, the service subscribes to the `ActivatedRoute` observables (params,\n * queryParams, data) and sets the inputs of the component using `ComponentRef.setInput`.\n * Importantly, when an input does not have an item in the route data with a matching key, this\n * input is set to `undefined`. If it were not done this way, the previous information would be\n * retained if the data got removed from the route (i.e. if a query parameter is removed).\n *\n * The `RouterOutlet` should unregister itself when destroyed via `unsubscribeFromRouteData` so that\n * the subscriptions are cleaned up.\n */\nclass RoutedComponentInputBinder {\n outletDataSubscriptions = new Map();\n bindActivatedRouteToOutletComponent(outlet) {\n this.unsubscribeFromRouteData(outlet);\n this.subscribeToRouteData(outlet);\n }\n unsubscribeFromRouteData(outlet) {\n this.outletDataSubscriptions.get(outlet)?.unsubscribe();\n this.outletDataSubscriptions.delete(outlet);\n }\n subscribeToRouteData(outlet) {\n const { activatedRoute } = outlet;\n const dataSubscription = combineLatest([\n activatedRoute.queryParams,\n activatedRoute.params,\n activatedRoute.data,\n ])\n .pipe(switchMap(([queryParams, params, data], index) => {\n data = { ...queryParams, ...params, ...data };\n // Get the first result from the data subscription synchronously so it's available to\n // the component as soon as possible (and doesn't require a second change detection).\n if (index === 0) {\n return of(data);\n }\n // Promise.resolve is used to avoid synchronously writing the wrong data when\n // two of the Observables in the `combineLatest` stream emit one after\n // another.\n return Promise.resolve(data);\n }))\n .subscribe((data) => {\n // Outlet may have been deactivated or changed names to be associated with a different\n // route\n if (!outlet.isActivated ||\n !outlet.activatedComponentRef ||\n outlet.activatedRoute !== activatedRoute ||\n activatedRoute.component === null) {\n this.unsubscribeFromRouteData(outlet);\n return;\n }\n const mirror = reflectComponentType(activatedRoute.component);\n if (!mirror) {\n this.unsubscribeFromRouteData(outlet);\n return;\n }\n for (const { templateName } of mirror.inputs) {\n outlet.activatedComponentRef.setInput(templateName, data[templateName]);\n }\n });\n this.outletDataSubscriptions.set(outlet, dataSubscription);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder, decorators: [{\n type: Injectable\n }] });\n\nfunction createRouterState(routeReuseStrategy, curr, prevState) {\n const root = createNode(routeReuseStrategy, curr._root, prevState ? prevState._root : undefined);\n return new RouterState(root, curr);\n}\nfunction createNode(routeReuseStrategy, curr, prevState) {\n // reuse an activated route that is currently displayed on the screen\n if (prevState && routeReuseStrategy.shouldReuseRoute(curr.value, prevState.value.snapshot)) {\n const value = prevState.value;\n value._futureSnapshot = curr.value;\n const children = createOrReuseChildren(routeReuseStrategy, curr, prevState);\n return new TreeNode(value, children);\n }\n else {\n if (routeReuseStrategy.shouldAttach(curr.value)) {\n // retrieve an activated route that is used to be displayed, but is not currently displayed\n const detachedRouteHandle = routeReuseStrategy.retrieve(curr.value);\n if (detachedRouteHandle !== null) {\n const tree = detachedRouteHandle.route;\n tree.value._futureSnapshot = curr.value;\n tree.children = curr.children.map((c) => createNode(routeReuseStrategy, c));\n return tree;\n }\n }\n const value = createActivatedRoute(curr.value);\n const children = curr.children.map((c) => createNode(routeReuseStrategy, c));\n return new TreeNode(value, children);\n }\n}\nfunction createOrReuseChildren(routeReuseStrategy, curr, prevState) {\n return curr.children.map((child) => {\n for (const p of prevState.children) {\n if (routeReuseStrategy.shouldReuseRoute(child.value, p.value.snapshot)) {\n return createNode(routeReuseStrategy, child, p);\n }\n }\n return createNode(routeReuseStrategy, child);\n });\n}\nfunction createActivatedRoute(c) {\n return new ActivatedRoute(new BehaviorSubject(c.url), new BehaviorSubject(c.params), new BehaviorSubject(c.queryParams), new BehaviorSubject(c.fragment), new BehaviorSubject(c.data), c.outlet, c.component, c);\n}\n\n/**\n * Can be returned by a `Router` guard to instruct the `Router` to redirect rather than continue\n * processing the path of the in-flight navigation. The `redirectTo` indicates _where_ the new\n * navigation should go to and the optional `navigationBehaviorOptions` can provide more information\n * about _how_ to perform the navigation.\n *\n * ```ts\n * const route: Route = {\n * path: \"user/:userId\",\n * component: User,\n * canActivate: [\n * () => {\n * const router = inject(Router);\n * const authService = inject(AuthenticationService);\n *\n * if (!authService.isLoggedIn()) {\n * const loginPath = router.parseUrl(\"/login\");\n * return new RedirectCommand(loginPath, {\n * skipLocationChange: \"true\",\n * });\n * }\n *\n * return true;\n * },\n * ],\n * };\n * ```\n * @see [Routing guide](guide/routing/common-router-tasks#preventing-unauthorized-access)\n *\n * @publicApi\n */\nclass RedirectCommand {\n redirectTo;\n navigationBehaviorOptions;\n constructor(redirectTo, navigationBehaviorOptions) {\n this.redirectTo = redirectTo;\n this.navigationBehaviorOptions = navigationBehaviorOptions;\n }\n}\n\nconst NAVIGATION_CANCELING_ERROR = 'ngNavigationCancelingError';\nfunction redirectingNavigationError(urlSerializer, redirect) {\n const { redirectTo, navigationBehaviorOptions } = isUrlTree(redirect)\n ? { redirectTo: redirect, navigationBehaviorOptions: undefined }\n : redirect;\n const error = navigationCancelingError(ngDevMode && `Redirecting to \"${urlSerializer.serialize(redirectTo)}\"`, NavigationCancellationCode.Redirect);\n error.url = redirectTo;\n error.navigationBehaviorOptions = navigationBehaviorOptions;\n return error;\n}\nfunction navigationCancelingError(message, code) {\n const error = new Error(`NavigationCancelingError: ${message || ''}`);\n error[NAVIGATION_CANCELING_ERROR] = true;\n error.cancellationCode = code;\n return error;\n}\nfunction isRedirectingNavigationCancelingError(error) {\n return (isNavigationCancelingError(error) &&\n isUrlTree(error.url));\n}\nfunction isNavigationCancelingError(error) {\n return !!error && error[NAVIGATION_CANCELING_ERROR];\n}\n\nlet warnedAboutUnsupportedInputBinding = false;\nconst activateRoutes = (rootContexts, routeReuseStrategy, forwardEvent, inputBindingEnabled) => map((t) => {\n new ActivateRoutes(routeReuseStrategy, t.targetRouterState, t.currentRouterState, forwardEvent, inputBindingEnabled).activate(rootContexts);\n return t;\n});\nclass ActivateRoutes {\n routeReuseStrategy;\n futureState;\n currState;\n forwardEvent;\n inputBindingEnabled;\n constructor(routeReuseStrategy, futureState, currState, forwardEvent, inputBindingEnabled) {\n this.routeReuseStrategy = routeReuseStrategy;\n this.futureState = futureState;\n this.currState = currState;\n this.forwardEvent = forwardEvent;\n this.inputBindingEnabled = inputBindingEnabled;\n }\n activate(parentContexts) {\n const futureRoot = this.futureState._root;\n const currRoot = this.currState ? this.currState._root : null;\n this.deactivateChildRoutes(futureRoot, currRoot, parentContexts);\n advanceActivatedRoute(this.futureState.root);\n this.activateChildRoutes(futureRoot, currRoot, parentContexts);\n }\n // De-activate the child route that are not re-used for the future state\n deactivateChildRoutes(futureNode, currNode, contexts) {\n const children = nodeChildrenAsMap(currNode);\n // Recurse on the routes active in the future state to de-activate deeper children\n futureNode.children.forEach((futureChild) => {\n const childOutletName = futureChild.value.outlet;\n this.deactivateRoutes(futureChild, children[childOutletName], contexts);\n delete children[childOutletName];\n });\n // De-activate the routes that will not be re-used\n Object.values(children).forEach((v) => {\n this.deactivateRouteAndItsChildren(v, contexts);\n });\n }\n deactivateRoutes(futureNode, currNode, parentContext) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n if (future === curr) {\n // Reusing the node, check to see if the children need to be de-activated\n if (future.component) {\n // If we have a normal route, we need to go through an outlet.\n const context = parentContext.getContext(future.outlet);\n if (context) {\n this.deactivateChildRoutes(futureNode, currNode, context.children);\n }\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.deactivateChildRoutes(futureNode, currNode, parentContext);\n }\n }\n else {\n if (curr) {\n // Deactivate the current route which will not be re-used\n this.deactivateRouteAndItsChildren(currNode, parentContext);\n }\n }\n }\n deactivateRouteAndItsChildren(route, parentContexts) {\n // If there is no component, the Route is never attached to an outlet (because there is no\n // component to attach).\n if (route.value.component && this.routeReuseStrategy.shouldDetach(route.value.snapshot)) {\n this.detachAndStoreRouteSubtree(route, parentContexts);\n }\n else {\n this.deactivateRouteAndOutlet(route, parentContexts);\n }\n }\n detachAndStoreRouteSubtree(route, parentContexts) {\n const context = parentContexts.getContext(route.value.outlet);\n const contexts = context && route.value.component ? context.children : parentContexts;\n const children = nodeChildrenAsMap(route);\n for (const treeNode of Object.values(children)) {\n this.deactivateRouteAndItsChildren(treeNode, contexts);\n }\n if (context && context.outlet) {\n const componentRef = context.outlet.detach();\n const contexts = context.children.onOutletDeactivated();\n this.routeReuseStrategy.store(route.value.snapshot, { componentRef, route, contexts });\n }\n }\n deactivateRouteAndOutlet(route, parentContexts) {\n const context = parentContexts.getContext(route.value.outlet);\n // The context could be `null` if we are on a componentless route but there may still be\n // children that need deactivating.\n const contexts = context && route.value.component ? context.children : parentContexts;\n const children = nodeChildrenAsMap(route);\n for (const treeNode of Object.values(children)) {\n this.deactivateRouteAndItsChildren(treeNode, contexts);\n }\n if (context) {\n if (context.outlet) {\n // Destroy the component\n context.outlet.deactivate();\n // Destroy the contexts for all the outlets that were in the component\n context.children.onOutletDeactivated();\n }\n // Clear the information about the attached component on the context but keep the reference to\n // the outlet. Clear even if outlet was not yet activated to avoid activating later with old\n // info\n context.attachRef = null;\n context.route = null;\n }\n }\n activateChildRoutes(futureNode, currNode, contexts) {\n const children = nodeChildrenAsMap(currNode);\n futureNode.children.forEach((c) => {\n this.activateRoutes(c, children[c.value.outlet], contexts);\n this.forwardEvent(new ActivationEnd(c.value.snapshot));\n });\n if (futureNode.children.length) {\n this.forwardEvent(new ChildActivationEnd(futureNode.value.snapshot));\n }\n }\n activateRoutes(futureNode, currNode, parentContexts) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n advanceActivatedRoute(future);\n // reusing the node\n if (future === curr) {\n if (future.component) {\n // If we have a normal route, we need to go through an outlet.\n const context = parentContexts.getOrCreateContext(future.outlet);\n this.activateChildRoutes(futureNode, currNode, context.children);\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.activateChildRoutes(futureNode, currNode, parentContexts);\n }\n }\n else {\n if (future.component) {\n // if we have a normal route, we need to place the component into the outlet and recurse.\n const context = parentContexts.getOrCreateContext(future.outlet);\n if (this.routeReuseStrategy.shouldAttach(future.snapshot)) {\n const stored = (this.routeReuseStrategy.retrieve(future.snapshot));\n this.routeReuseStrategy.store(future.snapshot, null);\n context.children.onOutletReAttached(stored.contexts);\n context.attachRef = stored.componentRef;\n context.route = stored.route.value;\n if (context.outlet) {\n // Attach right away when the outlet has already been instantiated\n // Otherwise attach from `RouterOutlet.ngOnInit` when it is instantiated\n context.outlet.attach(stored.componentRef, stored.route.value);\n }\n advanceActivatedRoute(stored.route.value);\n this.activateChildRoutes(futureNode, null, context.children);\n }\n else {\n context.attachRef = null;\n context.route = future;\n if (context.outlet) {\n // Activate the outlet when it has already been instantiated\n // Otherwise it will get activated from its `ngOnInit` when instantiated\n context.outlet.activateWith(future, context.injector);\n }\n this.activateChildRoutes(futureNode, null, context.children);\n }\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.activateChildRoutes(futureNode, null, parentContexts);\n }\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n const context = parentContexts.getOrCreateContext(future.outlet);\n const outlet = context.outlet;\n if (outlet &&\n this.inputBindingEnabled &&\n !outlet.supportsBindingToComponentInputs &&\n !warnedAboutUnsupportedInputBinding) {\n console.warn(`'withComponentInputBinding' feature is enabled but ` +\n `this application is using an outlet that may not support binding to component inputs.`);\n warnedAboutUnsupportedInputBinding = true;\n }\n }\n }\n}\n\nclass CanActivate {\n path;\n route;\n constructor(path) {\n this.path = path;\n this.route = this.path[this.path.length - 1];\n }\n}\nclass CanDeactivate {\n component;\n route;\n constructor(component, route) {\n this.component = component;\n this.route = route;\n }\n}\nfunction getAllRouteGuards(future, curr, parentContexts) {\n const futureRoot = future._root;\n const currRoot = curr ? curr._root : null;\n return getChildRouteGuards(futureRoot, currRoot, parentContexts, [futureRoot.value]);\n}\nfunction getCanActivateChild(p) {\n const canActivateChild = p.routeConfig ? p.routeConfig.canActivateChild : null;\n if (!canActivateChild || canActivateChild.length === 0)\n return null;\n return { node: p, guards: canActivateChild };\n}\nfunction getTokenOrFunctionIdentity(tokenOrFunction, injector) {\n const NOT_FOUND = Symbol();\n const result = injector.get(tokenOrFunction, NOT_FOUND);\n if (result === NOT_FOUND) {\n if (typeof tokenOrFunction === 'function' && !ɵisInjectable(tokenOrFunction)) {\n // We think the token is just a function so return it as-is\n return tokenOrFunction;\n }\n else {\n // This will throw the not found error\n return injector.get(tokenOrFunction);\n }\n }\n return result;\n}\nfunction getChildRouteGuards(futureNode, currNode, contexts, futurePath, checks = {\n canDeactivateChecks: [],\n canActivateChecks: [],\n}) {\n const prevChildren = nodeChildrenAsMap(currNode);\n // Process the children of the future route\n futureNode.children.forEach((c) => {\n getRouteGuards(c, prevChildren[c.value.outlet], contexts, futurePath.concat([c.value]), checks);\n delete prevChildren[c.value.outlet];\n });\n // Process any children left from the current route (not active for the future route)\n Object.entries(prevChildren).forEach(([k, v]) => deactivateRouteAndItsChildren(v, contexts.getContext(k), checks));\n return checks;\n}\nfunction getRouteGuards(futureNode, currNode, parentContexts, futurePath, checks = {\n canDeactivateChecks: [],\n canActivateChecks: [],\n}) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n const context = parentContexts ? parentContexts.getContext(futureNode.value.outlet) : null;\n // reusing the node\n if (curr && future.routeConfig === curr.routeConfig) {\n const shouldRun = shouldRunGuardsAndResolvers(curr, future, future.routeConfig.runGuardsAndResolvers);\n if (shouldRun) {\n checks.canActivateChecks.push(new CanActivate(futurePath));\n }\n else {\n // we need to set the data\n future.data = curr.data;\n future._resolvedData = curr._resolvedData;\n }\n // If we have a component, we need to go through an outlet.\n if (future.component) {\n getChildRouteGuards(futureNode, currNode, context ? context.children : null, futurePath, checks);\n // if we have a componentless route, we recurse but keep the same outlet map.\n }\n else {\n getChildRouteGuards(futureNode, currNode, parentContexts, futurePath, checks);\n }\n if (shouldRun && context && context.outlet && context.outlet.isActivated) {\n checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, curr));\n }\n }\n else {\n if (curr) {\n deactivateRouteAndItsChildren(currNode, context, checks);\n }\n checks.canActivateChecks.push(new CanActivate(futurePath));\n // If we have a component, we need to go through an outlet.\n if (future.component) {\n getChildRouteGuards(futureNode, null, context ? context.children : null, futurePath, checks);\n // if we have a componentless route, we recurse but keep the same outlet map.\n }\n else {\n getChildRouteGuards(futureNode, null, parentContexts, futurePath, checks);\n }\n }\n return checks;\n}\nfunction shouldRunGuardsAndResolvers(curr, future, mode) {\n if (typeof mode === 'function') {\n return mode(curr, future);\n }\n switch (mode) {\n case 'pathParamsChange':\n return !equalPath(curr.url, future.url);\n case 'pathParamsOrQueryParamsChange':\n return (!equalPath(curr.url, future.url) || !shallowEqual(curr.queryParams, future.queryParams));\n case 'always':\n return true;\n case 'paramsOrQueryParamsChange':\n return (!equalParamsAndUrlSegments(curr, future) ||\n !shallowEqual(curr.queryParams, future.queryParams));\n case 'paramsChange':\n default:\n return !equalParamsAndUrlSegments(curr, future);\n }\n}\nfunction deactivateRouteAndItsChildren(route, context, checks) {\n const children = nodeChildrenAsMap(route);\n const r = route.value;\n Object.entries(children).forEach(([childName, node]) => {\n if (!r.component) {\n deactivateRouteAndItsChildren(node, context, checks);\n }\n else if (context) {\n deactivateRouteAndItsChildren(node, context.children.getContext(childName), checks);\n }\n else {\n deactivateRouteAndItsChildren(node, null, checks);\n }\n });\n if (!r.component) {\n checks.canDeactivateChecks.push(new CanDeactivate(null, r));\n }\n else if (context && context.outlet && context.outlet.isActivated) {\n checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, r));\n }\n else {\n checks.canDeactivateChecks.push(new CanDeactivate(null, r));\n }\n}\n\n/**\n * Simple function check, but generic so type inference will flow. Example:\n *\n * function product(a: number, b: number) {\n * return a * b;\n * }\n *\n * if (isFunction(fn)) {\n * return fn(1, 2);\n * } else {\n * throw \"Must provide the `product` function\";\n * }\n */\nfunction isFunction(v) {\n return typeof v === 'function';\n}\nfunction isBoolean(v) {\n return typeof v === 'boolean';\n}\nfunction isCanLoad(guard) {\n return guard && isFunction(guard.canLoad);\n}\nfunction isCanActivate(guard) {\n return guard && isFunction(guard.canActivate);\n}\nfunction isCanActivateChild(guard) {\n return guard && isFunction(guard.canActivateChild);\n}\nfunction isCanDeactivate(guard) {\n return guard && isFunction(guard.canDeactivate);\n}\nfunction isCanMatch(guard) {\n return guard && isFunction(guard.canMatch);\n}\nfunction isEmptyError(e) {\n return e instanceof EmptyError || e?.name === 'EmptyError';\n}\n\nconst INITIAL_VALUE = /* @__PURE__ */ Symbol('INITIAL_VALUE');\nfunction prioritizedGuardValue() {\n return switchMap((obs) => {\n return combineLatest(obs.map((o) => o.pipe(take(1), startWith(INITIAL_VALUE)))).pipe(map((results) => {\n for (const result of results) {\n if (result === true) {\n // If result is true, check the next one\n continue;\n }\n else if (result === INITIAL_VALUE) {\n // If guard has not finished, we need to stop processing.\n return INITIAL_VALUE;\n }\n else if (result === false || isRedirect(result)) {\n // Result finished and was not true. Return the result.\n // Note that we only allow false/UrlTree/RedirectCommand. Other values are considered invalid and\n // ignored.\n return result;\n }\n }\n // Everything resolved to true. Return true.\n return true;\n }), filter((item) => item !== INITIAL_VALUE), take(1));\n });\n}\nfunction isRedirect(val) {\n return isUrlTree(val) || val instanceof RedirectCommand;\n}\n\nfunction checkGuards(injector, forwardEvent) {\n return mergeMap((t) => {\n const { targetSnapshot, currentSnapshot, guards: { canActivateChecks, canDeactivateChecks }, } = t;\n if (canDeactivateChecks.length === 0 && canActivateChecks.length === 0) {\n return of({ ...t, guardsResult: true });\n }\n return runCanDeactivateChecks(canDeactivateChecks, targetSnapshot, currentSnapshot, injector).pipe(mergeMap((canDeactivate) => {\n return canDeactivate && isBoolean(canDeactivate)\n ? runCanActivateChecks(targetSnapshot, canActivateChecks, injector, forwardEvent)\n : of(canDeactivate);\n }), map((guardsResult) => ({ ...t, guardsResult })));\n });\n}\nfunction runCanDeactivateChecks(checks, futureRSS, currRSS, injector) {\n return from(checks).pipe(mergeMap((check) => runCanDeactivate(check.component, check.route, currRSS, futureRSS, injector)), first((result) => {\n return result !== true;\n }, true));\n}\nfunction runCanActivateChecks(futureSnapshot, checks, injector, forwardEvent) {\n return from(checks).pipe(concatMap((check) => {\n return concat(fireChildActivationStart(check.route.parent, forwardEvent), fireActivationStart(check.route, forwardEvent), runCanActivateChild(futureSnapshot, check.path, injector), runCanActivate(futureSnapshot, check.route, injector));\n }), first((result) => {\n return result !== true;\n }, true));\n}\n/**\n * This should fire off `ActivationStart` events for each route being activated at this\n * level.\n * In other words, if you're activating `a` and `b` below, `path` will contain the\n * `ActivatedRouteSnapshot`s for both and we will fire `ActivationStart` for both. Always\n * return\n * `true` so checks continue to run.\n */\nfunction fireActivationStart(snapshot, forwardEvent) {\n if (snapshot !== null && forwardEvent) {\n forwardEvent(new ActivationStart(snapshot));\n }\n return of(true);\n}\n/**\n * This should fire off `ChildActivationStart` events for each route being activated at this\n * level.\n * In other words, if you're activating `a` and `b` below, `path` will contain the\n * `ActivatedRouteSnapshot`s for both and we will fire `ChildActivationStart` for both. Always\n * return\n * `true` so checks continue to run.\n */\nfunction fireChildActivationStart(snapshot, forwardEvent) {\n if (snapshot !== null && forwardEvent) {\n forwardEvent(new ChildActivationStart(snapshot));\n }\n return of(true);\n}\nfunction runCanActivate(futureRSS, futureARS, injector) {\n const canActivate = futureARS.routeConfig ? futureARS.routeConfig.canActivate : null;\n if (!canActivate || canActivate.length === 0)\n return of(true);\n const canActivateObservables = canActivate.map((canActivate) => {\n return defer(() => {\n const closestInjector = getClosestRouteInjector(futureARS) ?? injector;\n const guard = getTokenOrFunctionIdentity(canActivate, closestInjector);\n const guardVal = isCanActivate(guard)\n ? guard.canActivate(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n });\n return of(canActivateObservables).pipe(prioritizedGuardValue());\n}\nfunction runCanActivateChild(futureRSS, path, injector) {\n const futureARS = path[path.length - 1];\n const canActivateChildGuards = path\n .slice(0, path.length - 1)\n .reverse()\n .map((p) => getCanActivateChild(p))\n .filter((_) => _ !== null);\n const canActivateChildGuardsMapped = canActivateChildGuards.map((d) => {\n return defer(() => {\n const guardsMapped = d.guards.map((canActivateChild) => {\n const closestInjector = getClosestRouteInjector(d.node) ?? injector;\n const guard = getTokenOrFunctionIdentity(canActivateChild, closestInjector);\n const guardVal = isCanActivateChild(guard)\n ? guard.canActivateChild(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n return of(guardsMapped).pipe(prioritizedGuardValue());\n });\n });\n return of(canActivateChildGuardsMapped).pipe(prioritizedGuardValue());\n}\nfunction runCanDeactivate(component, currARS, currRSS, futureRSS, injector) {\n const canDeactivate = currARS && currARS.routeConfig ? currARS.routeConfig.canDeactivate : null;\n if (!canDeactivate || canDeactivate.length === 0)\n return of(true);\n const canDeactivateObservables = canDeactivate.map((c) => {\n const closestInjector = getClosestRouteInjector(currARS) ?? injector;\n const guard = getTokenOrFunctionIdentity(c, closestInjector);\n const guardVal = isCanDeactivate(guard)\n ? guard.canDeactivate(component, currARS, currRSS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(component, currARS, currRSS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n return of(canDeactivateObservables).pipe(prioritizedGuardValue());\n}\nfunction runCanLoadGuards(injector, route, segments, urlSerializer) {\n const canLoad = route.canLoad;\n if (canLoad === undefined || canLoad.length === 0) {\n return of(true);\n }\n const canLoadObservables = canLoad.map((injectionToken) => {\n const guard = getTokenOrFunctionIdentity(injectionToken, injector);\n const guardVal = isCanLoad(guard)\n ? guard.canLoad(route, segments)\n : runInInjectionContext(injector, () => guard(route, segments));\n return wrapIntoObservable(guardVal);\n });\n return of(canLoadObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));\n}\nfunction redirectIfUrlTree(urlSerializer) {\n return pipe(tap((result) => {\n if (typeof result === 'boolean')\n return;\n throw redirectingNavigationError(urlSerializer, result);\n }), map((result) => result === true));\n}\nfunction runCanMatchGuards(injector, route, segments, urlSerializer) {\n const canMatch = route.canMatch;\n if (!canMatch || canMatch.length === 0)\n return of(true);\n const canMatchObservables = canMatch.map((injectionToken) => {\n const guard = getTokenOrFunctionIdentity(injectionToken, injector);\n const guardVal = isCanMatch(guard)\n ? guard.canMatch(route, segments)\n : runInInjectionContext(injector, () => guard(route, segments));\n return wrapIntoObservable(guardVal);\n });\n return of(canMatchObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));\n}\n\nclass NoMatch {\n segmentGroup;\n constructor(segmentGroup) {\n this.segmentGroup = segmentGroup || null;\n }\n}\nclass AbsoluteRedirect extends Error {\n urlTree;\n constructor(urlTree) {\n super();\n this.urlTree = urlTree;\n }\n}\nfunction noMatch$1(segmentGroup) {\n return throwError(new NoMatch(segmentGroup));\n}\nfunction absoluteRedirect(newTree) {\n return throwError(new AbsoluteRedirect(newTree));\n}\nfunction namedOutletsRedirect(redirectTo) {\n return throwError(new ɵRuntimeError(4000 /* RuntimeErrorCode.NAMED_OUTLET_REDIRECT */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Only absolute redirects can have named outlets. redirectTo: '${redirectTo}'`));\n}\nfunction canLoadFails(route) {\n return throwError(navigationCancelingError((typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Cannot load children because the guard of the route \"path: '${route.path}'\" returned false`, NavigationCancellationCode.GuardRejected));\n}\nclass ApplyRedirects {\n urlSerializer;\n urlTree;\n constructor(urlSerializer, urlTree) {\n this.urlSerializer = urlSerializer;\n this.urlTree = urlTree;\n }\n lineralizeSegments(route, urlTree) {\n let res = [];\n let c = urlTree.root;\n while (true) {\n res = res.concat(c.segments);\n if (c.numberOfChildren === 0) {\n return of(res);\n }\n if (c.numberOfChildren > 1 || !c.children[PRIMARY_OUTLET]) {\n return namedOutletsRedirect(`${route.redirectTo}`);\n }\n c = c.children[PRIMARY_OUTLET];\n }\n }\n applyRedirectCommands(segments, redirectTo, posParams, currentSnapshot, injector) {\n if (typeof redirectTo !== 'string') {\n const redirectToFn = redirectTo;\n const { queryParams, fragment, routeConfig, url, outlet, params, data, title } = currentSnapshot;\n const newRedirect = runInInjectionContext(injector, () => redirectToFn({ params, data, queryParams, fragment, routeConfig, url, outlet, title }));\n if (newRedirect instanceof UrlTree) {\n throw new AbsoluteRedirect(newRedirect);\n }\n redirectTo = newRedirect;\n }\n const newTree = this.applyRedirectCreateUrlTree(redirectTo, this.urlSerializer.parse(redirectTo), segments, posParams);\n if (redirectTo[0] === '/') {\n throw new AbsoluteRedirect(newTree);\n }\n return newTree;\n }\n applyRedirectCreateUrlTree(redirectTo, urlTree, segments, posParams) {\n const newRoot = this.createSegmentGroup(redirectTo, urlTree.root, segments, posParams);\n return new UrlTree(newRoot, this.createQueryParams(urlTree.queryParams, this.urlTree.queryParams), urlTree.fragment);\n }\n createQueryParams(redirectToParams, actualParams) {\n const res = {};\n Object.entries(redirectToParams).forEach(([k, v]) => {\n const copySourceValue = typeof v === 'string' && v[0] === ':';\n if (copySourceValue) {\n const sourceName = v.substring(1);\n res[k] = actualParams[sourceName];\n }\n else {\n res[k] = v;\n }\n });\n return res;\n }\n createSegmentGroup(redirectTo, group, segments, posParams) {\n const updatedSegments = this.createSegments(redirectTo, group.segments, segments, posParams);\n let children = {};\n Object.entries(group.children).forEach(([name, child]) => {\n children[name] = this.createSegmentGroup(redirectTo, child, segments, posParams);\n });\n return new UrlSegmentGroup(updatedSegments, children);\n }\n createSegments(redirectTo, redirectToSegments, actualSegments, posParams) {\n return redirectToSegments.map((s) => s.path[0] === ':'\n ? this.findPosParam(redirectTo, s, posParams)\n : this.findOrReturn(s, actualSegments));\n }\n findPosParam(redirectTo, redirectToUrlSegment, posParams) {\n const pos = posParams[redirectToUrlSegment.path.substring(1)];\n if (!pos)\n throw new ɵRuntimeError(4001 /* RuntimeErrorCode.MISSING_REDIRECT */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Cannot redirect to '${redirectTo}'. Cannot find '${redirectToUrlSegment.path}'.`);\n return pos;\n }\n findOrReturn(redirectToUrlSegment, actualSegments) {\n let idx = 0;\n for (const s of actualSegments) {\n if (s.path === redirectToUrlSegment.path) {\n actualSegments.splice(idx);\n return s;\n }\n idx++;\n }\n return redirectToUrlSegment;\n }\n}\n\nconst noMatch = {\n matched: false,\n consumedSegments: [],\n remainingSegments: [],\n parameters: {},\n positionalParamSegments: {},\n};\nfunction matchWithChecks(segmentGroup, route, segments, injector, urlSerializer) {\n const result = match(segmentGroup, route, segments);\n if (!result.matched) {\n return of(result);\n }\n // Only create the Route's `EnvironmentInjector` if it matches the attempted\n // navigation\n injector = getOrCreateRouteInjectorIfNeeded(route, injector);\n return runCanMatchGuards(injector, route, segments, urlSerializer).pipe(map((v) => (v === true ? result : { ...noMatch })));\n}\nfunction match(segmentGroup, route, segments) {\n if (route.path === '**') {\n return createWildcardMatchResult(segments);\n }\n if (route.path === '') {\n if (route.pathMatch === 'full' && (segmentGroup.hasChildren() || segments.length > 0)) {\n return { ...noMatch };\n }\n return {\n matched: true,\n consumedSegments: [],\n remainingSegments: segments,\n parameters: {},\n positionalParamSegments: {},\n };\n }\n const matcher = route.matcher || defaultUrlMatcher;\n const res = matcher(segments, segmentGroup, route);\n if (!res)\n return { ...noMatch };\n const posParams = {};\n Object.entries(res.posParams ?? {}).forEach(([k, v]) => {\n posParams[k] = v.path;\n });\n const parameters = res.consumed.length > 0\n ? { ...posParams, ...res.consumed[res.consumed.length - 1].parameters }\n : posParams;\n return {\n matched: true,\n consumedSegments: res.consumed,\n remainingSegments: segments.slice(res.consumed.length),\n // TODO(atscott): investigate combining parameters and positionalParamSegments\n parameters,\n positionalParamSegments: res.posParams ?? {},\n };\n}\nfunction createWildcardMatchResult(segments) {\n return {\n matched: true,\n parameters: segments.length > 0 ? last(segments).parameters : {},\n consumedSegments: segments,\n remainingSegments: [],\n positionalParamSegments: {},\n };\n}\nfunction split(segmentGroup, consumedSegments, slicedSegments, config) {\n if (slicedSegments.length > 0 &&\n containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, config)) {\n const s = new UrlSegmentGroup(consumedSegments, createChildrenForEmptyPaths(config, new UrlSegmentGroup(slicedSegments, segmentGroup.children)));\n return { segmentGroup: s, slicedSegments: [] };\n }\n if (slicedSegments.length === 0 &&\n containsEmptyPathMatches(segmentGroup, slicedSegments, config)) {\n const s = new UrlSegmentGroup(segmentGroup.segments, addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, config, segmentGroup.children));\n return { segmentGroup: s, slicedSegments };\n }\n const s = new UrlSegmentGroup(segmentGroup.segments, segmentGroup.children);\n return { segmentGroup: s, slicedSegments };\n}\nfunction addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, routes, children) {\n const res = {};\n for (const r of routes) {\n if (emptyPathMatch(segmentGroup, slicedSegments, r) && !children[getOutlet(r)]) {\n const s = new UrlSegmentGroup([], {});\n res[getOutlet(r)] = s;\n }\n }\n return { ...children, ...res };\n}\nfunction createChildrenForEmptyPaths(routes, primarySegment) {\n const res = {};\n res[PRIMARY_OUTLET] = primarySegment;\n for (const r of routes) {\n if (r.path === '' && getOutlet(r) !== PRIMARY_OUTLET) {\n const s = new UrlSegmentGroup([], {});\n res[getOutlet(r)] = s;\n }\n }\n return res;\n}\nfunction containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, routes) {\n return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r) && getOutlet(r) !== PRIMARY_OUTLET);\n}\nfunction containsEmptyPathMatches(segmentGroup, slicedSegments, routes) {\n return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r));\n}\nfunction emptyPathMatch(segmentGroup, slicedSegments, r) {\n if ((segmentGroup.hasChildren() || slicedSegments.length > 0) && r.pathMatch === 'full') {\n return false;\n }\n return r.path === '';\n}\nfunction noLeftoversInUrl(segmentGroup, segments, outlet) {\n return segments.length === 0 && !segmentGroup.children[outlet];\n}\n\n/**\n * Class used to indicate there were no additional route config matches but that all segments of\n * the URL were consumed during matching so the route was URL matched. When this happens, we still\n * try to match child configs in case there are empty path children.\n */\nclass NoLeftoversInUrl {\n}\nfunction recognize$1(injector, configLoader, rootComponentType, config, urlTree, urlSerializer, paramsInheritanceStrategy = 'emptyOnly') {\n return new Recognizer(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer).recognize();\n}\nconst MAX_ALLOWED_REDIRECTS = 31;\nclass Recognizer {\n injector;\n configLoader;\n rootComponentType;\n config;\n urlTree;\n paramsInheritanceStrategy;\n urlSerializer;\n applyRedirects;\n absoluteRedirectCount = 0;\n allowRedirects = true;\n constructor(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer) {\n this.injector = injector;\n this.configLoader = configLoader;\n this.rootComponentType = rootComponentType;\n this.config = config;\n this.urlTree = urlTree;\n this.paramsInheritanceStrategy = paramsInheritanceStrategy;\n this.urlSerializer = urlSerializer;\n this.applyRedirects = new ApplyRedirects(this.urlSerializer, this.urlTree);\n }\n noMatchError(e) {\n return new ɵRuntimeError(4002 /* RuntimeErrorCode.NO_MATCH */, typeof ngDevMode === 'undefined' || ngDevMode\n ? `Cannot match any routes. URL Segment: '${e.segmentGroup}'`\n : `'${e.segmentGroup}'`);\n }\n recognize() {\n const rootSegmentGroup = split(this.urlTree.root, [], [], this.config).segmentGroup;\n return this.match(rootSegmentGroup).pipe(map(({ children, rootSnapshot }) => {\n const rootNode = new TreeNode(rootSnapshot, children);\n const routeState = new RouterStateSnapshot('', rootNode);\n const tree = createUrlTreeFromSnapshot(rootSnapshot, [], this.urlTree.queryParams, this.urlTree.fragment);\n // https://github.com/angular/angular/issues/47307\n // Creating the tree stringifies the query params\n // We don't want to do this here so reassign them to the original.\n tree.queryParams = this.urlTree.queryParams;\n routeState.url = this.urlSerializer.serialize(tree);\n return { state: routeState, tree };\n }));\n }\n match(rootSegmentGroup) {\n // Use Object.freeze to prevent readers of the Router state from modifying it outside\n // of a navigation, resulting in the router being out of sync with the browser.\n const rootSnapshot = new ActivatedRouteSnapshot([], Object.freeze({}), Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, Object.freeze({}), PRIMARY_OUTLET, this.rootComponentType, null, {});\n return this.processSegmentGroup(this.injector, this.config, rootSegmentGroup, PRIMARY_OUTLET, rootSnapshot).pipe(map((children) => {\n return { children, rootSnapshot };\n }), catchError((e) => {\n if (e instanceof AbsoluteRedirect) {\n this.urlTree = e.urlTree;\n return this.match(e.urlTree.root);\n }\n if (e instanceof NoMatch) {\n throw this.noMatchError(e);\n }\n throw e;\n }));\n }\n processSegmentGroup(injector, config, segmentGroup, outlet, parentRoute) {\n if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {\n return this.processChildren(injector, config, segmentGroup, parentRoute);\n }\n return this.processSegment(injector, config, segmentGroup, segmentGroup.segments, outlet, true, parentRoute).pipe(map((child) => (child instanceof TreeNode ? [child] : [])));\n }\n /**\n * Matches every child outlet in the `segmentGroup` to a `Route` in the config. Returns `null` if\n * we cannot find a match for _any_ of the children.\n *\n * @param config - The `Routes` to match against\n * @param segmentGroup - The `UrlSegmentGroup` whose children need to be matched against the\n * config.\n */\n processChildren(injector, config, segmentGroup, parentRoute) {\n // Expand outlets one at a time, starting with the primary outlet. We need to do it this way\n // because an absolute redirect from the primary outlet takes precedence.\n const childOutlets = [];\n for (const child of Object.keys(segmentGroup.children)) {\n if (child === 'primary') {\n childOutlets.unshift(child);\n }\n else {\n childOutlets.push(child);\n }\n }\n return from(childOutlets).pipe(concatMap((childOutlet) => {\n const child = segmentGroup.children[childOutlet];\n // Sort the config so that routes with outlets that match the one being activated\n // appear first, followed by routes for other outlets, which might match if they have\n // an empty path.\n const sortedConfig = sortByMatchingOutlets(config, childOutlet);\n return this.processSegmentGroup(injector, sortedConfig, child, childOutlet, parentRoute);\n }), scan((children, outletChildren) => {\n children.push(...outletChildren);\n return children;\n }), defaultIfEmpty(null), last$1(), mergeMap((children) => {\n if (children === null)\n return noMatch$1(segmentGroup);\n // Because we may have matched two outlets to the same empty path segment, we can have\n // multiple activated results for the same outlet. We should merge the children of\n // these results so the final return value is only one `TreeNode` per outlet.\n const mergedChildren = mergeEmptyPathMatches(children);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n // This should really never happen - we are only taking the first match for each\n // outlet and merge the empty path matches.\n checkOutletNameUniqueness(mergedChildren);\n }\n sortActivatedRouteSnapshots(mergedChildren);\n return of(mergedChildren);\n }));\n }\n processSegment(injector, routes, segmentGroup, segments, outlet, allowRedirects, parentRoute) {\n return from(routes).pipe(concatMap((r) => {\n return this.processSegmentAgainstRoute(r._injector ?? injector, routes, r, segmentGroup, segments, outlet, allowRedirects, parentRoute).pipe(catchError((e) => {\n if (e instanceof NoMatch) {\n return of(null);\n }\n throw e;\n }));\n }), first((x) => !!x), catchError((e) => {\n if (isEmptyError(e)) {\n if (noLeftoversInUrl(segmentGroup, segments, outlet)) {\n return of(new NoLeftoversInUrl());\n }\n return noMatch$1(segmentGroup);\n }\n throw e;\n }));\n }\n processSegmentAgainstRoute(injector, routes, route, rawSegment, segments, outlet, allowRedirects, parentRoute) {\n // We allow matches to empty paths when the outlets differ so we can match a url like `/(b:b)` to\n // a config like\n // * `{path: '', children: [{path: 'b', outlet: 'b'}]}`\n // or even\n // * `{path: '', outlet: 'a', children: [{path: 'b', outlet: 'b'}]`\n //\n // The exception here is when the segment outlet is for the primary outlet. This would\n // result in a match inside the named outlet because all children there are written as primary\n // outlets. So we need to prevent child named outlet matches in a url like `/b` in a config like\n // * `{path: '', outlet: 'x' children: [{path: 'b'}]}`\n // This should only match if the url is `/(x:b)`.\n if (getOutlet(route) !== outlet &&\n (outlet === PRIMARY_OUTLET || !emptyPathMatch(rawSegment, segments, route))) {\n return noMatch$1(rawSegment);\n }\n if (route.redirectTo === undefined) {\n return this.matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute);\n }\n if (this.allowRedirects && allowRedirects) {\n return this.expandSegmentAgainstRouteUsingRedirect(injector, rawSegment, routes, route, segments, outlet, parentRoute);\n }\n return noMatch$1(rawSegment);\n }\n expandSegmentAgainstRouteUsingRedirect(injector, segmentGroup, routes, route, segments, outlet, parentRoute) {\n const { matched, parameters, consumedSegments, positionalParamSegments, remainingSegments } = match(segmentGroup, route, segments);\n if (!matched)\n return noMatch$1(segmentGroup);\n // TODO(atscott): Move all of this under an if(ngDevMode) as a breaking change and allow stack\n // size exceeded in production\n if (typeof route.redirectTo === 'string' && route.redirectTo[0] === '/') {\n this.absoluteRedirectCount++;\n if (this.absoluteRedirectCount > MAX_ALLOWED_REDIRECTS) {\n if (ngDevMode) {\n throw new ɵRuntimeError(4016 /* RuntimeErrorCode.INFINITE_REDIRECT */, `Detected possible infinite redirect when redirecting from '${this.urlTree}' to '${route.redirectTo}'.\\n` +\n `This is currently a dev mode only error but will become a` +\n ` call stack size exceeded error in production in a future major version.`);\n }\n this.allowRedirects = false;\n }\n }\n const currentSnapshot = new ActivatedRouteSnapshot(segments, parameters, Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));\n const inherited = getInherited(currentSnapshot, parentRoute, this.paramsInheritanceStrategy);\n currentSnapshot.params = Object.freeze(inherited.params);\n currentSnapshot.data = Object.freeze(inherited.data);\n const newTree = this.applyRedirects.applyRedirectCommands(consumedSegments, route.redirectTo, positionalParamSegments, currentSnapshot, injector);\n return this.applyRedirects.lineralizeSegments(route, newTree).pipe(mergeMap((newSegments) => {\n return this.processSegment(injector, routes, segmentGroup, newSegments.concat(remainingSegments), outlet, false, parentRoute);\n }));\n }\n matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute) {\n const matchResult = matchWithChecks(rawSegment, route, segments, injector, this.urlSerializer);\n if (route.path === '**') {\n // Prior versions of the route matching algorithm would stop matching at the wildcard route.\n // We should investigate a better strategy for any existing children. Otherwise, these\n // child segments are silently dropped from the navigation.\n // https://github.com/angular/angular/issues/40089\n rawSegment.children = {};\n }\n return matchResult.pipe(switchMap((result) => {\n if (!result.matched) {\n return noMatch$1(rawSegment);\n }\n // If the route has an injector created from providers, we should start using that.\n injector = route._injector ?? injector;\n return this.getChildConfig(injector, route, segments).pipe(switchMap(({ routes: childConfig }) => {\n const childInjector = route._loadedInjector ?? injector;\n const { parameters, consumedSegments, remainingSegments } = result;\n const snapshot = new ActivatedRouteSnapshot(consumedSegments, parameters, Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));\n const inherited = getInherited(snapshot, parentRoute, this.paramsInheritanceStrategy);\n snapshot.params = Object.freeze(inherited.params);\n snapshot.data = Object.freeze(inherited.data);\n const { segmentGroup, slicedSegments } = split(rawSegment, consumedSegments, remainingSegments, childConfig);\n if (slicedSegments.length === 0 && segmentGroup.hasChildren()) {\n return this.processChildren(childInjector, childConfig, segmentGroup, snapshot).pipe(map((children) => {\n return new TreeNode(snapshot, children);\n }));\n }\n if (childConfig.length === 0 && slicedSegments.length === 0) {\n return of(new TreeNode(snapshot, []));\n }\n const matchedOnOutlet = getOutlet(route) === outlet;\n // If we matched a config due to empty path match on a different outlet, we need to\n // continue passing the current outlet for the segment rather than switch to PRIMARY.\n // Note that we switch to primary when we have a match because outlet configs look like\n // this: {path: 'a', outlet: 'a', children: [\n // {path: 'b', component: B},\n // {path: 'c', component: C},\n // ]}\n // Notice that the children of the named outlet are configured with the primary outlet\n return this.processSegment(childInjector, childConfig, segmentGroup, slicedSegments, matchedOnOutlet ? PRIMARY_OUTLET : outlet, true, snapshot).pipe(map((child) => {\n return new TreeNode(snapshot, child instanceof TreeNode ? [child] : []);\n }));\n }));\n }));\n }\n getChildConfig(injector, route, segments) {\n if (route.children) {\n // The children belong to the same module\n return of({ routes: route.children, injector });\n }\n if (route.loadChildren) {\n // lazy children belong to the loaded module\n if (route._loadedRoutes !== undefined) {\n return of({ routes: route._loadedRoutes, injector: route._loadedInjector });\n }\n return runCanLoadGuards(injector, route, segments, this.urlSerializer).pipe(mergeMap((shouldLoadResult) => {\n if (shouldLoadResult) {\n return this.configLoader.loadChildren(injector, route).pipe(tap((cfg) => {\n route._loadedRoutes = cfg.routes;\n route._loadedInjector = cfg.injector;\n }));\n }\n return canLoadFails(route);\n }));\n }\n return of({ routes: [], injector });\n }\n}\nfunction sortActivatedRouteSnapshots(nodes) {\n nodes.sort((a, b) => {\n if (a.value.outlet === PRIMARY_OUTLET)\n return -1;\n if (b.value.outlet === PRIMARY_OUTLET)\n return 1;\n return a.value.outlet.localeCompare(b.value.outlet);\n });\n}\nfunction hasEmptyPathConfig(node) {\n const config = node.value.routeConfig;\n return config && config.path === '';\n}\n/**\n * Finds `TreeNode`s with matching empty path route configs and merges them into `TreeNode` with\n * the children from each duplicate. This is necessary because different outlets can match a\n * single empty path route config and the results need to then be merged.\n */\nfunction mergeEmptyPathMatches(nodes) {\n const result = [];\n // The set of nodes which contain children that were merged from two duplicate empty path nodes.\n const mergedNodes = new Set();\n for (const node of nodes) {\n if (!hasEmptyPathConfig(node)) {\n result.push(node);\n continue;\n }\n const duplicateEmptyPathNode = result.find((resultNode) => node.value.routeConfig === resultNode.value.routeConfig);\n if (duplicateEmptyPathNode !== undefined) {\n duplicateEmptyPathNode.children.push(...node.children);\n mergedNodes.add(duplicateEmptyPathNode);\n }\n else {\n result.push(node);\n }\n }\n // For each node which has children from multiple sources, we need to recompute a new `TreeNode`\n // by also merging those children. This is necessary when there are multiple empty path configs\n // in a row. Put another way: whenever we combine children of two nodes, we need to also check\n // if any of those children can be combined into a single node as well.\n for (const mergedNode of mergedNodes) {\n const mergedChildren = mergeEmptyPathMatches(mergedNode.children);\n result.push(new TreeNode(mergedNode.value, mergedChildren));\n }\n return result.filter((n) => !mergedNodes.has(n));\n}\nfunction checkOutletNameUniqueness(nodes) {\n const names = {};\n nodes.forEach((n) => {\n const routeWithSameOutletName = names[n.value.outlet];\n if (routeWithSameOutletName) {\n const p = routeWithSameOutletName.url.map((s) => s.toString()).join('/');\n const c = n.value.url.map((s) => s.toString()).join('/');\n throw new ɵRuntimeError(4006 /* RuntimeErrorCode.TWO_SEGMENTS_WITH_SAME_OUTLET */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Two segments cannot have the same outlet name: '${p}' and '${c}'.`);\n }\n names[n.value.outlet] = n.value;\n });\n}\nfunction getData(route) {\n return route.data || {};\n}\nfunction getResolve(route) {\n return route.resolve || {};\n}\n\nfunction recognize(injector, configLoader, rootComponentType, config, serializer, paramsInheritanceStrategy) {\n return mergeMap((t) => recognize$1(injector, configLoader, rootComponentType, config, t.extractedUrl, serializer, paramsInheritanceStrategy).pipe(map(({ state: targetSnapshot, tree: urlAfterRedirects }) => {\n return { ...t, targetSnapshot, urlAfterRedirects };\n })));\n}\n\nfunction resolveData(paramsInheritanceStrategy, injector) {\n return mergeMap((t) => {\n const { targetSnapshot, guards: { canActivateChecks }, } = t;\n if (!canActivateChecks.length) {\n return of(t);\n }\n // Iterating a Set in javascript happens in insertion order so it is safe to use a `Set` to\n // preserve the correct order that the resolvers should run in.\n // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Set#description\n const routesWithResolversToRun = new Set(canActivateChecks.map((check) => check.route));\n const routesNeedingDataUpdates = new Set();\n for (const route of routesWithResolversToRun) {\n if (routesNeedingDataUpdates.has(route)) {\n continue;\n }\n // All children under the route with a resolver to run need to recompute inherited data.\n for (const newRoute of flattenRouteTree(route)) {\n routesNeedingDataUpdates.add(newRoute);\n }\n }\n let routesProcessed = 0;\n return from(routesNeedingDataUpdates).pipe(concatMap((route) => {\n if (routesWithResolversToRun.has(route)) {\n return runResolve(route, targetSnapshot, paramsInheritanceStrategy, injector);\n }\n else {\n route.data = getInherited(route, route.parent, paramsInheritanceStrategy).resolve;\n return of(void 0);\n }\n }), tap(() => routesProcessed++), takeLast(1), mergeMap((_) => (routesProcessed === routesNeedingDataUpdates.size ? of(t) : EMPTY)));\n });\n}\n/**\n * Returns the `ActivatedRouteSnapshot` tree as an array, using DFS to traverse the route tree.\n */\nfunction flattenRouteTree(route) {\n const descendants = route.children.map((child) => flattenRouteTree(child)).flat();\n return [route, ...descendants];\n}\nfunction runResolve(futureARS, futureRSS, paramsInheritanceStrategy, injector) {\n const config = futureARS.routeConfig;\n const resolve = futureARS._resolve;\n if (config?.title !== undefined && !hasStaticTitle(config)) {\n resolve[RouteTitleKey] = config.title;\n }\n return resolveNode(resolve, futureARS, futureRSS, injector).pipe(map((resolvedData) => {\n futureARS._resolvedData = resolvedData;\n futureARS.data = getInherited(futureARS, futureARS.parent, paramsInheritanceStrategy).resolve;\n return null;\n }));\n}\nfunction resolveNode(resolve, futureARS, futureRSS, injector) {\n const keys = getDataKeys(resolve);\n if (keys.length === 0) {\n return of({});\n }\n const data = {};\n return from(keys).pipe(mergeMap((key) => getResolver(resolve[key], futureARS, futureRSS, injector).pipe(first(), tap((value) => {\n if (value instanceof RedirectCommand) {\n throw redirectingNavigationError(new DefaultUrlSerializer(), value);\n }\n data[key] = value;\n }))), takeLast(1), map(() => data), catchError((e) => (isEmptyError(e) ? EMPTY : throwError(e))));\n}\nfunction getResolver(injectionToken, futureARS, futureRSS, injector) {\n const closestInjector = getClosestRouteInjector(futureARS) ?? injector;\n const resolver = getTokenOrFunctionIdentity(injectionToken, closestInjector);\n const resolverValue = resolver.resolve\n ? resolver.resolve(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => resolver(futureARS, futureRSS));\n return wrapIntoObservable(resolverValue);\n}\n\n/**\n * Perform a side effect through a switchMap for every emission on the source Observable,\n * but return an Observable that is identical to the source. It's essentially the same as\n * the `tap` operator, but if the side effectful `next` function returns an ObservableInput,\n * it will wait before continuing with the original value.\n */\nfunction switchTap(next) {\n return switchMap((v) => {\n const nextResult = next(v);\n if (nextResult) {\n return from(nextResult).pipe(map(() => v));\n }\n return of(v);\n });\n}\n\n/**\n * Provides a strategy for setting the page title after a router navigation.\n *\n * The built-in implementation traverses the router state snapshot and finds the deepest primary\n * outlet with `title` property. Given the `Routes` below, navigating to\n * `/base/child(popup:aux)` would result in the document title being set to \"child\".\n * ```ts\n * [\n * {path: 'base', title: 'base', children: [\n * {path: 'child', title: 'child'},\n * ],\n * {path: 'aux', outlet: 'popup', title: 'popupTitle'}\n * ]\n * ```\n *\n * This class can be used as a base class for custom title strategies. That is, you can create your\n * own class that extends the `TitleStrategy`. Note that in the above example, the `title`\n * from the named outlet is never used. However, a custom strategy might be implemented to\n * incorporate titles in named outlets.\n *\n * @publicApi\n * @see [Page title guide](guide/routing/common-router-tasks#setting-the-page-title)\n */\nclass TitleStrategy {\n /**\n * @returns The `title` of the deepest primary route.\n */\n buildTitle(snapshot) {\n let pageTitle;\n let route = snapshot.root;\n while (route !== undefined) {\n pageTitle = this.getResolvedTitleForRoute(route) ?? pageTitle;\n route = route.children.find((child) => child.outlet === PRIMARY_OUTLET);\n }\n return pageTitle;\n }\n /**\n * Given an `ActivatedRouteSnapshot`, returns the final value of the\n * `Route.title` property, which can either be a static string or a resolved value.\n */\n getResolvedTitleForRoute(snapshot) {\n return snapshot.data[RouteTitleKey];\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, providedIn: 'root', useFactory: () => inject(DefaultTitleStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(DefaultTitleStrategy) }]\n }] });\n/**\n * The default `TitleStrategy` used by the router that updates the title using the `Title` service.\n */\nclass DefaultTitleStrategy extends TitleStrategy {\n title;\n constructor(title) {\n super();\n this.title = title;\n }\n /**\n * Sets the title of the browser to the given value.\n *\n * @param title The `pageTitle` from the deepest primary route.\n */\n updateTitle(snapshot) {\n const title = this.buildTitle(snapshot);\n if (title !== undefined) {\n this.title.setTitle(title);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, deps: [{ token: i1.Title }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Title }] });\n\n/**\n * A DI token for the router service.\n *\n * @publicApi\n */\nconst ROUTER_CONFIGURATION = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router config' : '', {\n providedIn: 'root',\n factory: () => ({}),\n});\n\n/**\n * This component is used internally within the router to be a placeholder when an empty\n * router-outlet is needed. For example, with a config such as:\n *\n * `{path: 'parent', outlet: 'nav', children: [...]}`\n *\n * In order to render, there needs to be a component on this config, which will default\n * to this `EmptyOutletComponent`.\n */\nclass ɵEmptyOutletComponent {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ɵEmptyOutletComponent, deps: [], target: i0.ɵɵFactoryTarget.Component });\n static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"19.2.1\", type: ɵEmptyOutletComponent, isStandalone: true, selector: \"ng-component\", exportAs: [\"emptyRouterOutlet\"], ngImport: i0, template: ` `, isInline: true, dependencies: [{ kind: \"directive\", type: RouterOutlet, selector: \"router-outlet\", inputs: [\"name\", \"routerOutletData\"], outputs: [\"activate\", \"deactivate\", \"attach\", \"detach\"], exportAs: [\"outlet\"] }] });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ɵEmptyOutletComponent, decorators: [{\n type: Component,\n args: [{\n template: ` `,\n imports: [RouterOutlet],\n // Used to avoid component ID collisions with user code.\n exportAs: 'emptyRouterOutlet',\n }]\n }] });\n/**\n * Makes a copy of the config and adds any default required properties.\n */\nfunction standardizeConfig(r) {\n const children = r.children && r.children.map(standardizeConfig);\n const c = children ? { ...r, children } : { ...r };\n if (!c.component &&\n !c.loadComponent &&\n (children || c.loadChildren) &&\n c.outlet &&\n c.outlet !== PRIMARY_OUTLET) {\n c.component = ɵEmptyOutletComponent;\n }\n return c;\n}\n\n/**\n * The DI token for a router configuration.\n *\n * `ROUTES` is a low level API for router configuration via dependency injection.\n *\n * We recommend that in almost all cases to use higher level APIs such as `RouterModule.forRoot()`,\n * `provideRouter`, or `Router.resetConfig()`.\n *\n * @publicApi\n */\nconst ROUTES = new InjectionToken(ngDevMode ? 'ROUTES' : '');\nclass RouterConfigLoader {\n componentLoaders = new WeakMap();\n childrenLoaders = new WeakMap();\n onLoadStartListener;\n onLoadEndListener;\n compiler = inject(Compiler);\n loadComponent(route) {\n if (this.componentLoaders.get(route)) {\n return this.componentLoaders.get(route);\n }\n else if (route._loadedComponent) {\n return of(route._loadedComponent);\n }\n if (this.onLoadStartListener) {\n this.onLoadStartListener(route);\n }\n const loadRunner = wrapIntoObservable(route.loadComponent()).pipe(map(maybeUnwrapDefaultExport), tap((component) => {\n if (this.onLoadEndListener) {\n this.onLoadEndListener(route);\n }\n (typeof ngDevMode === 'undefined' || ngDevMode) &&\n assertStandalone(route.path ?? '', component);\n route._loadedComponent = component;\n }), finalize(() => {\n this.componentLoaders.delete(route);\n }));\n // Use custom ConnectableObservable as share in runners pipe increasing the bundle size too much\n const loader = new ConnectableObservable(loadRunner, () => new Subject()).pipe(refCount());\n this.componentLoaders.set(route, loader);\n return loader;\n }\n loadChildren(parentInjector, route) {\n if (this.childrenLoaders.get(route)) {\n return this.childrenLoaders.get(route);\n }\n else if (route._loadedRoutes) {\n return of({ routes: route._loadedRoutes, injector: route._loadedInjector });\n }\n if (this.onLoadStartListener) {\n this.onLoadStartListener(route);\n }\n const moduleFactoryOrRoutes$ = loadChildren(route, this.compiler, parentInjector, this.onLoadEndListener);\n const loadRunner = moduleFactoryOrRoutes$.pipe(finalize(() => {\n this.childrenLoaders.delete(route);\n }));\n // Use custom ConnectableObservable as share in runners pipe increasing the bundle size too much\n const loader = new ConnectableObservable(loadRunner, () => new Subject()).pipe(refCount());\n this.childrenLoaders.set(route, loader);\n return loader;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterConfigLoader, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterConfigLoader, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterConfigLoader, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/**\n * Executes a `route.loadChildren` callback and converts the result to an array of child routes and\n * an injector if that callback returned a module.\n *\n * This function is used for the route discovery during prerendering\n * in @angular-devkit/build-angular. If there are any updates to the contract here, it will require\n * an update to the extractor.\n */\nfunction loadChildren(route, compiler, parentInjector, onLoadEndListener) {\n return wrapIntoObservable(route.loadChildren()).pipe(map(maybeUnwrapDefaultExport), mergeMap((t) => {\n if (t instanceof NgModuleFactory || Array.isArray(t)) {\n return of(t);\n }\n else {\n return from(compiler.compileModuleAsync(t));\n }\n }), map((factoryOrRoutes) => {\n if (onLoadEndListener) {\n onLoadEndListener(route);\n }\n // This injector comes from the `NgModuleRef` when lazy loading an `NgModule`. There is\n // no injector associated with lazy loading a `Route` array.\n let injector;\n let rawRoutes;\n let requireStandaloneComponents = false;\n if (Array.isArray(factoryOrRoutes)) {\n rawRoutes = factoryOrRoutes;\n requireStandaloneComponents = true;\n }\n else {\n injector = factoryOrRoutes.create(parentInjector).injector;\n // When loading a module that doesn't provide `RouterModule.forChild()` preloader\n // will get stuck in an infinite loop. The child module's Injector will look to\n // its parent `Injector` when it doesn't find any ROUTES so it will return routes\n // for it's parent module instead.\n rawRoutes = injector.get(ROUTES, [], { optional: true, self: true }).flat();\n }\n const routes = rawRoutes.map(standardizeConfig);\n (typeof ngDevMode === 'undefined' || ngDevMode) &&\n validateConfig(routes, route.path, requireStandaloneComponents);\n return { routes, injector };\n }));\n}\nfunction isWrappedDefaultExport(value) {\n // We use `in` here with a string key `'default'`, because we expect `DefaultExport` objects to be\n // dynamically imported ES modules with a spec-mandated `default` key. Thus we don't expect that\n // `default` will be a renamed property.\n return value && typeof value === 'object' && 'default' in value;\n}\nfunction maybeUnwrapDefaultExport(input) {\n // As per `isWrappedDefaultExport`, the `default` key here is generated by the browser and not\n // subject to property renaming, so we reference it with bracket access.\n return isWrappedDefaultExport(input) ? input['default'] : input;\n}\n\n/**\n * @description\n *\n * Provides a way to migrate AngularJS applications to Angular.\n *\n * @publicApi\n */\nclass UrlHandlingStrategy {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlHandlingStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlHandlingStrategy, providedIn: 'root', useFactory: () => inject(DefaultUrlHandlingStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlHandlingStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(DefaultUrlHandlingStrategy) }]\n }] });\n/**\n * @publicApi\n */\nclass DefaultUrlHandlingStrategy {\n shouldProcessUrl(url) {\n return true;\n }\n extract(url) {\n return url;\n }\n merge(newUrlPart, wholeUrl) {\n return newUrlPart;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultUrlHandlingStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultUrlHandlingStrategy, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultUrlHandlingStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/// \nconst CREATE_VIEW_TRANSITION = new InjectionToken(ngDevMode ? 'view transition helper' : '');\nconst VIEW_TRANSITION_OPTIONS = new InjectionToken(ngDevMode ? 'view transition options' : '');\n/**\n * A helper function for using browser view transitions. This function skips the call to\n * `startViewTransition` if the browser does not support it.\n *\n * @returns A Promise that resolves when the view transition callback begins.\n */\nfunction createViewTransition(injector, from, to) {\n const transitionOptions = injector.get(VIEW_TRANSITION_OPTIONS);\n const document = injector.get(DOCUMENT);\n // Create promises outside the Angular zone to avoid causing extra change detections\n return injector.get(NgZone).runOutsideAngular(() => {\n if (!document.startViewTransition || transitionOptions.skipNextTransition) {\n transitionOptions.skipNextTransition = false;\n // The timing of `startViewTransition` is closer to a macrotask. It won't be called\n // until the current event loop exits so we use a promise resolved in a timeout instead\n // of Promise.resolve().\n return new Promise((resolve) => setTimeout(resolve));\n }\n let resolveViewTransitionStarted;\n const viewTransitionStarted = new Promise((resolve) => {\n resolveViewTransitionStarted = resolve;\n });\n const transition = document.startViewTransition(() => {\n resolveViewTransitionStarted();\n // We don't actually update dom within the transition callback. The resolving of the above\n // promise unblocks the Router navigation, which synchronously activates and deactivates\n // routes (the DOM update). This view transition waits for the next change detection to\n // complete (below), which includes the update phase of the routed components.\n return createRenderPromise(injector);\n });\n const { onViewTransitionCreated } = transitionOptions;\n if (onViewTransitionCreated) {\n runInInjectionContext(injector, () => onViewTransitionCreated({ transition, from, to }));\n }\n return viewTransitionStarted;\n });\n}\n/**\n * Creates a promise that resolves after next render.\n */\nfunction createRenderPromise(injector) {\n return new Promise((resolve) => {\n // Wait for the microtask queue to empty after the next render happens (by waiting a macrotask).\n // This ensures any follow-up renders in the microtask queue are completed before the\n // view transition starts animating.\n afterNextRender({ read: () => setTimeout(resolve) }, { injector });\n });\n}\n\nconst NAVIGATION_ERROR_HANDLER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'navigation error handler' : '');\nclass NavigationTransitions {\n currentNavigation = null;\n currentTransition = null;\n lastSuccessfulNavigation = null;\n /**\n * These events are used to communicate back to the Router about the state of the transition. The\n * Router wants to respond to these events in various ways. Because the `NavigationTransition`\n * class is not public, this event subject is not publicly exposed.\n */\n events = new Subject();\n /**\n * Used to abort the current transition with an error.\n */\n transitionAbortSubject = new Subject();\n configLoader = inject(RouterConfigLoader);\n environmentInjector = inject(EnvironmentInjector);\n destroyRef = inject(DestroyRef);\n urlSerializer = inject(UrlSerializer);\n rootContexts = inject(ChildrenOutletContexts);\n location = inject(Location);\n inputBindingEnabled = inject(INPUT_BINDER, { optional: true }) !== null;\n titleStrategy = inject(TitleStrategy);\n options = inject(ROUTER_CONFIGURATION, { optional: true }) || {};\n paramsInheritanceStrategy = this.options.paramsInheritanceStrategy || 'emptyOnly';\n urlHandlingStrategy = inject(UrlHandlingStrategy);\n createViewTransition = inject(CREATE_VIEW_TRANSITION, { optional: true });\n navigationErrorHandler = inject(NAVIGATION_ERROR_HANDLER, { optional: true });\n navigationId = 0;\n get hasRequestedNavigation() {\n return this.navigationId !== 0;\n }\n transitions;\n /**\n * Hook that enables you to pause navigation after the preactivation phase.\n * Used by `RouterModule`.\n *\n * @internal\n */\n afterPreactivation = () => of(void 0);\n /** @internal */\n rootComponentType = null;\n destroyed = false;\n constructor() {\n const onLoadStart = (r) => this.events.next(new RouteConfigLoadStart(r));\n const onLoadEnd = (r) => this.events.next(new RouteConfigLoadEnd(r));\n this.configLoader.onLoadEndListener = onLoadEnd;\n this.configLoader.onLoadStartListener = onLoadStart;\n this.destroyRef.onDestroy(() => {\n this.destroyed = true;\n });\n }\n complete() {\n this.transitions?.complete();\n }\n handleNavigationRequest(request) {\n const id = ++this.navigationId;\n this.transitions?.next({ ...this.transitions.value, ...request, id });\n }\n setupNavigations(router, initialUrlTree, initialRouterState) {\n this.transitions = new BehaviorSubject({\n id: 0,\n currentUrlTree: initialUrlTree,\n currentRawUrl: initialUrlTree,\n extractedUrl: this.urlHandlingStrategy.extract(initialUrlTree),\n urlAfterRedirects: this.urlHandlingStrategy.extract(initialUrlTree),\n rawUrl: initialUrlTree,\n extras: {},\n resolve: () => { },\n reject: () => { },\n promise: Promise.resolve(true),\n source: IMPERATIVE_NAVIGATION,\n restoredState: null,\n currentSnapshot: initialRouterState.snapshot,\n targetSnapshot: null,\n currentRouterState: initialRouterState,\n targetRouterState: null,\n guards: { canActivateChecks: [], canDeactivateChecks: [] },\n guardsResult: null,\n });\n return this.transitions.pipe(filter((t) => t.id !== 0), \n // Extract URL\n map((t) => ({\n ...t,\n extractedUrl: this.urlHandlingStrategy.extract(t.rawUrl),\n })), \n // Using switchMap so we cancel executing navigations when a new one comes in\n switchMap((overallTransitionState) => {\n let completed = false;\n let errored = false;\n return of(overallTransitionState).pipe(switchMap((t) => {\n // It is possible that `switchMap` fails to cancel previous navigations if a new one happens synchronously while the operator\n // is processing the `next` notification of that previous navigation. This can happen when a new navigation (say 2) cancels a\n // previous one (1) and yet another navigation (3) happens synchronously in response to the `NavigationCancel` event for (1).\n // https://github.com/ReactiveX/rxjs/issues/7455\n if (this.navigationId > overallTransitionState.id) {\n const cancellationReason = typeof ngDevMode === 'undefined' || ngDevMode\n ? `Navigation ID ${overallTransitionState.id} is not equal to the current navigation id ${this.navigationId}`\n : '';\n this.cancelNavigationTransition(overallTransitionState, cancellationReason, NavigationCancellationCode.SupersededByNewNavigation);\n return EMPTY;\n }\n this.currentTransition = overallTransitionState;\n // Store the Navigation object\n this.currentNavigation = {\n id: t.id,\n initialUrl: t.rawUrl,\n extractedUrl: t.extractedUrl,\n targetBrowserUrl: typeof t.extras.browserUrl === 'string'\n ? this.urlSerializer.parse(t.extras.browserUrl)\n : t.extras.browserUrl,\n trigger: t.source,\n extras: t.extras,\n previousNavigation: !this.lastSuccessfulNavigation\n ? null\n : {\n ...this.lastSuccessfulNavigation,\n previousNavigation: null,\n },\n };\n const urlTransition = !router.navigated || this.isUpdatingInternalState() || this.isUpdatedBrowserUrl();\n const onSameUrlNavigation = t.extras.onSameUrlNavigation ?? router.onSameUrlNavigation;\n if (!urlTransition && onSameUrlNavigation !== 'reload') {\n const reason = typeof ngDevMode === 'undefined' || ngDevMode\n ? `Navigation to ${t.rawUrl} was ignored because it is the same as the current Router URL.`\n : '';\n this.events.next(new NavigationSkipped(t.id, this.urlSerializer.serialize(t.rawUrl), reason, NavigationSkippedCode.IgnoredSameUrlNavigation));\n t.resolve(false);\n return EMPTY;\n }\n if (this.urlHandlingStrategy.shouldProcessUrl(t.rawUrl)) {\n return of(t).pipe(\n // Fire NavigationStart event\n switchMap((t) => {\n const transition = this.transitions?.getValue();\n this.events.next(new NavigationStart(t.id, this.urlSerializer.serialize(t.extractedUrl), t.source, t.restoredState));\n if (transition !== this.transitions?.getValue()) {\n return EMPTY;\n }\n // This delay is required to match old behavior that forced\n // navigation to always be async\n return Promise.resolve(t);\n }), \n // Recognize\n recognize(this.environmentInjector, this.configLoader, this.rootComponentType, router.config, this.urlSerializer, this.paramsInheritanceStrategy), \n // Update URL if in `eager` update mode\n tap((t) => {\n overallTransitionState.targetSnapshot = t.targetSnapshot;\n overallTransitionState.urlAfterRedirects = t.urlAfterRedirects;\n this.currentNavigation = {\n ...this.currentNavigation,\n finalUrl: t.urlAfterRedirects,\n };\n // Fire RoutesRecognized\n const routesRecognized = new RoutesRecognized(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot);\n this.events.next(routesRecognized);\n }));\n }\n else if (urlTransition &&\n this.urlHandlingStrategy.shouldProcessUrl(t.currentRawUrl)) {\n /* When the current URL shouldn't be processed, but the previous one\n * was, we handle this \"error condition\" by navigating to the\n * previously successful URL, but leaving the URL intact.*/\n const { id, extractedUrl, source, restoredState, extras } = t;\n const navStart = new NavigationStart(id, this.urlSerializer.serialize(extractedUrl), source, restoredState);\n this.events.next(navStart);\n const targetSnapshot = createEmptyState(this.rootComponentType).snapshot;\n this.currentTransition = overallTransitionState = {\n ...t,\n targetSnapshot,\n urlAfterRedirects: extractedUrl,\n extras: { ...extras, skipLocationChange: false, replaceUrl: false },\n };\n this.currentNavigation.finalUrl = extractedUrl;\n return of(overallTransitionState);\n }\n else {\n /* When neither the current or previous URL can be processed, do\n * nothing other than update router's internal reference to the\n * current \"settled\" URL. This way the next navigation will be coming\n * from the current URL in the browser.\n */\n const reason = typeof ngDevMode === 'undefined' || ngDevMode\n ? `Navigation was ignored because the UrlHandlingStrategy` +\n ` indicated neither the current URL ${t.currentRawUrl} nor target URL ${t.rawUrl} should be processed.`\n : '';\n this.events.next(new NavigationSkipped(t.id, this.urlSerializer.serialize(t.extractedUrl), reason, NavigationSkippedCode.IgnoredByUrlHandlingStrategy));\n t.resolve(false);\n return EMPTY;\n }\n }), \n // --- GUARDS ---\n tap((t) => {\n const guardsStart = new GuardsCheckStart(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot);\n this.events.next(guardsStart);\n }), map((t) => {\n this.currentTransition = overallTransitionState = {\n ...t,\n guards: getAllRouteGuards(t.targetSnapshot, t.currentSnapshot, this.rootContexts),\n };\n return overallTransitionState;\n }), checkGuards(this.environmentInjector, (evt) => this.events.next(evt)), tap((t) => {\n overallTransitionState.guardsResult = t.guardsResult;\n if (t.guardsResult && typeof t.guardsResult !== 'boolean') {\n throw redirectingNavigationError(this.urlSerializer, t.guardsResult);\n }\n const guardsEnd = new GuardsCheckEnd(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot, !!t.guardsResult);\n this.events.next(guardsEnd);\n }), filter((t) => {\n if (!t.guardsResult) {\n this.cancelNavigationTransition(t, '', NavigationCancellationCode.GuardRejected);\n return false;\n }\n return true;\n }), \n // --- RESOLVE ---\n switchTap((t) => {\n if (t.guards.canActivateChecks.length) {\n return of(t).pipe(tap((t) => {\n const resolveStart = new ResolveStart(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot);\n this.events.next(resolveStart);\n }), switchMap((t) => {\n let dataResolved = false;\n return of(t).pipe(resolveData(this.paramsInheritanceStrategy, this.environmentInjector), tap({\n next: () => (dataResolved = true),\n complete: () => {\n if (!dataResolved) {\n this.cancelNavigationTransition(t, typeof ngDevMode === 'undefined' || ngDevMode\n ? `At least one route resolver didn't emit any value.`\n : '', NavigationCancellationCode.NoDataFromResolver);\n }\n },\n }));\n }), tap((t) => {\n const resolveEnd = new ResolveEnd(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot);\n this.events.next(resolveEnd);\n }));\n }\n return undefined;\n }), \n // --- LOAD COMPONENTS ---\n switchTap((t) => {\n const loadComponents = (route) => {\n const loaders = [];\n if (route.routeConfig?.loadComponent && !route.routeConfig._loadedComponent) {\n loaders.push(this.configLoader.loadComponent(route.routeConfig).pipe(tap((loadedComponent) => {\n route.component = loadedComponent;\n }), map(() => void 0)));\n }\n for (const child of route.children) {\n loaders.push(...loadComponents(child));\n }\n return loaders;\n };\n return combineLatest(loadComponents(t.targetSnapshot.root)).pipe(defaultIfEmpty(null), take(1));\n }), switchTap(() => this.afterPreactivation()), switchMap(() => {\n const { currentSnapshot, targetSnapshot } = overallTransitionState;\n const viewTransitionStarted = this.createViewTransition?.(this.environmentInjector, currentSnapshot.root, targetSnapshot.root);\n // If view transitions are enabled, block the navigation until the view\n // transition callback starts. Otherwise, continue immediately.\n return viewTransitionStarted\n ? from(viewTransitionStarted).pipe(map(() => overallTransitionState))\n : of(overallTransitionState);\n }), map((t) => {\n const targetRouterState = createRouterState(router.routeReuseStrategy, t.targetSnapshot, t.currentRouterState);\n this.currentTransition = overallTransitionState = { ...t, targetRouterState };\n this.currentNavigation.targetRouterState = targetRouterState;\n return overallTransitionState;\n }), tap(() => {\n this.events.next(new BeforeActivateRoutes());\n }), activateRoutes(this.rootContexts, router.routeReuseStrategy, (evt) => this.events.next(evt), this.inputBindingEnabled), \n // Ensure that if some observable used to drive the transition doesn't\n // complete, the navigation still finalizes This should never happen, but\n // this is done as a safety measure to avoid surfacing this error (#49567).\n take(1), tap({\n next: (t) => {\n completed = true;\n this.lastSuccessfulNavigation = this.currentNavigation;\n this.events.next(new NavigationEnd(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects)));\n this.titleStrategy?.updateTitle(t.targetRouterState.snapshot);\n t.resolve(true);\n },\n complete: () => {\n completed = true;\n },\n }), \n // There used to be a lot more logic happening directly within the\n // transition Observable. Some of this logic has been refactored out to\n // other places but there may still be errors that happen there. This gives\n // us a way to cancel the transition from the outside. This may also be\n // required in the future to support something like the abort signal of the\n // Navigation API where the navigation gets aborted from outside the\n // transition.\n takeUntil(this.transitionAbortSubject.pipe(tap((err) => {\n throw err;\n }))), finalize(() => {\n /* When the navigation stream finishes either through error or success,\n * we set the `completed` or `errored` flag. However, there are some\n * situations where we could get here without either of those being set.\n * For instance, a redirect during NavigationStart. Therefore, this is a\n * catch-all to make sure the NavigationCancel event is fired when a\n * navigation gets cancelled but not caught by other means. */\n if (!completed && !errored) {\n const cancelationReason = typeof ngDevMode === 'undefined' || ngDevMode\n ? `Navigation ID ${overallTransitionState.id} is not equal to the current navigation id ${this.navigationId}`\n : '';\n this.cancelNavigationTransition(overallTransitionState, cancelationReason, NavigationCancellationCode.SupersededByNewNavigation);\n }\n // Only clear current navigation if it is still set to the one that\n // finalized.\n if (this.currentTransition?.id === overallTransitionState.id) {\n this.currentNavigation = null;\n this.currentTransition = null;\n }\n }), catchError((e) => {\n // If the application is already destroyed, the catch block should not\n // execute anything in practice because other resources have already\n // been released and destroyed.\n if (this.destroyed) {\n overallTransitionState.resolve(false);\n return EMPTY;\n }\n errored = true;\n /* This error type is issued during Redirect, and is handled as a\n * cancellation rather than an error. */\n if (isNavigationCancelingError(e)) {\n this.events.next(new NavigationCancel(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), e.message, e.cancellationCode));\n // When redirecting, we need to delay resolving the navigation\n // promise and push it to the redirect navigation\n if (!isRedirectingNavigationCancelingError(e)) {\n overallTransitionState.resolve(false);\n }\n else {\n this.events.next(new RedirectRequest(e.url, e.navigationBehaviorOptions));\n }\n /* All other errors should reset to the router's internal URL reference\n * to the pre-error state. */\n }\n else {\n const navigationError = new NavigationError(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), e, overallTransitionState.targetSnapshot ?? undefined);\n try {\n const navigationErrorHandlerResult = runInInjectionContext(this.environmentInjector, () => this.navigationErrorHandler?.(navigationError));\n if (navigationErrorHandlerResult instanceof RedirectCommand) {\n const { message, cancellationCode } = redirectingNavigationError(this.urlSerializer, navigationErrorHandlerResult);\n this.events.next(new NavigationCancel(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), message, cancellationCode));\n this.events.next(new RedirectRequest(navigationErrorHandlerResult.redirectTo, navigationErrorHandlerResult.navigationBehaviorOptions));\n }\n else {\n this.events.next(navigationError);\n throw e;\n }\n }\n catch (ee) {\n // TODO(atscott): consider flipping the default behavior of\n // resolveNavigationPromiseOnError to be `resolve(false)` when\n // undefined. This is the most sane thing to do given that\n // applications very rarely handle the promise rejection and, as a\n // result, would get \"unhandled promise rejection\" console logs.\n // The vast majority of applications would not be affected by this\n // change so omitting a migration seems reasonable. Instead,\n // applications that rely on rejection can specifically opt-in to the\n // old behavior.\n if (this.options.resolveNavigationPromiseOnError) {\n overallTransitionState.resolve(false);\n }\n else {\n overallTransitionState.reject(ee);\n }\n }\n }\n return EMPTY;\n }));\n // casting because `pipe` returns observable({}) when called with 8+ arguments\n }));\n }\n cancelNavigationTransition(t, reason, code) {\n const navCancel = new NavigationCancel(t.id, this.urlSerializer.serialize(t.extractedUrl), reason, code);\n this.events.next(navCancel);\n t.resolve(false);\n }\n /**\n * @returns Whether we're navigating to somewhere that is not what the Router is\n * currently set to.\n */\n isUpdatingInternalState() {\n // TODO(atscott): The serializer should likely be used instead of\n // `UrlTree.toString()`. Custom serializers are often written to handle\n // things better than the default one (objects, for example will be\n // [Object object] with the custom serializer and be \"the same\" when they\n // aren't).\n // (Same for isUpdatedBrowserUrl)\n return (this.currentTransition?.extractedUrl.toString() !==\n this.currentTransition?.currentUrlTree.toString());\n }\n /**\n * @returns Whether we're updating the browser URL to something new (navigation is going\n * to somewhere not displayed in the URL bar and we will update the URL\n * bar if navigation succeeds).\n */\n isUpdatedBrowserUrl() {\n // The extracted URL is the part of the URL that this application cares about. `extract` may\n // return only part of the browser URL and that part may have not changed even if some other\n // portion of the URL did.\n const currentBrowserUrl = this.urlHandlingStrategy.extract(this.urlSerializer.parse(this.location.path(true)));\n const targetBrowserUrl = this.currentNavigation?.targetBrowserUrl ?? this.currentNavigation?.extractedUrl;\n return (currentBrowserUrl.toString() !== targetBrowserUrl?.toString() &&\n !this.currentNavigation?.extras.skipLocationChange);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NavigationTransitions, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NavigationTransitions, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NavigationTransitions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\nfunction isBrowserTriggeredNavigation(source) {\n return source !== IMPERATIVE_NAVIGATION;\n}\n\n/**\n * @description\n *\n * Provides a way to customize when activated routes get reused.\n *\n * @publicApi\n */\nclass RouteReuseStrategy {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouteReuseStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouteReuseStrategy, providedIn: 'root', useFactory: () => inject(DefaultRouteReuseStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouteReuseStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(DefaultRouteReuseStrategy) }]\n }] });\n/**\n * @description\n *\n * This base route reuse strategy only reuses routes when the matched router configs are\n * identical. This prevents components from being destroyed and recreated\n * when just the route parameters, query parameters or fragment change\n * (that is, the existing component is _reused_).\n *\n * This strategy does not store any routes for later reuse.\n *\n * Angular uses this strategy by default.\n *\n *\n * It can be used as a base class for custom route reuse strategies, i.e. you can create your own\n * class that extends the `BaseRouteReuseStrategy` one.\n * @publicApi\n */\nclass BaseRouteReuseStrategy {\n /**\n * Whether the given route should detach for later reuse.\n * Always returns false for `BaseRouteReuseStrategy`.\n * */\n shouldDetach(route) {\n return false;\n }\n /**\n * A no-op; the route is never stored since this strategy never detaches routes for later re-use.\n */\n store(route, detachedTree) { }\n /** Returns `false`, meaning the route (and its subtree) is never reattached */\n shouldAttach(route) {\n return false;\n }\n /** Returns `null` because this strategy does not store routes for later re-use. */\n retrieve(route) {\n return null;\n }\n /**\n * Determines if a route should be reused.\n * This strategy returns `true` when the future route config and current route config are\n * identical.\n */\n shouldReuseRoute(future, curr) {\n return future.routeConfig === curr.routeConfig;\n }\n}\nclass DefaultRouteReuseStrategy extends BaseRouteReuseStrategy {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultRouteReuseStrategy, deps: null, target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultRouteReuseStrategy, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultRouteReuseStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\nclass StateManager {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: StateManager, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: StateManager, providedIn: 'root', useFactory: () => inject(HistoryStateManager) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: StateManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(HistoryStateManager) }]\n }] });\nclass HistoryStateManager extends StateManager {\n location = inject(Location);\n urlSerializer = inject(UrlSerializer);\n options = inject(ROUTER_CONFIGURATION, { optional: true }) || {};\n canceledNavigationResolution = this.options.canceledNavigationResolution || 'replace';\n urlHandlingStrategy = inject(UrlHandlingStrategy);\n urlUpdateStrategy = this.options.urlUpdateStrategy || 'deferred';\n currentUrlTree = new UrlTree();\n getCurrentUrlTree() {\n return this.currentUrlTree;\n }\n rawUrlTree = this.currentUrlTree;\n getRawUrlTree() {\n return this.rawUrlTree;\n }\n /**\n * The id of the currently active page in the router.\n * Updated to the transition's target id on a successful navigation.\n *\n * This is used to track what page the router last activated. When an attempted navigation fails,\n * the router can then use this to compute how to restore the state back to the previously active\n * page.\n */\n currentPageId = 0;\n lastSuccessfulId = -1;\n restoredState() {\n return this.location.getState();\n }\n /**\n * The ɵrouterPageId of whatever page is currently active in the browser history. This is\n * important for computing the target page id for new navigations because we need to ensure each\n * page id in the browser history is 1 more than the previous entry.\n */\n get browserPageId() {\n if (this.canceledNavigationResolution !== 'computed') {\n return this.currentPageId;\n }\n return this.restoredState()?.ɵrouterPageId ?? this.currentPageId;\n }\n routerState = createEmptyState(null);\n getRouterState() {\n return this.routerState;\n }\n stateMemento = this.createStateMemento();\n createStateMemento() {\n return {\n rawUrlTree: this.rawUrlTree,\n currentUrlTree: this.currentUrlTree,\n routerState: this.routerState,\n };\n }\n registerNonRouterCurrentEntryChangeListener(listener) {\n return this.location.subscribe((event) => {\n if (event['type'] === 'popstate') {\n listener(event['url'], event.state);\n }\n });\n }\n handleRouterEvent(e, currentTransition) {\n if (e instanceof NavigationStart) {\n this.stateMemento = this.createStateMemento();\n }\n else if (e instanceof NavigationSkipped) {\n this.rawUrlTree = currentTransition.initialUrl;\n }\n else if (e instanceof RoutesRecognized) {\n if (this.urlUpdateStrategy === 'eager') {\n if (!currentTransition.extras.skipLocationChange) {\n const rawUrl = this.urlHandlingStrategy.merge(currentTransition.finalUrl, currentTransition.initialUrl);\n this.setBrowserUrl(currentTransition.targetBrowserUrl ?? rawUrl, currentTransition);\n }\n }\n }\n else if (e instanceof BeforeActivateRoutes) {\n this.currentUrlTree = currentTransition.finalUrl;\n this.rawUrlTree = this.urlHandlingStrategy.merge(currentTransition.finalUrl, currentTransition.initialUrl);\n this.routerState = currentTransition.targetRouterState;\n if (this.urlUpdateStrategy === 'deferred' && !currentTransition.extras.skipLocationChange) {\n this.setBrowserUrl(currentTransition.targetBrowserUrl ?? this.rawUrlTree, currentTransition);\n }\n }\n else if (e instanceof NavigationCancel &&\n (e.code === NavigationCancellationCode.GuardRejected ||\n e.code === NavigationCancellationCode.NoDataFromResolver)) {\n this.restoreHistory(currentTransition);\n }\n else if (e instanceof NavigationError) {\n this.restoreHistory(currentTransition, true);\n }\n else if (e instanceof NavigationEnd) {\n this.lastSuccessfulId = e.id;\n this.currentPageId = this.browserPageId;\n }\n }\n setBrowserUrl(url, transition) {\n const path = url instanceof UrlTree ? this.urlSerializer.serialize(url) : url;\n if (this.location.isCurrentPathEqualTo(path) || !!transition.extras.replaceUrl) {\n // replacements do not update the target page\n const currentBrowserPageId = this.browserPageId;\n const state = {\n ...transition.extras.state,\n ...this.generateNgRouterState(transition.id, currentBrowserPageId),\n };\n this.location.replaceState(path, '', state);\n }\n else {\n const state = {\n ...transition.extras.state,\n ...this.generateNgRouterState(transition.id, this.browserPageId + 1),\n };\n this.location.go(path, '', state);\n }\n }\n /**\n * Performs the necessary rollback action to restore the browser URL to the\n * state before the transition.\n */\n restoreHistory(navigation, restoringFromCaughtError = false) {\n if (this.canceledNavigationResolution === 'computed') {\n const currentBrowserPageId = this.browserPageId;\n const targetPagePosition = this.currentPageId - currentBrowserPageId;\n if (targetPagePosition !== 0) {\n this.location.historyGo(targetPagePosition);\n }\n else if (this.currentUrlTree === navigation.finalUrl && targetPagePosition === 0) {\n // We got to the activation stage (where currentUrlTree is set to the navigation's\n // finalUrl), but we weren't moving anywhere in history (skipLocationChange or replaceUrl).\n // We still need to reset the router state back to what it was when the navigation started.\n this.resetState(navigation);\n this.resetUrlToCurrentUrlTree();\n }\n else {\n // The browser URL and router state was not updated before the navigation cancelled so\n // there's no restoration needed.\n }\n }\n else if (this.canceledNavigationResolution === 'replace') {\n // TODO(atscott): It seems like we should _always_ reset the state here. It would be a no-op\n // for `deferred` navigations that haven't change the internal state yet because guards\n // reject. For 'eager' navigations, it seems like we also really should reset the state\n // because the navigation was cancelled. Investigate if this can be done by running TGP.\n if (restoringFromCaughtError) {\n this.resetState(navigation);\n }\n this.resetUrlToCurrentUrlTree();\n }\n }\n resetState(navigation) {\n this.routerState = this.stateMemento.routerState;\n this.currentUrlTree = this.stateMemento.currentUrlTree;\n // Note here that we use the urlHandlingStrategy to get the reset `rawUrlTree` because it may be\n // configured to handle only part of the navigation URL. This means we would only want to reset\n // the part of the navigation handled by the Angular router rather than the whole URL. In\n // addition, the URLHandlingStrategy may be configured to specifically preserve parts of the URL\n // when merging, such as the query params so they are not lost on a refresh.\n this.rawUrlTree = this.urlHandlingStrategy.merge(this.currentUrlTree, navigation.finalUrl ?? this.rawUrlTree);\n }\n resetUrlToCurrentUrlTree() {\n this.location.replaceState(this.urlSerializer.serialize(this.rawUrlTree), '', this.generateNgRouterState(this.lastSuccessfulId, this.currentPageId));\n }\n generateNgRouterState(navigationId, routerPageId) {\n if (this.canceledNavigationResolution === 'computed') {\n return { navigationId, ɵrouterPageId: routerPageId };\n }\n return { navigationId };\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HistoryStateManager, deps: null, target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HistoryStateManager, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HistoryStateManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * Performs the given action once the router finishes its next/current navigation.\n *\n * The navigation is considered complete under the following conditions:\n * - `NavigationCancel` event emits and the code is not `NavigationCancellationCode.Redirect` or\n * `NavigationCancellationCode.SupersededByNewNavigation`. In these cases, the\n * redirecting/superseding navigation must finish.\n * - `NavigationError`, `NavigationEnd`, or `NavigationSkipped` event emits\n */\nfunction afterNextNavigation(router, action) {\n router.events\n .pipe(filter((e) => e instanceof NavigationEnd ||\n e instanceof NavigationCancel ||\n e instanceof NavigationError ||\n e instanceof NavigationSkipped), map((e) => {\n if (e instanceof NavigationEnd || e instanceof NavigationSkipped) {\n return 0 /* NavigationResult.COMPLETE */;\n }\n const redirecting = e instanceof NavigationCancel\n ? e.code === NavigationCancellationCode.Redirect ||\n e.code === NavigationCancellationCode.SupersededByNewNavigation\n : false;\n return redirecting ? 2 /* NavigationResult.REDIRECTING */ : 1 /* NavigationResult.FAILED */;\n }), filter((result) => result !== 2 /* NavigationResult.REDIRECTING */), take(1))\n .subscribe(() => {\n action();\n });\n}\n\n/**\n * The equivalent `IsActiveMatchOptions` options for `Router.isActive` is called with `true`\n * (exact = true).\n */\nconst exactMatchOptions = {\n paths: 'exact',\n fragment: 'ignored',\n matrixParams: 'ignored',\n queryParams: 'exact',\n};\n/**\n * The equivalent `IsActiveMatchOptions` options for `Router.isActive` is called with `false`\n * (exact = false).\n */\nconst subsetMatchOptions = {\n paths: 'subset',\n fragment: 'ignored',\n matrixParams: 'ignored',\n queryParams: 'subset',\n};\n/**\n * @description\n *\n * A service that facilitates navigation among views and URL manipulation capabilities.\n * This service is provided in the root scope and configured with [provideRouter](api/router/provideRouter).\n *\n * @see {@link Route}\n * @see {@link provideRouter}\n * @see [Routing and Navigation Guide](guide/routing/common-router-tasks).\n *\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass Router {\n get currentUrlTree() {\n return this.stateManager.getCurrentUrlTree();\n }\n get rawUrlTree() {\n return this.stateManager.getRawUrlTree();\n }\n disposed = false;\n nonRouterCurrentEntryChangeSubscription;\n console = inject(ɵConsole);\n stateManager = inject(StateManager);\n options = inject(ROUTER_CONFIGURATION, { optional: true }) || {};\n pendingTasks = inject(ɵPendingTasksInternal);\n urlUpdateStrategy = this.options.urlUpdateStrategy || 'deferred';\n navigationTransitions = inject(NavigationTransitions);\n urlSerializer = inject(UrlSerializer);\n location = inject(Location);\n urlHandlingStrategy = inject(UrlHandlingStrategy);\n /**\n * The private `Subject` type for the public events exposed in the getter. This is used internally\n * to push events to. The separate field allows us to expose separate types in the public API\n * (i.e., an Observable rather than the Subject).\n */\n _events = new Subject();\n /**\n * An event stream for routing events.\n */\n get events() {\n // TODO(atscott): This _should_ be events.asObservable(). However, this change requires internal\n // cleanup: tests are doing `(route.events as Subject).next(...)`. This isn't\n // allowed/supported but we still have to fix these or file bugs against the teams before making\n // the change.\n return this._events;\n }\n /**\n * The current state of routing in this NgModule.\n */\n get routerState() {\n return this.stateManager.getRouterState();\n }\n /**\n * True if at least one navigation event has occurred,\n * false otherwise.\n */\n navigated = false;\n /**\n * A strategy for re-using routes.\n *\n * @deprecated Configure using `providers` instead:\n * `{provide: RouteReuseStrategy, useClass: MyStrategy}`.\n */\n routeReuseStrategy = inject(RouteReuseStrategy);\n /**\n * How to handle a navigation request to the current URL.\n *\n *\n * @deprecated Configure this through `provideRouter` or `RouterModule.forRoot` instead.\n * @see {@link withRouterConfig}\n * @see {@link provideRouter}\n * @see {@link RouterModule}\n */\n onSameUrlNavigation = this.options.onSameUrlNavigation || 'ignore';\n config = inject(ROUTES, { optional: true })?.flat() ?? [];\n /**\n * Indicates whether the application has opted in to binding Router data to component inputs.\n *\n * This option is enabled by the `withComponentInputBinding` feature of `provideRouter` or\n * `bindToComponentInputs` in the `ExtraOptions` of `RouterModule.forRoot`.\n */\n componentInputBindingEnabled = !!inject(INPUT_BINDER, { optional: true });\n constructor() {\n this.resetConfig(this.config);\n this.navigationTransitions\n .setupNavigations(this, this.currentUrlTree, this.routerState)\n .subscribe({\n error: (e) => {\n this.console.warn(ngDevMode ? `Unhandled Navigation Error: ${e}` : e);\n },\n });\n this.subscribeToNavigationEvents();\n }\n eventsSubscription = new Subscription();\n subscribeToNavigationEvents() {\n const subscription = this.navigationTransitions.events.subscribe((e) => {\n try {\n const currentTransition = this.navigationTransitions.currentTransition;\n const currentNavigation = this.navigationTransitions.currentNavigation;\n if (currentTransition !== null && currentNavigation !== null) {\n this.stateManager.handleRouterEvent(e, currentNavigation);\n if (e instanceof NavigationCancel &&\n e.code !== NavigationCancellationCode.Redirect &&\n e.code !== NavigationCancellationCode.SupersededByNewNavigation) {\n // It seems weird that `navigated` is set to `true` when the navigation is rejected,\n // however it's how things were written initially. Investigation would need to be done\n // to determine if this can be removed.\n this.navigated = true;\n }\n else if (e instanceof NavigationEnd) {\n this.navigated = true;\n }\n else if (e instanceof RedirectRequest) {\n const opts = e.navigationBehaviorOptions;\n const mergedTree = this.urlHandlingStrategy.merge(e.url, currentTransition.currentRawUrl);\n const extras = {\n browserUrl: currentTransition.extras.browserUrl,\n info: currentTransition.extras.info,\n skipLocationChange: currentTransition.extras.skipLocationChange,\n // The URL is already updated at this point if we have 'eager' URL\n // updates or if the navigation was triggered by the browser (back\n // button, URL bar, etc). We want to replace that item in history\n // if the navigation is rejected.\n replaceUrl: currentTransition.extras.replaceUrl ||\n this.urlUpdateStrategy === 'eager' ||\n isBrowserTriggeredNavigation(currentTransition.source),\n // allow developer to override default options with RedirectCommand\n ...opts,\n };\n this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras, {\n resolve: currentTransition.resolve,\n reject: currentTransition.reject,\n promise: currentTransition.promise,\n });\n }\n }\n // Note that it's important to have the Router process the events _before_ the event is\n // pushed through the public observable. This ensures the correct router state is in place\n // before applications observe the events.\n if (isPublicRouterEvent(e)) {\n this._events.next(e);\n }\n }\n catch (e) {\n this.navigationTransitions.transitionAbortSubject.next(e);\n }\n });\n this.eventsSubscription.add(subscription);\n }\n /** @internal */\n resetRootComponentType(rootComponentType) {\n // TODO: vsavkin router 4.0 should make the root component set to null\n // this will simplify the lifecycle of the router.\n this.routerState.root.component = rootComponentType;\n this.navigationTransitions.rootComponentType = rootComponentType;\n }\n /**\n * Sets up the location change listener and performs the initial navigation.\n */\n initialNavigation() {\n this.setUpLocationChangeListener();\n if (!this.navigationTransitions.hasRequestedNavigation) {\n this.navigateToSyncWithBrowser(this.location.path(true), IMPERATIVE_NAVIGATION, this.stateManager.restoredState());\n }\n }\n /**\n * Sets up the location change listener. This listener detects navigations triggered from outside\n * the Router (the browser back/forward buttons, for example) and schedules a corresponding Router\n * navigation so that the correct events, guards, etc. are triggered.\n */\n setUpLocationChangeListener() {\n // Don't need to use Zone.wrap any more, because zone.js\n // already patch onPopState, so location change callback will\n // run into ngZone\n this.nonRouterCurrentEntryChangeSubscription ??=\n this.stateManager.registerNonRouterCurrentEntryChangeListener((url, state) => {\n // The `setTimeout` was added in #12160 and is likely to support Angular/AngularJS\n // hybrid apps.\n setTimeout(() => {\n this.navigateToSyncWithBrowser(url, 'popstate', state);\n }, 0);\n });\n }\n /**\n * Schedules a router navigation to synchronize Router state with the browser state.\n *\n * This is done as a response to a popstate event and the initial navigation. These\n * two scenarios represent times when the browser URL/state has been updated and\n * the Router needs to respond to ensure its internal state matches.\n */\n navigateToSyncWithBrowser(url, source, state) {\n const extras = { replaceUrl: true };\n // TODO: restoredState should always include the entire state, regardless\n // of navigationId. This requires a breaking change to update the type on\n // NavigationStart’s restoredState, which currently requires navigationId\n // to always be present. The Router used to only restore history state if\n // a navigationId was present.\n // The stored navigationId is used by the RouterScroller to retrieve the scroll\n // position for the page.\n const restoredState = state?.navigationId ? state : null;\n // Separate to NavigationStart.restoredState, we must also restore the state to\n // history.state and generate a new navigationId, since it will be overwritten\n if (state) {\n const stateCopy = { ...state };\n delete stateCopy.navigationId;\n delete stateCopy.ɵrouterPageId;\n if (Object.keys(stateCopy).length !== 0) {\n extras.state = stateCopy;\n }\n }\n const urlTree = this.parseUrl(url);\n this.scheduleNavigation(urlTree, source, restoredState, extras);\n }\n /** The current URL. */\n get url() {\n return this.serializeUrl(this.currentUrlTree);\n }\n /**\n * Returns the current `Navigation` object when the router is navigating,\n * and `null` when idle.\n */\n getCurrentNavigation() {\n return this.navigationTransitions.currentNavigation;\n }\n /**\n * The `Navigation` object of the most recent navigation to succeed and `null` if there\n * has not been a successful navigation yet.\n */\n get lastSuccessfulNavigation() {\n return this.navigationTransitions.lastSuccessfulNavigation;\n }\n /**\n * Resets the route configuration used for navigation and generating links.\n *\n * @param config The route array for the new configuration.\n *\n * @usageNotes\n *\n * ```ts\n * router.resetConfig([\n * { path: 'team/:id', component: TeamCmp, children: [\n * { path: 'simple', component: SimpleCmp },\n * { path: 'user/:name', component: UserCmp }\n * ]}\n * ]);\n * ```\n */\n resetConfig(config) {\n (typeof ngDevMode === 'undefined' || ngDevMode) && validateConfig(config);\n this.config = config.map(standardizeConfig);\n this.navigated = false;\n }\n /** @nodoc */\n ngOnDestroy() {\n this.dispose();\n }\n /** Disposes of the router. */\n dispose() {\n // We call `unsubscribe()` to release observers, as users may forget to\n // unsubscribe manually when subscribing to `router.events`. We do not call\n // `complete()` because it is unsafe; if someone subscribes using the `first`\n // operator and the observable completes before emitting a value,\n // RxJS will throw an error.\n this._events.unsubscribe();\n this.navigationTransitions.complete();\n if (this.nonRouterCurrentEntryChangeSubscription) {\n this.nonRouterCurrentEntryChangeSubscription.unsubscribe();\n this.nonRouterCurrentEntryChangeSubscription = undefined;\n }\n this.disposed = true;\n this.eventsSubscription.unsubscribe();\n }\n /**\n * Appends URL segments to the current URL tree to create a new URL tree.\n *\n * @param commands An array of URL fragments with which to construct the new URL tree.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the current URL tree or the one provided in the `relativeTo`\n * property of the options object, if supplied.\n * @param navigationExtras Options that control the navigation strategy.\n * @returns The new URL tree.\n *\n * @usageNotes\n *\n * ```\n * // create /team/33/user/11\n * router.createUrlTree(['/team', 33, 'user', 11]);\n *\n * // create /team/33;expand=true/user/11\n * router.createUrlTree(['/team', 33, {expand: true}, 'user', 11]);\n *\n * // you can collapse static segments like this (this works only with the first passed-in value):\n * router.createUrlTree(['/team/33/user', userId]);\n *\n * // If the first segment can contain slashes, and you do not want the router to split it,\n * // you can do the following:\n * router.createUrlTree([{segmentPath: '/one/two'}]);\n *\n * // create /team/33/(user/11//right:chat)\n * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: 'chat'}}]);\n *\n * // remove the right secondary node\n * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: null}}]);\n *\n * // assuming the current url is `/team/33/user/11` and the route points to `user/11`\n *\n * // navigate to /team/33/user/11/details\n * router.createUrlTree(['details'], {relativeTo: route});\n *\n * // navigate to /team/33/user/22\n * router.createUrlTree(['../22'], {relativeTo: route});\n *\n * // navigate to /team/44/user/22\n * router.createUrlTree(['../../team/44/user/22'], {relativeTo: route});\n *\n * Note that a value of `null` or `undefined` for `relativeTo` indicates that the\n * tree should be created relative to the root.\n * ```\n */\n createUrlTree(commands, navigationExtras = {}) {\n const { relativeTo, queryParams, fragment, queryParamsHandling, preserveFragment } = navigationExtras;\n const f = preserveFragment ? this.currentUrlTree.fragment : fragment;\n let q = null;\n switch (queryParamsHandling ?? this.options.defaultQueryParamsHandling) {\n case 'merge':\n q = { ...this.currentUrlTree.queryParams, ...queryParams };\n break;\n case 'preserve':\n q = this.currentUrlTree.queryParams;\n break;\n default:\n q = queryParams || null;\n }\n if (q !== null) {\n q = this.removeEmptyProps(q);\n }\n let relativeToUrlSegmentGroup;\n try {\n const relativeToSnapshot = relativeTo ? relativeTo.snapshot : this.routerState.snapshot.root;\n relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeToSnapshot);\n }\n catch (e) {\n // This is strictly for backwards compatibility with tests that create\n // invalid `ActivatedRoute` mocks.\n // Note: the difference between having this fallback for invalid `ActivatedRoute` setups and\n // just throwing is ~500 test failures. Fixing all of those tests by hand is not feasible at\n // the moment.\n if (typeof commands[0] !== 'string' || commands[0][0] !== '/') {\n // Navigations that were absolute in the old way of creating UrlTrees\n // would still work because they wouldn't attempt to match the\n // segments in the `ActivatedRoute` to the `currentUrlTree` but\n // instead just replace the root segment with the navigation result.\n // Non-absolute navigations would fail to apply the commands because\n // the logic could not find the segment to replace (so they'd act like there were no\n // commands).\n commands = [];\n }\n relativeToUrlSegmentGroup = this.currentUrlTree.root;\n }\n return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, q, f ?? null);\n }\n /**\n * Navigates to a view using an absolute route path.\n *\n * @param url An absolute path for a defined route. The function does not apply any delta to the\n * current URL.\n * @param extras An object containing properties that modify the navigation strategy.\n *\n * @returns A Promise that resolves to 'true' when navigation succeeds,\n * to 'false' when navigation fails, or is rejected on error.\n *\n * @usageNotes\n *\n * The following calls request navigation to an absolute path.\n *\n * ```ts\n * router.navigateByUrl(\"/team/33/user/11\");\n *\n * // Navigate without updating the URL\n * router.navigateByUrl(\"/team/33/user/11\", { skipLocationChange: true });\n * ```\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks)\n *\n */\n navigateByUrl(url, extras = {\n skipLocationChange: false,\n }) {\n const urlTree = isUrlTree(url) ? url : this.parseUrl(url);\n const mergedTree = this.urlHandlingStrategy.merge(urlTree, this.rawUrlTree);\n return this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras);\n }\n /**\n * Navigate based on the provided array of commands and a starting point.\n * If no starting route is provided, the navigation is absolute.\n *\n * @param commands An array of URL fragments with which to construct the target URL.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the current URL or the one provided in the `relativeTo` property\n * of the options object, if supplied.\n * @param extras An options object that determines how the URL should be constructed or\n * interpreted.\n *\n * @returns A Promise that resolves to `true` when navigation succeeds, or `false` when navigation\n * fails. The Promise is rejected when an error occurs if `resolveNavigationPromiseOnError` is\n * not `true`.\n *\n * @usageNotes\n *\n * The following calls request navigation to a dynamic route path relative to the current URL.\n *\n * ```ts\n * router.navigate(['team', 33, 'user', 11], {relativeTo: route});\n *\n * // Navigate without updating the URL, overriding the default behavior\n * router.navigate(['team', 33, 'user', 11], {relativeTo: route, skipLocationChange: true});\n * ```\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks)\n *\n */\n navigate(commands, extras = { skipLocationChange: false }) {\n validateCommands(commands);\n return this.navigateByUrl(this.createUrlTree(commands, extras), extras);\n }\n /** Serializes a `UrlTree` into a string */\n serializeUrl(url) {\n return this.urlSerializer.serialize(url);\n }\n /** Parses a string into a `UrlTree` */\n parseUrl(url) {\n try {\n return this.urlSerializer.parse(url);\n }\n catch {\n return this.urlSerializer.parse('/');\n }\n }\n isActive(url, matchOptions) {\n let options;\n if (matchOptions === true) {\n options = { ...exactMatchOptions };\n }\n else if (matchOptions === false) {\n options = { ...subsetMatchOptions };\n }\n else {\n options = matchOptions;\n }\n if (isUrlTree(url)) {\n return containsTree(this.currentUrlTree, url, options);\n }\n const urlTree = this.parseUrl(url);\n return containsTree(this.currentUrlTree, urlTree, options);\n }\n removeEmptyProps(params) {\n return Object.entries(params).reduce((result, [key, value]) => {\n if (value !== null && value !== undefined) {\n result[key] = value;\n }\n return result;\n }, {});\n }\n scheduleNavigation(rawUrl, source, restoredState, extras, priorPromise) {\n if (this.disposed) {\n return Promise.resolve(false);\n }\n let resolve;\n let reject;\n let promise;\n if (priorPromise) {\n resolve = priorPromise.resolve;\n reject = priorPromise.reject;\n promise = priorPromise.promise;\n }\n else {\n promise = new Promise((res, rej) => {\n resolve = res;\n reject = rej;\n });\n }\n // Indicate that the navigation is happening.\n const taskId = this.pendingTasks.add();\n afterNextNavigation(this, () => {\n // Remove pending task in a microtask to allow for cancelled\n // initial navigations and redirects within the same task.\n queueMicrotask(() => this.pendingTasks.remove(taskId));\n });\n this.navigationTransitions.handleNavigationRequest({\n source,\n restoredState,\n currentUrlTree: this.currentUrlTree,\n currentRawUrl: this.currentUrlTree,\n rawUrl,\n extras,\n resolve: resolve,\n reject: reject,\n promise,\n currentSnapshot: this.routerState.snapshot,\n currentRouterState: this.routerState,\n });\n // Make sure that the error is propagated even though `processNavigations` catch\n // handler does not rethrow\n return promise.catch((e) => {\n return Promise.reject(e);\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\nfunction validateCommands(commands) {\n for (let i = 0; i < commands.length; i++) {\n const cmd = commands[i];\n if (cmd == null) {\n throw new ɵRuntimeError(4008 /* RuntimeErrorCode.NULLISH_COMMAND */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `The requested path contains ${cmd} segment at index ${i}`);\n }\n }\n}\nfunction isPublicRouterEvent(e) {\n return !(e instanceof BeforeActivateRoutes) && !(e instanceof RedirectRequest);\n}\n\n/**\n * @description\n *\n * When applied to an element in a template, makes that element a link\n * that initiates navigation to a route. Navigation opens one or more routed components\n * in one or more `` locations on the page.\n *\n * Given a route configuration `[{ path: 'user/:name', component: UserCmp }]`,\n * the following creates a static link to the route:\n * `link to user component `\n *\n * You can use dynamic values to generate the link.\n * For a dynamic link, pass an array of path segments,\n * followed by the params for each segment.\n * For example, `['/team', teamId, 'user', userName, {details: true}]`\n * generates a link to `/team/11/user/bob;details=true`.\n *\n * Multiple static segments can be merged into one term and combined with dynamic segments.\n * For example, `['/team/11/user', userName, {details: true}]`\n *\n * The input that you provide to the link is treated as a delta to the current URL.\n * For instance, suppose the current URL is `/user/(box//aux:team)`.\n * The link `Jim ` creates the URL\n * `/user/(jim//aux:team)`.\n * See {@link Router#createUrlTree} for more information.\n *\n * @usageNotes\n *\n * You can use absolute or relative paths in a link, set query parameters,\n * control how parameters are handled, and keep a history of navigation states.\n *\n * ### Relative link paths\n *\n * The first segment name can be prepended with `/`, `./`, or `../`.\n * * If the first segment begins with `/`, the router looks up the route from the root of the\n * app.\n * * If the first segment begins with `./`, or doesn't begin with a slash, the router\n * looks in the children of the current activated route.\n * * If the first segment begins with `../`, the router goes up one level in the route tree.\n *\n * ### Setting and handling query params and fragments\n *\n * The following link adds a query parameter and a fragment to the generated URL:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n * By default, the directive constructs the new URL using the given query parameters.\n * The example generates the link: `/user/bob?debug=true#education`.\n *\n * You can instruct the directive to handle query parameters differently\n * by specifying the `queryParamsHandling` option in the link.\n * Allowed values are:\n *\n * - `'merge'`: Merge the given `queryParams` into the current query params.\n * - `'preserve'`: Preserve the current query params.\n *\n * For example:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n *\n * `queryParams`, `fragment`, `queryParamsHandling`, `preserveFragment`, and `relativeTo`\n * cannot be used when the `routerLink` input is a `UrlTree`.\n *\n * See {@link UrlCreationOptions#queryParamsHandling}.\n *\n * ### Preserving navigation history\n *\n * You can provide a `state` value to be persisted to the browser's\n * [`History.state` property](https://developer.mozilla.org/en-US/docs/Web/API/History#Properties).\n * For example:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n *\n * Use {@link Router#getCurrentNavigation} to retrieve a saved\n * navigation-state value. For example, to capture the `tracingId` during the `NavigationStart`\n * event:\n *\n * ```ts\n * // Get NavigationStart events\n * router.events.pipe(filter(e => e instanceof NavigationStart)).subscribe(e => {\n * const navigation = router.getCurrentNavigation();\n * tracingService.trace({id: navigation.extras.state.tracingId});\n * });\n * ```\n *\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterLink {\n router;\n route;\n tabIndexAttribute;\n renderer;\n el;\n locationStrategy;\n /**\n * Represents an `href` attribute value applied to a host element,\n * when a host element is ``. For other tags, the value is `null`.\n */\n href = null;\n /**\n * Represents the `target` attribute on a host element.\n * This is only used when the host element is an ` ` tag.\n */\n target;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#queryParams}\n * @see {@link Router#createUrlTree}\n */\n queryParams;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#fragment}\n * @see {@link Router#createUrlTree}\n */\n fragment;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#queryParamsHandling}\n * @see {@link Router#createUrlTree}\n */\n queryParamsHandling;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#state}\n * @see {@link Router#navigateByUrl}\n */\n state;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#info}\n * @see {@link Router#navigateByUrl}\n */\n info;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * Specify a value here when you do not want to use the default value\n * for `routerLink`, which is the current activated route.\n * Note that a value of `undefined` here will use the `routerLink` default.\n * @see {@link UrlCreationOptions#relativeTo}\n * @see {@link Router#createUrlTree}\n */\n relativeTo;\n /** Whether a host element is an ` ` tag. */\n isAnchorElement;\n subscription;\n /** @internal */\n onChanges = new Subject();\n constructor(router, route, tabIndexAttribute, renderer, el, locationStrategy) {\n this.router = router;\n this.route = route;\n this.tabIndexAttribute = tabIndexAttribute;\n this.renderer = renderer;\n this.el = el;\n this.locationStrategy = locationStrategy;\n const tagName = el.nativeElement.tagName?.toLowerCase();\n this.isAnchorElement = tagName === 'a' || tagName === 'area';\n if (this.isAnchorElement) {\n this.subscription = router.events.subscribe((s) => {\n if (s instanceof NavigationEnd) {\n this.updateHref();\n }\n });\n }\n else {\n this.setTabIndexIfNotOnNativeEl('0');\n }\n }\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#preserveFragment}\n * @see {@link Router#createUrlTree}\n */\n preserveFragment = false;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#skipLocationChange}\n * @see {@link Router#navigateByUrl}\n */\n skipLocationChange = false;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#replaceUrl}\n * @see {@link Router#navigateByUrl}\n */\n replaceUrl = false;\n /**\n * Modifies the tab index if there was not a tabindex attribute on the element during\n * instantiation.\n */\n setTabIndexIfNotOnNativeEl(newTabIndex) {\n if (this.tabIndexAttribute != null /* both `null` and `undefined` */ || this.isAnchorElement) {\n return;\n }\n this.applyAttributeValue('tabindex', newTabIndex);\n }\n /** @nodoc */\n // TODO(atscott): Remove changes parameter in major version as a breaking change.\n ngOnChanges(changes) {\n if (ngDevMode &&\n isUrlTree(this.routerLinkInput) &&\n (this.fragment !== undefined ||\n this.queryParams ||\n this.queryParamsHandling ||\n this.preserveFragment ||\n this.relativeTo)) {\n throw new ɵRuntimeError(4016 /* RuntimeErrorCode.INVALID_ROUTER_LINK_INPUTS */, 'Cannot configure queryParams or fragment when using a UrlTree as the routerLink input value.');\n }\n if (this.isAnchorElement) {\n this.updateHref();\n }\n // This is subscribed to by `RouterLinkActive` so that it knows to update when there are changes\n // to the RouterLinks it's tracking.\n this.onChanges.next(this);\n }\n routerLinkInput = null;\n /**\n * Commands to pass to {@link Router#createUrlTree} or a `UrlTree`.\n * - **array**: commands to pass to {@link Router#createUrlTree}.\n * - **string**: shorthand for array of commands with just the string, i.e. `['/route']`\n * - **UrlTree**: a `UrlTree` for this link rather than creating one from the commands\n * and other inputs that correspond to properties of `UrlCreationOptions`.\n * - **null|undefined**: effectively disables the `routerLink`\n * @see {@link Router#createUrlTree}\n */\n set routerLink(commandsOrUrlTree) {\n if (commandsOrUrlTree == null) {\n this.routerLinkInput = null;\n this.setTabIndexIfNotOnNativeEl(null);\n }\n else {\n if (isUrlTree(commandsOrUrlTree)) {\n this.routerLinkInput = commandsOrUrlTree;\n }\n else {\n this.routerLinkInput = Array.isArray(commandsOrUrlTree)\n ? commandsOrUrlTree\n : [commandsOrUrlTree];\n }\n this.setTabIndexIfNotOnNativeEl('0');\n }\n }\n /** @nodoc */\n onClick(button, ctrlKey, shiftKey, altKey, metaKey) {\n const urlTree = this.urlTree;\n if (urlTree === null) {\n return true;\n }\n if (this.isAnchorElement) {\n if (button !== 0 || ctrlKey || shiftKey || altKey || metaKey) {\n return true;\n }\n if (typeof this.target === 'string' && this.target != '_self') {\n return true;\n }\n }\n const extras = {\n skipLocationChange: this.skipLocationChange,\n replaceUrl: this.replaceUrl,\n state: this.state,\n info: this.info,\n };\n this.router.navigateByUrl(urlTree, extras);\n // Return `false` for ` ` elements to prevent default action\n // and cancel the native behavior, since the navigation is handled\n // by the Router.\n return !this.isAnchorElement;\n }\n /** @nodoc */\n ngOnDestroy() {\n this.subscription?.unsubscribe();\n }\n updateHref() {\n const urlTree = this.urlTree;\n this.href =\n urlTree !== null && this.locationStrategy\n ? this.locationStrategy?.prepareExternalUrl(this.router.serializeUrl(urlTree))\n : null;\n const sanitizedValue = this.href === null\n ? null\n : // This class represents a directive that can be added to both ` ` elements,\n // as well as other elements. As a result, we can't define security context at\n // compile time. So the security context is deferred to runtime.\n // The `ɵɵsanitizeUrlOrResourceUrl` selects the necessary sanitizer function\n // based on the tag and property names. The logic mimics the one from\n // `packages/compiler/src/schema/dom_security_schema.ts`, which is used at compile time.\n //\n // Note: we should investigate whether we can switch to using `@HostBinding('attr.href')`\n // instead of applying a value via a renderer, after a final merge of the\n // `RouterLinkWithHref` directive.\n ɵɵsanitizeUrlOrResourceUrl(this.href, this.el.nativeElement.tagName.toLowerCase(), 'href');\n this.applyAttributeValue('href', sanitizedValue);\n }\n applyAttributeValue(attrName, attrValue) {\n const renderer = this.renderer;\n const nativeElement = this.el.nativeElement;\n if (attrValue !== null) {\n renderer.setAttribute(nativeElement, attrName, attrValue);\n }\n else {\n renderer.removeAttribute(nativeElement, attrName);\n }\n }\n get urlTree() {\n if (this.routerLinkInput === null) {\n return null;\n }\n else if (isUrlTree(this.routerLinkInput)) {\n return this.routerLinkInput;\n }\n return this.router.createUrlTree(this.routerLinkInput, {\n // If the `relativeTo` input is not defined, we want to use `this.route` by default.\n // Otherwise, we should use the value provided by the user in the input.\n relativeTo: this.relativeTo !== undefined ? this.relativeTo : this.route,\n queryParams: this.queryParams,\n fragment: this.fragment,\n queryParamsHandling: this.queryParamsHandling,\n preserveFragment: this.preserveFragment,\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLink, deps: [{ token: Router }, { token: ActivatedRoute }, { token: 'tabindex', attribute: true }, { token: i0.Renderer2 }, { token: i0.ElementRef }, { token: i3.LocationStrategy }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"19.2.1\", type: RouterLink, isStandalone: true, selector: \"[routerLink]\", inputs: { target: \"target\", queryParams: \"queryParams\", fragment: \"fragment\", queryParamsHandling: \"queryParamsHandling\", state: \"state\", info: \"info\", relativeTo: \"relativeTo\", preserveFragment: [\"preserveFragment\", \"preserveFragment\", booleanAttribute], skipLocationChange: [\"skipLocationChange\", \"skipLocationChange\", booleanAttribute], replaceUrl: [\"replaceUrl\", \"replaceUrl\", booleanAttribute], routerLink: \"routerLink\" }, host: { listeners: { \"click\": \"onClick($event.button,$event.ctrlKey,$event.shiftKey,$event.altKey,$event.metaKey)\" }, properties: { \"attr.target\": \"this.target\" } }, usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLink, decorators: [{\n type: Directive,\n args: [{\n selector: '[routerLink]',\n }]\n }], ctorParameters: () => [{ type: Router }, { type: ActivatedRoute }, { type: undefined, decorators: [{\n type: Attribute,\n args: ['tabindex']\n }] }, { type: i0.Renderer2 }, { type: i0.ElementRef }, { type: i3.LocationStrategy }], propDecorators: { target: [{\n type: HostBinding,\n args: ['attr.target']\n }, {\n type: Input\n }], queryParams: [{\n type: Input\n }], fragment: [{\n type: Input\n }], queryParamsHandling: [{\n type: Input\n }], state: [{\n type: Input\n }], info: [{\n type: Input\n }], relativeTo: [{\n type: Input\n }], preserveFragment: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], skipLocationChange: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], replaceUrl: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], routerLink: [{\n type: Input\n }], onClick: [{\n type: HostListener,\n args: ['click', [\n '$event.button',\n '$event.ctrlKey',\n '$event.shiftKey',\n '$event.altKey',\n '$event.metaKey',\n ]]\n }] } });\n\n/**\n *\n * @description\n *\n * Tracks whether the linked route of an element is currently active, and allows you\n * to specify one or more CSS classes to add to the element when the linked route\n * is active.\n *\n * Use this directive to create a visual distinction for elements associated with an active route.\n * For example, the following code highlights the word \"Bob\" when the router\n * activates the associated route:\n *\n * ```html\n * Bob \n * ```\n *\n * Whenever the URL is either '/user' or '/user/bob', the \"active-link\" class is\n * added to the anchor tag. If the URL changes, the class is removed.\n *\n * You can set more than one class using a space-separated string or an array.\n * For example:\n *\n * ```html\n * Bob \n * Bob \n * ```\n *\n * To add the classes only when the URL matches the link exactly, add the option `exact: true`:\n *\n * ```html\n * Bob \n * ```\n *\n * To directly check the `isActive` status of the link, assign the `RouterLinkActive`\n * instance to a template variable.\n * For example, the following checks the status without assigning any CSS classes:\n *\n * ```html\n * \n * Bob {{ rla.isActive ? '(already open)' : ''}}\n * \n * ```\n *\n * You can apply the `RouterLinkActive` directive to an ancestor of linked elements.\n * For example, the following sets the active-link class on the `` parent tag\n * when the URL is either '/user/jim' or '/user/bob'.\n *\n * ```html\n *
\n * ```\n *\n * The `RouterLinkActive` directive can also be used to set the aria-current attribute\n * to provide an alternative distinction for active elements to visually impaired users.\n *\n * For example, the following code adds the 'active' class to the Home Page link when it is\n * indeed active and in such case also sets its aria-current attribute to 'page':\n *\n * ```html\n *
Home Page \n * ```\n *\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterLinkActive {\n router;\n element;\n renderer;\n cdr;\n link;\n links;\n classes = [];\n routerEventsSubscription;\n linkInputChangesSubscription;\n _isActive = false;\n get isActive() {\n return this._isActive;\n }\n /**\n * Options to configure how to determine if the router link is active.\n *\n * These options are passed to the `Router.isActive()` function.\n *\n * @see {@link Router#isActive}\n */\n routerLinkActiveOptions = { exact: false };\n /**\n * Aria-current attribute to apply when the router link is active.\n *\n * Possible values: `'page'` | `'step'` | `'location'` | `'date'` | `'time'` | `true` | `false`.\n *\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/Attributes/aria-current}\n */\n ariaCurrentWhenActive;\n /**\n *\n * You can use the output `isActiveChange` to get notified each time the link becomes\n * active or inactive.\n *\n * Emits:\n * true -> Route is active\n * false -> Route is inactive\n *\n * ```html\n *
Bob \n * ```\n */\n isActiveChange = new EventEmitter();\n constructor(router, element, renderer, cdr, link) {\n this.router = router;\n this.element = element;\n this.renderer = renderer;\n this.cdr = cdr;\n this.link = link;\n this.routerEventsSubscription = router.events.subscribe((s) => {\n if (s instanceof NavigationEnd) {\n this.update();\n }\n });\n }\n /** @nodoc */\n ngAfterContentInit() {\n // `of(null)` is used to force subscribe body to execute once immediately (like `startWith`).\n of(this.links.changes, of(null))\n .pipe(mergeAll())\n .subscribe((_) => {\n this.update();\n this.subscribeToEachLinkOnChanges();\n });\n }\n subscribeToEachLinkOnChanges() {\n this.linkInputChangesSubscription?.unsubscribe();\n const allLinkChanges = [...this.links.toArray(), this.link]\n .filter((link) => !!link)\n .map((link) => link.onChanges);\n this.linkInputChangesSubscription = from(allLinkChanges)\n .pipe(mergeAll())\n .subscribe((link) => {\n if (this._isActive !== this.isLinkActive(this.router)(link)) {\n this.update();\n }\n });\n }\n set routerLinkActive(data) {\n const classes = Array.isArray(data) ? data : data.split(' ');\n this.classes = classes.filter((c) => !!c);\n }\n /** @nodoc */\n ngOnChanges(changes) {\n this.update();\n }\n /** @nodoc */\n ngOnDestroy() {\n this.routerEventsSubscription.unsubscribe();\n this.linkInputChangesSubscription?.unsubscribe();\n }\n update() {\n if (!this.links || !this.router.navigated)\n return;\n queueMicrotask(() => {\n const hasActiveLinks = this.hasActiveLinks();\n this.classes.forEach((c) => {\n if (hasActiveLinks) {\n this.renderer.addClass(this.element.nativeElement, c);\n }\n else {\n this.renderer.removeClass(this.element.nativeElement, c);\n }\n });\n if (hasActiveLinks && this.ariaCurrentWhenActive !== undefined) {\n this.renderer.setAttribute(this.element.nativeElement, 'aria-current', this.ariaCurrentWhenActive.toString());\n }\n else {\n this.renderer.removeAttribute(this.element.nativeElement, 'aria-current');\n }\n // Only emit change if the active state changed.\n if (this._isActive !== hasActiveLinks) {\n this._isActive = hasActiveLinks;\n this.cdr.markForCheck();\n // Emit on isActiveChange after classes are updated\n this.isActiveChange.emit(hasActiveLinks);\n }\n });\n }\n isLinkActive(router) {\n const options = isActiveMatchOptions(this.routerLinkActiveOptions)\n ? this.routerLinkActiveOptions\n : // While the types should disallow `undefined` here, it's possible without strict inputs\n this.routerLinkActiveOptions.exact || false;\n return (link) => {\n const urlTree = link.urlTree;\n return urlTree ? router.isActive(urlTree, options) : false;\n };\n }\n hasActiveLinks() {\n const isActiveCheckFn = this.isLinkActive(this.router);\n return (this.link && isActiveCheckFn(this.link)) || this.links.some(isActiveCheckFn);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLinkActive, deps: [{ token: Router }, { token: i0.ElementRef }, { token: i0.Renderer2 }, { token: i0.ChangeDetectorRef }, { token: RouterLink, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: RouterLinkActive, isStandalone: true, selector: \"[routerLinkActive]\", inputs: { routerLinkActiveOptions: \"routerLinkActiveOptions\", ariaCurrentWhenActive: \"ariaCurrentWhenActive\", routerLinkActive: \"routerLinkActive\" }, outputs: { isActiveChange: \"isActiveChange\" }, queries: [{ propertyName: \"links\", predicate: RouterLink, descendants: true }], exportAs: [\"routerLinkActive\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLinkActive, decorators: [{\n type: Directive,\n args: [{\n selector: '[routerLinkActive]',\n exportAs: 'routerLinkActive',\n }]\n }], ctorParameters: () => [{ type: Router }, { type: i0.ElementRef }, { type: i0.Renderer2 }, { type: i0.ChangeDetectorRef }, { type: RouterLink, decorators: [{\n type: Optional\n }] }], propDecorators: { links: [{\n type: ContentChildren,\n args: [RouterLink, { descendants: true }]\n }], routerLinkActiveOptions: [{\n type: Input\n }], ariaCurrentWhenActive: [{\n type: Input\n }], isActiveChange: [{\n type: Output\n }], routerLinkActive: [{\n type: Input\n }] } });\n/**\n * Use instead of `'paths' in options` to be compatible with property renaming\n */\nfunction isActiveMatchOptions(options) {\n return !!options.paths;\n}\n\n/**\n * @description\n *\n * Provides a preloading strategy.\n *\n * @publicApi\n */\nclass PreloadingStrategy {\n}\n/**\n * @description\n *\n * Provides a preloading strategy that preloads all modules as quickly as possible.\n *\n * ```ts\n * RouterModule.forRoot(ROUTES, {preloadingStrategy: PreloadAllModules})\n * ```\n *\n * @publicApi\n */\nclass PreloadAllModules {\n preload(route, fn) {\n return fn().pipe(catchError(() => of(null)));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/**\n * @description\n *\n * Provides a preloading strategy that does not preload any modules.\n *\n * This strategy is enabled by default.\n *\n * @publicApi\n */\nclass NoPreloading {\n preload(route, fn) {\n return of(null);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/**\n * The preloader optimistically loads all router configurations to\n * make navigations into lazily-loaded sections of the application faster.\n *\n * The preloader runs in the background. When the router bootstraps, the preloader\n * starts listening to all navigation events. After every such event, the preloader\n * will check if any configurations can be loaded lazily.\n *\n * If a route is protected by `canLoad` guards, the preloaded will not load it.\n *\n * @publicApi\n */\nclass RouterPreloader {\n router;\n injector;\n preloadingStrategy;\n loader;\n subscription;\n constructor(router, compiler, injector, preloadingStrategy, loader) {\n this.router = router;\n this.injector = injector;\n this.preloadingStrategy = preloadingStrategy;\n this.loader = loader;\n }\n setUpPreloading() {\n this.subscription = this.router.events\n .pipe(filter((e) => e instanceof NavigationEnd), concatMap(() => this.preload()))\n .subscribe(() => { });\n }\n preload() {\n return this.processRoutes(this.injector, this.router.config);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this.subscription) {\n this.subscription.unsubscribe();\n }\n }\n processRoutes(injector, routes) {\n const res = [];\n for (const route of routes) {\n if (route.providers && !route._injector) {\n route._injector = createEnvironmentInjector(route.providers, injector, `Route: ${route.path}`);\n }\n const injectorForCurrentRoute = route._injector ?? injector;\n const injectorForChildren = route._loadedInjector ?? injectorForCurrentRoute;\n // Note that `canLoad` is only checked as a condition that prevents `loadChildren` and not\n // `loadComponent`. `canLoad` guards only block loading of child routes by design. This\n // happens as a consequence of needing to descend into children for route matching immediately\n // while component loading is deferred until route activation. Because `canLoad` guards can\n // have side effects, we cannot execute them here so we instead skip preloading altogether\n // when present. Lastly, it remains to be decided whether `canLoad` should behave this way\n // at all. Code splitting and lazy loading is separate from client-side authorization checks\n // and should not be used as a security measure to prevent loading of code.\n if ((route.loadChildren && !route._loadedRoutes && route.canLoad === undefined) ||\n (route.loadComponent && !route._loadedComponent)) {\n res.push(this.preloadConfig(injectorForCurrentRoute, route));\n }\n if (route.children || route._loadedRoutes) {\n res.push(this.processRoutes(injectorForChildren, (route.children ?? route._loadedRoutes)));\n }\n }\n return from(res).pipe(mergeAll());\n }\n preloadConfig(injector, route) {\n return this.preloadingStrategy.preload(route, () => {\n let loadedChildren$;\n if (route.loadChildren && route.canLoad === undefined) {\n loadedChildren$ = this.loader.loadChildren(injector, route);\n }\n else {\n loadedChildren$ = of(null);\n }\n const recursiveLoadChildren$ = loadedChildren$.pipe(mergeMap((config) => {\n if (config === null) {\n return of(void 0);\n }\n route._loadedRoutes = config.routes;\n route._loadedInjector = config.injector;\n // If the loaded config was a module, use that as the module/module injector going\n // forward. Otherwise, continue using the current module/module injector.\n return this.processRoutes(config.injector ?? injector, config.routes);\n }));\n if (route.loadComponent && !route._loadedComponent) {\n const loadComponent$ = this.loader.loadComponent(route);\n return from([recursiveLoadChildren$, loadComponent$]).pipe(mergeAll());\n }\n else {\n return recursiveLoadChildren$;\n }\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, deps: [{ token: Router }, { token: i0.Compiler }, { token: i0.EnvironmentInjector }, { token: PreloadingStrategy }, { token: RouterConfigLoader }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: Router }, { type: i0.Compiler }, { type: i0.EnvironmentInjector }, { type: PreloadingStrategy }, { type: RouterConfigLoader }] });\n\nconst ROUTER_SCROLLER = new InjectionToken('');\nclass RouterScroller {\n urlSerializer;\n transitions;\n viewportScroller;\n zone;\n options;\n routerEventsSubscription;\n scrollEventsSubscription;\n lastId = 0;\n lastSource = 'imperative';\n restoredId = 0;\n store = {};\n /** @nodoc */\n constructor(urlSerializer, transitions, viewportScroller, zone, options = {}) {\n this.urlSerializer = urlSerializer;\n this.transitions = transitions;\n this.viewportScroller = viewportScroller;\n this.zone = zone;\n this.options = options;\n // Default both options to 'disabled'\n options.scrollPositionRestoration ||= 'disabled';\n options.anchorScrolling ||= 'disabled';\n }\n init() {\n // we want to disable the automatic scrolling because having two places\n // responsible for scrolling results race conditions, especially given\n // that browser don't implement this behavior consistently\n if (this.options.scrollPositionRestoration !== 'disabled') {\n this.viewportScroller.setHistoryScrollRestoration('manual');\n }\n this.routerEventsSubscription = this.createScrollEvents();\n this.scrollEventsSubscription = this.consumeScrollEvents();\n }\n createScrollEvents() {\n return this.transitions.events.subscribe((e) => {\n if (e instanceof NavigationStart) {\n // store the scroll position of the current stable navigations.\n this.store[this.lastId] = this.viewportScroller.getScrollPosition();\n this.lastSource = e.navigationTrigger;\n this.restoredId = e.restoredState ? e.restoredState.navigationId : 0;\n }\n else if (e instanceof NavigationEnd) {\n this.lastId = e.id;\n this.scheduleScrollEvent(e, this.urlSerializer.parse(e.urlAfterRedirects).fragment);\n }\n else if (e instanceof NavigationSkipped &&\n e.code === NavigationSkippedCode.IgnoredSameUrlNavigation) {\n this.lastSource = undefined;\n this.restoredId = 0;\n this.scheduleScrollEvent(e, this.urlSerializer.parse(e.url).fragment);\n }\n });\n }\n consumeScrollEvents() {\n return this.transitions.events.subscribe((e) => {\n if (!(e instanceof Scroll))\n return;\n // a popstate event. The pop state event will always ignore anchor scrolling.\n if (e.position) {\n if (this.options.scrollPositionRestoration === 'top') {\n this.viewportScroller.scrollToPosition([0, 0]);\n }\n else if (this.options.scrollPositionRestoration === 'enabled') {\n this.viewportScroller.scrollToPosition(e.position);\n }\n // imperative navigation \"forward\"\n }\n else {\n if (e.anchor && this.options.anchorScrolling === 'enabled') {\n this.viewportScroller.scrollToAnchor(e.anchor);\n }\n else if (this.options.scrollPositionRestoration !== 'disabled') {\n this.viewportScroller.scrollToPosition([0, 0]);\n }\n }\n });\n }\n scheduleScrollEvent(routerEvent, anchor) {\n this.zone.runOutsideAngular(() => {\n // The scroll event needs to be delayed until after change detection. Otherwise, we may\n // attempt to restore the scroll position before the router outlet has fully rendered the\n // component by executing its update block of the template function.\n setTimeout(() => {\n this.zone.run(() => {\n this.transitions.events.next(new Scroll(routerEvent, this.lastSource === 'popstate' ? this.store[this.restoredId] : null, anchor));\n });\n }, 0);\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this.routerEventsSubscription?.unsubscribe();\n this.scrollEventsSubscription?.unsubscribe();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller, deps: \"invalid\", target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: UrlSerializer }, { type: NavigationTransitions }, { type: i3.ViewportScroller }, { type: i0.NgZone }, { type: undefined }] });\n\n/**\n * Sets up providers necessary to enable `Router` functionality for the application.\n * Allows to configure a set of routes as well as extra features that should be enabled.\n *\n * @usageNotes\n *\n * Basic example of how you can add a Router to your application:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent, {\n * providers: [provideRouter(appRoutes)]\n * });\n * ```\n *\n * You can also enable optional features in the Router by adding functions from the `RouterFeatures`\n * type:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes,\n * withDebugTracing(),\n * withRouterConfig({paramsInheritanceStrategy: 'always'}))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link RouterFeatures}\n *\n * @publicApi\n * @param routes A set of `Route`s to use for the application routing table.\n * @param features Optional features to configure additional router behaviors.\n * @returns A set of providers to setup a Router.\n */\nfunction provideRouter(routes, ...features) {\n return makeEnvironmentProviders([\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode\n ? { provide: ROUTER_IS_PROVIDED, useValue: true }\n : [],\n { provide: ActivatedRoute, useFactory: rootRoute, deps: [Router] },\n { provide: APP_BOOTSTRAP_LISTENER, multi: true, useFactory: getBootstrapListener },\n features.map((feature) => feature.ɵproviders),\n ]);\n}\nfunction rootRoute(router) {\n return router.routerState.root;\n}\n/**\n * Helper function to create an object that represents a Router feature.\n */\nfunction routerFeature(kind, providers) {\n return { ɵkind: kind, ɵproviders: providers };\n}\n/**\n * An Injection token used to indicate whether `provideRouter` or `RouterModule.forRoot` was ever\n * called.\n */\nconst ROUTER_IS_PROVIDED = new InjectionToken('', {\n providedIn: 'root',\n factory: () => false,\n});\nconst routerIsProvidedDevModeCheck = {\n provide: ENVIRONMENT_INITIALIZER,\n multi: true,\n useFactory() {\n return () => {\n if (!inject(ROUTER_IS_PROVIDED)) {\n console.warn('`provideRoutes` was called without `provideRouter` or `RouterModule.forRoot`. ' +\n 'This is likely a mistake.');\n }\n };\n },\n};\n/**\n * Registers a DI provider for a set of routes.\n * @param routes The route configuration to provide.\n *\n * @usageNotes\n *\n * ```ts\n * @NgModule({\n * providers: [provideRoutes(ROUTES)]\n * })\n * class LazyLoadedChildModule {}\n * ```\n *\n * @deprecated If necessary, provide routes using the `ROUTES` `InjectionToken`.\n * @see {@link ROUTES}\n * @publicApi\n */\nfunction provideRoutes(routes) {\n return [\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode ? routerIsProvidedDevModeCheck : [],\n ];\n}\n/**\n * Enables customizable scrolling behavior for router navigations.\n *\n * @usageNotes\n *\n * Basic example of how you can enable scrolling feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withInMemoryScrolling())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n * @see {@link ViewportScroller}\n *\n * @publicApi\n * @param options Set of configuration parameters to customize scrolling behavior, see\n * `InMemoryScrollingOptions` for additional information.\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withInMemoryScrolling(options = {}) {\n const providers = [\n {\n provide: ROUTER_SCROLLER,\n useFactory: () => {\n const viewportScroller = inject(ViewportScroller);\n const zone = inject(NgZone);\n const transitions = inject(NavigationTransitions);\n const urlSerializer = inject(UrlSerializer);\n return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, options);\n },\n },\n ];\n return routerFeature(4 /* RouterFeatureKind.InMemoryScrollingFeature */, providers);\n}\nfunction getBootstrapListener() {\n const injector = inject(Injector);\n return (bootstrappedComponentRef) => {\n const ref = injector.get(ApplicationRef);\n if (bootstrappedComponentRef !== ref.components[0]) {\n return;\n }\n const router = injector.get(Router);\n const bootstrapDone = injector.get(BOOTSTRAP_DONE);\n if (injector.get(INITIAL_NAVIGATION) === 1 /* InitialNavigation.EnabledNonBlocking */) {\n router.initialNavigation();\n }\n injector.get(ROUTER_PRELOADER, null, InjectFlags.Optional)?.setUpPreloading();\n injector.get(ROUTER_SCROLLER, null, InjectFlags.Optional)?.init();\n router.resetRootComponentType(ref.componentTypes[0]);\n if (!bootstrapDone.closed) {\n bootstrapDone.next();\n bootstrapDone.complete();\n bootstrapDone.unsubscribe();\n }\n };\n}\n/**\n * A subject used to indicate that the bootstrapping phase is done. When initial navigation is\n * `enabledBlocking`, the first navigation waits until bootstrapping is finished before continuing\n * to the activation phase.\n */\nconst BOOTSTRAP_DONE = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'bootstrap done indicator' : '', {\n factory: () => {\n return new Subject();\n },\n});\nconst INITIAL_NAVIGATION = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'initial navigation' : '', { providedIn: 'root', factory: () => 1 /* InitialNavigation.EnabledNonBlocking */ });\n/**\n * Configures initial navigation to start before the root component is created.\n *\n * The bootstrap is blocked until the initial navigation is complete. This should be set in case\n * you use [server-side rendering](guide/ssr), but do not enable [hydration](guide/hydration) for\n * your application.\n *\n * @usageNotes\n *\n * Basic example of how you can enable this navigation behavior:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withEnabledBlockingInitialNavigation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @publicApi\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withEnabledBlockingInitialNavigation() {\n const providers = [\n { provide: INITIAL_NAVIGATION, useValue: 0 /* InitialNavigation.EnabledBlocking */ },\n {\n provide: APP_INITIALIZER,\n multi: true,\n deps: [Injector],\n useFactory: (injector) => {\n const locationInitialized = injector.get(LOCATION_INITIALIZED, Promise.resolve());\n return () => {\n return locationInitialized.then(() => {\n return new Promise((resolve) => {\n const router = injector.get(Router);\n const bootstrapDone = injector.get(BOOTSTRAP_DONE);\n afterNextNavigation(router, () => {\n // Unblock APP_INITIALIZER in case the initial navigation was canceled or errored\n // without a redirect.\n resolve(true);\n });\n injector.get(NavigationTransitions).afterPreactivation = () => {\n // Unblock APP_INITIALIZER once we get to `afterPreactivation`. At this point, we\n // assume activation will complete successfully (even though this is not\n // guaranteed).\n resolve(true);\n return bootstrapDone.closed ? of(void 0) : bootstrapDone;\n };\n router.initialNavigation();\n });\n });\n };\n },\n },\n ];\n return routerFeature(2 /* RouterFeatureKind.EnabledBlockingInitialNavigationFeature */, providers);\n}\n/**\n * Disables initial navigation.\n *\n * Use if there is a reason to have more control over when the router starts its initial navigation\n * due to some complex initialization logic.\n *\n * @usageNotes\n *\n * Basic example of how you can disable initial navigation:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withDisabledInitialNavigation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withDisabledInitialNavigation() {\n const providers = [\n {\n provide: APP_INITIALIZER,\n multi: true,\n useFactory: () => {\n const router = inject(Router);\n return () => {\n router.setUpLocationChangeListener();\n };\n },\n },\n { provide: INITIAL_NAVIGATION, useValue: 2 /* InitialNavigation.Disabled */ },\n ];\n return routerFeature(3 /* RouterFeatureKind.DisabledInitialNavigationFeature */, providers);\n}\n/**\n * Enables logging of all internal navigation events to the console.\n * Extra logging might be useful for debugging purposes to inspect Router event sequence.\n *\n * @usageNotes\n *\n * Basic example of how you can enable debug tracing:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withDebugTracing())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withDebugTracing() {\n let providers = [];\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n providers = [\n {\n provide: ENVIRONMENT_INITIALIZER,\n multi: true,\n useFactory: () => {\n const router = inject(Router);\n return () => router.events.subscribe((e) => {\n // tslint:disable:no-console\n console.group?.(`Router Event: ${e.constructor.name}`);\n console.log(stringifyEvent(e));\n console.log(e);\n console.groupEnd?.();\n // tslint:enable:no-console\n });\n },\n },\n ];\n }\n else {\n providers = [];\n }\n return routerFeature(1 /* RouterFeatureKind.DebugTracingFeature */, providers);\n}\nconst ROUTER_PRELOADER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router preloader' : '');\n/**\n * Allows to configure a preloading strategy to use. The strategy is configured by providing a\n * reference to a class that implements a `PreloadingStrategy`.\n *\n * @usageNotes\n *\n * Basic example of how you can configure preloading:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withPreloading(PreloadAllModules))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @param preloadingStrategy A reference to a class that implements a `PreloadingStrategy` that\n * should be used.\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withPreloading(preloadingStrategy) {\n const providers = [\n { provide: ROUTER_PRELOADER, useExisting: RouterPreloader },\n { provide: PreloadingStrategy, useExisting: preloadingStrategy },\n ];\n return routerFeature(0 /* RouterFeatureKind.PreloadingFeature */, providers);\n}\n/**\n * Allows to provide extra parameters to configure Router.\n *\n * @usageNotes\n *\n * Basic example of how you can provide extra configuration options:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withRouterConfig({\n * onSameUrlNavigation: 'reload'\n * }))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @param options A set of parameters to configure Router, see `RouterConfigOptions` for\n * additional information.\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withRouterConfig(options) {\n const providers = [{ provide: ROUTER_CONFIGURATION, useValue: options }];\n return routerFeature(5 /* RouterFeatureKind.RouterConfigurationFeature */, providers);\n}\n/**\n * Provides the location strategy that uses the URL fragment instead of the history API.\n *\n * @usageNotes\n *\n * Basic example of how you can use the hash location option:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withHashLocation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n * @see {@link /api/common/HashLocationStrategy HashLocationStrategy}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withHashLocation() {\n const providers = [{ provide: LocationStrategy, useClass: HashLocationStrategy }];\n return routerFeature(6 /* RouterFeatureKind.RouterHashLocationFeature */, providers);\n}\n/**\n * Provides a function which is called when a navigation error occurs.\n *\n * This function is run inside application's [injection context](guide/di/dependency-injection-context)\n * so you can use the [`inject`](api/core/inject) function.\n *\n * This function can return a `RedirectCommand` to convert the error to a redirect, similar to returning\n * a `UrlTree` or `RedirectCommand` from a guard. This will also prevent the `Router` from emitting\n * `NavigationError`; it will instead emit `NavigationCancel` with code NavigationCancellationCode.Redirect.\n * Return values other than `RedirectCommand` are ignored and do not change any behavior with respect to\n * how the `Router` handles the error.\n *\n * @usageNotes\n *\n * Basic example of how you can use the error handler option:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withNavigationErrorHandler((e: NavigationError) =>\n * inject(MyErrorTracker).trackError(e)))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link NavigationError}\n * @see {@link /api/core/inject inject}\n * @see {@link runInInjectionContext}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withNavigationErrorHandler(handler) {\n const providers = [\n {\n provide: NAVIGATION_ERROR_HANDLER,\n useValue: handler,\n },\n ];\n return routerFeature(7 /* RouterFeatureKind.NavigationErrorHandlerFeature */, providers);\n}\n/**\n * Enables binding information from the `Router` state directly to the inputs of the component in\n * `Route` configurations.\n *\n * @usageNotes\n *\n * Basic example of how you can enable the feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withComponentInputBinding())\n * ]\n * }\n * );\n * ```\n *\n * The router bindings information from any of the following sources:\n *\n * - query parameters\n * - path and matrix parameters\n * - static route data\n * - data from resolvers\n *\n * Duplicate keys are resolved in the same order from above, from least to greatest,\n * meaning that resolvers have the highest precedence and override any of the other information\n * from the route.\n *\n * Importantly, when an input does not have an item in the route data with a matching key, this\n * input is set to `undefined`. This prevents previous information from being\n * retained if the data got removed from the route (i.e. if a query parameter is removed).\n * Default values can be provided with a resolver on the route to ensure the value is always present\n * or an input and use an input transform in the component.\n *\n * @see {@link /guide/components/inputs#input-transforms Input Transforms}\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withComponentInputBinding() {\n const providers = [\n RoutedComponentInputBinder,\n { provide: INPUT_BINDER, useExisting: RoutedComponentInputBinder },\n ];\n return routerFeature(8 /* RouterFeatureKind.ComponentInputBindingFeature */, providers);\n}\n/**\n * Enables view transitions in the Router by running the route activation and deactivation inside of\n * `document.startViewTransition`.\n *\n * Note: The View Transitions API is not available in all browsers. If the browser does not support\n * view transitions, the Router will not attempt to start a view transition and continue processing\n * the navigation as usual.\n *\n * @usageNotes\n *\n * Basic example of how you can enable the feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withViewTransitions())\n * ]\n * }\n * );\n * ```\n *\n * @returns A set of providers for use with `provideRouter`.\n * @see https://developer.chrome.com/docs/web-platform/view-transitions/\n * @see https://developer.mozilla.org/en-US/docs/Web/API/View_Transitions_API\n * @developerPreview\n */\nfunction withViewTransitions(options) {\n const providers = [\n { provide: CREATE_VIEW_TRANSITION, useValue: createViewTransition },\n {\n provide: VIEW_TRANSITION_OPTIONS,\n useValue: { skipNextTransition: !!options?.skipInitialTransition, ...options },\n },\n ];\n return routerFeature(9 /* RouterFeatureKind.ViewTransitionsFeature */, providers);\n}\n\n/**\n * The directives defined in the `RouterModule`.\n */\nconst ROUTER_DIRECTIVES = [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent];\n/**\n * @docsNotRequired\n */\nconst ROUTER_FORROOT_GUARD = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router duplicate forRoot guard' : '');\n// TODO(atscott): All of these except `ActivatedRoute` are `providedIn: 'root'`. They are only kept\n// here to avoid a breaking change whereby the provider order matters based on where the\n// `RouterModule`/`RouterTestingModule` is imported. These can/should be removed as a \"breaking\"\n// change in a major version.\nconst ROUTER_PROVIDERS = [\n Location,\n { provide: UrlSerializer, useClass: DefaultUrlSerializer },\n Router,\n ChildrenOutletContexts,\n { provide: ActivatedRoute, useFactory: rootRoute, deps: [Router] },\n RouterConfigLoader,\n // Only used to warn when `provideRoutes` is used without `RouterModule` or `provideRouter`. Can\n // be removed when `provideRoutes` is removed.\n typeof ngDevMode === 'undefined' || ngDevMode\n ? { provide: ROUTER_IS_PROVIDED, useValue: true }\n : [],\n];\n/**\n * @description\n *\n * Adds directives and providers for in-app navigation among views defined in an application.\n * Use the Angular `Router` service to declaratively specify application states and manage state\n * transitions.\n *\n * You can import this NgModule multiple times, once for each lazy-loaded bundle.\n * However, only one `Router` service can be active.\n * To ensure this, there are two ways to register routes when importing this module:\n *\n * * The `forRoot()` method creates an `NgModule` that contains all the directives, the given\n * routes, and the `Router` service itself.\n * * The `forChild()` method creates an `NgModule` that contains all the directives and the given\n * routes, but does not include the `Router` service.\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks) for an\n * overview of how the `Router` service should be used.\n *\n * @publicApi\n */\nclass RouterModule {\n constructor() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n inject(ROUTER_FORROOT_GUARD, { optional: true });\n }\n }\n /**\n * Creates and configures a module with all the router providers and directives.\n * Optionally sets up an application listener to perform an initial navigation.\n *\n * When registering the NgModule at the root, import as follows:\n *\n * ```ts\n * @NgModule({\n * imports: [RouterModule.forRoot(ROUTES)]\n * })\n * class MyNgModule {}\n * ```\n *\n * @param routes An array of `Route` objects that define the navigation paths for the application.\n * @param config An `ExtraOptions` configuration object that controls how navigation is performed.\n * @return The new `NgModule`.\n *\n */\n static forRoot(routes, config) {\n return {\n ngModule: RouterModule,\n providers: [\n ROUTER_PROVIDERS,\n typeof ngDevMode === 'undefined' || ngDevMode\n ? config?.enableTracing\n ? withDebugTracing().ɵproviders\n : []\n : [],\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode\n ? {\n provide: ROUTER_FORROOT_GUARD,\n useFactory: provideForRootGuard,\n deps: [[Router, new Optional(), new SkipSelf()]],\n }\n : [],\n config?.errorHandler\n ? {\n provide: NAVIGATION_ERROR_HANDLER,\n useValue: config.errorHandler,\n }\n : [],\n { provide: ROUTER_CONFIGURATION, useValue: config ? config : {} },\n config?.useHash ? provideHashLocationStrategy() : providePathLocationStrategy(),\n provideRouterScroller(),\n config?.preloadingStrategy ? withPreloading(config.preloadingStrategy).ɵproviders : [],\n config?.initialNavigation ? provideInitialNavigation(config) : [],\n config?.bindToComponentInputs ? withComponentInputBinding().ɵproviders : [],\n config?.enableViewTransitions ? withViewTransitions().ɵproviders : [],\n provideRouterInitializer(),\n ],\n };\n }\n /**\n * Creates a module with all the router directives and a provider registering routes,\n * without creating a new Router service.\n * When registering for submodules and lazy-loaded submodules, create the NgModule as follows:\n *\n * ```ts\n * @NgModule({\n * imports: [RouterModule.forChild(ROUTES)]\n * })\n * class MyNgModule {}\n * ```\n *\n * @param routes An array of `Route` objects that define the navigation paths for the submodule.\n * @return The new NgModule.\n *\n */\n static forChild(routes) {\n return {\n ngModule: RouterModule,\n providers: [{ provide: ROUTES, multi: true, useValue: routes }],\n };\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\n static ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, imports: [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent], exports: [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent] });\n static ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, decorators: [{\n type: NgModule,\n args: [{\n imports: ROUTER_DIRECTIVES,\n exports: ROUTER_DIRECTIVES,\n }]\n }], ctorParameters: () => [] });\n/**\n * For internal use by `RouterModule` only. Note that this differs from `withInMemoryRouterScroller`\n * because it reads from the `ExtraOptions` which should not be used in the standalone world.\n */\nfunction provideRouterScroller() {\n return {\n provide: ROUTER_SCROLLER,\n useFactory: () => {\n const viewportScroller = inject(ViewportScroller);\n const zone = inject(NgZone);\n const config = inject(ROUTER_CONFIGURATION);\n const transitions = inject(NavigationTransitions);\n const urlSerializer = inject(UrlSerializer);\n if (config.scrollOffset) {\n viewportScroller.setOffset(config.scrollOffset);\n }\n return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, config);\n },\n };\n}\n// Note: For internal use only with `RouterModule`. Standalone setup via `provideRouter` should\n// provide hash location directly via `{provide: LocationStrategy, useClass: HashLocationStrategy}`.\nfunction provideHashLocationStrategy() {\n return { provide: LocationStrategy, useClass: HashLocationStrategy };\n}\n// Note: For internal use only with `RouterModule`. Standalone setup via `provideRouter` does not\n// need this at all because `PathLocationStrategy` is the default factory for `LocationStrategy`.\nfunction providePathLocationStrategy() {\n return { provide: LocationStrategy, useClass: PathLocationStrategy };\n}\nfunction provideForRootGuard(router) {\n if (router) {\n throw new ɵRuntimeError(4007 /* RuntimeErrorCode.FOR_ROOT_CALLED_TWICE */, `The Router was provided more than once. This can happen if 'forRoot' is used outside of the root injector.` +\n ` Lazy loaded modules should use RouterModule.forChild() instead.`);\n }\n return 'guarded';\n}\n// Note: For internal use only with `RouterModule`. Standalone router setup with `provideRouter`\n// users call `withXInitialNavigation` directly.\nfunction provideInitialNavigation(config) {\n return [\n config.initialNavigation === 'disabled' ? withDisabledInitialNavigation().ɵproviders : [],\n config.initialNavigation === 'enabledBlocking'\n ? withEnabledBlockingInitialNavigation().ɵproviders\n : [],\n ];\n}\n// TODO(atscott): This should not be in the public API\n/**\n * A DI token for the router initializer that\n * is called after the app is bootstrapped.\n *\n * @publicApi\n */\nconst ROUTER_INITIALIZER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'Router Initializer' : '');\nfunction provideRouterInitializer() {\n return [\n // ROUTER_INITIALIZER token should be removed. It's public API but shouldn't be. We can just\n // have `getBootstrapListener` directly attached to APP_BOOTSTRAP_LISTENER.\n { provide: ROUTER_INITIALIZER, useFactory: getBootstrapListener },\n { provide: APP_BOOTSTRAP_LISTENER, multi: true, useExisting: ROUTER_INITIALIZER },\n ];\n}\n\n/**\n * Maps an array of injectable classes with canMatch functions to an array of equivalent\n * `CanMatchFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanMatch(providers) {\n return providers.map((provider) => (...params) => inject(provider).canMatch(...params));\n}\n/**\n * Maps an array of injectable classes with canActivate functions to an array of equivalent\n * `CanActivateFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanActivate(providers) {\n return providers.map((provider) => (...params) => inject(provider).canActivate(...params));\n}\n/**\n * Maps an array of injectable classes with canActivateChild functions to an array of equivalent\n * `CanActivateChildFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanActivateChild(providers) {\n return providers.map((provider) => (...params) => inject(provider).canActivateChild(...params));\n}\n/**\n * Maps an array of injectable classes with canDeactivate functions to an array of equivalent\n * `CanDeactivateFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanDeactivate(providers) {\n return providers.map((provider) => (...params) => inject(provider).canDeactivate(...params));\n}\n/**\n * Maps an injectable class with a resolve function to an equivalent `ResolveFn`\n * for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='Resolve'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToResolve(provider) {\n return (...params) => inject(provider).resolve(...params);\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the router package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('19.2.1');\n\nfunction getLoadedRoutes(route) {\n return route._loadedRoutes;\n}\nɵpublishExternalGlobalUtil('ɵgetLoadedRoutes', getLoadedRoutes);\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ActivatedRoute, ActivatedRouteSnapshot, ActivationEnd, ActivationStart, BaseRouteReuseStrategy, ChildActivationEnd, ChildActivationStart, ChildrenOutletContexts, DefaultTitleStrategy, DefaultUrlSerializer, EventType, GuardsCheckEnd, GuardsCheckStart, NavigationCancel, NavigationCancellationCode, NavigationEnd, NavigationError, NavigationSkipped, NavigationSkippedCode, NavigationStart, NoPreloading, OutletContext, PRIMARY_OUTLET, PreloadAllModules, PreloadingStrategy, ROUTER_CONFIGURATION, ROUTER_INITIALIZER, ROUTER_OUTLET_DATA, ROUTES, RedirectCommand, ResolveEnd, ResolveStart, RouteConfigLoadEnd, RouteConfigLoadStart, RouteReuseStrategy, Router, RouterEvent, RouterLink, RouterLinkActive, RouterLink as RouterLinkWithHref, RouterModule, RouterOutlet, RouterPreloader, RouterState, RouterStateSnapshot, RoutesRecognized, Scroll, TitleStrategy, UrlHandlingStrategy, UrlSegment, UrlSegmentGroup, UrlSerializer, UrlTree, VERSION, convertToParamMap, createUrlTreeFromSnapshot, defaultUrlMatcher, mapToCanActivate, mapToCanActivateChild, mapToCanDeactivate, mapToCanMatch, mapToResolve, provideRouter, provideRoutes, withComponentInputBinding, withDebugTracing, withDisabledInitialNavigation, withEnabledBlockingInitialNavigation, withHashLocation, withInMemoryScrolling, withNavigationErrorHandler, withPreloading, withRouterConfig, withViewTransitions, ɵEmptyOutletComponent, ROUTER_PROVIDERS as ɵROUTER_PROVIDERS, afterNextNavigation as ɵafterNextNavigation, loadChildren as ɵloadChildren };\n","import { operate } from '../util/lift';\nimport { scanInternals } from './scanInternals';\nexport function scan(accumulator, seed) {\n return operate(scanInternals(accumulator, seed, arguments.length >= 2, true));\n}\n","import { createOperatorSubscriber } from './OperatorSubscriber';\nexport function scanInternals(accumulator, seed, hasSeed, emitOnNext, emitBeforeComplete) {\n return (source, subscriber) => {\n let hasState = hasSeed;\n let state = seed;\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n const i = index++;\n state = hasState\n ?\n accumulator(state, value, i)\n :\n ((hasState = true), value);\n emitOnNext && subscriber.next(state);\n }, emitBeforeComplete &&\n (() => {\n hasState && subscriber.next(state);\n subscriber.complete();\n })));\n };\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","
\n \n \n\n
\n \n
\n \n \n \n \n\n
\n \n \n \n \n \n
\n \n","import { Component } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { IPsychologicalSurvey } from '@backend/models/types/psychological-survey';\nimport { IPsychologicalSurveyAnswerValue } from '@backend/models/types/psychological-survey-answer';\nimport {\n EPsychologicalSurveyQuestionType,\n IPsychologicalSurveyQuestion\n} from '@backend/models/types/psychological-survey-question';\nimport { ModalClass } from '@core/class/modal.class';\nimport { PsychologicalSurveyApiService } from '@core/service/api/psychologicalSurvey.api.service';\nimport { ToastService } from '@core/service/toast.service';\nimport { UserEntityService } from '@core/service/user-entity.service';\nimport { LoadingController, ModalController } from '@ionic/angular';\n\n@Component({\n selector: 'app-psychological-survey-modal',\n templateUrl: './psychological-survey-modal.component.html',\n styleUrls: ['./psychological-survey-modal.component.scss'],\n standalone: false\n})\nexport class PsychologicalSurveyModalComponent extends ModalClass {\n protected psychologicalSurveyQuestionType = EPsychologicalSurveyQuestionType;\n\n protected survey: MongoStoredObject
= null;\n protected questions: MongoStoredObject[] = [];\n protected isLoading = true;\n protected currentQuestionIndex = 0;\n protected answers: {\n question: string;\n result: IPsychologicalSurveyAnswerValue;\n }[] = [];\n\n public constructor(\n private readonly _psychologicalSurveyApiService: PsychologicalSurveyApiService,\n private readonly _toastSerivce: ToastService,\n private readonly _loadingCtrl: LoadingController,\n private readonly _userEntityService: UserEntityService,\n private readonly _modalCtrl: ModalController\n ) {\n super();\n\n this._psychologicalSurveyApiService\n .getCurrentPsychologicalSurvey()\n .subscribe((res) => {\n this.survey = res.survey;\n this.questions = res.questions;\n this.isLoading = false;\n });\n }\n\n protected get currentQuestion() {\n if (this.questions.length === 0) {\n return null;\n }\n\n const question = this.questions[this.currentQuestionIndex];\n const answer = question\n ? this.answers.find((a) => a.question === question._id)?.result\n : null;\n\n return {\n question,\n answer\n } as any;\n }\n\n protected async onQuestionComplete(event: {\n questionId: string;\n result: IPsychologicalSurveyAnswerValue;\n }) {\n this.answers.push({\n question: event.questionId,\n result: event.result\n });\n\n if (this.currentQuestionIndex === this.questions.length - 1) {\n const loading = await this._loadingCtrl.create({\n message: 'Please wait...'\n });\n loading.present();\n\n this._psychologicalSurveyApiService\n .answerToPsychologicalSurvey({\n path: { surveyId: this.survey._id },\n body: { questionAnswers: this.answers }\n })\n .subscribe({\n next: () => {\n loading.dismiss();\n this._toastSerivce.presentToast(\n 'Your answer has been submitted! Thank you!'\n );\n this._userEntityService.update();\n this.confirm();\n },\n error: () => {\n loading.dismiss();\n this._toastSerivce.presentToast('Unable to complete the survey');\n this.confirm();\n }\n });\n } else {\n this.currentQuestionIndex++;\n }\n }\n\n protected onStepBack() {\n if (this.currentQuestionIndex > 0) {\n this.currentQuestionIndex--;\n }\n }\n\n protected confirm(): void {\n this._modalCtrl.dismiss(null, 'confirm', this._modalName);\n }\n}\n","\n \n When are you off today? \n \n \n\n\n \n \n\n\n \n \n \n \n\n \n \n Submit\n \n
\n \n \n I don't work today\n \n
\n \n \n","import { Component } from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { ModalClass } from '@core/class/modal.class';\nimport { TodaysShiftApiService } from '@core/service/api/todaysShift.api.service';\nimport { ToastService } from '@core/service/toast.service';\nimport { LoadingController, ModalController } from '@ionic/angular';\nimport { add } from 'date-fns';\n\n@Component({\n selector: 'app-todays-shift-modal',\n templateUrl: './todays-shift-modal.component.html',\n standalone: false\n})\nexport class TodaysShiftModalComponent extends ModalClass {\n protected form = new FormGroup({\n start: new FormControl('00:00', Validators.required),\n end: new FormControl('00:00', Validators.required)\n });\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _loadingCtrl: LoadingController,\n private readonly _todaysShiftApiService: TodaysShiftApiService,\n private readonly _toastService: ToastService\n ) {\n super();\n\n const start = new Date();\n start.setMinutes(Math.floor(start.getMinutes() / 30) * 30);\n\n const end = add(start, { hours: 6 });\n\n this.form.reset({\n start: `${start.getHours()}:${start.getMinutes()}`,\n end: `${end.getHours()}:${end.getMinutes()}`\n });\n }\n\n protected async iDontWorkToday() {\n const loading = await this._loadingCtrl.create({\n message: 'Loading...'\n });\n loading.present();\n\n this._todaysShiftApiService.setShiftTime({ body: {} }).subscribe({\n next: (res) => {\n loading.dismiss();\n this._modalCtrl.dismiss(res, 'confirm', this._modalName);\n },\n error: () => {\n loading.dismiss();\n this._toastService.presentToast('Unable to set the shift time');\n }\n });\n }\n\n protected async onSubmitClick() {\n const loading = await this._loadingCtrl.create({\n message: 'Loading...'\n });\n loading.present();\n\n const formValue = this.form.value;\n\n this._todaysShiftApiService\n .setShiftTime({ body: { start: formValue.start, end: formValue.end } })\n .subscribe({\n next: (res) => {\n loading.dismiss();\n this._modalCtrl.dismiss(res, 'confirm', this._modalName);\n },\n error: () => {\n loading.dismiss();\n this._toastService.presentToast('Unable to set the shift time');\n }\n });\n }\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { PsychologicalSurveyModalComponent } from '@app/modals/psychological-survey-modal/psychological-survey-modal.component';\nimport { TodaysShiftModalComponent } from '@app/modals/todays-shift-modal/todays-shift-modal.component';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { showModal } from '@app/utils/modal';\nimport { EUserScheduleType } from '@backend/models/types/user';\nimport { IUserShiftTime } from '@backend/models/types/user-shift-time';\nimport {\n TSpecQueryGetUserLatestShiftTime,\n TSpecRoute_getUserLatestShiftTime\n} from '@backend/types/generated/Users/getUserLatestShiftTime';\nimport {\n TSpecBodySetShiftTime,\n TSpecRoute_setShiftTime\n} from '@backend/types/generated/Users/setShiftTime';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalController } from '@ionic/angular';\nimport { isSameDay, isWithinInterval, subMinutes } from 'date-fns';\nimport { Observable, take } from 'rxjs';\nimport { PsychologicalSurveyApiService } from './psychologicalSurvey.api.service';\n\n@Injectable()\nexport class TodaysShiftApiService {\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _authenticationService: AuthenticationService,\n private readonly _httpClient: HttpClient,\n private readonly _psychologicalSurveyApiService: PsychologicalSurveyApiService\n ) {}\n\n public async askTodaysShift(dailySurveyPNTime = 0) {\n const user = this._authenticationService.user;\n\n if (user && user.schedule) {\n this.getUserLatestShiftTime({ query: {} })\n .pipe(take(1))\n .subscribe(async (lastShift) => {\n if (\n user.schedule.scheduleType === EUserScheduleType.VARIABLE &&\n (!lastShift || !isSameDay(new Date(lastShift.date), new Date()))\n ) {\n await showModal(\n { component: TodaysShiftModalComponent },\n this._modalCtrl,\n {\n canDismiss: async (_, role) => role === 'confirm',\n useTopModalAsParent: true\n }\n );\n }\n\n if (dailySurveyPNTime) {\n let todaysShiftEnd: string | null = null;\n\n if (user.schedule.scheduleType === EUserScheduleType.FIXED) {\n const weekDayIndex = new Date().getDay();\n\n if (user.schedule.weekDays[weekDayIndex]) {\n todaysShiftEnd = user.schedule.weekTime[weekDayIndex].to;\n }\n } else if (\n user.schedule.scheduleType === EUserScheduleType.VARIABLE\n ) {\n if (\n lastShift &&\n isSameDay(new Date(lastShift.date), new Date()) &&\n lastShift.end\n ) {\n todaysShiftEnd = lastShift.end;\n }\n }\n\n if (todaysShiftEnd) {\n const splitted = todaysShiftEnd.split(':');\n\n const dateTo = new Date();\n const toHour = Number(splitted[0]);\n const toMinute = Number(splitted[1]);\n dateTo.setHours(toHour);\n dateTo.setMinutes(toMinute);\n\n const dateFrom = subMinutes(dateTo, dailySurveyPNTime);\n\n const showSurvey = isWithinInterval(new Date(), {\n start: dateFrom,\n end: dateTo\n });\n\n if (showSurvey) {\n this._psychologicalSurveyApiService\n .getUnansweredPsychologicalSurveys({\n query: { skipSurveyMode: true }\n })\n .pipe(take(1))\n .subscribe(({ items }) => {\n if (items.length) {\n showModal(\n {\n component: PsychologicalSurveyModalComponent\n },\n this._modalCtrl,\n {\n canDismiss: async (_, role) => role === 'confirm',\n useTopModalAsParent: true\n }\n );\n }\n });\n }\n }\n }\n });\n }\n }\n\n public getUserLatestShiftTime(params: {\n query: TSpecQueryGetUserLatestShiftTime;\n }): Observable | null> {\n return this._httpClient.get | null>(\n TSpecRoute_getUserLatestShiftTime(),\n { params: { ...params.query } }\n );\n }\n\n public setShiftTime(params: {\n body: TSpecBodySetShiftTime;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_setShiftTime(),\n params.body\n );\n }\n}\n","import addMinutes from \"../addMinutes/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name subMinutes\n * @category Minute Helpers\n * @summary Subtract the specified number of minutes from the given date.\n *\n * @description\n * Subtract the specified number of minutes from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of minutes to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the minutes subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 30 minutes from 10 July 2014 12:00:00:\n * const result = subMinutes(new Date(2014, 6, 10, 12, 0), 30)\n * //=> Thu Jul 10 2014 11:30:00\n */\nexport default function subMinutes(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var amount = toInteger(dirtyAmount);\n return addMinutes(dirtyDate, -amount);\n}","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getUserLatestShiftTime = () => \"/users/latest-shift-time\";\n\nexport type TSpecHandler_getUserLatestShiftTime = RequestHandler;\n\nexport interface TSpecPathGetUserLatestShiftTime { }\n\nexport interface TSpecBodyGetUserLatestShiftTime {}\n\nexport interface TSpecQueryGetUserLatestShiftTime {\n userId?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_setShiftTime = () => \"/user/shift-time\";\n\nexport type TSpecHandler_setShiftTime = RequestHandler;\n\nexport interface TSpecPathSetShiftTime { }\n\nexport interface TSpecBodySetShiftTime {\n start?: string;\n end?: string;\n}\n\nexport interface TSpecQuerySetShiftTime {\n AppVersion?: string;\n AppUser?: string;\n}\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = subMilliseconds;\nvar _index = _interopRequireDefault(require(\"../addMilliseconds/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\nvar _index3 = _interopRequireDefault(require(\"../_lib/toInteger/index.js\"));\n/**\n * @name subMilliseconds\n * @category Millisecond Helpers\n * @summary Subtract the specified number of milliseconds from the given date.\n *\n * @description\n * Subtract the specified number of milliseconds from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of milliseconds to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the milliseconds subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 750 milliseconds from 10 July 2014 12:45:30.000:\n * const result = subMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)\n * //=> Thu Jul 10 2014 12:45:29.250\n */\nfunction subMilliseconds(dirtyDate, dirtyAmount) {\n (0, _index2.default)(2, arguments);\n var amount = (0, _index3.default)(dirtyAmount);\n return (0, _index.default)(dirtyDate, -amount);\n}\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar _index = _interopRequireDefault(require(\"../../../_lib/buildFormatLongFn/index.js\"));\nvar dateFormats = {\n full: 'EEEE, MMMM do, y',\n long: 'MMMM do, y',\n medium: 'MMM d, y',\n short: 'MM/dd/yyyy'\n};\nvar timeFormats = {\n full: 'h:mm:ss a zzzz',\n long: 'h:mm:ss a z',\n medium: 'h:mm:ss a',\n short: 'h:mm a'\n};\nvar dateTimeFormats = {\n full: \"{{date}} 'at' {{time}}\",\n long: \"{{date}} 'at' {{time}}\",\n medium: '{{date}}, {{time}}',\n short: '{{date}}, {{time}}'\n};\nvar formatLong = {\n date: (0, _index.default)({\n formats: dateFormats,\n defaultWidth: 'full'\n }),\n time: (0, _index.default)({\n formats: timeFormats,\n defaultWidth: 'full'\n }),\n dateTime: (0, _index.default)({\n formats: dateTimeFormats,\n defaultWidth: 'full'\n })\n};\nvar _default = formatLong;\nexports.default = _default;\nmodule.exports = exports.default;","import {\n AfterViewInit,\n ChangeDetectionStrategy,\n Component,\n HostBinding,\n Input\n} from '@angular/core';\n\n@Component({\n selector: 'app-full-height-container',\n templateUrl: './full-height-container.component.html',\n styleUrls: ['./full-height-container.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class FullHeightContainerComponent implements AfterViewInit {\n @Input()\n public readonly maxWidth: 'default' | 'modal' = 'default';\n\n @Input()\n public readonly isModal: boolean = false;\n\n @Input()\n public readonly isFullHeight: boolean = false;\n\n @Input()\n public readonly isVirtualScroll: boolean = false;\n\n @Input()\n public readonly withVerticalPadding: boolean = false;\n\n @HostBinding('class.full-height')\n public get fullHeight() {\n return this.isFullHeight || this.isVirtualScroll;\n }\n\n @HostBinding('class.is-modal')\n public get modal() {\n return this.isModal;\n }\n\n public ngAfterViewInit(): void {\n if (this.isVirtualScroll && this.isModal) {\n const scrollcontainer = document.querySelector(\n '.virtual-scroll-container'\n );\n\n if (scrollcontainer) {\n scrollcontainer.ontouchmove = function (e) {\n e.stopPropagation();\n };\n }\n }\n }\n}\n","\n \n \n\n\n \n \n","export const dateTimestampProvider = {\n now() {\n return (dateTimestampProvider.delegate || Date).now();\n },\n delegate: undefined,\n};\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { DirectivesModule } from '@app/modules/directives.module';\nimport { FormatTimeModule } from '@app/modules/format-time/format-time.module';\nimport { IonicModule } from '@ionic/angular';\nimport { TimeFormControlComponent } from './time-form-control.component';\n\n@NgModule({\n declarations: [TimeFormControlComponent],\n imports: [CommonModule, IonicModule, DirectivesModule, FormatTimeModule],\n exports: [TimeFormControlComponent]\n})\nexport class TimeFormControlModule {}\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Optional, Inject, ɵɵinject, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, untracked, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, PLATFORM_ID, ɵIMAGE_CONFIG, Renderer2, ElementRef, Injector, DestroyRef, ɵperformanceMarkFeature, NgZone, ApplicationRef, ChangeDetectorRef, numberAttribute, booleanAttribute, ɵIMAGE_CONFIG_DEFAULTS, ɵunwrapSafeValue } from '@angular/core';\nexport { ɵIMAGE_CONFIG as IMAGE_CONFIG } from '@angular/core';\nimport { Subject } from 'rxjs';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n _DOM ??= adapter;\n}\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * This class wraps the platform Navigation API which allows server-specific and test\n * implementations.\n */\nclass PlatformNavigation {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, providedIn: 'platform', useFactory: () => window.navigation });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => window.navigation }]\n }] });\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken(ngDevMode ? 'DocumentToken' : '');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link /api/router/Router Router} in order to navigate between routes. Since all interactions between\n * {@link /api/router/Router Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }]\n }] });\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? 'Location Initialized' : '');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n _location;\n _history;\n _doc = inject(DOCUMENT);\n constructor() {\n super();\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n this._history.pushState(state, title, url);\n }\n replaceState(state, title, url) {\n this._history.replaceState(state, title, url);\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: () => new BrowserPlatformLocation() });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n useFactory: () => new BrowserPlatformLocation(),\n }]\n }], ctorParameters: () => [] });\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n // If `start` is an empty string, return `end` as the result.\n if (!start)\n return end;\n // If `end` is an empty string, return `start` as the result.\n if (!end)\n return start;\n // If `start` ends with a slash, remove the leading slash from `end`.\n if (start.endsWith('/')) {\n return end.startsWith('/') ? start + end.slice(1) : start + end;\n }\n // If `start` doesn't end with a slash, add one if `end` doesn't start with a slash.\n return end.startsWith('/') ? start + end : `${start}/${end}`;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n // Find the index of the first occurrence of `#`, `?`, or the end of the string.\n // This marks the start of the query string, fragment, or the end of the URL path.\n const pathEndIdx = url.search(/#|\\?|$/);\n // Check if the character before `pathEndIdx` is a trailing slash.\n // If it is, remove the trailing slash and return the modified URL.\n // Otherwise, return the URL as is.\n return url[pathEndIdx - 1] === '/' ? url.slice(0, pathEndIdx - 1) + url.slice(pathEndIdx) : url;\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? `?${params}` : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com/#/foo
,\n * and `PathLocationStrategy` produces\n * http://example.com/foo
as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined DI token for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```ts\n * import {NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken(ngDevMode ? 'appBaseHref' : '');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a ` ` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the ` ` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add ` ` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the ` ` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n _platformLocation;\n _baseHref;\n _removeListenerFns = [];\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref =\n href ??\n this._platformLocation.getBaseHrefFromDOM() ??\n inject(DOCUMENT).location?.origin ??\n '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }] });\n\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n _platformLocation;\n _baseHref = '';\n _removeListenerFns = [];\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n const path = this._platformLocation.hash ?? '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? '#' + url : url;\n }\n pushState(state, title, path, queryParams) {\n const url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)) ||\n this._platformLocation.pathname;\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n const url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)) ||\n this._platformLocation.pathname;\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HashLocationStrategy });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }] });\n\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass Location {\n /** @internal */\n _subject = new Subject();\n /** @internal */\n _basePath;\n /** @internal */\n _locationStrategy;\n /** @internal */\n _urlChangeListeners = [];\n /** @internal */\n _urlChangeSubscription = null;\n constructor(locationStrategy) {\n this._locationStrategy = locationStrategy;\n const baseHref = this._locationStrategy.getBaseHref();\n // Note: This class's interaction with base HREF does not fully follow the rules\n // outlined in the spec https://www.freesoft.org/CIE/RFC/1808/18.htm.\n // Instead of trying to fix individual bugs with more and more code, we should\n // investigate using the URL constructor and providing the base as a second\n // argument.\n // https://developer.mozilla.org/en-US/docs/Web/API/URL/URL#parameters\n this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));\n this._locationStrategy.onPopState((ev) => {\n this._subject.next({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._locationStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n this._urlChangeSubscription ??= this.subscribe((v) => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n return () => {\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach((fn) => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({\n next: onNext,\n error: onThrow ?? undefined,\n complete: onReturn ?? undefined,\n });\n }\n /**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\n static normalizeQueryParams = normalizeQueryParams;\n /**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\n static joinWithSlash = joinWithSlash;\n /**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\n static stripTrailingSlash = stripTrailingSlash;\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: () => [{ type: LocationStrategy }] });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBasePath(basePath, url) {\n if (!basePath || !url.startsWith(basePath)) {\n return url;\n }\n const strippedUrl = url.substring(basePath.length);\n if (strippedUrl === '' || ['/', ';', '?', '#'].includes(strippedUrl[0])) {\n return strippedUrl;\n }\n return url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\nfunction _stripOrigin(baseHref) {\n // DO NOT REFACTOR! Previously, this check looked like this:\n // `/^(https?:)?\\/\\//.test(baseHref)`, but that resulted in\n // syntactically incorrect code after Closure Compiler minification.\n // This was likely caused by a bug in Closure Compiler, but\n // for now, the check is rewritten to use `new RegExp` instead.\n const isAbsoluteUrl = new RegExp('^(https?:)?//').test(baseHref);\n if (isAbsoluteUrl) {\n const [, pathname] = baseHref.split(/\\/\\/[^\\/]+/);\n return pathname;\n }\n return baseHref;\n}\n\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * Format styles that can be used to represent numbers.\n * @see {@link getLocaleNumberFormat}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated `getLocaleNumberFormat` is deprecated\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see {@link NgPlural}\n * @see {@link NgPluralCase}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated `getLocalePluralCase` is deprecated\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated locale data getters are deprecated\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n *\n * @deprecated locale data getters are deprecated\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see {@link getLocaleDateFormat}\n * @see {@link getLocaleTimeFormat}\n * @see {@link getLocaleDateTimeFormat}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n * @publicApi\n *\n * @deprecated Date locale data getters are deprecated\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, `'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n// This needs to be an object literal, rather than an enum, because TypeScript 5.4+\n// doesn't allow numeric keys and we have `Infinity` and `NaN`.\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see {@link getLocaleNumberSymbol}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated `getLocaleNumberSymbol` is deprecated\n *\n * @object-literal-as-enum\n */\nconst NumberSymbol = {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n Decimal: 0,\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n Group: 1,\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n List: 2,\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n PercentSign: 3,\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n PlusSign: 4,\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n MinusSign: 5,\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n Exponential: 6,\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n SuperscriptingExponent: 7,\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n PerMille: 8,\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n Infinity: 9,\n /**\n * Not a number.\n * Example: NaN\n */\n NaN: 10,\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n TimeSeparator: 11,\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n CurrencyDecimal: 12,\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n CurrencyGroup: 13,\n};\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n *\n * @deprecated Week locale getters are deprecated\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * This function serves no purpose when relying on the `Intl` API.\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat],\n data[ɵLocaleDataIndex.DayPeriodsStandalone],\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [\n data[ɵLocaleDataIndex.DaysFormat],\n data[ɵLocaleDataIndex.DaysStandalone],\n ];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [\n data[ɵLocaleDataIndex.MonthsFormat],\n data[ɵLocaleDataIndex.MonthsStandalone],\n ];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Intl's [`getWeekInfo`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Intl/Locale/getWeekInfo) has partial support (Chromium M99 & Safari 17).\n * You may want to rely on the following alternatives:\n * - Libraries like [`Luxon`](https://moment.github.io/luxon/#/) rely on `Intl` but fallback on the ISO 8601 definition (monday) if `getWeekInfo` is not supported.\n * - Other librairies like [`date-fns`](https://date-fns.org/), [`day.js`](https://day.js.org/en/) or [`weekstart`](https://www.npmjs.com/package/weekstart) library provide their own locale based data for the first day of the week.\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Intl's [`getWeekInfo`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Intl/Locale/getWeekInfo) has partial support (Chromium M99 & Safari 17).\n * Libraries like [`Luxon`](https://moment.github.io/luxon/#/) rely on `Intl` but fallback on the ISO 8601 definition (Saturday+Sunday) if `getWeekInfo` is not supported .\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n\n * @publicApi\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.DateTimeFormat` for date formating instead.\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize. Must be one of `NumberSymbol`.\n * @returns The character for the localized symbol.\n * @see {@link NumberSymbol}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.NumberFormat` to format numbers instead.\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see {@link NumberFormatStyle}\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.NumberFormat` determine the number format instead\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n *\n * @deprecated We recommend you create a map of locale to ISO 4217 currency codes.\n * Time relative currency data is provided by the CLDR project. See https://www.unicode.org/cldr/charts/44/supplemental/detailed_territory_currency_information.html\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.PluralRules` instead\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex.LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see {@link getLocaleExtraDayPeriods}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.DateTimeFormat` determine the day period instead.\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see {@link getLocaleExtraDayPeriodRules}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * To extract a day period use `Intl.DateTimeFormat` with the `dayPeriod` option instead.\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */],\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * For dates and numbers, let `Intl.DateTimeFormat()` and `Intl.NumberFormat()` determine the writing direction.\n * The `Intl` alternative [`getTextInfo`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Intl/Locale/getTextInfo).\n * has only partial support (Chromium M99 & Safari 17).\n * 3rd party alternatives like [`rtl-detect`](https://www.npmjs.com/package/rtl-detect) can work around this issue.\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * You can use `Intl.NumberFormat().formatToParts()` to extract the currency symbol.\n * For example: `Intl.NumberFormat('en', {style:'currency', currency: 'USD'}).formatToParts().find(part => part.type === 'currency').value`\n * returns `$` for USD currency code in the `en` locale.\n * Note: `US$` is a currency symbol for the `en-ca` locale but not the `en-us` locale.\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * This function should not be used anymore. Let `Intl.NumberFormat` determine the number of digits to display for the currency\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`).\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see {@link DatePipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach((value) => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter\n ? dateFormatter(date, locale, dateTimezoneOffset)\n : value === \"''\"\n ? \"'\"\n : value.replace(/(^'|'$)/g, '').replace(/''/g, \"'\");\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] ??= {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [\n shortTime,\n shortDate,\n ]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [\n mediumTime,\n mediumDate,\n ]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [\n longTime,\n longDate,\n ]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [\n fullTime,\n fullDate,\n ]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return opt_values != null && key in opt_values ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === 3 /* DateType.Hours */) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === 6 /* DateType.FractionalSeconds */) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case 0 /* DateType.FullYear */:\n return date.getFullYear();\n case 1 /* DateType.Month */:\n return date.getMonth();\n case 2 /* DateType.Date */:\n return date.getDate();\n case 3 /* DateType.Hours */:\n return date.getHours();\n case 4 /* DateType.Minutes */:\n return date.getMinutes();\n case 5 /* DateType.Seconds */:\n return date.getSeconds();\n case 6 /* DateType.FractionalSeconds */:\n return date.getMilliseconds();\n case 7 /* DateType.Day */:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case 2 /* TranslationType.Months */:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case 1 /* TranslationType.Days */:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case 0 /* TranslationType.DayPeriods */:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex((rule) => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = currentHours < to.hours || (currentHours === to.hours && currentMinutes < to.minutes);\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else {\n // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case 3 /* TranslationType.Eras */:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case 0 /* ZoneWidth.Short */:\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case 1 /* ZoneWidth.ShortGMT */:\n return 'GMT' + (zone >= 0 ? '+' : '') + padNumber(hours, 1, minusSign);\n case 2 /* ZoneWidth.Long */:\n return ('GMT' +\n (zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case 3 /* ZoneWidth.Extended */:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + (firstDayOfYear <= THURSDAY ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\n/**\n * ISO Week starts on day 1 (Monday) and ends with day 0 (Sunday)\n */\nfunction getThursdayThisIsoWeek(datetime) {\n // getDay returns 0-6 range with sunday as 0.\n const currentDay = datetime.getDay();\n // On a Sunday, read the previous Thursday since ISO weeks start on Monday.\n const deltaToThursday = currentDay === 0 ? -3 : THURSDAY - currentDay;\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + deltaToThursday);\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisIsoWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisIsoWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(0 /* DateType.FullYear */, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(0 /* DateType.FullYear */, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(0 /* DateType.FullYear */, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(0 /* DateType.FullYear */, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(1 /* DateType.Month */, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(1 /* DateType.Month */, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(2 /* DateType.Date */, 1);\n break;\n case 'dd':\n formatter = dateGetter(2 /* DateType.Date */, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(7 /* DateType.Day */, 1);\n break;\n case 'ccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(3 /* DateType.Hours */, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(3 /* DateType.Hours */, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(3 /* DateType.Hours */, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(3 /* DateType.Hours */, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(4 /* DateType.Minutes */, 1);\n break;\n case 'mm':\n formatter = dateGetter(4 /* DateType.Minutes */, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(5 /* DateType.Seconds */, 1);\n break;\n case 'ss':\n formatter = dateGetter(5 /* DateType.Seconds */, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 1);\n break;\n case 'SS':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 2);\n break;\n case 'SSS':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(0 /* ZoneWidth.Short */);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(3 /* ZoneWidth.Extended */);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(1 /* ZoneWidth.ShortGMT */);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(2 /* ZoneWidth.Long */);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if ((match = value.match(ISO8601_DATE_REGEX))) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every((d) => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return (res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim());\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0,\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1\n ? positive.split(DECIMAL_SEP)\n : [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1),\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = groups[2] || groups[1] ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) {\n /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, (roundAt = fractionSize + 1));\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n locale;\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n/format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```html\n * ... \n *\n * ... \n * ```\n *\n * For more simple use cases you can use the [class bindings](/guide/templates/binding#css-class-and-style-property-bindings) directly.\n * It doesn't require importing a directive.\n *\n * ```html\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n * ```\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n *\n * @see [Class bindings](/guide/templates/binding#css-class-and-style-property-bindings)\n *\n * @publicApi\n */\nclass NgClass {\n _ngEl;\n _renderer;\n initialClasses = EMPTY_ARRAY;\n rawClass;\n stateMap = new Map();\n constructor(_ngEl, _renderer) {\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach((klass) => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgClass, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.Renderer2 }], propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link /api/core/Component Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInputs`: Optional component inputs object, which will be bind to the\n * component.\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```html\n * \n * ```\n *\n * With inputs\n * ```html\n * \n * \n * ```\n *\n * Customized injector/content\n * ```html\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```html\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n _viewContainerRef;\n // TODO(crisbeto): this should be `Type`, but doing so broke a few\n // targets in a TGP so we need to do it in a major version.\n /** Component that should be rendered in the outlet. */\n ngComponentOutlet = null;\n ngComponentOutletInputs;\n ngComponentOutletInjector;\n ngComponentOutletContent;\n ngComponentOutletNgModule;\n /**\n * @deprecated This input is deprecated, use `ngComponentOutletNgModule` instead.\n */\n ngComponentOutletNgModuleFactory;\n _componentRef;\n _moduleRef;\n /**\n * A helper data structure that allows us to track inputs that were part of the\n * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones\n * that are no longer referenced.\n */\n _inputsUsed = new Map();\n /**\n * Gets the instance of the currently-rendered component.\n * Will be null if no component has been rendered.\n */\n get componentInstance() {\n return this._componentRef?.instance ?? null;\n }\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n }\n _needToReCreateNgModuleInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutletNgModule'] !== undefined ||\n changes['ngComponentOutletNgModuleFactory'] !== undefined);\n }\n _needToReCreateComponentInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutlet'] !== undefined ||\n changes['ngComponentOutletContent'] !== undefined ||\n changes['ngComponentOutletInjector'] !== undefined ||\n this._needToReCreateNgModuleInstance(changes));\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (this._needToReCreateComponentInstance(changes)) {\n this._viewContainerRef.clear();\n this._inputsUsed.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (this._needToReCreateNgModuleInstance(changes)) {\n this._moduleRef?.destroy();\n if (this.ngComponentOutletNgModule) {\n this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));\n }\n else if (this.ngComponentOutletNgModuleFactory) {\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n }\n /** @nodoc */\n ngDoCheck() {\n if (this._componentRef) {\n if (this.ngComponentOutletInputs) {\n for (const inputName of Object.keys(this.ngComponentOutletInputs)) {\n this._inputsUsed.set(inputName, true);\n }\n }\n this._applyInputStateDiff(this._componentRef);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n this._moduleRef?.destroy();\n }\n _applyInputStateDiff(componentRef) {\n for (const [inputName, touched] of this._inputsUsed) {\n if (!touched) {\n // The input that was previously active no longer exists and needs to be set to undefined.\n componentRef.setInput(inputName, undefined);\n this._inputsUsed.delete(inputName);\n }\n else {\n // Since touched is true, it can be asserted that the inputs object is not empty.\n componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);\n this._inputsUsed.set(inputName, false);\n }\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInputs: \"ngComponentOutletInputs\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, exportAs: [\"ngComponentOutlet\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n exportAs: 'ngComponentOutlet',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }], propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInputs: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @publicApi\n */\nclass NgForOfContext {\n $implicit;\n ngForOf;\n index;\n count;\n constructor(\n /** Reference to the current item from the collection. */\n $implicit, \n /**\n * The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe\n * (`userStreams | async`).\n */\n ngForOf, \n /** Returns an index of the current item in the collection. */\n index, \n /** Returns total amount of items in the collection. */\n count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n // Indicates whether this is the first item in the collection.\n get first() {\n return this.index === 0;\n }\n // Indicates whether this is the last item in the collection.\n get last() {\n return this.index === this.count - 1;\n }\n // Indicates whether an index of this item in the collection is even.\n get even() {\n return this.index % 2 === 0;\n }\n // Indicates whether an index of this item in the collection is odd.\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/directives/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/directives/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```html\n * ... \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```html\n * \n * ... \n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/directives/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```html\n * \n * {{i}}/{{users.length}}. {{user}} default \n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as ` ` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/animations/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/directives/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n _viewContainer;\n _template;\n _differs;\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/directives/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see {@link TrackByFunction}\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n _ngForOf = null;\n _ngForOfDirty = true;\n _differ = null;\n // TODO(issue/24571): remove '!'\n // waiting for microsoft/typescript#43662 to allow the return type `TrackByFunction|undefined` for\n // the getter\n _trackByFn;\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/templates/variables#template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }], propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/directives/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```html\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```html\n * Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```html\n * Content to render when condition is true.
\n * Content to render when condition is false. \n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```html\n *
\n * Content to render when condition is true. \n * Content to render when condition is false. \n * ```\n *\n * Form with storing the value locally:\n *\n * ```html\n * {{value}}
\n * Content to render when value is null. \n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```html\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```html\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n _viewContainer;\n _context = new NgIfContext();\n _thenTemplateRef = null;\n _elseTemplateRef = null;\n _thenViewRef = null;\n _elseViewRef = null;\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /** @internal */\n static ngIfUseIfTypeGuard;\n /**\n * Assert the correct type of the expression bound to the `ngIf` input within the template.\n *\n * The presence of this static field is a signal to the Ivy template type check compiler that\n * when the `NgIf` structural directive renders its template, the type of the expression bound\n * to `ngIf` should be narrowed in some way. For `NgIf`, the binding expression itself is used to\n * narrow its type, which allows the strictNullChecks feature of TypeScript to work with `NgIf`.\n */\n static ngTemplateGuard_ngIf;\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }], propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n $implicit = null;\n ngIf = null;\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n _viewContainerRef;\n _templateRef;\n _created = false;\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```html\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```html\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```html\n * \n * \n * ... \n * ... \n * ... \n * \n * ... \n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```html\n * \n * ... \n * ... \n * ... \n * \n * \n * \n * \n * \n * ... \n * \n * ```\n *\n * @publicApi\n * @see {@link NgSwitchCase}\n * @see {@link NgSwitchDefault}\n * @see [Structural Directives](guide/directives/structural-directives)\n *\n */\nclass NgSwitch {\n _defaultViews = [];\n _defaultUsed = false;\n _caseCount = 0;\n _lastCaseCheckIndex = 0;\n _lastCasesMatched = false;\n _ngSwitch;\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value === this._ngSwitch;\n this._lastCasesMatched ||= matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```html\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * As of Angular v17 the NgSwitch directive uses strict equality comparison (`===`) instead of\n * loose equality (`==`) to match different cases.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchDefault}\n *\n */\nclass NgSwitchCase {\n ngSwitch;\n _view;\n /**\n * Stores the HTML template to be selected on match.\n */\n ngSwitchCase;\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }], propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchCase}\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }] });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```html\n * \n * there is nothing \n * there is one \n * there are a few \n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n _localization;\n _activeView;\n _caseViews = {};\n constructor(_localization) {\n this._localization = _localization;\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n }]\n }], ctorParameters: () => [{ type: NgLocalization }], propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```html\n * \n * ... \n * ... \n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n value;\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }] });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```html\n * ... \n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```html\n * ... \n * ```\n *\n * For more simple use cases you can use the [style bindings](/guide/templates/binding#css-class-and-style-property-bindings) directly.\n * It doesn't require importing a directive.\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```html\n * ... \n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @see [Style bindings](/guide/templates/binding#css-class-and-style-property-bindings)\n *\n * @publicApi\n */\nclass NgStyle {\n _ngEl;\n _differs;\n _renderer;\n _ngStyle = null;\n _differ = null;\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }], propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```html\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n _viewContainerRef;\n _viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n ngTemplateOutletInjector = null;\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n }\n ngOnChanges(changes) {\n if (this._shouldRecreateView(changes)) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n // If there is no outlet, clear the destroyed view ref.\n if (!this.ngTemplateOutlet) {\n this._viewRef = null;\n return;\n }\n // Create a context forward `Proxy` that will always bind to the user-specified context,\n // without having to destroy and re-create views whenever the context changes.\n const viewContext = this._createContextForwardProxy();\n this._viewRef = viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, viewContext, {\n injector: this.ngTemplateOutletInjector ?? undefined,\n });\n }\n }\n /**\n * We need to re-create existing embedded view if either is true:\n * - the outlet changed.\n * - the injector changed.\n */\n _shouldRecreateView(changes) {\n return !!changes['ngTemplateOutlet'] || !!changes['ngTemplateOutletInjector'];\n }\n /**\n * For a given outlet instance, we create a proxy object that delegates\n * to the user-specified context. This allows changing, or swapping out\n * the context object completely without having to destroy/re-create the view.\n */\n _createContextForwardProxy() {\n return new Proxy({}, {\n set: (_target, prop, newValue) => {\n if (!this.ngTemplateOutletContext) {\n return false;\n }\n return Reflect.set(this.ngTemplateOutletContext, prop, newValue);\n },\n get: (_target, prop, receiver) => {\n if (!this.ngTemplateOutletContext) {\n return undefined;\n }\n return Reflect.get(this.ngTemplateOutletContext, prop, receiver);\n },\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }], propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n // Subscription can be side-effectful, and we don't want any signal reads which happen in the\n // side effect of the subscription to be tracked by a component's template when that\n // subscription is triggered via the async pipe. So we wrap the subscription in `untracked` to\n // decouple from the current reactive context.\n //\n // `untracked` also prevents signal _writes_ which happen in the subscription side effect from\n // being treated as signal writes during the template evaluation (which throws errors).\n return untracked(() => async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n },\n }));\n }\n dispose(subscription) {\n // See the comment in `createSubscription` above on the use of `untracked`.\n untracked(() => subscription.unsubscribe());\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, (e) => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n _ref;\n _latestValue = null;\n markForCheckOnValueUpdate = true;\n _subscription = null;\n _obj = null;\n _strategy = null;\n constructor(ref) {\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n try {\n // Only call `markForCheck` if the value is updated asynchronously.\n // Synchronous updates _during_ subscription should not wastefully mark for check -\n // this value is already going to be returned from the transform function.\n this.markForCheckOnValueUpdate = false;\n this._subscribe(obj);\n }\n finally {\n this.markForCheckOnValueUpdate = true;\n }\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n if (this.markForCheckOnValueUpdate) {\n this._ref?.markForCheck();\n }\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n }]\n }], ctorParameters: () => [{ type: i0.ChangeDetectorRef }] });\n\n/**\n * Transforms text to all lower case.\n *\n * @see {@link UpperCasePipe}\n * @see {@link TitleCasePipe}\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * {@example common/pipes/ts/lowerupper_pipe.ts region='LowerUpperPipe'}\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see {@link LowerCasePipe}\n * @see {@link UpperCasePipe}\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * {@example common/pipes/ts/titlecase_pipe.ts region='TitleCasePipe'}\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt) => txt[0].toUpperCase() + txt.slice(1).toLowerCase());\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see {@link LowerCasePipe}\n * @see {@link TitleCasePipe}\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n }]\n }] });\n\n/**\n * The default date format of Angular date pipe, which corresponds to the following format:\n * `'MMM d,y'` (e.g. `Jun 15, 2015`)\n */\nconst DEFAULT_DATE_FORMAT = 'mediumDate';\n\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n *\n * @deprecated use DATE_PIPE_DEFAULT_OPTIONS token to configure DatePipe\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken(ngDevMode ? 'DATE_PIPE_DEFAULT_TIMEZONE' : '');\n/**\n * DI token that allows to provide default configuration for the `DatePipe` instances in an\n * application. The value is an object which can include the following fields:\n * - `dateFormat`: configures the default date format. If not provided, the `DatePipe`\n * will use the 'mediumDate' as a value.\n * - `timezone`: configures the default timezone. If not provided, the `DatePipe` will\n * use the end-user's local system timezone.\n *\n * @see {@link DatePipeConfig}\n *\n * @usageNotes\n *\n * Various date pipe default values can be overwritten by providing this token with\n * the value that has this interface.\n *\n * For example:\n *\n * Override the default date format by providing a value using the token:\n * ```ts\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {dateFormat: 'shortDate'}}\n * ]\n * ```\n *\n * Override the default timezone by providing a value using the token:\n * ```ts\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {timezone: '-1200'}}\n * ]\n * ```\n */\nconst DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken(ngDevMode ? 'DATE_PIPE_DEFAULT_OPTIONS' : '');\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n/format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_OPTIONS`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see {@link formatDate}\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------------|-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | ISO Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | ISO Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * {{ dateObj | date:\"MMM dd, yyyy 'at' hh:mm a\" }} // output is 'Jun 15, 2015 at 09:43 PM'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```angular-ts\n * @Component({\n * selector: 'date-pipe',\n * template: `\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\nclass DatePipe {\n locale;\n defaultTimezone;\n defaultOptions;\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }] });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n _localization;\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n }]\n }], ctorParameters: () => [{ type: NgLocalization }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n * Passing `null` as the compareFn will use natural ordering of the input.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n differs;\n constructor(differs) {\n this.differs = differs;\n }\n differ;\n keyValues = [];\n compareFn = defaultComparator;\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n // make a differ for whatever type we've been passed in\n this.differ ??= this.differs.find(input).create();\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n if (compareFn) {\n this.keyValues.sort(compareFn);\n }\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n }]\n }], ctorParameters: () => [{ type: i0.KeyValueDiffers }] });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // If both keys are the same, return 0 (no sorting needed).\n if (a === b)\n return 0;\n // If one of the keys is `null` or `undefined`, place it at the end of the sort.\n if (a == null)\n return 1; // `a` comes after `b`.\n if (b == null)\n return -1; // `b` comes after `a`.\n // If both keys are strings, compare them lexicographically.\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n // If both keys are numbers, sort them numerically.\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n // If both keys are booleans, sort `false` before `true`.\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // Fallback case: if keys are of different types, compare their string representations.\n const aString = String(a);\n const bString = String(b);\n // Compare the string representations lexicographically.\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see {@link formatNumber}\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n/locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * {@example common/pipes/ts/number_pipe.ts region='NumberPipe'}\n *\n * @publicApi\n */\nclass DecimalPipe {\n _locale;\n constructor(_locale) {\n this._locale = _locale;\n }\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see {@link formatPercent}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * {@example common/pipes/ts/percent_pipe.ts region='PercentPipe'}\n *\n * @publicApi\n */\nclass PercentPipe {\n _locale;\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see {@link getCurrencySymbol}\n * @see {@link formatCurrency}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * {@example common/pipes/ts/currency_pipe.ts region='CurrencyPipe'}\n *\n * @publicApi\n */\nclass CurrencyPipe {\n _locale;\n _defaultCurrencyCode;\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }] });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b \n * c \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n const supports = typeof value === 'string' || Array.isArray(value);\n if (!supports) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\n static ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\n static ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('19.2.1');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n // De-sugared tree-shakable injection\n // See #23917\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => typeof ngServerMode !== 'undefined' && ngServerMode\n ? new NullViewportScroller()\n : new BrowserViewportScroller(inject(DOCUMENT), window),\n });\n}\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n document;\n window;\n offset = () => [0, 0];\n constructor(document, window) {\n this.document = document;\n this.window = window;\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n return [this.window.scrollX, this.window.scrollY];\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n this.window.scrollTo(position[0], position[1]);\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n this.window.history.scrollRestoration = scrollRestoration;\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' &&\n document.body &&\n typeof document.body.attachShadow === 'function') {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * Value (out of 100) of the requested quality for placeholder images.\n */\nconst PLACEHOLDER_QUALITY = '20';\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? new URL(url).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken(ngDevMode ? 'ImageLoader' : '', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\` \\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params += `,quality=${PLACEHOLDER_QUALITY}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl,\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode\n ? [\n 'https://res.cloudinary.com/mysite',\n 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com',\n ]\n : undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n // For a placeholder image, we use the lowest image setting available to reduce the load time\n // else we use the auto size\n const quality = config.isPlaceholder ? 'q_auto:low' : 'q_auto';\n let params = `f_auto,${quality}`;\n if (config.width) {\n params += `,w_${config.width}`;\n }\n if (config.loaderParams?.['rounded']) {\n params += `,r_max`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n const params = [];\n if (width) {\n params.push(`w-${width}`);\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params.push(`q-${PLACEHOLDER_QUALITY}`);\n }\n const urlSegments = params.length ? [path, `tr:${params.join(',')}`, src] : [path, src];\n const url = new URL(urlSegments.join('/'));\n return url.href;\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl,\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n return url.href;\n}\n\n/**\n * Name and URL tester for Netlify.\n */\nconst netlifyLoaderInfo = {\n name: 'Netlify',\n testUrl: isNetlifyUrl,\n};\nconst NETLIFY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.netlify\\.app\\/.+/;\n/**\n * Tests whether a URL is from a Netlify site. This won't catch sites with a custom domain,\n * but it's a good start for sites in development. This is only used to warn users who haven't\n * configured an image loader.\n */\nfunction isNetlifyUrl(url) {\n return NETLIFY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Netlify and turns it into an Angular provider.\n *\n * @param path optional URL of the desired Netlify site. Defaults to the current site.\n * @returns Set of providers to configure the Netlify loader.\n *\n * @publicApi\n */\nfunction provideNetlifyLoader(path) {\n if (path && !isValidPath(path)) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply either the full URL to the Netlify site, or leave it empty to use the current site.`);\n }\n if (path) {\n const url = new URL(path);\n path = url.origin;\n }\n const loaderFn = (config) => {\n return createNetlifyUrl(config, path);\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n}\nconst validParams = new Map([\n ['height', 'h'],\n ['fit', 'fit'],\n ['quality', 'q'],\n ['q', 'q'],\n ['position', 'position'],\n]);\nfunction createNetlifyUrl(config, path) {\n // Note: `path` can be undefined, in which case we use a fake one to construct a `URL` instance.\n const url = new URL(path ?? 'https://a/');\n url.pathname = '/.netlify/images';\n if (!isAbsoluteUrl(config.src) && !config.src.startsWith('/')) {\n config.src = '/' + config.src;\n }\n url.searchParams.set('url', config.src);\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n // If the quality is specified in the loader config - always use provided value.\n const configQuality = config.loaderParams?.['quality'] ?? config.loaderParams?.['q'];\n if (config.isPlaceholder && !configQuality) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n for (const [param, value] of Object.entries(config.loaderParams ?? {})) {\n if (validParams.has(param)) {\n url.searchParams.set(validParams.get(param), value.toString());\n }\n else {\n if (ngDevMode) {\n console.warn(ɵformatRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, `The Netlify image loader has detected an \\` \\` tag with the unsupported attribute \"\\`${param}\\`\".`));\n }\n }\n }\n // The \"a\" hostname is used for relative URLs, so we can remove it from the final URL.\n return url.hostname === 'a' ? url.href.replace(url.origin, '') : url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc\n ? `(activated on an element with the \\`ngSrc=\"${ngSrc}\"\\`) `\n : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n // Map of full image URLs -> original `ngSrc` values.\n images = new Map();\n window = null;\n observer = null;\n constructor() {\n const isBrowser = isPlatformBrowser(inject(PLATFORM_ID));\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (isBrowser && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const img = this.images.get(imgSrc);\n if (!img)\n return;\n if (!img.priority && !img.alreadyWarnedPriority) {\n img.alreadyWarnedPriority = true;\n logMissingPriorityError(imgSrc);\n }\n if (img.modified && !img.alreadyWarnedModified) {\n img.alreadyWarnedModified = true;\n logModifiedWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc, isPriority) {\n if (!this.observer)\n return;\n const newObservedImageState = {\n priority: isPriority,\n modified: false,\n alreadyWarnedModified: false,\n alreadyWarnedPriority: false,\n };\n this.images.set(getUrl(rewrittenSrc, this.window).href, newObservedImageState);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n updateImage(originalSrc, newSrc) {\n if (!this.observer)\n return;\n const originalUrl = getUrl(originalSrc, this.window).href;\n const img = this.images.get(originalUrl);\n if (img) {\n img.modified = true;\n this.images.set(getUrl(newSrc, this.window).href, img);\n this.images.delete(originalUrl);\n }\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\nfunction logMissingPriorityError(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.error(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\nfunction logModifiedWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2964 /* RuntimeErrorCode.LCP_IMG_NGSRC_MODIFIED */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element and has had its \"ngSrc\" attribute modified. This can cause ` +\n `slower loading performance. It is recommended not to modify the \"ngSrc\" ` +\n `property on any image which could be the LCP element.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```ts\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```ts\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken(ngDevMode ? 'PRECONNECT_CHECK_BLOCKLIST' : '');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding ` ` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n alreadySeen = new Set();\n window = this.document.defaultView;\n blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n constructor() {\n assertDevMode('preconnect link checker');\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, (origin) => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (typeof ngServerMode !== 'undefined' && ngServerMode)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks ??= this.queryPreconnectLinks();\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload ` ` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'NG_OPTIMIZED_PRELOADED_IMAGES' : '', {\n providedIn: 'root',\n factory: () => new Set(),\n});\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n preloadedImages = inject(PRELOADED_IMAGES);\n document = inject(DOCUMENT);\n /**\n * @description Add a preload ` ` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload ` ` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the ` ` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = 0.1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/**\n * Default blur radius of the CSS filter used on placeholder images, in pixels\n */\nconst PLACEHOLDER_BLUR_AMOUNT = 15;\n/**\n * Placeholder dimension (height or width) limit in pixels. Angular produces a warning\n * when this limit is crossed.\n */\nconst PLACEHOLDER_DIMENSION_LIMIT = 1000;\n/**\n * Used to warn or error when the user provides an overly large dataURL for the placeholder\n * attribute.\n * Character count of Base64 images is 1 character per byte, and base64 encoding is approximately\n * 33% larger than base images, so 4000 characters is around 3KB on disk and 10000 characters is\n * around 7.7KB. Experimentally, 4000 characters is about 20x20px in PNG or medium-quality JPEG\n * format, and 10,000 is around 50x50px, but there's quite a bit of variation depending on how the\n * image is saved.\n */\nconst DATA_URL_WARN_LIMIT = 4000;\nconst DATA_URL_ERROR_LIMIT = 10000;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [\n imgixLoaderInfo,\n imageKitLoaderInfo,\n cloudinaryLoaderInfo,\n netlifyLoaderInfo,\n];\n/**\n * Threshold for the PRIORITY_TRUE_COUNT\n */\nconst PRIORITY_COUNT_THRESHOLD = 10;\n/**\n * This count is used to log a devMode warning\n * when the count of directive instances with priority=true\n * exceeds the threshold PRIORITY_COUNT_THRESHOLD\n */\nlet IMGS_WITH_PRIORITY_ATTR_COUNT = 0;\n/**\n * This function is for testing purpose.\n */\nfunction resetImagePriorityCount() {\n IMGS_WITH_PRIORITY_ATTR_COUNT = 0;\n}\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the ` ` tag\n * - Lazy loading non-priority images by default\n * - Automatically generating a preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/components/importing) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary ` ` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```ts\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```ts\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```ts\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update ` ` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```html\n * \n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n imageLoader = inject(IMAGE_LOADER);\n config = processConfig(inject(ɵIMAGE_CONFIG));\n renderer = inject(Renderer2);\n imgElement = inject(ElementRef).nativeElement;\n injector = inject(Injector);\n // An LCP image observer should be injected only in development mode.\n // Do not assign it to `null` to avoid having a redundant property in the production bundle.\n lcpObserver;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n _renderedSrc = null;\n /**\n * Name of the source image.\n * Image name will be processed by the image loader and the final URL will be applied as the `src`\n * property of the image.\n */\n ngSrc;\n /**\n * A comma separated list of width or density descriptors.\n * The image name will be taken from `ngSrc` and combined with the list of width or density\n * descriptors to generate the final `srcset` property of the image.\n *\n * Example:\n * ```html\n * =>\n * \n * ```\n */\n ngSrcset;\n /**\n * The base `sizes` attribute passed through to the ` ` element.\n * Providing sizes causes the image to create an automatic responsive srcset.\n */\n sizes;\n /**\n * For responsive images: the intrinsic width of the image in pixels.\n * For fixed size images: the desired rendered width of the image in pixels.\n */\n width;\n /**\n * For responsive images: the intrinsic height of the image in pixels.\n * For fixed size images: the desired rendered height of the image in pixels.\n */\n height;\n /**\n * The desired loading behavior (lazy, eager, or auto). Defaults to `lazy`,\n * which is recommended for most images.\n *\n * Warning: Setting images as loading=\"eager\" or loading=\"auto\" marks them\n * as non-priority images and can hurt loading performance. For images which\n * may be the LCP element, use the `priority` attribute instead of `loading`.\n */\n loading;\n /**\n * Indicates whether this image should have a high priority.\n */\n priority = false;\n /**\n * Data to pass through to custom loaders.\n */\n loaderParams;\n /**\n * Disables automatic srcset generation for this image.\n */\n disableOptimizedSrcset = false;\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n */\n fill = false;\n /**\n * A URL or data URL for an image to be used as a placeholder while this image loads.\n */\n placeholder;\n /**\n * Configuration object for placeholder settings. Options:\n * * blur: Setting this to false disables the automatic CSS blur.\n */\n placeholderConfig;\n /**\n * Value of the `src` attribute if set on the host ` ` element.\n * This input is exclusively read to assert that `src` is not set in conflict\n * with `ngSrc` and that images don't start to load until a lazy loading strategy is set.\n * @internal\n */\n src;\n /**\n * Value of the `srcset` attribute if set on the host ` ` element.\n * This input is exclusively read to assert that `srcset` is not set in conflict\n * with `ngSrcset` and that images don't start to load until a lazy loading strategy is set.\n * @internal\n */\n srcset;\n constructor() {\n if (ngDevMode) {\n this.lcpObserver = this.injector.get(LCPImageObserver);\n // Using `DestroyRef` to avoid having an empty `ngOnDestroy` method since this\n // is only run in development mode.\n const destroyRef = inject(DestroyRef);\n destroyRef.onDestroy(() => {\n if (!this.priority && this._renderedSrc !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n });\n }\n }\n /** @nodoc */\n ngOnInit() {\n ɵperformanceMarkFeature('NgOptimizedImage');\n if (ngDevMode) {\n const ngZone = this.injector.get(NgZone);\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n // This leaves the Angular zone to avoid triggering unnecessary change detection cycles when\n // `load` tasks are invoked on images.\n ngZone.runOutsideAngular(() => assertNonZeroRenderedHeight(this, this.imgElement, this.renderer));\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n if (this.height !== undefined) {\n assertGreaterThanZero(this, this.height, 'height');\n }\n if (this.width !== undefined) {\n assertGreaterThanZero(this, this.width, 'width');\n }\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n ngZone.runOutsideAngular(() => assertNoImageDistortion(this, this.imgElement, this.renderer));\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertValidPlaceholder(this, this.imageLoader);\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc, this.priority);\n });\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n if (typeof ngServerMode !== 'undefined' && !ngServerMode) {\n const applicationRef = this.injector.get(ApplicationRef);\n assetPriorityCountBelowThreshold(applicationRef);\n }\n }\n }\n if (this.placeholder) {\n this.removePlaceholderOnLoad(this.imgElement);\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n this.sizes ||= '100vw';\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrcset = this.updateSrcAndSrcset();\n if (this.sizes) {\n if (this.getLoadingBehavior() === 'lazy') {\n this.setHostAttribute('sizes', 'auto, ' + this.sizes);\n }\n else {\n this.setHostAttribute('sizes', this.sizes);\n }\n }\n else {\n if (this.ngSrcset &&\n VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset) &&\n this.getLoadingBehavior() === 'lazy') {\n this.setHostAttribute('sizes', 'auto, 100vw');\n }\n }\n if (typeof ngServerMode !== 'undefined' && ngServerMode && this.priority) {\n const preloadLinkCreator = this.injector.get(PreloadLinkCreator);\n preloadLinkCreator.createPreloadLinkTag(this.renderer, this.getRewrittenSrc(), rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n if (changes['ngSrc'] && !changes['ngSrc'].isFirstChange()) {\n const oldSrc = this._renderedSrc;\n this.updateSrcAndSrcset(true);\n if (ngDevMode) {\n const newSrc = this._renderedSrc;\n if (oldSrc && newSrc && oldSrc !== newSrc) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.updateImage(oldSrc, newSrc);\n });\n }\n }\n }\n if (ngDevMode &&\n changes['placeholder']?.currentValue &&\n typeof ngServerMode !== 'undefined' &&\n !ngServerMode) {\n assertPlaceholderDimensions(this, this.imgElement);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset\n .split(',')\n .filter((src) => src !== '')\n .map((srcStr) => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter((bp) => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map((bp) => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n updateSrcAndSrcset(forceSrcRecalc = false) {\n if (forceSrcRecalc) {\n // Reset cached value, so that the followup `getRewrittenSrc()` call\n // will recalculate it and update the cache.\n this._renderedSrc = null;\n }\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n return rewrittenSrcset;\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map((multiplier) => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier,\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n let oversizedImage = false;\n if (!this.sizes) {\n oversizedImage =\n this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT;\n }\n return (!this.disableOptimizedSrcset &&\n !this.srcset &&\n this.imageLoader !== noopImageLoader &&\n !oversizedImage);\n }\n /**\n * Returns an image url formatted for use with the CSS background-image property. Expects one of:\n * * A base64 encoded image, which is wrapped and passed through.\n * * A boolean. If true, calls the image loader to generate a small placeholder url.\n */\n generatePlaceholder(placeholderInput) {\n const { placeholderResolution } = this.config;\n if (placeholderInput === true) {\n return `url(${this.callImageLoader({\n src: this.ngSrc,\n width: placeholderResolution,\n isPlaceholder: true,\n })})`;\n }\n else if (typeof placeholderInput === 'string') {\n return `url(${placeholderInput})`;\n }\n return null;\n }\n /**\n * Determines if blur should be applied, based on an optional boolean\n * property `blur` within the optional configuration object `placeholderConfig`.\n */\n shouldBlurPlaceholder(placeholderConfig) {\n if (!placeholderConfig || !placeholderConfig.hasOwnProperty('blur')) {\n return true;\n }\n return Boolean(placeholderConfig.blur);\n }\n removePlaceholderOnLoad(img) {\n const callback = () => {\n const changeDetectorRef = this.injector.get(ChangeDetectorRef);\n removeLoadListenerFn();\n removeErrorListenerFn();\n this.placeholder = false;\n changeDetectorRef.markForCheck();\n };\n const removeLoadListenerFn = this.renderer.listen(img, 'load', callback);\n const removeErrorListenerFn = this.renderer.listen(img, 'error', callback);\n callOnLoadIfImageIsLoaded(img, callback);\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"19.2.1\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: [\"ngSrc\", \"ngSrc\", unwrapSafeUrl], ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: [\"width\", \"width\", numberAttribute], height: [\"height\", \"height\", numberAttribute], loading: \"loading\", priority: [\"priority\", \"priority\", booleanAttribute], loaderParams: \"loaderParams\", disableOptimizedSrcset: [\"disableOptimizedSrcset\", \"disableOptimizedSrcset\", booleanAttribute], fill: [\"fill\", \"fill\", booleanAttribute], placeholder: [\"placeholder\", \"placeholder\", booleanOrUrlAttribute], placeholderConfig: \"placeholderConfig\", src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0\\\" : null\", \"style.background-size\": \"placeholder ? \\\"cover\\\" : null\", \"style.background-position\": \"placeholder ? \\\"50% 50%\\\" : null\", \"style.background-repeat\": \"placeholder ? \\\"no-repeat\\\" : null\", \"style.background-image\": \"placeholder ? generatePlaceholder(placeholder) : null\", \"style.filter\": \"placeholder && shouldBlurPlaceholder(placeholderConfig) ? \\\"blur(15px)\\\" : null\" } }, usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0\" : null',\n '[style.background-size]': 'placeholder ? \"cover\" : null',\n '[style.background-position]': 'placeholder ? \"50% 50%\" : null',\n '[style.background-repeat]': 'placeholder ? \"no-repeat\" : null',\n '[style.background-image]': 'placeholder ? generatePlaceholder(placeholder) : null',\n '[style.filter]': `placeholder && shouldBlurPlaceholder(placeholderConfig) ? \"blur(${PLACEHOLDER_BLUR_AMOUNT}px)\" : null`,\n },\n }]\n }], ctorParameters: () => [], propDecorators: { ngSrc: [{\n type: Input,\n args: [{ required: true, transform: unwrapSafeUrl }]\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], height: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], fill: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], placeholder: [{\n type: Input,\n args: [{ transform: booleanOrUrlAttribute }]\n }], placeholderConfig: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, ɵIMAGE_CONFIG_DEFAULTS, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\nfunction assertValidPlaceholder(dir, imageLoader) {\n assertNoPlaceholderConfigWithoutPlaceholder(dir);\n assertNoRelativePlaceholderWithoutLoader(dir, imageLoader);\n assertNoOversizedDataUrl(dir);\n}\n/**\n * Verifies that placeholderConfig isn't being used without placeholder\n */\nfunction assertNoPlaceholderConfigWithoutPlaceholder(dir) {\n if (dir.placeholderConfig && !dir.placeholder) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`placeholderConfig\\` options were provided for an ` +\n `image that does not use the \\`placeholder\\` attribute, and will have no effect.`);\n }\n}\n/**\n * Warns if a relative URL placeholder is specified, but no loader is present to provide the small\n * image.\n */\nfunction assertNoRelativePlaceholderWithoutLoader(dir, imageLoader) {\n if (dir.placeholder === true && imageLoader === noopImageLoader) {\n throw new ɵRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to true but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for the primary image and its placeholder. ` +\n `To fix this, provide a loader or remove the \\`placeholder\\` attribute from the image.`);\n }\n}\n/**\n * Warns or throws an error if an oversized dataURL placeholder is provided.\n */\nfunction assertNoOversizedDataUrl(dir) {\n if (dir.placeholder &&\n typeof dir.placeholder === 'string' &&\n dir.placeholder.startsWith('data:')) {\n if (dir.placeholder.length > DATA_URL_ERROR_LIMIT) {\n throw new ɵRuntimeError(2965 /* RuntimeErrorCode.OVERSIZED_PLACEHOLDER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to a data URL which is longer ` +\n `than ${DATA_URL_ERROR_LIMIT} characters. This is strongly discouraged, as large inline placeholders ` +\n `directly increase the bundle size of Angular and hurt page load performance. To fix this, generate ` +\n `a smaller data URL placeholder.`);\n }\n if (dir.placeholder.length > DATA_URL_WARN_LIMIT) {\n console.warn(ɵformatRuntimeError(2965 /* RuntimeErrorCode.OVERSIZED_PLACEHOLDER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to a data URL which is longer ` +\n `than ${DATA_URL_WARN_LIMIT} characters. This is discouraged, as large inline placeholders ` +\n `directly increase the bundle size of Angular and hurt page load performance. For better loading performance, ` +\n `generate a smaller data URL placeholder.`));\n }\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value\n .split(',')\n .every((num) => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason =\n `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason =\n `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an @if that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach((input) => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value. ` +\n `To fix this, provide \\`${inputName}\\` as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const callback = () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${round(suppliedAspectRatio)}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${round(renderedAspectRatio)}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = intrinsicWidth - recommendedWidth >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = intrinsicHeight - recommendedHeight >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n };\n const removeLoadListenerFn = renderer.listen(img, 'load', callback);\n // We only listen to the `error` event to remove the `load` event listener because it will not be\n // fired if the image fails to load. This is done to prevent memory leaks in development mode\n // because image elements aren't garbage-collected properly. It happens because zone.js stores the\n // event listener directly on the element and closures capture `dir`.\n const removeErrorListenerFn = renderer.listen(img, 'error', () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n });\n callOnLoadIfImageIsLoaded(img, callback);\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map((attr) => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const callback = () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n };\n const removeLoadListenerFn = renderer.listen(img, 'load', callback);\n // See comments in the `assertNoImageDistortion`.\n const removeErrorListenerFn = renderer.listen(img, 'error', () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n });\n callOnLoadIfImageIsLoaded(img, callback);\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n/**\n * Warns if the priority attribute is used too often on page load\n */\nasync function assetPriorityCountBelowThreshold(appRef) {\n if (IMGS_WITH_PRIORITY_ATTR_COUNT === 0) {\n IMGS_WITH_PRIORITY_ATTR_COUNT++;\n await appRef.whenStable();\n if (IMGS_WITH_PRIORITY_ATTR_COUNT > PRIORITY_COUNT_THRESHOLD) {\n console.warn(ɵformatRuntimeError(2966 /* RuntimeErrorCode.TOO_MANY_PRIORITY_ATTRIBUTES */, `NgOptimizedImage: The \"priority\" attribute is set to true more than ${PRIORITY_COUNT_THRESHOLD} times (${IMGS_WITH_PRIORITY_ATTR_COUNT} times). ` +\n `Marking too many images as \"high\" priority can hurt your application's LCP (https://web.dev/lcp). ` +\n `\"Priority\" should only be set on the image expected to be the page's LCP element.`));\n }\n }\n else {\n IMGS_WITH_PRIORITY_ATTR_COUNT++;\n }\n}\n/**\n * Warns if placeholder's dimension are over a threshold.\n *\n * This assert function is meant to only run on the browser.\n */\nfunction assertPlaceholderDimensions(dir, imgElement) {\n const computedStyle = window.getComputedStyle(imgElement);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n if (renderedWidth > PLACEHOLDER_DIMENSION_LIMIT || renderedHeight > PLACEHOLDER_DIMENSION_LIMIT) {\n console.warn(ɵformatRuntimeError(2967 /* RuntimeErrorCode.PLACEHOLDER_DIMENSION_LIMIT_EXCEEDED */, `${imgDirectiveDetails(dir.ngSrc)} it uses a placeholder image, but at least one ` +\n `of the dimensions attribute (height or width) exceeds the limit of ${PLACEHOLDER_DIMENSION_LIMIT}px. ` +\n `To fix this, use a smaller image as a placeholder.`));\n }\n}\nfunction callOnLoadIfImageIsLoaded(img, callback) {\n // https://html.spec.whatwg.org/multipage/embedded-content.html#dom-img-complete\n // The spec defines that `complete` is truthy once its request state is fully available.\n // The image may already be available if it’s loaded from the browser cache.\n // In that case, the `load` event will not fire at all, meaning that all setup\n // callbacks listening for the `load` event will not be invoked.\n // In Safari, there is a known behavior where the `complete` property of an\n // `HTMLImageElement` may sometimes return `true` even when the image is not fully loaded.\n // Checking both `img.complete` and `img.naturalWidth` is the most reliable way to\n // determine if an image has been fully loaded, especially in browsers where the\n // `complete` property may return `true` prematurely.\n if (img.complete && img.naturalWidth) {\n callback();\n }\n}\nfunction round(input) {\n return Number.isInteger(input) ? input : input.toFixed(2);\n}\n// Transform function to handle SafeValue input for ngSrc. This doesn't do any sanitization,\n// as that is not needed for img.src and img.srcset. This transform is purely for compatibility.\nfunction unwrapSafeUrl(value) {\n if (typeof value === 'string') {\n return value;\n }\n return ɵunwrapSafeValue(value);\n}\n// Transform function to handle inputs which may be booleans, strings, or string representations\n// of boolean values. Used for the placeholder attribute.\nfunction booleanOrUrlAttribute(value) {\n if (typeof value === 'string' && value !== 'true' && value !== 'false' && value !== '') {\n return value;\n }\n return booleanAttribute(value);\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, provideNetlifyLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PlatformNavigation as ɵPlatformNavigation, getDOM as ɵgetDOM, normalizeQueryParams as ɵnormalizeQueryParams, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","import { Injectable } from '@angular/core';\nimport { ToastController } from '@ionic/angular';\nimport { HapticsService } from './haptics.service';\n\n@Injectable({ providedIn: 'root' })\nexport class ToastService {\n public constructor(\n private readonly _toastController: ToastController,\n private readonly _hapticsService: HapticsService\n ) {}\n\n public async presentToast(\n message: string,\n options?: {\n duration?: number;\n position?: 'top' | 'bottom';\n okText?: string;\n okCallback?: (role: string) => void;\n }\n ) {\n if (!options) {\n options = {};\n }\n\n if (!options.duration) {\n options.duration = 5000;\n }\n\n if (!options.position) {\n options.position = 'bottom';\n }\n\n if (!options.okText) {\n options.okText = 'OK';\n }\n\n this.dismissAll();\n\n const toast = await this._toastController.create({\n message,\n duration: options.duration,\n position: options.position,\n buttons: [{ text: options.okText, role: 'cancel', side: 'end' }]\n });\n toast.present();\n\n const { role } = await toast.onWillDismiss();\n\n if (role === 'cancel') {\n this._hapticsService.hapticsImpact();\n\n options.okCallback && options.okCallback(role);\n }\n }\n\n public async dismissAll() {\n const topToast = await this._toastController.getTop();\n if (topToast) {\n await topToast.dismiss();\n }\n }\n}\n","import { Injectable } from '@angular/core';\nimport { Haptics, ImpactStyle } from '@capacitor/haptics';\nimport { Capacitor } from '@capacitor/core';\n\n@Injectable({ providedIn: 'root' })\nexport class HapticsService {\n private isMobile = Capacitor.getPlatform() !== 'web';\n\n public async hapticsImpact(impactStyle: ImpactStyle = ImpactStyle.Light) {\n if (this.isMobile) {\n await Haptics.impact({ style: impactStyle });\n }\n }\n}\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = format;\nvar _index = _interopRequireDefault(require(\"../isValid/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"../subMilliseconds/index.js\"));\nvar _index3 = _interopRequireDefault(require(\"../toDate/index.js\"));\nvar _index4 = _interopRequireDefault(require(\"../_lib/format/formatters/index.js\"));\nvar _index5 = _interopRequireDefault(require(\"../_lib/format/longFormatters/index.js\"));\nvar _index6 = _interopRequireDefault(require(\"../_lib/getTimezoneOffsetInMilliseconds/index.js\"));\nvar _index7 = require(\"../_lib/protectedTokens/index.js\");\nvar _index8 = _interopRequireDefault(require(\"../_lib/toInteger/index.js\"));\nvar _index9 = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\nvar _index10 = require(\"../_lib/defaultOptions/index.js\");\nvar _index11 = _interopRequireDefault(require(\"../_lib/defaultLocale/index.js\"));\n// This RegExp consists of three parts separated by `|`:\n// - [yYQqMLwIdDecihHKkms]o matches any available ordinal number token\n// (one of the certain letters followed by `o`)\n// - (\\w)\\1* matches any sequences of the same letter\n// - '' matches two quote characters in a row\n// - '(''|[^'])+('|$) matches anything surrounded by two quote characters ('),\n// except a single quote symbol, which ends the sequence.\n// Two quote characters do not end the sequence.\n// If there is no matching single quote\n// then the sequence will continue until the end of the string.\n// - . matches any single character unmatched by previous parts of the RegExps\nvar formattingTokensRegExp = /[yYQqMLwIdDecihHKkms]o|(\\w)\\1*|''|'(''|[^'])+('|$)|./g;\n\n// This RegExp catches symbols escaped by quotes, and also\n// sequences of symbols P, p, and the combinations like `PPPPPPPppppp`\nvar longFormattingTokensRegExp = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g;\nvar escapedStringRegExp = /^'([^]*?)'?$/;\nvar doubleQuoteRegExp = /''/g;\nvar unescapedLatinCharacterRegExp = /[a-zA-Z]/;\n\n/**\n * @name format\n * @category Common Helpers\n * @summary Format the date.\n *\n * @description\n * Return the formatted date string in the given format. The result may vary by locale.\n *\n * > ⚠️ Please note that the `format` tokens differ from Moment.js and other libraries.\n * > See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * The characters wrapped between two single quotes characters (') are escaped.\n * Two single quotes in a row, whether inside or outside a quoted sequence, represent a 'real' single quote.\n * (see the last example)\n *\n * Format of the string is based on Unicode Technical Standard #35:\n * https://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n * with a few additions (see note 7 below the table).\n *\n * Accepted patterns:\n * | Unit | Pattern | Result examples | Notes |\n * |---------------------------------|---------|-----------------------------------|-------|\n * | Era | G..GGG | AD, BC | |\n * | | GGGG | Anno Domini, Before Christ | 2 |\n * | | GGGGG | A, B | |\n * | Calendar year | y | 44, 1, 1900, 2017 | 5 |\n * | | yo | 44th, 1st, 0th, 17th | 5,7 |\n * | | yy | 44, 01, 00, 17 | 5 |\n * | | yyy | 044, 001, 1900, 2017 | 5 |\n * | | yyyy | 0044, 0001, 1900, 2017 | 5 |\n * | | yyyyy | ... | 3,5 |\n * | Local week-numbering year | Y | 44, 1, 1900, 2017 | 5 |\n * | | Yo | 44th, 1st, 1900th, 2017th | 5,7 |\n * | | YY | 44, 01, 00, 17 | 5,8 |\n * | | YYY | 044, 001, 1900, 2017 | 5 |\n * | | YYYY | 0044, 0001, 1900, 2017 | 5,8 |\n * | | YYYYY | ... | 3,5 |\n * | ISO week-numbering year | R | -43, 0, 1, 1900, 2017 | 5,7 |\n * | | RR | -43, 00, 01, 1900, 2017 | 5,7 |\n * | | RRR | -043, 000, 001, 1900, 2017 | 5,7 |\n * | | RRRR | -0043, 0000, 0001, 1900, 2017 | 5,7 |\n * | | RRRRR | ... | 3,5,7 |\n * | Extended year | u | -43, 0, 1, 1900, 2017 | 5 |\n * | | uu | -43, 01, 1900, 2017 | 5 |\n * | | uuu | -043, 001, 1900, 2017 | 5 |\n * | | uuuu | -0043, 0001, 1900, 2017 | 5 |\n * | | uuuuu | ... | 3,5 |\n * | Quarter (formatting) | Q | 1, 2, 3, 4 | |\n * | | Qo | 1st, 2nd, 3rd, 4th | 7 |\n * | | QQ | 01, 02, 03, 04 | |\n * | | QQQ | Q1, Q2, Q3, Q4 | |\n * | | QQQQ | 1st quarter, 2nd quarter, ... | 2 |\n * | | QQQQQ | 1, 2, 3, 4 | 4 |\n * | Quarter (stand-alone) | q | 1, 2, 3, 4 | |\n * | | qo | 1st, 2nd, 3rd, 4th | 7 |\n * | | qq | 01, 02, 03, 04 | |\n * | | qqq | Q1, Q2, Q3, Q4 | |\n * | | qqqq | 1st quarter, 2nd quarter, ... | 2 |\n * | | qqqqq | 1, 2, 3, 4 | 4 |\n * | Month (formatting) | M | 1, 2, ..., 12 | |\n * | | Mo | 1st, 2nd, ..., 12th | 7 |\n * | | MM | 01, 02, ..., 12 | |\n * | | MMM | Jan, Feb, ..., Dec | |\n * | | MMMM | January, February, ..., December | 2 |\n * | | MMMMM | J, F, ..., D | |\n * | Month (stand-alone) | L | 1, 2, ..., 12 | |\n * | | Lo | 1st, 2nd, ..., 12th | 7 |\n * | | LL | 01, 02, ..., 12 | |\n * | | LLL | Jan, Feb, ..., Dec | |\n * | | LLLL | January, February, ..., December | 2 |\n * | | LLLLL | J, F, ..., D | |\n * | Local week of year | w | 1, 2, ..., 53 | |\n * | | wo | 1st, 2nd, ..., 53th | 7 |\n * | | ww | 01, 02, ..., 53 | |\n * | ISO week of year | I | 1, 2, ..., 53 | 7 |\n * | | Io | 1st, 2nd, ..., 53th | 7 |\n * | | II | 01, 02, ..., 53 | 7 |\n * | Day of month | d | 1, 2, ..., 31 | |\n * | | do | 1st, 2nd, ..., 31st | 7 |\n * | | dd | 01, 02, ..., 31 | |\n * | Day of year | D | 1, 2, ..., 365, 366 | 9 |\n * | | Do | 1st, 2nd, ..., 365th, 366th | 7 |\n * | | DD | 01, 02, ..., 365, 366 | 9 |\n * | | DDD | 001, 002, ..., 365, 366 | |\n * | | DDDD | ... | 3 |\n * | Day of week (formatting) | E..EEE | Mon, Tue, Wed, ..., Sun | |\n * | | EEEE | Monday, Tuesday, ..., Sunday | 2 |\n * | | EEEEE | M, T, W, T, F, S, S | |\n * | | EEEEEE | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | ISO day of week (formatting) | i | 1, 2, 3, ..., 7 | 7 |\n * | | io | 1st, 2nd, ..., 7th | 7 |\n * | | ii | 01, 02, ..., 07 | 7 |\n * | | iii | Mon, Tue, Wed, ..., Sun | 7 |\n * | | iiii | Monday, Tuesday, ..., Sunday | 2,7 |\n * | | iiiii | M, T, W, T, F, S, S | 7 |\n * | | iiiiii | Mo, Tu, We, Th, Fr, Sa, Su | 7 |\n * | Local day of week (formatting) | e | 2, 3, 4, ..., 1 | |\n * | | eo | 2nd, 3rd, ..., 1st | 7 |\n * | | ee | 02, 03, ..., 01 | |\n * | | eee | Mon, Tue, Wed, ..., Sun | |\n * | | eeee | Monday, Tuesday, ..., Sunday | 2 |\n * | | eeeee | M, T, W, T, F, S, S | |\n * | | eeeeee | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | Local day of week (stand-alone) | c | 2, 3, 4, ..., 1 | |\n * | | co | 2nd, 3rd, ..., 1st | 7 |\n * | | cc | 02, 03, ..., 01 | |\n * | | ccc | Mon, Tue, Wed, ..., Sun | |\n * | | cccc | Monday, Tuesday, ..., Sunday | 2 |\n * | | ccccc | M, T, W, T, F, S, S | |\n * | | cccccc | Mo, Tu, We, Th, Fr, Sa, Su | |\n * | AM, PM | a..aa | AM, PM | |\n * | | aaa | am, pm | |\n * | | aaaa | a.m., p.m. | 2 |\n * | | aaaaa | a, p | |\n * | AM, PM, noon, midnight | b..bb | AM, PM, noon, midnight | |\n * | | bbb | am, pm, noon, midnight | |\n * | | bbbb | a.m., p.m., noon, midnight | 2 |\n * | | bbbbb | a, p, n, mi | |\n * | Flexible day period | B..BBB | at night, in the morning, ... | |\n * | | BBBB | at night, in the morning, ... | 2 |\n * | | BBBBB | at night, in the morning, ... | |\n * | Hour [1-12] | h | 1, 2, ..., 11, 12 | |\n * | | ho | 1st, 2nd, ..., 11th, 12th | 7 |\n * | | hh | 01, 02, ..., 11, 12 | |\n * | Hour [0-23] | H | 0, 1, 2, ..., 23 | |\n * | | Ho | 0th, 1st, 2nd, ..., 23rd | 7 |\n * | | HH | 00, 01, 02, ..., 23 | |\n * | Hour [0-11] | K | 1, 2, ..., 11, 0 | |\n * | | Ko | 1st, 2nd, ..., 11th, 0th | 7 |\n * | | KK | 01, 02, ..., 11, 00 | |\n * | Hour [1-24] | k | 24, 1, 2, ..., 23 | |\n * | | ko | 24th, 1st, 2nd, ..., 23rd | 7 |\n * | | kk | 24, 01, 02, ..., 23 | |\n * | Minute | m | 0, 1, ..., 59 | |\n * | | mo | 0th, 1st, ..., 59th | 7 |\n * | | mm | 00, 01, ..., 59 | |\n * | Second | s | 0, 1, ..., 59 | |\n * | | so | 0th, 1st, ..., 59th | 7 |\n * | | ss | 00, 01, ..., 59 | |\n * | Fraction of second | S | 0, 1, ..., 9 | |\n * | | SS | 00, 01, ..., 99 | |\n * | | SSS | 000, 001, ..., 999 | |\n * | | SSSS | ... | 3 |\n * | Timezone (ISO-8601 w/ Z) | X | -08, +0530, Z | |\n * | | XX | -0800, +0530, Z | |\n * | | XXX | -08:00, +05:30, Z | |\n * | | XXXX | -0800, +0530, Z, +123456 | 2 |\n * | | XXXXX | -08:00, +05:30, Z, +12:34:56 | |\n * | Timezone (ISO-8601 w/o Z) | x | -08, +0530, +00 | |\n * | | xx | -0800, +0530, +0000 | |\n * | | xxx | -08:00, +05:30, +00:00 | 2 |\n * | | xxxx | -0800, +0530, +0000, +123456 | |\n * | | xxxxx | -08:00, +05:30, +00:00, +12:34:56 | |\n * | Timezone (GMT) | O...OOO | GMT-8, GMT+5:30, GMT+0 | |\n * | | OOOO | GMT-08:00, GMT+05:30, GMT+00:00 | 2 |\n * | Timezone (specific non-locat.) | z...zzz | GMT-8, GMT+5:30, GMT+0 | 6 |\n * | | zzzz | GMT-08:00, GMT+05:30, GMT+00:00 | 2,6 |\n * | Seconds timestamp | t | 512969520 | 7 |\n * | | tt | ... | 3,7 |\n * | Milliseconds timestamp | T | 512969520900 | 7 |\n * | | TT | ... | 3,7 |\n * | Long localized date | P | 04/29/1453 | 7 |\n * | | PP | Apr 29, 1453 | 7 |\n * | | PPP | April 29th, 1453 | 7 |\n * | | PPPP | Friday, April 29th, 1453 | 2,7 |\n * | Long localized time | p | 12:00 AM | 7 |\n * | | pp | 12:00:00 AM | 7 |\n * | | ppp | 12:00:00 AM GMT+2 | 7 |\n * | | pppp | 12:00:00 AM GMT+02:00 | 2,7 |\n * | Combination of date and time | Pp | 04/29/1453, 12:00 AM | 7 |\n * | | PPpp | Apr 29, 1453, 12:00:00 AM | 7 |\n * | | PPPppp | April 29th, 1453 at ... | 7 |\n * | | PPPPpppp| Friday, April 29th, 1453 at ... | 2,7 |\n * Notes:\n * 1. \"Formatting\" units (e.g. formatting quarter) in the default en-US locale\n * are the same as \"stand-alone\" units, but are different in some languages.\n * \"Formatting\" units are declined according to the rules of the language\n * in the context of a date. \"Stand-alone\" units are always nominative singular:\n *\n * `format(new Date(2017, 10, 6), 'do LLLL', {locale: cs}) //=> '6. listopad'`\n *\n * `format(new Date(2017, 10, 6), 'do MMMM', {locale: cs}) //=> '6. listopadu'`\n *\n * 2. Any sequence of the identical letters is a pattern, unless it is escaped by\n * the single quote characters (see below).\n * If the sequence is longer than listed in table (e.g. `EEEEEEEEEEE`)\n * the output will be the same as default pattern for this unit, usually\n * the longest one (in case of ISO weekdays, `EEEE`). Default patterns for units\n * are marked with \"2\" in the last column of the table.\n *\n * `format(new Date(2017, 10, 6), 'MMM') //=> 'Nov'`\n *\n * `format(new Date(2017, 10, 6), 'MMMM') //=> 'November'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMM') //=> 'N'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMMM') //=> 'November'`\n *\n * `format(new Date(2017, 10, 6), 'MMMMMMM') //=> 'November'`\n *\n * 3. Some patterns could be unlimited length (such as `yyyyyyyy`).\n * The output will be padded with zeros to match the length of the pattern.\n *\n * `format(new Date(2017, 10, 6), 'yyyyyyyy') //=> '00002017'`\n *\n * 4. `QQQQQ` and `qqqqq` could be not strictly numerical in some locales.\n * These tokens represent the shortest form of the quarter.\n *\n * 5. The main difference between `y` and `u` patterns are B.C. years:\n *\n * | Year | `y` | `u` |\n * |------|-----|-----|\n * | AC 1 | 1 | 1 |\n * | BC 1 | 1 | 0 |\n * | BC 2 | 2 | -1 |\n *\n * Also `yy` always returns the last two digits of a year,\n * while `uu` pads single digit years to 2 characters and returns other years unchanged:\n *\n * | Year | `yy` | `uu` |\n * |------|------|------|\n * | 1 | 01 | 01 |\n * | 14 | 14 | 14 |\n * | 376 | 76 | 376 |\n * | 1453 | 53 | 1453 |\n *\n * The same difference is true for local and ISO week-numbering years (`Y` and `R`),\n * except local week-numbering years are dependent on `options.weekStartsOn`\n * and `options.firstWeekContainsDate` (compare [getISOWeekYear]{@link https://date-fns.org/docs/getISOWeekYear}\n * and [getWeekYear]{@link https://date-fns.org/docs/getWeekYear}).\n *\n * 6. Specific non-location timezones are currently unavailable in `date-fns`,\n * so right now these tokens fall back to GMT timezones.\n *\n * 7. These patterns are not in the Unicode Technical Standard #35:\n * - `i`: ISO day of week\n * - `I`: ISO week of year\n * - `R`: ISO week-numbering year\n * - `t`: seconds timestamp\n * - `T`: milliseconds timestamp\n * - `o`: ordinal number modifier\n * - `P`: long localized date\n * - `p`: long localized time\n *\n * 8. `YY` and `YYYY` tokens represent week-numbering years but they are often confused with years.\n * You should enable `options.useAdditionalWeekYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * 9. `D` and `DD` tokens represent days of the year but they are often confused with days of the month.\n * You should enable `options.useAdditionalDayOfYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * @param {Date|Number} date - the original date\n * @param {String} format - the string of tokens\n * @param {Object} [options] - an object with options.\n * @param {Locale} [options.locale=defaultLocale] - the locale object. See [Locale]{@link https://date-fns.org/docs/Locale}\n * @param {0|1|2|3|4|5|6} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)\n * @param {Number} [options.firstWeekContainsDate=1] - the day of January, which is\n * @param {Boolean} [options.useAdditionalWeekYearTokens=false] - if true, allows usage of the week-numbering year tokens `YY` and `YYYY`;\n * see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @param {Boolean} [options.useAdditionalDayOfYearTokens=false] - if true, allows usage of the day of year tokens `D` and `DD`;\n * see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @returns {String} the formatted date string\n * @throws {TypeError} 2 arguments required\n * @throws {RangeError} `date` must not be Invalid Date\n * @throws {RangeError} `options.locale` must contain `localize` property\n * @throws {RangeError} `options.locale` must contain `formatLong` property\n * @throws {RangeError} `options.weekStartsOn` must be between 0 and 6\n * @throws {RangeError} `options.firstWeekContainsDate` must be between 1 and 7\n * @throws {RangeError} use `yyyy` instead of `YYYY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `yy` instead of `YY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `d` instead of `D` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} use `dd` instead of `DD` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws {RangeError} format string contains an unescaped latin alphabet character\n *\n * @example\n * // Represent 11 February 2014 in middle-endian format:\n * const result = format(new Date(2014, 1, 11), 'MM/dd/yyyy')\n * //=> '02/11/2014'\n *\n * @example\n * // Represent 2 July 2014 in Esperanto:\n * import { eoLocale } from 'date-fns/locale/eo'\n * const result = format(new Date(2014, 6, 2), \"do 'de' MMMM yyyy\", {\n * locale: eoLocale\n * })\n * //=> '2-a de julio 2014'\n *\n * @example\n * // Escape string by single quote characters:\n * const result = format(new Date(2014, 6, 2, 15), \"h 'o''clock'\")\n * //=> \"3 o'clock\"\n */\n\nfunction format(dirtyDate, dirtyFormatStr, options) {\n var _ref, _options$locale, _ref2, _ref3, _ref4, _options$firstWeekCon, _options$locale2, _options$locale2$opti, _defaultOptions$local, _defaultOptions$local2, _ref5, _ref6, _ref7, _options$weekStartsOn, _options$locale3, _options$locale3$opti, _defaultOptions$local3, _defaultOptions$local4;\n (0, _index9.default)(2, arguments);\n var formatStr = String(dirtyFormatStr);\n var defaultOptions = (0, _index10.getDefaultOptions)();\n var locale = (_ref = (_options$locale = options === null || options === void 0 ? void 0 : options.locale) !== null && _options$locale !== void 0 ? _options$locale : defaultOptions.locale) !== null && _ref !== void 0 ? _ref : _index11.default;\n var firstWeekContainsDate = (0, _index8.default)((_ref2 = (_ref3 = (_ref4 = (_options$firstWeekCon = options === null || options === void 0 ? void 0 : options.firstWeekContainsDate) !== null && _options$firstWeekCon !== void 0 ? _options$firstWeekCon : options === null || options === void 0 ? void 0 : (_options$locale2 = options.locale) === null || _options$locale2 === void 0 ? void 0 : (_options$locale2$opti = _options$locale2.options) === null || _options$locale2$opti === void 0 ? void 0 : _options$locale2$opti.firstWeekContainsDate) !== null && _ref4 !== void 0 ? _ref4 : defaultOptions.firstWeekContainsDate) !== null && _ref3 !== void 0 ? _ref3 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.firstWeekContainsDate) !== null && _ref2 !== void 0 ? _ref2 : 1);\n\n // Test if weekStartsOn is between 1 and 7 _and_ is not NaN\n if (!(firstWeekContainsDate >= 1 && firstWeekContainsDate <= 7)) {\n throw new RangeError('firstWeekContainsDate must be between 1 and 7 inclusively');\n }\n var weekStartsOn = (0, _index8.default)((_ref5 = (_ref6 = (_ref7 = (_options$weekStartsOn = options === null || options === void 0 ? void 0 : options.weekStartsOn) !== null && _options$weekStartsOn !== void 0 ? _options$weekStartsOn : options === null || options === void 0 ? void 0 : (_options$locale3 = options.locale) === null || _options$locale3 === void 0 ? void 0 : (_options$locale3$opti = _options$locale3.options) === null || _options$locale3$opti === void 0 ? void 0 : _options$locale3$opti.weekStartsOn) !== null && _ref7 !== void 0 ? _ref7 : defaultOptions.weekStartsOn) !== null && _ref6 !== void 0 ? _ref6 : (_defaultOptions$local3 = defaultOptions.locale) === null || _defaultOptions$local3 === void 0 ? void 0 : (_defaultOptions$local4 = _defaultOptions$local3.options) === null || _defaultOptions$local4 === void 0 ? void 0 : _defaultOptions$local4.weekStartsOn) !== null && _ref5 !== void 0 ? _ref5 : 0);\n\n // Test if weekStartsOn is between 0 and 6 _and_ is not NaN\n if (!(weekStartsOn >= 0 && weekStartsOn <= 6)) {\n throw new RangeError('weekStartsOn must be between 0 and 6 inclusively');\n }\n if (!locale.localize) {\n throw new RangeError('locale must contain localize property');\n }\n if (!locale.formatLong) {\n throw new RangeError('locale must contain formatLong property');\n }\n var originalDate = (0, _index3.default)(dirtyDate);\n if (!(0, _index.default)(originalDate)) {\n throw new RangeError('Invalid time value');\n }\n\n // Convert the date in system timezone to the same date in UTC+00:00 timezone.\n // This ensures that when UTC functions will be implemented, locales will be compatible with them.\n // See an issue about UTC functions: https://github.com/date-fns/date-fns/issues/376\n var timezoneOffset = (0, _index6.default)(originalDate);\n var utcDate = (0, _index2.default)(originalDate, timezoneOffset);\n var formatterOptions = {\n firstWeekContainsDate: firstWeekContainsDate,\n weekStartsOn: weekStartsOn,\n locale: locale,\n _originalDate: originalDate\n };\n var result = formatStr.match(longFormattingTokensRegExp).map(function (substring) {\n var firstCharacter = substring[0];\n if (firstCharacter === 'p' || firstCharacter === 'P') {\n var longFormatter = _index5.default[firstCharacter];\n return longFormatter(substring, locale.formatLong);\n }\n return substring;\n }).join('').match(formattingTokensRegExp).map(function (substring) {\n // Replace two single quote characters with one single quote character\n if (substring === \"''\") {\n return \"'\";\n }\n var firstCharacter = substring[0];\n if (firstCharacter === \"'\") {\n return cleanEscapedString(substring);\n }\n var formatter = _index4.default[firstCharacter];\n if (formatter) {\n if (!(options !== null && options !== void 0 && options.useAdditionalWeekYearTokens) && (0, _index7.isProtectedWeekYearToken)(substring)) {\n (0, _index7.throwProtectedError)(substring, dirtyFormatStr, String(dirtyDate));\n }\n if (!(options !== null && options !== void 0 && options.useAdditionalDayOfYearTokens) && (0, _index7.isProtectedDayOfYearToken)(substring)) {\n (0, _index7.throwProtectedError)(substring, dirtyFormatStr, String(dirtyDate));\n }\n return formatter(utcDate, substring, locale.localize, formatterOptions);\n }\n if (firstCharacter.match(unescapedLatinCharacterRegExp)) {\n throw new RangeError('Format string contains an unescaped latin alphabet character `' + firstCharacter + '`');\n }\n return substring;\n }).join('');\n return result;\n}\nfunction cleanEscapedString(input) {\n var matched = input.match(escapedStringRegExp);\n if (!matched) {\n return input;\n }\n return matched[1].replace(doubleQuoteRegExp, \"'\");\n}\nmodule.exports = exports.default;","import { isFunction } from '../util/isFunction';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { identity } from '../util/identity';\nexport function tap(observerOrNext, error, complete) {\n const tapObserver = isFunction(observerOrNext) || error || complete\n ?\n { next: observerOrNext, error, complete }\n : observerOrNext;\n return tapObserver\n ? operate((source, subscriber) => {\n var _a;\n (_a = tapObserver.subscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n let isUnsub = true;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n var _a;\n (_a = tapObserver.next) === null || _a === void 0 ? void 0 : _a.call(tapObserver, value);\n subscriber.next(value);\n }, () => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.complete) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n subscriber.complete();\n }, (err) => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.error) === null || _a === void 0 ? void 0 : _a.call(tapObserver, err);\n subscriber.error(err);\n }, () => {\n var _a, _b;\n if (isUnsub) {\n (_a = tapObserver.unsubscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n }\n (_b = tapObserver.finalize) === null || _b === void 0 ? void 0 : _b.call(tapObserver);\n }));\n })\n :\n identity;\n}\n","function _interopRequireDefault(e) {\n return e && e.__esModule ? e : {\n \"default\": e\n };\n}\nmodule.exports = _interopRequireDefault, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","import { isFunction } from \"./isFunction\";\nexport function isPromise(value) {\n return isFunction(value === null || value === void 0 ? void 0 : value.then);\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { TSpecRoute_getConnectedAccountsGroups } from '@backend/types/generated/ConnectedAccounts/getConnectedAccountsGroups';\nimport { TSpecRoute_getMyConnectedAccounts } from '@backend/types/generated/ConnectedAccounts/getMyConnectedAccounts';\nimport {\n TSpecBodyLoginToConnectedAccount,\n TSpecRoute_loginToConnectedAccount\n} from '@backend/types/generated/ConnectedAccounts/loginToConnectedAccount';\nimport {\n TSpecQueryRemoveConnectedAccountFromGroup,\n TSpecRoute_removeConnectedAccountFromGroup\n} from '@backend/types/generated/ConnectedAccounts/removeConnectedAccountFromGroup';\nimport {\n TSpecQueryRemoveMyConnectedAccount,\n TSpecRoute_removeMyConnectedAccount\n} from '@backend/types/generated/ConnectedAccounts/removeMyConnectedAccount';\nimport { AuthToken } from '@core/model/authentication.model';\nimport { ConnectedAccountModel } from '@core/model/connected-account-model';\nimport { UserModel } from '@core/model/user.model';\n\n@Injectable({ providedIn: 'root' })\nexport class ConnectedAccountsApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public getMyConnectedAccounts() {\n return this._httpClient.get(\n TSpecRoute_getMyConnectedAccounts()\n );\n }\n\n public loginToConnectedAccount(params: {\n body: TSpecBodyLoginToConnectedAccount;\n }) {\n return this._httpClient.post<{\n authToken: AuthToken;\n user: UserModel;\n }>(TSpecRoute_loginToConnectedAccount(), params.body);\n }\n\n public removeMyConnectedAccount(params: {\n query: TSpecQueryRemoveMyConnectedAccount;\n }) {\n return this._httpClient.delete(\n TSpecRoute_removeMyConnectedAccount(),\n { params: { ...params.query } }\n );\n }\n\n public getConnectedAccountsGroups() {\n return this._httpClient.get<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n >(TSpecRoute_getConnectedAccountsGroups());\n }\n\n public removeConnectedAccountFromGroup(params: {\n query: TSpecQueryRemoveConnectedAccountFromGroup;\n }) {\n return this._httpClient.delete<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n >(TSpecRoute_removeConnectedAccountFromGroup(), {\n params: { ...params.query }\n });\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getMyConnectedAccounts = () => \"/connected-accounts\";\n\nexport type TSpecHandler_getMyConnectedAccounts = RequestHandler;\n\nexport interface TSpecPathGetMyConnectedAccounts { }\n\nexport interface TSpecBodyGetMyConnectedAccounts {}\n\nexport interface TSpecQueryGetMyConnectedAccounts {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_loginToConnectedAccount = () => \"/connected-accounts/login\";\n\nexport type TSpecHandler_loginToConnectedAccount = RequestHandler;\n\nexport interface TSpecPathLoginToConnectedAccount { }\n\nexport interface TSpecBodyLoginToConnectedAccount {\n userId: string;\n}\n\nexport interface TSpecQueryLoginToConnectedAccount {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_removeMyConnectedAccount = () => \"/connected-accounts\";\n\nexport type TSpecHandler_removeMyConnectedAccount = RequestHandler;\n\nexport interface TSpecPathRemoveMyConnectedAccount { }\n\nexport interface TSpecBodyRemoveMyConnectedAccount {}\n\nexport interface TSpecQueryRemoveMyConnectedAccount {\n userId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getConnectedAccountsGroups = () => \"/connected-accounts/groups\";\n\nexport type TSpecHandler_getConnectedAccountsGroups = RequestHandler;\n\nexport interface TSpecPathGetConnectedAccountsGroups { }\n\nexport interface TSpecBodyGetConnectedAccountsGroups {}\n\nexport interface TSpecQueryGetConnectedAccountsGroups {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_removeConnectedAccountFromGroup = () => \"/connected-accounts/groups\";\n\nexport type TSpecHandler_removeConnectedAccountFromGroup = RequestHandler;\n\nexport interface TSpecPathRemoveConnectedAccountFromGroup { }\n\nexport interface TSpecBodyRemoveConnectedAccountFromGroup {}\n\nexport interface TSpecQueryRemoveConnectedAccountFromGroup {\n groupId: string;\n userId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { d as doc } from './index-a5d50daf.js';\nimport { MENU_BACK_BUTTON_PRIORITY } from './hardware-back-button-06ef3c3e.js';\nimport { p as printIonWarning } from './index-9b0d46f4.js';\nimport { c as componentOnReady } from './helpers-da915de8.js';\nimport { b as getIonMode } from './ionic-global-c81d82ab.js';\nimport { c as createAnimation } from './animation-eab5a4ca.js';\n\n/**\n * baseAnimation\n * Base class which is extended by the various types. Each\n * type will provide their own animations for open and close\n * and registers itself with Menu.\n */\nconst baseAnimation = (isIos) => {\n // https://material.io/guidelines/motion/movement.html#movement-movement-in-out-of-screen-bounds\n // https://material.io/guidelines/motion/duration-easing.html#duration-easing-natural-easing-curves\n /**\n * \"Apply the sharp curve to items temporarily leaving the screen that may return\n * from the same exit point. When they return, use the deceleration curve. On mobile,\n * this transition typically occurs over 300ms\" -- MD Motion Guide\n */\n return createAnimation().duration(isIos ? 400 : 300);\n};\n\n/**\n * Menu Overlay Type\n * The menu slides over the content. The content\n * itself, which is under the menu, does not move.\n */\nconst menuOverlayAnimation = (menu) => {\n let closedX;\n let openedX;\n const width = menu.width + 8;\n const menuAnimation = createAnimation();\n const backdropAnimation = createAnimation();\n if (menu.isEndSide) {\n // right side\n closedX = width + 'px';\n openedX = '0px';\n }\n else {\n // left side\n closedX = -width + 'px';\n openedX = '0px';\n }\n menuAnimation.addElement(menu.menuInnerEl).fromTo('transform', `translateX(${closedX})`, `translateX(${openedX})`);\n const mode = getIonMode(menu);\n const isIos = mode === 'ios';\n const opacity = isIos ? 0.2 : 0.25;\n backdropAnimation.addElement(menu.backdropEl).fromTo('opacity', 0.01, opacity);\n return baseAnimation(isIos).addAnimation([menuAnimation, backdropAnimation]);\n};\n\n/**\n * Menu Push Type\n * The content slides over to reveal the menu underneath.\n * The menu itself also slides over to reveal its bad self.\n */\nconst menuPushAnimation = (menu) => {\n let contentOpenedX;\n let menuClosedX;\n const mode = getIonMode(menu);\n const width = menu.width;\n if (menu.isEndSide) {\n contentOpenedX = -width + 'px';\n menuClosedX = width + 'px';\n }\n else {\n contentOpenedX = width + 'px';\n menuClosedX = -width + 'px';\n }\n const menuAnimation = createAnimation()\n .addElement(menu.menuInnerEl)\n .fromTo('transform', `translateX(${menuClosedX})`, 'translateX(0px)');\n const contentAnimation = createAnimation()\n .addElement(menu.contentEl)\n .fromTo('transform', 'translateX(0px)', `translateX(${contentOpenedX})`);\n const backdropAnimation = createAnimation().addElement(menu.backdropEl).fromTo('opacity', 0.01, 0.32);\n return baseAnimation(mode === 'ios').addAnimation([menuAnimation, contentAnimation, backdropAnimation]);\n};\n\n/**\n * Menu Reveal Type\n * The content slides over to reveal the menu underneath.\n * The menu itself, which is under the content, does not move.\n */\nconst menuRevealAnimation = (menu) => {\n const mode = getIonMode(menu);\n const openedX = menu.width * (menu.isEndSide ? -1 : 1) + 'px';\n const contentOpen = createAnimation()\n .addElement(menu.contentEl) // REVIEW\n .fromTo('transform', 'translateX(0px)', `translateX(${openedX})`);\n return baseAnimation(mode === 'ios').addAnimation(contentOpen);\n};\n\nconst createMenuController = () => {\n const menuAnimations = new Map();\n const menus = [];\n const open = async (menu) => {\n const menuEl = await get(menu, true);\n if (menuEl) {\n return menuEl.open();\n }\n return false;\n };\n const close = async (menu) => {\n const menuEl = await (menu !== undefined ? get(menu, true) : getOpen());\n if (menuEl !== undefined) {\n return menuEl.close();\n }\n return false;\n };\n const toggle = async (menu) => {\n const menuEl = await get(menu, true);\n if (menuEl) {\n return menuEl.toggle();\n }\n return false;\n };\n const enable = async (shouldEnable, menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n menuEl.disabled = !shouldEnable;\n }\n return menuEl;\n };\n const swipeGesture = async (shouldEnable, menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n menuEl.swipeGesture = shouldEnable;\n }\n return menuEl;\n };\n const isOpen = async (menu) => {\n if (menu != null) {\n const menuEl = await get(menu);\n // eslint-disable-next-line @typescript-eslint/prefer-optional-chain\n return menuEl !== undefined && menuEl.isOpen();\n }\n else {\n const menuEl = await getOpen();\n return menuEl !== undefined;\n }\n };\n const isEnabled = async (menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n return !menuEl.disabled;\n }\n return false;\n };\n /**\n * Finds and returns the menu specified by \"menu\" if registered.\n * @param menu - The side or ID of the desired menu\n * @param logOnMultipleSideMenus - If true, this function will log a warning\n * if \"menu\" is a side but multiple menus on the same side were found. Since this function\n * is used in multiple places, we default this log to false so that the calling\n * functions can choose whether or not it is appropriate to log this warning.\n */\n const get = async (menu, logOnMultipleSideMenus = false) => {\n await waitUntilReady();\n if (menu === 'start' || menu === 'end') {\n // there could be more than one menu on the same side\n // so first try to get the enabled one\n const menuRefs = menus.filter((m) => m.side === menu && !m.disabled);\n if (menuRefs.length >= 1) {\n if (menuRefs.length > 1 && logOnMultipleSideMenus) {\n printIonWarning(`menuController queried for a menu on the \"${menu}\" side, but ${menuRefs.length} menus were found. The first menu reference will be used. If this is not the behavior you want then pass the ID of the menu instead of its side.`, menuRefs.map((m) => m.el));\n }\n return menuRefs[0].el;\n }\n // didn't find a menu side that is enabled\n // so try to get the first menu side found\n const sideMenuRefs = menus.filter((m) => m.side === menu);\n if (sideMenuRefs.length >= 1) {\n if (sideMenuRefs.length > 1 && logOnMultipleSideMenus) {\n printIonWarning(`menuController queried for a menu on the \"${menu}\" side, but ${sideMenuRefs.length} menus were found. The first menu reference will be used. If this is not the behavior you want then pass the ID of the menu instead of its side.`, sideMenuRefs.map((m) => m.el));\n }\n return sideMenuRefs[0].el;\n }\n }\n else if (menu != null) {\n // the menuId was not left or right\n // so try to get the menu by its \"id\"\n return find((m) => m.menuId === menu);\n }\n // return the first enabled menu\n const menuEl = find((m) => !m.disabled);\n if (menuEl) {\n return menuEl;\n }\n // get the first menu in the array, if one exists\n return menus.length > 0 ? menus[0].el : undefined;\n };\n /**\n * Get the instance of the opened menu. Returns `null` if a menu is not found.\n */\n const getOpen = async () => {\n await waitUntilReady();\n return _getOpenSync();\n };\n /**\n * Get all menu instances.\n */\n const getMenus = async () => {\n await waitUntilReady();\n return getMenusSync();\n };\n /**\n * Get whether or not a menu is animating. Returns `true` if any\n * menu is currently animating.\n */\n const isAnimating = async () => {\n await waitUntilReady();\n return isAnimatingSync();\n };\n const registerAnimation = (name, animation) => {\n menuAnimations.set(name, animation);\n };\n const _register = (menu) => {\n if (menus.indexOf(menu) < 0) {\n menus.push(menu);\n }\n };\n const _unregister = (menu) => {\n const index = menus.indexOf(menu);\n if (index > -1) {\n menus.splice(index, 1);\n }\n };\n const _setOpen = async (menu, shouldOpen, animated, role) => {\n if (isAnimatingSync()) {\n return false;\n }\n if (shouldOpen) {\n const openedMenu = await getOpen();\n if (openedMenu && menu.el !== openedMenu) {\n await openedMenu.setOpen(false, false);\n }\n }\n return menu._setOpen(shouldOpen, animated, role);\n };\n const _createAnimation = (type, menuCmp) => {\n const animationBuilder = menuAnimations.get(type); // TODO(FW-2832): type\n if (!animationBuilder) {\n throw new Error('animation not registered');\n }\n const animation = animationBuilder(menuCmp);\n return animation;\n };\n const _getOpenSync = () => {\n return find((m) => m._isOpen);\n };\n const getMenusSync = () => {\n return menus.map((menu) => menu.el);\n };\n const isAnimatingSync = () => {\n return menus.some((menu) => menu.isAnimating);\n };\n const find = (predicate) => {\n const instance = menus.find(predicate);\n if (instance !== undefined) {\n return instance.el;\n }\n return undefined;\n };\n const waitUntilReady = () => {\n return Promise.all(Array.from(document.querySelectorAll('ion-menu')).map((menu) => new Promise((resolve) => componentOnReady(menu, resolve))));\n };\n registerAnimation('reveal', menuRevealAnimation);\n registerAnimation('push', menuPushAnimation);\n registerAnimation('overlay', menuOverlayAnimation);\n doc === null || doc === void 0 ? void 0 : doc.addEventListener('ionBackButton', (ev) => {\n const openMenu = _getOpenSync();\n if (openMenu) {\n ev.detail.register(MENU_BACK_BUTTON_PRIORITY, () => {\n return openMenu.close();\n });\n }\n });\n return {\n registerAnimation,\n get,\n getMenus,\n getOpen,\n isEnabled,\n swipeGesture,\n isAnimating,\n isOpen,\n enable,\n toggle,\n close,\n open,\n _getOpenSync,\n _createAnimation,\n _register,\n _unregister,\n _setOpen,\n };\n};\nconst menuController = /*@__PURE__*/ createMenuController();\n\nexport { menuController as m };\n","import { __asyncGenerator, __await } from \"tslib\";\nimport { isFunction } from './isFunction';\nexport function readableStreamLikeToAsyncGenerator(readableStream) {\n return __asyncGenerator(this, arguments, function* readableStreamLikeToAsyncGenerator_1() {\n const reader = readableStream.getReader();\n try {\n while (true) {\n const { value, done } = yield __await(reader.read());\n if (done) {\n return yield __await(void 0);\n }\n yield yield __await(value);\n }\n }\n finally {\n reader.releaseLock();\n }\n });\n}\nexport function isReadableStreamLike(obj) {\n return isFunction(obj === null || obj === void 0 ? void 0 : obj.getReader);\n}\n","import toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name getDay\n * @category Weekday Helpers\n * @summary Get the day of the week of the given date.\n *\n * @description\n * Get the day of the week of the given date.\n *\n * @param {Date|Number} date - the given date\n * @returns {0|1|2|3|4|5|6} the day of week, 0 represents Sunday\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Which day of the week is 29 February 2012?\n * const result = getDay(new Date(2012, 1, 29))\n * //=> 3\n */\nexport default function getDay(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var day = date.getDay();\n return day;\n}","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { i as initialize } from './ionic-global-c81d82ab.js';\n\nconst globalScripts = initialize;\n\nexport { globalScripts as g };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { b as bootstrapLazy } from './index-28849c61.js';\nexport { s as setNonce } from './index-28849c61.js';\nimport { g as globalScripts } from './app-globals-5dbb61a5.js';\nimport './ionic-global-c81d82ab.js';\n\nconst defineCustomElements = async (win, options) => {\n if (typeof window === 'undefined') return undefined;\n await globalScripts();\n return bootstrapLazy(JSON.parse(\"[[\\\"ion-menu_3\\\",[[33,\\\"ion-menu-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"type\\\":[1],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]],[33,\\\"ion-menu\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"menuId\\\":[513,\\\"menu-id\\\"],\\\"type\\\":[1025],\\\"disabled\\\":[1028],\\\"side\\\":[513],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"maxEdgeStart\\\":[2,\\\"max-edge-start\\\"],\\\"isPaneVisible\\\":[32],\\\"isEndSide\\\":[32],\\\"isOpen\\\":[64],\\\"isActive\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"toggle\\\":[64],\\\"setOpen\\\":[64]},[[16,\\\"ionSplitPaneVisible\\\",\\\"onSplitPaneChanged\\\"],[2,\\\"click\\\",\\\"onBackdropClick\\\"]],{\\\"type\\\":[\\\"typeChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"side\\\":[\\\"sideChanged\\\"],\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"]}],[1,\\\"ion-menu-toggle\\\",{\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]]]],[\\\"ion-input-password-toggle\\\",[[33,\\\"ion-input-password-toggle\\\",{\\\"color\\\":[513],\\\"showIcon\\\":[1,\\\"show-icon\\\"],\\\"hideIcon\\\":[1,\\\"hide-icon\\\"],\\\"type\\\":[1025]},null,{\\\"type\\\":[\\\"onTypeChange\\\"]}]]],[\\\"ion-fab_3\\\",[[33,\\\"ion-fab-button\\\",{\\\"color\\\":[513],\\\"activated\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1],\\\"show\\\":[4],\\\"translucent\\\":[4],\\\"type\\\":[1],\\\"size\\\":[1],\\\"closeIcon\\\":[1,\\\"close-icon\\\"]}],[1,\\\"ion-fab\\\",{\\\"horizontal\\\":[1],\\\"vertical\\\":[1],\\\"edge\\\":[4],\\\"activated\\\":[1028],\\\"close\\\":[64],\\\"toggle\\\":[64]},null,{\\\"activated\\\":[\\\"activatedChanged\\\"]}],[1,\\\"ion-fab-list\\\",{\\\"activated\\\":[4],\\\"side\\\":[1]},null,{\\\"activated\\\":[\\\"activatedChanged\\\"]}]]],[\\\"ion-refresher_2\\\",[[0,\\\"ion-refresher-content\\\",{\\\"pullingIcon\\\":[1025,\\\"pulling-icon\\\"],\\\"pullingText\\\":[1,\\\"pulling-text\\\"],\\\"refreshingSpinner\\\":[1025,\\\"refreshing-spinner\\\"],\\\"refreshingText\\\":[1,\\\"refreshing-text\\\"]}],[32,\\\"ion-refresher\\\",{\\\"pullMin\\\":[2,\\\"pull-min\\\"],\\\"pullMax\\\":[2,\\\"pull-max\\\"],\\\"closeDuration\\\":[1,\\\"close-duration\\\"],\\\"snapbackDuration\\\":[1,\\\"snapback-duration\\\"],\\\"pullFactor\\\":[2,\\\"pull-factor\\\"],\\\"disabled\\\":[4],\\\"nativeRefresher\\\":[32],\\\"state\\\":[32],\\\"complete\\\":[64],\\\"cancel\\\":[64],\\\"getProgress\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-back-button\\\",[[33,\\\"ion-back-button\\\",{\\\"color\\\":[513],\\\"defaultHref\\\":[1025,\\\"default-href\\\"],\\\"disabled\\\":[516],\\\"icon\\\":[1],\\\"text\\\":[1],\\\"type\\\":[1],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-toast\\\",[[33,\\\"ion-toast\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"color\\\":[513],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"header\\\":[1],\\\"layout\\\":[1],\\\"message\\\":[1],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"position\\\":[1],\\\"positionAnchor\\\":[1,\\\"position-anchor\\\"],\\\"buttons\\\":[16],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"icon\\\":[1],\\\"htmlAttributes\\\":[16],\\\"swipeGesture\\\":[1,\\\"swipe-gesture\\\"],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"revealContentToScreenReader\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-card_5\\\",[[33,\\\"ion-card\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"type\\\":[1],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}],[32,\\\"ion-card-content\\\"],[33,\\\"ion-card-header\\\",{\\\"color\\\":[513],\\\"translucent\\\":[4]}],[33,\\\"ion-card-subtitle\\\",{\\\"color\\\":[513]}],[33,\\\"ion-card-title\\\",{\\\"color\\\":[513]}]]],[\\\"ion-item-option_3\\\",[[33,\\\"ion-item-option\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"expandable\\\":[4],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"target\\\":[1],\\\"type\\\":[1]}],[32,\\\"ion-item-options\\\",{\\\"side\\\":[1],\\\"fireSwipeEvent\\\":[64]}],[0,\\\"ion-item-sliding\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"getOpenAmount\\\":[64],\\\"getSlidingRatio\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"closeOpened\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-accordion_2\\\",[[49,\\\"ion-accordion\\\",{\\\"value\\\":[1],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"toggleIcon\\\":[1,\\\"toggle-icon\\\"],\\\"toggleIconSlot\\\":[1,\\\"toggle-icon-slot\\\"],\\\"state\\\":[32],\\\"isNext\\\":[32],\\\"isPrevious\\\":[32]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[33,\\\"ion-accordion-group\\\",{\\\"animated\\\":[4],\\\"multiple\\\":[4],\\\"value\\\":[1025],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"expand\\\":[1],\\\"requestAccordionToggle\\\":[64],\\\"getAccordions\\\":[64]},[[0,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"value\\\":[\\\"valueChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"readonly\\\":[\\\"readonlyChanged\\\"]}]]],[\\\"ion-infinite-scroll_2\\\",[[32,\\\"ion-infinite-scroll-content\\\",{\\\"loadingSpinner\\\":[1025,\\\"loading-spinner\\\"],\\\"loadingText\\\":[1,\\\"loading-text\\\"]}],[0,\\\"ion-infinite-scroll\\\",{\\\"threshold\\\":[1],\\\"disabled\\\":[4],\\\"position\\\":[1],\\\"isLoading\\\":[32],\\\"complete\\\":[64]},null,{\\\"threshold\\\":[\\\"thresholdChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-reorder_2\\\",[[33,\\\"ion-reorder\\\",null,[[2,\\\"click\\\",\\\"onClick\\\"]]],[0,\\\"ion-reorder-group\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"complete\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-segment_2\\\",[[33,\\\"ion-segment-button\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"disabled\\\":[1028],\\\"layout\\\":[1],\\\"type\\\":[1],\\\"value\\\":[8],\\\"checked\\\":[32],\\\"setFocus\\\":[64]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[33,\\\"ion-segment\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"scrollable\\\":[4],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"value\\\":[1032],\\\"selectOnFocus\\\":[4,\\\"select-on-focus\\\"],\\\"activated\\\":[32]},[[16,\\\"ionSegmentViewScroll\\\",\\\"handleSegmentViewScroll\\\"],[0,\\\"keydown\\\",\\\"onKeyDown\\\"]],{\\\"color\\\":[\\\"colorChanged\\\"],\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-chip\\\",[[33,\\\"ion-chip\\\",{\\\"color\\\":[513],\\\"outline\\\":[4],\\\"disabled\\\":[4]}]]],[\\\"ion-input\\\",[[38,\\\"ion-input\\\",{\\\"color\\\":[513],\\\"autocapitalize\\\":[1],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"autofocus\\\":[4],\\\"clearInput\\\":[4,\\\"clear-input\\\"],\\\"clearInputIcon\\\":[1,\\\"clear-input-icon\\\"],\\\"clearOnEdit\\\":[4,\\\"clear-on-edit\\\"],\\\"counter\\\":[4],\\\"counterFormatter\\\":[16],\\\"debounce\\\":[2],\\\"disabled\\\":[516],\\\"enterkeyhint\\\":[1],\\\"errorText\\\":[1,\\\"error-text\\\"],\\\"fill\\\":[1],\\\"inputmode\\\":[1],\\\"helperText\\\":[1,\\\"helper-text\\\"],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"max\\\":[8],\\\"maxlength\\\":[2],\\\"min\\\":[8],\\\"minlength\\\":[2],\\\"multiple\\\":[4],\\\"name\\\":[1],\\\"pattern\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[516],\\\"required\\\":[4],\\\"shape\\\":[1],\\\"spellcheck\\\":[4],\\\"step\\\":[1],\\\"type\\\":[1],\\\"value\\\":[1032],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"type\\\":[\\\"onTypeChange\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-searchbar\\\",[[34,\\\"ion-searchbar\\\",{\\\"color\\\":[513],\\\"animated\\\":[4],\\\"autocapitalize\\\":[1],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"cancelButtonIcon\\\":[1,\\\"cancel-button-icon\\\"],\\\"cancelButtonText\\\":[1,\\\"cancel-button-text\\\"],\\\"clearIcon\\\":[1,\\\"clear-icon\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"maxlength\\\":[2],\\\"minlength\\\":[2],\\\"name\\\":[1],\\\"placeholder\\\":[1],\\\"searchIcon\\\":[1,\\\"search-icon\\\"],\\\"showCancelButton\\\":[1,\\\"show-cancel-button\\\"],\\\"showClearButton\\\":[1,\\\"show-clear-button\\\"],\\\"spellcheck\\\":[4],\\\"type\\\":[1],\\\"value\\\":[1025],\\\"focused\\\":[32],\\\"noAnimate\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"lang\\\":[\\\"onLangChanged\\\"],\\\"dir\\\":[\\\"onDirChanged\\\"],\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"],\\\"showCancelButton\\\":[\\\"showCancelButtonChanged\\\"]}]]],[\\\"ion-toggle\\\",[[33,\\\"ion-toggle\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[1],\\\"enableOnOffLabels\\\":[4,\\\"enable-on-off-labels\\\"],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"activated\\\":[32]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-nav_2\\\",[[1,\\\"ion-nav\\\",{\\\"delegate\\\":[16],\\\"swipeGesture\\\":[1028,\\\"swipe-gesture\\\"],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"rootParams\\\":[16],\\\"root\\\":[1],\\\"push\\\":[64],\\\"insert\\\":[64],\\\"insertPages\\\":[64],\\\"pop\\\":[64],\\\"popTo\\\":[64],\\\"popToRoot\\\":[64],\\\"removeIndex\\\":[64],\\\"setRoot\\\":[64],\\\"setPages\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64],\\\"getActive\\\":[64],\\\"getByIndex\\\":[64],\\\"canGoBack\\\":[64],\\\"getPrevious\\\":[64],\\\"getLength\\\":[64]},null,{\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"root\\\":[\\\"rootChanged\\\"]}],[0,\\\"ion-nav-link\\\",{\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-tab_2\\\",[[1,\\\"ion-tab\\\",{\\\"active\\\":[1028],\\\"delegate\\\":[16],\\\"tab\\\":[1],\\\"component\\\":[1],\\\"setActive\\\":[64]},null,{\\\"active\\\":[\\\"changeActive\\\"]}],[1,\\\"ion-tabs\\\",{\\\"useRouter\\\":[1028,\\\"use-router\\\"],\\\"selectedTab\\\":[32],\\\"select\\\":[64],\\\"getTab\\\":[64],\\\"getSelected\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]}]]],[\\\"ion-textarea\\\",[[38,\\\"ion-textarea\\\",{\\\"color\\\":[513],\\\"autocapitalize\\\":[1],\\\"autofocus\\\":[4],\\\"clearOnEdit\\\":[4,\\\"clear-on-edit\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"fill\\\":[1],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"maxlength\\\":[2],\\\"minlength\\\":[2],\\\"name\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[4],\\\"required\\\":[4],\\\"spellcheck\\\":[4],\\\"cols\\\":[514],\\\"rows\\\":[2],\\\"wrap\\\":[1],\\\"autoGrow\\\":[516,\\\"auto-grow\\\"],\\\"value\\\":[1025],\\\"counter\\\":[4],\\\"counterFormatter\\\":[16],\\\"errorText\\\":[1,\\\"error-text\\\"],\\\"helperText\\\":[1,\\\"helper-text\\\"],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"shape\\\":[1],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-backdrop\\\",[[33,\\\"ion-backdrop\\\",{\\\"visible\\\":[4],\\\"tappable\\\":[4],\\\"stopPropagation\\\":[4,\\\"stop-propagation\\\"]},[[2,\\\"click\\\",\\\"onMouseDown\\\"]]]]],[\\\"ion-loading\\\",[[34,\\\"ion-loading\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"message\\\":[1],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"spinner\\\":[1025],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-breadcrumb_2\\\",[[33,\\\"ion-breadcrumb\\\",{\\\"collapsed\\\":[4],\\\"last\\\":[4],\\\"showCollapsedIndicator\\\":[4,\\\"show-collapsed-indicator\\\"],\\\"color\\\":[1],\\\"active\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"separator\\\":[4],\\\"target\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}],[33,\\\"ion-breadcrumbs\\\",{\\\"color\\\":[513],\\\"maxItems\\\":[2,\\\"max-items\\\"],\\\"itemsBeforeCollapse\\\":[2,\\\"items-before-collapse\\\"],\\\"itemsAfterCollapse\\\":[2,\\\"items-after-collapse\\\"],\\\"collapsed\\\":[32],\\\"activeChanged\\\":[32]},[[0,\\\"collapsedClick\\\",\\\"onCollapsedClick\\\"]],{\\\"maxItems\\\":[\\\"maxItemsChanged\\\"],\\\"itemsBeforeCollapse\\\":[\\\"maxItemsChanged\\\"],\\\"itemsAfterCollapse\\\":[\\\"maxItemsChanged\\\"]}]]],[\\\"ion-tab-bar_2\\\",[[33,\\\"ion-tab-button\\\",{\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"layout\\\":[1025],\\\"selected\\\":[1028],\\\"tab\\\":[1],\\\"target\\\":[1]},[[8,\\\"ionTabBarChanged\\\",\\\"onTabBarChanged\\\"]]],[33,\\\"ion-tab-bar\\\",{\\\"color\\\":[513],\\\"selectedTab\\\":[1,\\\"selected-tab\\\"],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]},null,{\\\"selectedTab\\\":[\\\"selectedTabChanged\\\"]}]]],[\\\"ion-datetime-button\\\",[[33,\\\"ion-datetime-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[516],\\\"datetime\\\":[1],\\\"datetimePresentation\\\":[32],\\\"dateText\\\":[32],\\\"timeText\\\":[32],\\\"datetimeActive\\\":[32],\\\"selectedButton\\\":[32]}]]],[\\\"ion-route_4\\\",[[0,\\\"ion-route\\\",{\\\"url\\\":[1],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"beforeLeave\\\":[16],\\\"beforeEnter\\\":[16]},null,{\\\"url\\\":[\\\"onUpdate\\\"],\\\"component\\\":[\\\"onUpdate\\\"],\\\"componentProps\\\":[\\\"onComponentProps\\\"]}],[0,\\\"ion-route-redirect\\\",{\\\"from\\\":[1],\\\"to\\\":[1]},null,{\\\"from\\\":[\\\"propDidChange\\\"],\\\"to\\\":[\\\"propDidChange\\\"]}],[0,\\\"ion-router\\\",{\\\"root\\\":[1],\\\"useHash\\\":[4,\\\"use-hash\\\"],\\\"canTransition\\\":[64],\\\"push\\\":[64],\\\"back\\\":[64],\\\"printDebug\\\":[64],\\\"navChanged\\\":[64]},[[8,\\\"popstate\\\",\\\"onPopState\\\"],[4,\\\"ionBackButton\\\",\\\"onBackButton\\\"]]],[1,\\\"ion-router-link\\\",{\\\"color\\\":[513],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}]]],[\\\"ion-avatar_3\\\",[[33,\\\"ion-avatar\\\"],[33,\\\"ion-badge\\\",{\\\"color\\\":[513]}],[1,\\\"ion-thumbnail\\\"]]],[\\\"ion-col_3\\\",[[1,\\\"ion-col\\\",{\\\"offset\\\":[1],\\\"offsetXs\\\":[1,\\\"offset-xs\\\"],\\\"offsetSm\\\":[1,\\\"offset-sm\\\"],\\\"offsetMd\\\":[1,\\\"offset-md\\\"],\\\"offsetLg\\\":[1,\\\"offset-lg\\\"],\\\"offsetXl\\\":[1,\\\"offset-xl\\\"],\\\"pull\\\":[1],\\\"pullXs\\\":[1,\\\"pull-xs\\\"],\\\"pullSm\\\":[1,\\\"pull-sm\\\"],\\\"pullMd\\\":[1,\\\"pull-md\\\"],\\\"pullLg\\\":[1,\\\"pull-lg\\\"],\\\"pullXl\\\":[1,\\\"pull-xl\\\"],\\\"push\\\":[1],\\\"pushXs\\\":[1,\\\"push-xs\\\"],\\\"pushSm\\\":[1,\\\"push-sm\\\"],\\\"pushMd\\\":[1,\\\"push-md\\\"],\\\"pushLg\\\":[1,\\\"push-lg\\\"],\\\"pushXl\\\":[1,\\\"push-xl\\\"],\\\"size\\\":[1],\\\"sizeXs\\\":[1,\\\"size-xs\\\"],\\\"sizeSm\\\":[1,\\\"size-sm\\\"],\\\"sizeMd\\\":[1,\\\"size-md\\\"],\\\"sizeLg\\\":[1,\\\"size-lg\\\"],\\\"sizeXl\\\":[1,\\\"size-xl\\\"]},[[9,\\\"resize\\\",\\\"onResize\\\"]]],[1,\\\"ion-grid\\\",{\\\"fixed\\\":[4]}],[1,\\\"ion-row\\\"]]],[\\\"ion-img\\\",[[1,\\\"ion-img\\\",{\\\"alt\\\":[1],\\\"src\\\":[1],\\\"loadSrc\\\":[32],\\\"loadError\\\":[32]},null,{\\\"src\\\":[\\\"srcChanged\\\"]}]]],[\\\"ion-progress-bar\\\",[[33,\\\"ion-progress-bar\\\",{\\\"type\\\":[1],\\\"reversed\\\":[4],\\\"value\\\":[2],\\\"buffer\\\":[2],\\\"color\\\":[513]}]]],[\\\"ion-range\\\",[[33,\\\"ion-range\\\",{\\\"color\\\":[513],\\\"debounce\\\":[2],\\\"name\\\":[1],\\\"label\\\":[1],\\\"dualKnobs\\\":[4,\\\"dual-knobs\\\"],\\\"min\\\":[2],\\\"max\\\":[2],\\\"pin\\\":[4],\\\"pinFormatter\\\":[16],\\\"snaps\\\":[4],\\\"step\\\":[2],\\\"ticks\\\":[4],\\\"activeBarStart\\\":[1026,\\\"active-bar-start\\\"],\\\"disabled\\\":[4],\\\"value\\\":[1026],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"ratioA\\\":[32],\\\"ratioB\\\":[32],\\\"pressedKnob\\\":[32]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"min\\\":[\\\"minChanged\\\"],\\\"max\\\":[\\\"maxChanged\\\"],\\\"activeBarStart\\\":[\\\"activeBarStartChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-segment-content\\\",[[1,\\\"ion-segment-content\\\"]]],[\\\"ion-segment-view\\\",[[33,\\\"ion-segment-view\\\",{\\\"disabled\\\":[4],\\\"isManualScroll\\\":[32],\\\"setContent\\\":[64]},[[1,\\\"scroll\\\",\\\"handleScroll\\\"],[1,\\\"touchstart\\\",\\\"handleScrollStart\\\"],[1,\\\"touchend\\\",\\\"handleTouchEnd\\\"]]]]],[\\\"ion-split-pane\\\",[[33,\\\"ion-split-pane\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"disabled\\\":[4],\\\"when\\\":[8],\\\"visible\\\":[32],\\\"isVisible\\\":[64]},null,{\\\"visible\\\":[\\\"visibleChanged\\\"],\\\"disabled\\\":[\\\"updateState\\\"],\\\"when\\\":[\\\"updateState\\\"]}]]],[\\\"ion-text\\\",[[1,\\\"ion-text\\\",{\\\"color\\\":[513]}]]],[\\\"ion-select-modal\\\",[[34,\\\"ion-select-modal\\\",{\\\"header\\\":[1],\\\"multiple\\\":[4],\\\"options\\\":[16]}]]],[\\\"ion-datetime_3\\\",[[33,\\\"ion-datetime\\\",{\\\"color\\\":[1],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"formatOptions\\\":[16],\\\"readonly\\\":[4],\\\"isDateEnabled\\\":[16],\\\"min\\\":[1025],\\\"max\\\":[1025],\\\"presentation\\\":[1],\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"doneText\\\":[1,\\\"done-text\\\"],\\\"clearText\\\":[1,\\\"clear-text\\\"],\\\"yearValues\\\":[8,\\\"year-values\\\"],\\\"monthValues\\\":[8,\\\"month-values\\\"],\\\"dayValues\\\":[8,\\\"day-values\\\"],\\\"hourValues\\\":[8,\\\"hour-values\\\"],\\\"minuteValues\\\":[8,\\\"minute-values\\\"],\\\"locale\\\":[1],\\\"firstDayOfWeek\\\":[2,\\\"first-day-of-week\\\"],\\\"titleSelectedDatesFormatter\\\":[16],\\\"multiple\\\":[4],\\\"highlightedDates\\\":[16],\\\"value\\\":[1025],\\\"showDefaultTitle\\\":[4,\\\"show-default-title\\\"],\\\"showDefaultButtons\\\":[4,\\\"show-default-buttons\\\"],\\\"showClearButton\\\":[4,\\\"show-clear-button\\\"],\\\"showDefaultTimeLabel\\\":[4,\\\"show-default-time-label\\\"],\\\"hourCycle\\\":[1,\\\"hour-cycle\\\"],\\\"size\\\":[1],\\\"preferWheel\\\":[4,\\\"prefer-wheel\\\"],\\\"showMonthAndYear\\\":[32],\\\"activeParts\\\":[32],\\\"workingParts\\\":[32],\\\"isTimePopoverOpen\\\":[32],\\\"forceRenderDate\\\":[32],\\\"confirm\\\":[64],\\\"reset\\\":[64],\\\"cancel\\\":[64]},null,{\\\"formatOptions\\\":[\\\"formatOptionsChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"min\\\":[\\\"minChanged\\\"],\\\"max\\\":[\\\"maxChanged\\\"],\\\"presentation\\\":[\\\"presentationChanged\\\"],\\\"yearValues\\\":[\\\"yearValuesChanged\\\"],\\\"monthValues\\\":[\\\"monthValuesChanged\\\"],\\\"dayValues\\\":[\\\"dayValuesChanged\\\"],\\\"hourValues\\\":[\\\"hourValuesChanged\\\"],\\\"minuteValues\\\":[\\\"minuteValuesChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}],[34,\\\"ion-picker-legacy\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"columns\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"getColumn\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}],[32,\\\"ion-picker-legacy-column\\\",{\\\"col\\\":[16]},null,{\\\"col\\\":[\\\"colChanged\\\"]}]]],[\\\"ion-action-sheet\\\",[[34,\\\"ion-action-sheet\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-alert\\\",[[34,\\\"ion-alert\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"buttons\\\":[16],\\\"inputs\\\":[1040],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"],\\\"buttons\\\":[\\\"buttonsChanged\\\"],\\\"inputs\\\":[\\\"inputsChanged\\\"]}]]],[\\\"ion-modal\\\",[[33,\\\"ion-modal\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"breakpoints\\\":[16],\\\"initialBreakpoint\\\":[2,\\\"initial-breakpoint\\\"],\\\"backdropBreakpoint\\\":[2,\\\"backdrop-breakpoint\\\"],\\\"handle\\\":[4],\\\"handleBehavior\\\":[1,\\\"handle-behavior\\\"],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"animated\\\":[4],\\\"presentingElement\\\":[16],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"focusTrap\\\":[4,\\\"focus-trap\\\"],\\\"canDismiss\\\":[4,\\\"can-dismiss\\\"],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"setCurrentBreakpoint\\\":[64],\\\"getCurrentBreakpoint\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-picker\\\",[[33,\\\"ion-picker\\\",{\\\"exitInputMode\\\":[64]},[[1,\\\"touchstart\\\",\\\"preventTouchStartPropagation\\\"]]]]],[\\\"ion-picker-column\\\",[[1,\\\"ion-picker-column\\\",{\\\"disabled\\\":[4],\\\"value\\\":[1032],\\\"color\\\":[513],\\\"numericInput\\\":[4,\\\"numeric-input\\\"],\\\"ariaLabel\\\":[32],\\\"isActive\\\":[32],\\\"scrollActiveItemIntoView\\\":[64],\\\"setValue\\\":[64],\\\"setFocus\\\":[64]},null,{\\\"aria-label\\\":[\\\"ariaLabelChanged\\\"],\\\"value\\\":[\\\"valueChange\\\"]}]]],[\\\"ion-picker-column-option\\\",[[33,\\\"ion-picker-column-option\\\",{\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"color\\\":[513],\\\"ariaLabel\\\":[32]},null,{\\\"aria-label\\\":[\\\"onAriaLabelChange\\\"]}]]],[\\\"ion-popover\\\",[[33,\\\"ion-popover\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"delegate\\\":[16],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"event\\\":[8],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"triggerAction\\\":[1,\\\"trigger-action\\\"],\\\"trigger\\\":[1],\\\"size\\\":[1],\\\"dismissOnSelect\\\":[4,\\\"dismiss-on-select\\\"],\\\"reference\\\":[1],\\\"side\\\":[1],\\\"alignment\\\":[1025],\\\"arrow\\\":[4],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"keyboardEvents\\\":[4,\\\"keyboard-events\\\"],\\\"focusTrap\\\":[4,\\\"focus-trap\\\"],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"presented\\\":[32],\\\"presentFromTrigger\\\":[64],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"getParentPopover\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"trigger\\\":[\\\"onTriggerChange\\\"],\\\"triggerAction\\\":[\\\"onTriggerChange\\\"],\\\"isOpen\\\":[\\\"onIsOpenChange\\\"]}]]],[\\\"ion-checkbox\\\",[[33,\\\"ion-checkbox\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"indeterminate\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"setFocus\\\":[64]}]]],[\\\"ion-item_8\\\",[[33,\\\"ion-item-divider\\\",{\\\"color\\\":[513],\\\"sticky\\\":[4]}],[32,\\\"ion-item-group\\\"],[33,\\\"ion-note\\\",{\\\"color\\\":[513]}],[1,\\\"ion-skeleton-text\\\",{\\\"animated\\\":[4]}],[38,\\\"ion-label\\\",{\\\"color\\\":[513],\\\"position\\\":[1],\\\"noAnimate\\\":[32]},null,{\\\"color\\\":[\\\"colorChanged\\\"],\\\"position\\\":[\\\"positionChanged\\\"]}],[33,\\\"ion-list-header\\\",{\\\"color\\\":[513],\\\"lines\\\":[1]}],[33,\\\"ion-item\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"detail\\\":[4],\\\"detailIcon\\\":[1,\\\"detail-icon\\\"],\\\"disabled\\\":[516],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"lines\\\":[1],\\\"routerAnimation\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"target\\\":[1],\\\"type\\\":[1],\\\"multipleInputs\\\":[32],\\\"focusable\\\":[32]},[[0,\\\"ionColor\\\",\\\"labelColorChanged\\\"],[0,\\\"ionStyle\\\",\\\"itemStyle\\\"]],{\\\"button\\\":[\\\"buttonChanged\\\"]}],[32,\\\"ion-list\\\",{\\\"lines\\\":[1],\\\"inset\\\":[4],\\\"closeSlidingItems\\\":[64]}]]],[\\\"ion-app_8\\\",[[0,\\\"ion-app\\\",{\\\"setFocus\\\":[64]}],[36,\\\"ion-footer\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]}],[1,\\\"ion-router-outlet\\\",{\\\"mode\\\":[1025],\\\"delegate\\\":[16],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"swipeHandler\\\":[16],\\\"commit\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]},null,{\\\"swipeHandler\\\":[\\\"swipeHandlerChanged\\\"]}],[1,\\\"ion-content\\\",{\\\"color\\\":[513],\\\"fullscreen\\\":[4],\\\"fixedSlotPlacement\\\":[1,\\\"fixed-slot-placement\\\"],\\\"forceOverscroll\\\":[1028,\\\"force-overscroll\\\"],\\\"scrollX\\\":[4,\\\"scroll-x\\\"],\\\"scrollY\\\":[4,\\\"scroll-y\\\"],\\\"scrollEvents\\\":[4,\\\"scroll-events\\\"],\\\"getScrollElement\\\":[64],\\\"getBackgroundElement\\\":[64],\\\"scrollToTop\\\":[64],\\\"scrollToBottom\\\":[64],\\\"scrollByPoint\\\":[64],\\\"scrollToPoint\\\":[64]},[[9,\\\"resize\\\",\\\"onResize\\\"]]],[36,\\\"ion-header\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4]}],[33,\\\"ion-title\\\",{\\\"color\\\":[513],\\\"size\\\":[1]},null,{\\\"size\\\":[\\\"sizeChanged\\\"]}],[33,\\\"ion-toolbar\\\",{\\\"color\\\":[513]},[[0,\\\"ionStyle\\\",\\\"childrenStyle\\\"]]],[38,\\\"ion-buttons\\\",{\\\"collapse\\\":[4]}]]],[\\\"ion-select_3\\\",[[33,\\\"ion-select\\\",{\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"color\\\":[513],\\\"compareWith\\\":[1,\\\"compare-with\\\"],\\\"disabled\\\":[4],\\\"fill\\\":[1],\\\"interface\\\":[1],\\\"interfaceOptions\\\":[8,\\\"interface-options\\\"],\\\"justify\\\":[1],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"multiple\\\":[4],\\\"name\\\":[1],\\\"okText\\\":[1,\\\"ok-text\\\"],\\\"placeholder\\\":[1],\\\"selectedText\\\":[1,\\\"selected-text\\\"],\\\"toggleIcon\\\":[1,\\\"toggle-icon\\\"],\\\"expandedIcon\\\":[1,\\\"expanded-icon\\\"],\\\"shape\\\":[1],\\\"value\\\":[1032],\\\"isExpanded\\\":[32],\\\"open\\\":[64]},null,{\\\"disabled\\\":[\\\"styleChanged\\\"],\\\"isExpanded\\\":[\\\"styleChanged\\\"],\\\"placeholder\\\":[\\\"styleChanged\\\"],\\\"value\\\":[\\\"styleChanged\\\"]}],[1,\\\"ion-select-option\\\",{\\\"disabled\\\":[4],\\\"value\\\":[8]}],[34,\\\"ion-select-popover\\\",{\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"multiple\\\":[4],\\\"options\\\":[16]}]]],[\\\"ion-spinner\\\",[[1,\\\"ion-spinner\\\",{\\\"color\\\":[513],\\\"duration\\\":[2],\\\"name\\\":[1],\\\"paused\\\":[4]}]]],[\\\"ion-radio_2\\\",[[33,\\\"ion-radio\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"checked\\\":[32],\\\"buttonTabindex\\\":[32],\\\"setFocus\\\":[64],\\\"setButtonTabindex\\\":[64]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[0,\\\"ion-radio-group\\\",{\\\"allowEmptySelection\\\":[4,\\\"allow-empty-selection\\\"],\\\"compareWith\\\":[1,\\\"compare-with\\\"],\\\"name\\\":[1],\\\"value\\\":[1032],\\\"setFocus\\\":[64]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-ripple-effect\\\",[[1,\\\"ion-ripple-effect\\\",{\\\"type\\\":[1],\\\"addRipple\\\":[64]}]]],[\\\"ion-button_2\\\",[[33,\\\"ion-button\\\",{\\\"color\\\":[513],\\\"buttonType\\\":[1025,\\\"button-type\\\"],\\\"disabled\\\":[516],\\\"expand\\\":[513],\\\"fill\\\":[1537],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"shape\\\":[513],\\\"size\\\":[513],\\\"strong\\\":[4],\\\"target\\\":[1],\\\"type\\\":[1],\\\"form\\\":[1],\\\"isCircle\\\":[32]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}],[1,\\\"ion-icon\\\",{\\\"mode\\\":[1025],\\\"color\\\":[1],\\\"ios\\\":[1],\\\"md\\\":[1],\\\"flipRtl\\\":[4,\\\"flip-rtl\\\"],\\\"name\\\":[513],\\\"src\\\":[1],\\\"icon\\\":[8],\\\"size\\\":[1],\\\"lazy\\\":[4],\\\"sanitize\\\":[4],\\\"svgContent\\\":[32],\\\"isVisible\\\":[32]},null,{\\\"name\\\":[\\\"loadIcon\\\"],\\\"src\\\":[\\\"loadIcon\\\"],\\\"icon\\\":[\\\"loadIcon\\\"],\\\"ios\\\":[\\\"loadIcon\\\"],\\\"md\\\":[\\\"loadIcon\\\"]}]]]]\"), options);\n};\n\nexport { defineCustomElements };\n","import * as i0 from '@angular/core';\nimport { Directive, HostListener, Component, ChangeDetectionStrategy, ViewContainerRef, Attribute, Optional, SkipSelf, ViewChild, ContentChild, ContentChildren, forwardRef, Injectable, inject, Injector, EnvironmentInjector, APP_INITIALIZER, NgZone, NgModule } from '@angular/core';\nimport { NG_VALUE_ACCESSOR, NG_VALIDATORS, MaxValidator, MinValidator } from '@angular/forms';\nimport * as i2$1 from '@ionic/angular/common';\nimport { ValueAccessor, setIonicClasses, IonRouterOutlet as IonRouterOutlet$1, IonTabs as IonTabs$1, IonBackButton as IonBackButton$1, IonNav as IonNav$1, RouterLinkDelegateDirective as RouterLinkDelegateDirective$1, RouterLinkWithHrefDelegateDirective as RouterLinkWithHrefDelegateDirective$1, IonModal as IonModal$1, IonPopover as IonPopover$1, OverlayBaseController, MenuController as MenuController$1, AngularDelegate, raf, ConfigToken, provideComponentInputBinding } from '@ionic/angular/common';\nexport { AngularDelegate, Config, DomController, IonicRouteStrategy, NavController, NavParams, Platform } from '@ionic/angular/common';\nimport { __decorate } from 'tslib';\nimport { fromEvent } from 'rxjs';\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, CommonModule } from '@angular/common';\nimport * as i2 from '@angular/router';\nimport { alertController, createAnimation, getTimeGivenProgression, actionSheetController, createGesture, loadingController, menuController, modalController, pickerController, popoverController, toastController, setupConfig } from '@ionic/core';\nexport { IonicSafeString, IonicSlides, createAnimation, createGesture, getIonPageElement, getPlatforms, getTimeGivenProgression, iosTransitionAnimation, isPlatform, mdTransitionAnimation, openURL } from '@ionic/core';\nimport { applyPolyfills, defineCustomElements } from '@ionic/core/loader';\n\nclass BooleanValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n writeValue(value) {\n this.elementRef.nativeElement.checked = this.lastValue = value;\n setIonicClasses(this.elementRef);\n }\n _handleIonChange(el) {\n this.handleValueChange(el, el.checked);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BooleanValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: BooleanValueAccessorDirective, selector: \"ion-checkbox,ion-toggle\", host: { listeners: { \"ionChange\": \"_handleIonChange($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: BooleanValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BooleanValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-checkbox,ion-toggle',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: BooleanValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleIonChange: [{\n type: HostListener,\n args: ['ionChange', ['$event.target']]\n }] } });\n\nclass NumericValueAccessorDirective extends ValueAccessor {\n el;\n constructor(injector, el) {\n super(injector, el);\n this.el = el;\n }\n handleInputEvent(el) {\n this.handleValueChange(el, el.value);\n }\n registerOnChange(fn) {\n if (this.el.nativeElement.tagName === 'ION-INPUT') {\n super.registerOnChange((value) => {\n fn(value === '' ? null : parseFloat(value));\n });\n }\n else {\n super.registerOnChange(fn);\n }\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NumericValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NumericValueAccessorDirective, selector: \"ion-input[type=number],ion-range\", host: { listeners: { \"ionInput\": \"handleInputEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: NumericValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NumericValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input[type=number],ion-range',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: NumericValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { handleInputEvent: [{\n type: HostListener,\n args: ['ionInput', ['$event.target']]\n }] } });\n\nclass SelectValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n _handleChangeEvent(el) {\n this.handleValueChange(el, el.value);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SelectValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: SelectValueAccessorDirective, selector: \"ion-select, ion-radio-group, ion-segment, ion-datetime\", host: { listeners: { \"ionChange\": \"_handleChangeEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: SelectValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SelectValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n /* tslint:disable-next-line:directive-selector */\n selector: 'ion-select, ion-radio-group, ion-segment, ion-datetime',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: SelectValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleChangeEvent: [{\n type: HostListener,\n args: ['ionChange', ['$event.target']]\n }] } });\n\nclass TextValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n _handleInputEvent(el) {\n this.handleValueChange(el, el.value);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TextValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: TextValueAccessorDirective, selector: \"ion-input:not([type=number]),ion-textarea,ion-searchbar\", host: { listeners: { \"ionInput\": \"_handleInputEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: TextValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TextValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input:not([type=number]),ion-textarea,ion-searchbar',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: TextValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleInputEvent: [{\n type: HostListener,\n args: ['ionInput', ['$event.target']]\n }] } });\n\n/* eslint-disable */\n/* tslint:disable */\nconst proxyInputs = (Cmp, inputs) => {\n const Prototype = Cmp.prototype;\n inputs.forEach((item) => {\n Object.defineProperty(Prototype, item, {\n get() {\n return this.el[item];\n },\n set(val) {\n this.z.runOutsideAngular(() => (this.el[item] = val));\n },\n /**\n * In the event that proxyInputs is called\n * multiple times re-defining these inputs\n * will cause an error to be thrown. As a result\n * we set configurable: true to indicate these\n * properties can be changed.\n */\n configurable: true,\n });\n });\n};\nconst proxyMethods = (Cmp, methods) => {\n const Prototype = Cmp.prototype;\n methods.forEach((methodName) => {\n Prototype[methodName] = function () {\n const args = arguments;\n return this.z.runOutsideAngular(() => this.el[methodName].apply(this.el, args));\n };\n });\n};\nconst proxyOutputs = (instance, el, events) => {\n events.forEach((eventName) => (instance[eventName] = fromEvent(el, eventName)));\n};\nconst defineCustomElement = (tagName, customElement) => {\n if (customElement !== undefined && typeof customElements !== 'undefined' && !customElements.get(tagName)) {\n customElements.define(tagName, customElement);\n }\n};\n// tslint:disable-next-line: only-arrow-functions\nfunction ProxyCmp(opts) {\n const decorator = function (cls) {\n const { defineCustomElementFn, inputs, methods } = opts;\n if (defineCustomElementFn !== undefined) {\n defineCustomElementFn();\n }\n if (inputs) {\n proxyInputs(cls, inputs);\n }\n if (methods) {\n proxyMethods(cls, methods);\n }\n return cls;\n };\n return decorator;\n}\n\nlet IonAccordion = class IonAccordion {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAccordion, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonAccordion, selector: \"ion-accordion\", inputs: { disabled: \"disabled\", mode: \"mode\", readonly: \"readonly\", toggleIcon: \"toggleIcon\", toggleIconSlot: \"toggleIconSlot\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonAccordion = __decorate([\n ProxyCmp({\n inputs: ['disabled', 'mode', 'readonly', 'toggleIcon', 'toggleIconSlot', 'value']\n })\n], IonAccordion);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAccordion, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-accordion',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled', 'mode', 'readonly', 'toggleIcon', 'toggleIconSlot', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonAccordionGroup = class IonAccordionGroup {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAccordionGroup, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonAccordionGroup, selector: \"ion-accordion-group\", inputs: { animated: \"animated\", disabled: \"disabled\", expand: \"expand\", mode: \"mode\", multiple: \"multiple\", readonly: \"readonly\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonAccordionGroup = __decorate([\n ProxyCmp({\n inputs: ['animated', 'disabled', 'expand', 'mode', 'multiple', 'readonly', 'value']\n })\n], IonAccordionGroup);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAccordionGroup, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-accordion-group',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'disabled', 'expand', 'mode', 'multiple', 'readonly', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonActionSheet = class IonActionSheet {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionActionSheetDidPresent', 'ionActionSheetWillPresent', 'ionActionSheetWillDismiss', 'ionActionSheetDidDismiss', 'didPresent', 'willPresent', 'willDismiss', 'didDismiss']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonActionSheet, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonActionSheet, selector: \"ion-action-sheet\", inputs: { animated: \"animated\", backdropDismiss: \"backdropDismiss\", buttons: \"buttons\", cssClass: \"cssClass\", enterAnimation: \"enterAnimation\", header: \"header\", htmlAttributes: \"htmlAttributes\", isOpen: \"isOpen\", keyboardClose: \"keyboardClose\", leaveAnimation: \"leaveAnimation\", mode: \"mode\", subHeader: \"subHeader\", translucent: \"translucent\", trigger: \"trigger\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonActionSheet = __decorate([\n ProxyCmp({\n inputs: ['animated', 'backdropDismiss', 'buttons', 'cssClass', 'enterAnimation', 'header', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'mode', 'subHeader', 'translucent', 'trigger'],\n methods: ['present', 'dismiss', 'onDidDismiss', 'onWillDismiss']\n })\n], IonActionSheet);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonActionSheet, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-action-sheet',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'backdropDismiss', 'buttons', 'cssClass', 'enterAnimation', 'header', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'mode', 'subHeader', 'translucent', 'trigger'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonAlert = class IonAlert {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionAlertDidPresent', 'ionAlertWillPresent', 'ionAlertWillDismiss', 'ionAlertDidDismiss', 'didPresent', 'willPresent', 'willDismiss', 'didDismiss']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAlert, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonAlert, selector: \"ion-alert\", inputs: { animated: \"animated\", backdropDismiss: \"backdropDismiss\", buttons: \"buttons\", cssClass: \"cssClass\", enterAnimation: \"enterAnimation\", header: \"header\", htmlAttributes: \"htmlAttributes\", inputs: \"inputs\", isOpen: \"isOpen\", keyboardClose: \"keyboardClose\", leaveAnimation: \"leaveAnimation\", message: \"message\", mode: \"mode\", subHeader: \"subHeader\", translucent: \"translucent\", trigger: \"trigger\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonAlert = __decorate([\n ProxyCmp({\n inputs: ['animated', 'backdropDismiss', 'buttons', 'cssClass', 'enterAnimation', 'header', 'htmlAttributes', 'inputs', 'isOpen', 'keyboardClose', 'leaveAnimation', 'message', 'mode', 'subHeader', 'translucent', 'trigger'],\n methods: ['present', 'dismiss', 'onDidDismiss', 'onWillDismiss']\n })\n], IonAlert);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAlert, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-alert',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'backdropDismiss', 'buttons', 'cssClass', 'enterAnimation', 'header', 'htmlAttributes', 'inputs', 'isOpen', 'keyboardClose', 'leaveAnimation', 'message', 'mode', 'subHeader', 'translucent', 'trigger'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonApp = class IonApp {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonApp, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonApp, selector: \"ion-app\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonApp = __decorate([\n ProxyCmp({\n methods: ['setFocus']\n })\n], IonApp);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonApp, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-app',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonAvatar = class IonAvatar {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAvatar, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonAvatar, selector: \"ion-avatar\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonAvatar = __decorate([\n ProxyCmp({})\n], IonAvatar);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAvatar, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-avatar',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonBackdrop = class IonBackdrop {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionBackdropTap']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBackdrop, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonBackdrop, selector: \"ion-backdrop\", inputs: { stopPropagation: \"stopPropagation\", tappable: \"tappable\", visible: \"visible\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonBackdrop = __decorate([\n ProxyCmp({\n inputs: ['stopPropagation', 'tappable', 'visible']\n })\n], IonBackdrop);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBackdrop, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-backdrop',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['stopPropagation', 'tappable', 'visible'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonBadge = class IonBadge {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBadge, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonBadge, selector: \"ion-badge\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonBadge = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonBadge);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBadge, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-badge',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonBreadcrumb = class IonBreadcrumb {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBreadcrumb, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonBreadcrumb, selector: \"ion-breadcrumb\", inputs: { active: \"active\", color: \"color\", disabled: \"disabled\", download: \"download\", href: \"href\", mode: \"mode\", rel: \"rel\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\", separator: \"separator\", target: \"target\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonBreadcrumb = __decorate([\n ProxyCmp({\n inputs: ['active', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'separator', 'target']\n })\n], IonBreadcrumb);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBreadcrumb, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-breadcrumb',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['active', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'separator', 'target'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonBreadcrumbs = class IonBreadcrumbs {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionCollapsedClick']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBreadcrumbs, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonBreadcrumbs, selector: \"ion-breadcrumbs\", inputs: { color: \"color\", itemsAfterCollapse: \"itemsAfterCollapse\", itemsBeforeCollapse: \"itemsBeforeCollapse\", maxItems: \"maxItems\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonBreadcrumbs = __decorate([\n ProxyCmp({\n inputs: ['color', 'itemsAfterCollapse', 'itemsBeforeCollapse', 'maxItems', 'mode']\n })\n], IonBreadcrumbs);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBreadcrumbs, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-breadcrumbs',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'itemsAfterCollapse', 'itemsBeforeCollapse', 'maxItems', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonButton = class IonButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonButton, selector: \"ion-button\", inputs: { buttonType: \"buttonType\", color: \"color\", disabled: \"disabled\", download: \"download\", expand: \"expand\", fill: \"fill\", form: \"form\", href: \"href\", mode: \"mode\", rel: \"rel\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\", shape: \"shape\", size: \"size\", strong: \"strong\", target: \"target\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonButton = __decorate([\n ProxyCmp({\n inputs: ['buttonType', 'color', 'disabled', 'download', 'expand', 'fill', 'form', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'shape', 'size', 'strong', 'target', 'type']\n })\n], IonButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['buttonType', 'color', 'disabled', 'download', 'expand', 'fill', 'form', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'shape', 'size', 'strong', 'target', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonButtons = class IonButtons {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonButtons, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonButtons, selector: \"ion-buttons\", inputs: { collapse: \"collapse\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonButtons = __decorate([\n ProxyCmp({\n inputs: ['collapse']\n })\n], IonButtons);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonButtons, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-buttons',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['collapse'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCard = class IonCard {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCard, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCard, selector: \"ion-card\", inputs: { button: \"button\", color: \"color\", disabled: \"disabled\", download: \"download\", href: \"href\", mode: \"mode\", rel: \"rel\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\", target: \"target\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCard = __decorate([\n ProxyCmp({\n inputs: ['button', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'target', 'type']\n })\n], IonCard);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCard, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-card',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['button', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'target', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCardContent = class IonCardContent {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardContent, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCardContent, selector: \"ion-card-content\", inputs: { mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCardContent = __decorate([\n ProxyCmp({\n inputs: ['mode']\n })\n], IonCardContent);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardContent, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-card-content',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCardHeader = class IonCardHeader {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardHeader, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCardHeader, selector: \"ion-card-header\", inputs: { color: \"color\", mode: \"mode\", translucent: \"translucent\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCardHeader = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode', 'translucent']\n })\n], IonCardHeader);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardHeader, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-card-header',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode', 'translucent'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCardSubtitle = class IonCardSubtitle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardSubtitle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCardSubtitle, selector: \"ion-card-subtitle\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCardSubtitle = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonCardSubtitle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardSubtitle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-card-subtitle',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCardTitle = class IonCardTitle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardTitle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCardTitle, selector: \"ion-card-title\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCardTitle = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonCardTitle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCardTitle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-card-title',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCheckbox = class IonCheckbox {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange', 'ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCheckbox, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCheckbox, selector: \"ion-checkbox\", inputs: { alignment: \"alignment\", checked: \"checked\", color: \"color\", disabled: \"disabled\", indeterminate: \"indeterminate\", justify: \"justify\", labelPlacement: \"labelPlacement\", mode: \"mode\", name: \"name\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCheckbox = __decorate([\n ProxyCmp({\n inputs: ['alignment', 'checked', 'color', 'disabled', 'indeterminate', 'justify', 'labelPlacement', 'mode', 'name', 'value']\n })\n], IonCheckbox);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCheckbox, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-checkbox',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['alignment', 'checked', 'color', 'disabled', 'indeterminate', 'justify', 'labelPlacement', 'mode', 'name', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonChip = class IonChip {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonChip, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonChip, selector: \"ion-chip\", inputs: { color: \"color\", disabled: \"disabled\", mode: \"mode\", outline: \"outline\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonChip = __decorate([\n ProxyCmp({\n inputs: ['color', 'disabled', 'mode', 'outline']\n })\n], IonChip);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonChip, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-chip',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'disabled', 'mode', 'outline'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonCol = class IonCol {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCol, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonCol, selector: \"ion-col\", inputs: { offset: \"offset\", offsetLg: \"offsetLg\", offsetMd: \"offsetMd\", offsetSm: \"offsetSm\", offsetXl: \"offsetXl\", offsetXs: \"offsetXs\", pull: \"pull\", pullLg: \"pullLg\", pullMd: \"pullMd\", pullSm: \"pullSm\", pullXl: \"pullXl\", pullXs: \"pullXs\", push: \"push\", pushLg: \"pushLg\", pushMd: \"pushMd\", pushSm: \"pushSm\", pushXl: \"pushXl\", pushXs: \"pushXs\", size: \"size\", sizeLg: \"sizeLg\", sizeMd: \"sizeMd\", sizeSm: \"sizeSm\", sizeXl: \"sizeXl\", sizeXs: \"sizeXs\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonCol = __decorate([\n ProxyCmp({\n inputs: ['offset', 'offsetLg', 'offsetMd', 'offsetSm', 'offsetXl', 'offsetXs', 'pull', 'pullLg', 'pullMd', 'pullSm', 'pullXl', 'pullXs', 'push', 'pushLg', 'pushMd', 'pushSm', 'pushXl', 'pushXs', 'size', 'sizeLg', 'sizeMd', 'sizeSm', 'sizeXl', 'sizeXs']\n })\n], IonCol);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonCol, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-col',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['offset', 'offsetLg', 'offsetMd', 'offsetSm', 'offsetXl', 'offsetXs', 'pull', 'pullLg', 'pullMd', 'pullSm', 'pullXl', 'pullXs', 'push', 'pushLg', 'pushMd', 'pushSm', 'pushXl', 'pushXs', 'size', 'sizeLg', 'sizeMd', 'sizeSm', 'sizeXl', 'sizeXs'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonContent = class IonContent {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionScrollStart', 'ionScroll', 'ionScrollEnd']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonContent, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonContent, selector: \"ion-content\", inputs: { color: \"color\", fixedSlotPlacement: \"fixedSlotPlacement\", forceOverscroll: \"forceOverscroll\", fullscreen: \"fullscreen\", scrollEvents: \"scrollEvents\", scrollX: \"scrollX\", scrollY: \"scrollY\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonContent = __decorate([\n ProxyCmp({\n inputs: ['color', 'fixedSlotPlacement', 'forceOverscroll', 'fullscreen', 'scrollEvents', 'scrollX', 'scrollY'],\n methods: ['getScrollElement', 'scrollToTop', 'scrollToBottom', 'scrollByPoint', 'scrollToPoint']\n })\n], IonContent);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonContent, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-content',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'fixedSlotPlacement', 'forceOverscroll', 'fullscreen', 'scrollEvents', 'scrollX', 'scrollY'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonDatetime = class IonDatetime {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionCancel', 'ionChange', 'ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonDatetime, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonDatetime, selector: \"ion-datetime\", inputs: { cancelText: \"cancelText\", clearText: \"clearText\", color: \"color\", dayValues: \"dayValues\", disabled: \"disabled\", doneText: \"doneText\", firstDayOfWeek: \"firstDayOfWeek\", formatOptions: \"formatOptions\", highlightedDates: \"highlightedDates\", hourCycle: \"hourCycle\", hourValues: \"hourValues\", isDateEnabled: \"isDateEnabled\", locale: \"locale\", max: \"max\", min: \"min\", minuteValues: \"minuteValues\", mode: \"mode\", monthValues: \"monthValues\", multiple: \"multiple\", name: \"name\", preferWheel: \"preferWheel\", presentation: \"presentation\", readonly: \"readonly\", showClearButton: \"showClearButton\", showDefaultButtons: \"showDefaultButtons\", showDefaultTimeLabel: \"showDefaultTimeLabel\", showDefaultTitle: \"showDefaultTitle\", size: \"size\", titleSelectedDatesFormatter: \"titleSelectedDatesFormatter\", value: \"value\", yearValues: \"yearValues\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonDatetime = __decorate([\n ProxyCmp({\n inputs: ['cancelText', 'clearText', 'color', 'dayValues', 'disabled', 'doneText', 'firstDayOfWeek', 'formatOptions', 'highlightedDates', 'hourCycle', 'hourValues', 'isDateEnabled', 'locale', 'max', 'min', 'minuteValues', 'mode', 'monthValues', 'multiple', 'name', 'preferWheel', 'presentation', 'readonly', 'showClearButton', 'showDefaultButtons', 'showDefaultTimeLabel', 'showDefaultTitle', 'size', 'titleSelectedDatesFormatter', 'value', 'yearValues'],\n methods: ['confirm', 'reset', 'cancel']\n })\n], IonDatetime);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonDatetime, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-datetime',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['cancelText', 'clearText', 'color', 'dayValues', 'disabled', 'doneText', 'firstDayOfWeek', 'formatOptions', 'highlightedDates', 'hourCycle', 'hourValues', 'isDateEnabled', 'locale', 'max', 'min', 'minuteValues', 'mode', 'monthValues', 'multiple', 'name', 'preferWheel', 'presentation', 'readonly', 'showClearButton', 'showDefaultButtons', 'showDefaultTimeLabel', 'showDefaultTitle', 'size', 'titleSelectedDatesFormatter', 'value', 'yearValues'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonDatetimeButton = class IonDatetimeButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonDatetimeButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonDatetimeButton, selector: \"ion-datetime-button\", inputs: { color: \"color\", datetime: \"datetime\", disabled: \"disabled\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonDatetimeButton = __decorate([\n ProxyCmp({\n inputs: ['color', 'datetime', 'disabled', 'mode']\n })\n], IonDatetimeButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonDatetimeButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-datetime-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'datetime', 'disabled', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonFab = class IonFab {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFab, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonFab, selector: \"ion-fab\", inputs: { activated: \"activated\", edge: \"edge\", horizontal: \"horizontal\", vertical: \"vertical\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonFab = __decorate([\n ProxyCmp({\n inputs: ['activated', 'edge', 'horizontal', 'vertical'],\n methods: ['close']\n })\n], IonFab);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFab, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-fab',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['activated', 'edge', 'horizontal', 'vertical'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonFabButton = class IonFabButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFabButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonFabButton, selector: \"ion-fab-button\", inputs: { activated: \"activated\", closeIcon: \"closeIcon\", color: \"color\", disabled: \"disabled\", download: \"download\", href: \"href\", mode: \"mode\", rel: \"rel\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\", show: \"show\", size: \"size\", target: \"target\", translucent: \"translucent\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonFabButton = __decorate([\n ProxyCmp({\n inputs: ['activated', 'closeIcon', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'show', 'size', 'target', 'translucent', 'type']\n })\n], IonFabButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFabButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-fab-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['activated', 'closeIcon', 'color', 'disabled', 'download', 'href', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'show', 'size', 'target', 'translucent', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonFabList = class IonFabList {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFabList, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonFabList, selector: \"ion-fab-list\", inputs: { activated: \"activated\", side: \"side\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonFabList = __decorate([\n ProxyCmp({\n inputs: ['activated', 'side']\n })\n], IonFabList);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFabList, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-fab-list',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['activated', 'side'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonFooter = class IonFooter {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFooter, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonFooter, selector: \"ion-footer\", inputs: { collapse: \"collapse\", mode: \"mode\", translucent: \"translucent\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonFooter = __decorate([\n ProxyCmp({\n inputs: ['collapse', 'mode', 'translucent']\n })\n], IonFooter);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonFooter, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-footer',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['collapse', 'mode', 'translucent'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonGrid = class IonGrid {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonGrid, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonGrid, selector: \"ion-grid\", inputs: { fixed: \"fixed\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonGrid = __decorate([\n ProxyCmp({\n inputs: ['fixed']\n })\n], IonGrid);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonGrid, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-grid',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['fixed'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonHeader = class IonHeader {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonHeader, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonHeader, selector: \"ion-header\", inputs: { collapse: \"collapse\", mode: \"mode\", translucent: \"translucent\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonHeader = __decorate([\n ProxyCmp({\n inputs: ['collapse', 'mode', 'translucent']\n })\n], IonHeader);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonHeader, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-header',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['collapse', 'mode', 'translucent'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonIcon = class IonIcon {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonIcon, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonIcon, selector: \"ion-icon\", inputs: { color: \"color\", flipRtl: \"flipRtl\", icon: \"icon\", ios: \"ios\", lazy: \"lazy\", md: \"md\", mode: \"mode\", name: \"name\", sanitize: \"sanitize\", size: \"size\", src: \"src\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonIcon = __decorate([\n ProxyCmp({\n inputs: ['color', 'flipRtl', 'icon', 'ios', 'lazy', 'md', 'mode', 'name', 'sanitize', 'size', 'src']\n })\n], IonIcon);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonIcon, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-icon',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'flipRtl', 'icon', 'ios', 'lazy', 'md', 'mode', 'name', 'sanitize', 'size', 'src'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonImg = class IonImg {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionImgWillLoad', 'ionImgDidLoad', 'ionError']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonImg, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonImg, selector: \"ion-img\", inputs: { alt: \"alt\", src: \"src\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonImg = __decorate([\n ProxyCmp({\n inputs: ['alt', 'src']\n })\n], IonImg);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonImg, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-img',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['alt', 'src'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonInfiniteScroll = class IonInfiniteScroll {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionInfinite']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInfiniteScroll, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonInfiniteScroll, selector: \"ion-infinite-scroll\", inputs: { disabled: \"disabled\", position: \"position\", threshold: \"threshold\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonInfiniteScroll = __decorate([\n ProxyCmp({\n inputs: ['disabled', 'position', 'threshold'],\n methods: ['complete']\n })\n], IonInfiniteScroll);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInfiniteScroll, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-infinite-scroll',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled', 'position', 'threshold'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonInfiniteScrollContent = class IonInfiniteScrollContent {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInfiniteScrollContent, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonInfiniteScrollContent, selector: \"ion-infinite-scroll-content\", inputs: { loadingSpinner: \"loadingSpinner\", loadingText: \"loadingText\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonInfiniteScrollContent = __decorate([\n ProxyCmp({\n inputs: ['loadingSpinner', 'loadingText']\n })\n], IonInfiniteScrollContent);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInfiniteScrollContent, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-infinite-scroll-content',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['loadingSpinner', 'loadingText'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonInput = class IonInput {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionInput', 'ionChange', 'ionBlur', 'ionFocus']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInput, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonInput, selector: \"ion-input\", inputs: { autocapitalize: \"autocapitalize\", autocomplete: \"autocomplete\", autocorrect: \"autocorrect\", autofocus: \"autofocus\", clearInput: \"clearInput\", clearInputIcon: \"clearInputIcon\", clearOnEdit: \"clearOnEdit\", color: \"color\", counter: \"counter\", counterFormatter: \"counterFormatter\", debounce: \"debounce\", disabled: \"disabled\", enterkeyhint: \"enterkeyhint\", errorText: \"errorText\", fill: \"fill\", helperText: \"helperText\", inputmode: \"inputmode\", label: \"label\", labelPlacement: \"labelPlacement\", max: \"max\", maxlength: \"maxlength\", min: \"min\", minlength: \"minlength\", mode: \"mode\", multiple: \"multiple\", name: \"name\", pattern: \"pattern\", placeholder: \"placeholder\", readonly: \"readonly\", required: \"required\", shape: \"shape\", spellcheck: \"spellcheck\", step: \"step\", type: \"type\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonInput = __decorate([\n ProxyCmp({\n inputs: ['autocapitalize', 'autocomplete', 'autocorrect', 'autofocus', 'clearInput', 'clearInputIcon', 'clearOnEdit', 'color', 'counter', 'counterFormatter', 'debounce', 'disabled', 'enterkeyhint', 'errorText', 'fill', 'helperText', 'inputmode', 'label', 'labelPlacement', 'max', 'maxlength', 'min', 'minlength', 'mode', 'multiple', 'name', 'pattern', 'placeholder', 'readonly', 'required', 'shape', 'spellcheck', 'step', 'type', 'value'],\n methods: ['setFocus', 'getInputElement']\n })\n], IonInput);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInput, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-input',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['autocapitalize', 'autocomplete', 'autocorrect', 'autofocus', 'clearInput', 'clearInputIcon', 'clearOnEdit', 'color', 'counter', 'counterFormatter', 'debounce', 'disabled', 'enterkeyhint', 'errorText', 'fill', 'helperText', 'inputmode', 'label', 'labelPlacement', 'max', 'maxlength', 'min', 'minlength', 'mode', 'multiple', 'name', 'pattern', 'placeholder', 'readonly', 'required', 'shape', 'spellcheck', 'step', 'type', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonInputPasswordToggle = class IonInputPasswordToggle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInputPasswordToggle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonInputPasswordToggle, selector: \"ion-input-password-toggle\", inputs: { color: \"color\", hideIcon: \"hideIcon\", mode: \"mode\", showIcon: \"showIcon\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonInputPasswordToggle = __decorate([\n ProxyCmp({\n inputs: ['color', 'hideIcon', 'mode', 'showIcon']\n })\n], IonInputPasswordToggle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonInputPasswordToggle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-input-password-toggle',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'hideIcon', 'mode', 'showIcon'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItem = class IonItem {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItem, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItem, selector: \"ion-item\", inputs: { button: \"button\", color: \"color\", detail: \"detail\", detailIcon: \"detailIcon\", disabled: \"disabled\", download: \"download\", href: \"href\", lines: \"lines\", mode: \"mode\", rel: \"rel\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\", target: \"target\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItem = __decorate([\n ProxyCmp({\n inputs: ['button', 'color', 'detail', 'detailIcon', 'disabled', 'download', 'href', 'lines', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'target', 'type']\n })\n], IonItem);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItem, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['button', 'color', 'detail', 'detailIcon', 'disabled', 'download', 'href', 'lines', 'mode', 'rel', 'routerAnimation', 'routerDirection', 'target', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItemDivider = class IonItemDivider {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemDivider, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItemDivider, selector: \"ion-item-divider\", inputs: { color: \"color\", mode: \"mode\", sticky: \"sticky\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItemDivider = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode', 'sticky']\n })\n], IonItemDivider);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemDivider, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item-divider',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode', 'sticky'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItemGroup = class IonItemGroup {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemGroup, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItemGroup, selector: \"ion-item-group\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItemGroup = __decorate([\n ProxyCmp({})\n], IonItemGroup);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemGroup, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item-group',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItemOption = class IonItemOption {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemOption, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItemOption, selector: \"ion-item-option\", inputs: { color: \"color\", disabled: \"disabled\", download: \"download\", expandable: \"expandable\", href: \"href\", mode: \"mode\", rel: \"rel\", target: \"target\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItemOption = __decorate([\n ProxyCmp({\n inputs: ['color', 'disabled', 'download', 'expandable', 'href', 'mode', 'rel', 'target', 'type']\n })\n], IonItemOption);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemOption, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item-option',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'disabled', 'download', 'expandable', 'href', 'mode', 'rel', 'target', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItemOptions = class IonItemOptions {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionSwipe']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemOptions, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItemOptions, selector: \"ion-item-options\", inputs: { side: \"side\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItemOptions = __decorate([\n ProxyCmp({\n inputs: ['side']\n })\n], IonItemOptions);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemOptions, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item-options',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['side'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonItemSliding = class IonItemSliding {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionDrag']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemSliding, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonItemSliding, selector: \"ion-item-sliding\", inputs: { disabled: \"disabled\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonItemSliding = __decorate([\n ProxyCmp({\n inputs: ['disabled'],\n methods: ['getOpenAmount', 'getSlidingRatio', 'open', 'close', 'closeOpened']\n })\n], IonItemSliding);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonItemSliding, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-item-sliding',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonLabel = class IonLabel {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonLabel, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonLabel, selector: \"ion-label\", inputs: { color: \"color\", mode: \"mode\", position: \"position\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonLabel = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode', 'position']\n })\n], IonLabel);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonLabel, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-label',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode', 'position'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonList = class IonList {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonList, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonList, selector: \"ion-list\", inputs: { inset: \"inset\", lines: \"lines\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonList = __decorate([\n ProxyCmp({\n inputs: ['inset', 'lines', 'mode'],\n methods: ['closeSlidingItems']\n })\n], IonList);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonList, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-list',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['inset', 'lines', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonListHeader = class IonListHeader {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonListHeader, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonListHeader, selector: \"ion-list-header\", inputs: { color: \"color\", lines: \"lines\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonListHeader = __decorate([\n ProxyCmp({\n inputs: ['color', 'lines', 'mode']\n })\n], IonListHeader);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonListHeader, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-list-header',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'lines', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonLoading = class IonLoading {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionLoadingDidPresent', 'ionLoadingWillPresent', 'ionLoadingWillDismiss', 'ionLoadingDidDismiss', 'didPresent', 'willPresent', 'willDismiss', 'didDismiss']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonLoading, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonLoading, selector: \"ion-loading\", inputs: { animated: \"animated\", backdropDismiss: \"backdropDismiss\", cssClass: \"cssClass\", duration: \"duration\", enterAnimation: \"enterAnimation\", htmlAttributes: \"htmlAttributes\", isOpen: \"isOpen\", keyboardClose: \"keyboardClose\", leaveAnimation: \"leaveAnimation\", message: \"message\", mode: \"mode\", showBackdrop: \"showBackdrop\", spinner: \"spinner\", translucent: \"translucent\", trigger: \"trigger\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonLoading = __decorate([\n ProxyCmp({\n inputs: ['animated', 'backdropDismiss', 'cssClass', 'duration', 'enterAnimation', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'message', 'mode', 'showBackdrop', 'spinner', 'translucent', 'trigger'],\n methods: ['present', 'dismiss', 'onDidDismiss', 'onWillDismiss']\n })\n], IonLoading);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonLoading, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-loading',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'backdropDismiss', 'cssClass', 'duration', 'enterAnimation', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'message', 'mode', 'showBackdrop', 'spinner', 'translucent', 'trigger'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonMenu = class IonMenu {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionWillOpen', 'ionWillClose', 'ionDidOpen', 'ionDidClose']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenu, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonMenu, selector: \"ion-menu\", inputs: { contentId: \"contentId\", disabled: \"disabled\", maxEdgeStart: \"maxEdgeStart\", menuId: \"menuId\", side: \"side\", swipeGesture: \"swipeGesture\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonMenu = __decorate([\n ProxyCmp({\n inputs: ['contentId', 'disabled', 'maxEdgeStart', 'menuId', 'side', 'swipeGesture', 'type'],\n methods: ['isOpen', 'isActive', 'open', 'close', 'toggle', 'setOpen']\n })\n], IonMenu);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenu, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-menu',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['contentId', 'disabled', 'maxEdgeStart', 'menuId', 'side', 'swipeGesture', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonMenuButton = class IonMenuButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenuButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonMenuButton, selector: \"ion-menu-button\", inputs: { autoHide: \"autoHide\", color: \"color\", disabled: \"disabled\", menu: \"menu\", mode: \"mode\", type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonMenuButton = __decorate([\n ProxyCmp({\n inputs: ['autoHide', 'color', 'disabled', 'menu', 'mode', 'type']\n })\n], IonMenuButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenuButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-menu-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['autoHide', 'color', 'disabled', 'menu', 'mode', 'type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonMenuToggle = class IonMenuToggle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenuToggle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonMenuToggle, selector: \"ion-menu-toggle\", inputs: { autoHide: \"autoHide\", menu: \"menu\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonMenuToggle = __decorate([\n ProxyCmp({\n inputs: ['autoHide', 'menu']\n })\n], IonMenuToggle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMenuToggle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-menu-toggle',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['autoHide', 'menu'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonNavLink = class IonNavLink {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNavLink, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonNavLink, selector: \"ion-nav-link\", inputs: { component: \"component\", componentProps: \"componentProps\", routerAnimation: \"routerAnimation\", routerDirection: \"routerDirection\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonNavLink = __decorate([\n ProxyCmp({\n inputs: ['component', 'componentProps', 'routerAnimation', 'routerDirection']\n })\n], IonNavLink);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNavLink, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-nav-link',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['component', 'componentProps', 'routerAnimation', 'routerDirection'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonNote = class IonNote {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNote, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonNote, selector: \"ion-note\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonNote = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonNote);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNote, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-note',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonPicker = class IonPicker {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPicker, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPicker, selector: \"ion-picker\", inputs: { mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonPicker = __decorate([\n ProxyCmp({\n inputs: ['mode']\n })\n], IonPicker);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPicker, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-picker',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonPickerColumn = class IonPickerColumn {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerColumn, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPickerColumn, selector: \"ion-picker-column\", inputs: { color: \"color\", disabled: \"disabled\", mode: \"mode\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonPickerColumn = __decorate([\n ProxyCmp({\n inputs: ['color', 'disabled', 'mode', 'value'],\n methods: ['setFocus']\n })\n], IonPickerColumn);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerColumn, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-picker-column',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'disabled', 'mode', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonPickerColumnOption = class IonPickerColumnOption {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerColumnOption, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPickerColumnOption, selector: \"ion-picker-column-option\", inputs: { color: \"color\", disabled: \"disabled\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonPickerColumnOption = __decorate([\n ProxyCmp({\n inputs: ['color', 'disabled', 'value']\n })\n], IonPickerColumnOption);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerColumnOption, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-picker-column-option',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'disabled', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonPickerLegacy = class IonPickerLegacy {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionPickerDidPresent', 'ionPickerWillPresent', 'ionPickerWillDismiss', 'ionPickerDidDismiss', 'didPresent', 'willPresent', 'willDismiss', 'didDismiss']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerLegacy, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPickerLegacy, selector: \"ion-picker-legacy\", inputs: { animated: \"animated\", backdropDismiss: \"backdropDismiss\", buttons: \"buttons\", columns: \"columns\", cssClass: \"cssClass\", duration: \"duration\", enterAnimation: \"enterAnimation\", htmlAttributes: \"htmlAttributes\", isOpen: \"isOpen\", keyboardClose: \"keyboardClose\", leaveAnimation: \"leaveAnimation\", mode: \"mode\", showBackdrop: \"showBackdrop\", trigger: \"trigger\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonPickerLegacy = __decorate([\n ProxyCmp({\n inputs: ['animated', 'backdropDismiss', 'buttons', 'columns', 'cssClass', 'duration', 'enterAnimation', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'mode', 'showBackdrop', 'trigger'],\n methods: ['present', 'dismiss', 'onDidDismiss', 'onWillDismiss', 'getColumn']\n })\n], IonPickerLegacy);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPickerLegacy, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-picker-legacy',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'backdropDismiss', 'buttons', 'columns', 'cssClass', 'duration', 'enterAnimation', 'htmlAttributes', 'isOpen', 'keyboardClose', 'leaveAnimation', 'mode', 'showBackdrop', 'trigger'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonProgressBar = class IonProgressBar {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonProgressBar, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonProgressBar, selector: \"ion-progress-bar\", inputs: { buffer: \"buffer\", color: \"color\", mode: \"mode\", reversed: \"reversed\", type: \"type\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonProgressBar = __decorate([\n ProxyCmp({\n inputs: ['buffer', 'color', 'mode', 'reversed', 'type', 'value']\n })\n], IonProgressBar);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonProgressBar, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-progress-bar',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['buffer', 'color', 'mode', 'reversed', 'type', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRadio = class IonRadio {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRadio, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRadio, selector: \"ion-radio\", inputs: { alignment: \"alignment\", color: \"color\", disabled: \"disabled\", justify: \"justify\", labelPlacement: \"labelPlacement\", mode: \"mode\", name: \"name\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRadio = __decorate([\n ProxyCmp({\n inputs: ['alignment', 'color', 'disabled', 'justify', 'labelPlacement', 'mode', 'name', 'value']\n })\n], IonRadio);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRadio, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-radio',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['alignment', 'color', 'disabled', 'justify', 'labelPlacement', 'mode', 'name', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRadioGroup = class IonRadioGroup {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRadioGroup, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRadioGroup, selector: \"ion-radio-group\", inputs: { allowEmptySelection: \"allowEmptySelection\", compareWith: \"compareWith\", name: \"name\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRadioGroup = __decorate([\n ProxyCmp({\n inputs: ['allowEmptySelection', 'compareWith', 'name', 'value']\n })\n], IonRadioGroup);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRadioGroup, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-radio-group',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['allowEmptySelection', 'compareWith', 'name', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRange = class IonRange {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange', 'ionInput', 'ionFocus', 'ionBlur', 'ionKnobMoveStart', 'ionKnobMoveEnd']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRange, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRange, selector: \"ion-range\", inputs: { activeBarStart: \"activeBarStart\", color: \"color\", debounce: \"debounce\", disabled: \"disabled\", dualKnobs: \"dualKnobs\", label: \"label\", labelPlacement: \"labelPlacement\", max: \"max\", min: \"min\", mode: \"mode\", name: \"name\", pin: \"pin\", pinFormatter: \"pinFormatter\", snaps: \"snaps\", step: \"step\", ticks: \"ticks\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRange = __decorate([\n ProxyCmp({\n inputs: ['activeBarStart', 'color', 'debounce', 'disabled', 'dualKnobs', 'label', 'labelPlacement', 'max', 'min', 'mode', 'name', 'pin', 'pinFormatter', 'snaps', 'step', 'ticks', 'value']\n })\n], IonRange);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRange, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-range',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['activeBarStart', 'color', 'debounce', 'disabled', 'dualKnobs', 'label', 'labelPlacement', 'max', 'min', 'mode', 'name', 'pin', 'pinFormatter', 'snaps', 'step', 'ticks', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRefresher = class IonRefresher {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionRefresh', 'ionPull', 'ionStart']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRefresher, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRefresher, selector: \"ion-refresher\", inputs: { closeDuration: \"closeDuration\", disabled: \"disabled\", mode: \"mode\", pullFactor: \"pullFactor\", pullMax: \"pullMax\", pullMin: \"pullMin\", snapbackDuration: \"snapbackDuration\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRefresher = __decorate([\n ProxyCmp({\n inputs: ['closeDuration', 'disabled', 'mode', 'pullFactor', 'pullMax', 'pullMin', 'snapbackDuration'],\n methods: ['complete', 'cancel', 'getProgress']\n })\n], IonRefresher);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRefresher, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-refresher',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['closeDuration', 'disabled', 'mode', 'pullFactor', 'pullMax', 'pullMin', 'snapbackDuration'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRefresherContent = class IonRefresherContent {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRefresherContent, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRefresherContent, selector: \"ion-refresher-content\", inputs: { pullingIcon: \"pullingIcon\", pullingText: \"pullingText\", refreshingSpinner: \"refreshingSpinner\", refreshingText: \"refreshingText\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRefresherContent = __decorate([\n ProxyCmp({\n inputs: ['pullingIcon', 'pullingText', 'refreshingSpinner', 'refreshingText']\n })\n], IonRefresherContent);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRefresherContent, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-refresher-content',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['pullingIcon', 'pullingText', 'refreshingSpinner', 'refreshingText'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonReorder = class IonReorder {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonReorder, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonReorder, selector: \"ion-reorder\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonReorder = __decorate([\n ProxyCmp({})\n], IonReorder);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonReorder, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-reorder',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonReorderGroup = class IonReorderGroup {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionItemReorder']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonReorderGroup, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonReorderGroup, selector: \"ion-reorder-group\", inputs: { disabled: \"disabled\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonReorderGroup = __decorate([\n ProxyCmp({\n inputs: ['disabled'],\n methods: ['complete']\n })\n], IonReorderGroup);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonReorderGroup, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-reorder-group',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRippleEffect = class IonRippleEffect {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRippleEffect, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRippleEffect, selector: \"ion-ripple-effect\", inputs: { type: \"type\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRippleEffect = __decorate([\n ProxyCmp({\n inputs: ['type'],\n methods: ['addRipple']\n })\n], IonRippleEffect);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRippleEffect, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-ripple-effect',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['type'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonRow = class IonRow {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRow, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRow, selector: \"ion-row\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonRow = __decorate([\n ProxyCmp({})\n], IonRow);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRow, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-row',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSearchbar = class IonSearchbar {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionInput', 'ionChange', 'ionCancel', 'ionClear', 'ionBlur', 'ionFocus']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSearchbar, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSearchbar, selector: \"ion-searchbar\", inputs: { animated: \"animated\", autocapitalize: \"autocapitalize\", autocomplete: \"autocomplete\", autocorrect: \"autocorrect\", cancelButtonIcon: \"cancelButtonIcon\", cancelButtonText: \"cancelButtonText\", clearIcon: \"clearIcon\", color: \"color\", debounce: \"debounce\", disabled: \"disabled\", enterkeyhint: \"enterkeyhint\", inputmode: \"inputmode\", maxlength: \"maxlength\", minlength: \"minlength\", mode: \"mode\", name: \"name\", placeholder: \"placeholder\", searchIcon: \"searchIcon\", showCancelButton: \"showCancelButton\", showClearButton: \"showClearButton\", spellcheck: \"spellcheck\", type: \"type\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSearchbar = __decorate([\n ProxyCmp({\n inputs: ['animated', 'autocapitalize', 'autocomplete', 'autocorrect', 'cancelButtonIcon', 'cancelButtonText', 'clearIcon', 'color', 'debounce', 'disabled', 'enterkeyhint', 'inputmode', 'maxlength', 'minlength', 'mode', 'name', 'placeholder', 'searchIcon', 'showCancelButton', 'showClearButton', 'spellcheck', 'type', 'value'],\n methods: ['setFocus', 'getInputElement']\n })\n], IonSearchbar);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSearchbar, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-searchbar',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'autocapitalize', 'autocomplete', 'autocorrect', 'cancelButtonIcon', 'cancelButtonText', 'clearIcon', 'color', 'debounce', 'disabled', 'enterkeyhint', 'inputmode', 'maxlength', 'minlength', 'mode', 'name', 'placeholder', 'searchIcon', 'showCancelButton', 'showClearButton', 'spellcheck', 'type', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSegment = class IonSegment {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegment, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSegment, selector: \"ion-segment\", inputs: { color: \"color\", disabled: \"disabled\", mode: \"mode\", scrollable: \"scrollable\", selectOnFocus: \"selectOnFocus\", swipeGesture: \"swipeGesture\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSegment = __decorate([\n ProxyCmp({\n inputs: ['color', 'disabled', 'mode', 'scrollable', 'selectOnFocus', 'swipeGesture', 'value']\n })\n], IonSegment);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegment, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-segment',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'disabled', 'mode', 'scrollable', 'selectOnFocus', 'swipeGesture', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSegmentButton = class IonSegmentButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSegmentButton, selector: \"ion-segment-button\", inputs: { contentId: \"contentId\", disabled: \"disabled\", layout: \"layout\", mode: \"mode\", type: \"type\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSegmentButton = __decorate([\n ProxyCmp({\n inputs: ['contentId', 'disabled', 'layout', 'mode', 'type', 'value']\n })\n], IonSegmentButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-segment-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['contentId', 'disabled', 'layout', 'mode', 'type', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSegmentContent = class IonSegmentContent {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentContent, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSegmentContent, selector: \"ion-segment-content\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSegmentContent = __decorate([\n ProxyCmp({})\n], IonSegmentContent);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentContent, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-segment-content',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSegmentView = class IonSegmentView {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionSegmentViewScroll']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentView, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSegmentView, selector: \"ion-segment-view\", inputs: { disabled: \"disabled\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSegmentView = __decorate([\n ProxyCmp({\n inputs: ['disabled']\n })\n], IonSegmentView);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSegmentView, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-segment-view',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSelect = class IonSelect {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange', 'ionCancel', 'ionDismiss', 'ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelect, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSelect, selector: \"ion-select\", inputs: { cancelText: \"cancelText\", color: \"color\", compareWith: \"compareWith\", disabled: \"disabled\", expandedIcon: \"expandedIcon\", fill: \"fill\", interface: \"interface\", interfaceOptions: \"interfaceOptions\", justify: \"justify\", label: \"label\", labelPlacement: \"labelPlacement\", mode: \"mode\", multiple: \"multiple\", name: \"name\", okText: \"okText\", placeholder: \"placeholder\", selectedText: \"selectedText\", shape: \"shape\", toggleIcon: \"toggleIcon\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSelect = __decorate([\n ProxyCmp({\n inputs: ['cancelText', 'color', 'compareWith', 'disabled', 'expandedIcon', 'fill', 'interface', 'interfaceOptions', 'justify', 'label', 'labelPlacement', 'mode', 'multiple', 'name', 'okText', 'placeholder', 'selectedText', 'shape', 'toggleIcon', 'value'],\n methods: ['open']\n })\n], IonSelect);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelect, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-select',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['cancelText', 'color', 'compareWith', 'disabled', 'expandedIcon', 'fill', 'interface', 'interfaceOptions', 'justify', 'label', 'labelPlacement', 'mode', 'multiple', 'name', 'okText', 'placeholder', 'selectedText', 'shape', 'toggleIcon', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSelectModal = class IonSelectModal {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelectModal, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSelectModal, selector: \"ion-select-modal\", inputs: { header: \"header\", multiple: \"multiple\", options: \"options\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSelectModal = __decorate([\n ProxyCmp({\n inputs: ['header', 'multiple', 'options']\n })\n], IonSelectModal);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelectModal, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-select-modal',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['header', 'multiple', 'options'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSelectOption = class IonSelectOption {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelectOption, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSelectOption, selector: \"ion-select-option\", inputs: { disabled: \"disabled\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSelectOption = __decorate([\n ProxyCmp({\n inputs: ['disabled', 'value']\n })\n], IonSelectOption);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSelectOption, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-select-option',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSkeletonText = class IonSkeletonText {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSkeletonText, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSkeletonText, selector: \"ion-skeleton-text\", inputs: { animated: \"animated\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSkeletonText = __decorate([\n ProxyCmp({\n inputs: ['animated']\n })\n], IonSkeletonText);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSkeletonText, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-skeleton-text',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSpinner = class IonSpinner {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSpinner, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSpinner, selector: \"ion-spinner\", inputs: { color: \"color\", duration: \"duration\", name: \"name\", paused: \"paused\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSpinner = __decorate([\n ProxyCmp({\n inputs: ['color', 'duration', 'name', 'paused']\n })\n], IonSpinner);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSpinner, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-spinner',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'duration', 'name', 'paused'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonSplitPane = class IonSplitPane {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionSplitPaneVisible']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSplitPane, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonSplitPane, selector: \"ion-split-pane\", inputs: { contentId: \"contentId\", disabled: \"disabled\", when: \"when\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonSplitPane = __decorate([\n ProxyCmp({\n inputs: ['contentId', 'disabled', 'when']\n })\n], IonSplitPane);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonSplitPane, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-split-pane',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['contentId', 'disabled', 'when'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonTab = class IonTab {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTab, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTab, selector: \"ion-tab\", inputs: { component: \"component\", tab: \"tab\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonTab = __decorate([\n ProxyCmp({\n inputs: ['component', 'tab'],\n methods: ['setActive']\n })\n], IonTab);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTab, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-tab',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['component', 'tab'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonTabBar = class IonTabBar {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabBar, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTabBar, selector: \"ion-tab-bar\", inputs: { color: \"color\", mode: \"mode\", selectedTab: \"selectedTab\", translucent: \"translucent\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonTabBar = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode', 'selectedTab', 'translucent']\n })\n], IonTabBar);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabBar, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-tab-bar',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode', 'selectedTab', 'translucent'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonTabButton = class IonTabButton {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabButton, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTabButton, selector: \"ion-tab-button\", inputs: { disabled: \"disabled\", download: \"download\", href: \"href\", layout: \"layout\", mode: \"mode\", rel: \"rel\", selected: \"selected\", tab: \"tab\", target: \"target\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonTabButton = __decorate([\n ProxyCmp({\n inputs: ['disabled', 'download', 'href', 'layout', 'mode', 'rel', 'selected', 'tab', 'target']\n })\n], IonTabButton);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-tab-button',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['disabled', 'download', 'href', 'layout', 'mode', 'rel', 'selected', 'tab', 'target'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonText = class IonText {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonText, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonText, selector: \"ion-text\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonText = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonText);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonText, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-text',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonTextarea = class IonTextarea {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange', 'ionInput', 'ionBlur', 'ionFocus']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTextarea, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTextarea, selector: \"ion-textarea\", inputs: { autoGrow: \"autoGrow\", autocapitalize: \"autocapitalize\", autofocus: \"autofocus\", clearOnEdit: \"clearOnEdit\", color: \"color\", cols: \"cols\", counter: \"counter\", counterFormatter: \"counterFormatter\", debounce: \"debounce\", disabled: \"disabled\", enterkeyhint: \"enterkeyhint\", errorText: \"errorText\", fill: \"fill\", helperText: \"helperText\", inputmode: \"inputmode\", label: \"label\", labelPlacement: \"labelPlacement\", maxlength: \"maxlength\", minlength: \"minlength\", mode: \"mode\", name: \"name\", placeholder: \"placeholder\", readonly: \"readonly\", required: \"required\", rows: \"rows\", shape: \"shape\", spellcheck: \"spellcheck\", value: \"value\", wrap: \"wrap\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonTextarea = __decorate([\n ProxyCmp({\n inputs: ['autoGrow', 'autocapitalize', 'autofocus', 'clearOnEdit', 'color', 'cols', 'counter', 'counterFormatter', 'debounce', 'disabled', 'enterkeyhint', 'errorText', 'fill', 'helperText', 'inputmode', 'label', 'labelPlacement', 'maxlength', 'minlength', 'mode', 'name', 'placeholder', 'readonly', 'required', 'rows', 'shape', 'spellcheck', 'value', 'wrap'],\n methods: ['setFocus', 'getInputElement']\n })\n], IonTextarea);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTextarea, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-textarea',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['autoGrow', 'autocapitalize', 'autofocus', 'clearOnEdit', 'color', 'cols', 'counter', 'counterFormatter', 'debounce', 'disabled', 'enterkeyhint', 'errorText', 'fill', 'helperText', 'inputmode', 'label', 'labelPlacement', 'maxlength', 'minlength', 'mode', 'name', 'placeholder', 'readonly', 'required', 'rows', 'shape', 'spellcheck', 'value', 'wrap'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonThumbnail = class IonThumbnail {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonThumbnail, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonThumbnail, selector: \"ion-thumbnail\", ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonThumbnail = __decorate([\n ProxyCmp({})\n], IonThumbnail);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonThumbnail, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-thumbnail',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: [],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonTitle = class IonTitle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTitle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTitle, selector: \"ion-title\", inputs: { color: \"color\", size: \"size\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonTitle = __decorate([\n ProxyCmp({\n inputs: ['color', 'size']\n })\n], IonTitle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTitle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-title',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'size'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonToast = class IonToast {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionToastDidPresent', 'ionToastWillPresent', 'ionToastWillDismiss', 'ionToastDidDismiss', 'didPresent', 'willPresent', 'willDismiss', 'didDismiss']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToast, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonToast, selector: \"ion-toast\", inputs: { animated: \"animated\", buttons: \"buttons\", color: \"color\", cssClass: \"cssClass\", duration: \"duration\", enterAnimation: \"enterAnimation\", header: \"header\", htmlAttributes: \"htmlAttributes\", icon: \"icon\", isOpen: \"isOpen\", keyboardClose: \"keyboardClose\", layout: \"layout\", leaveAnimation: \"leaveAnimation\", message: \"message\", mode: \"mode\", position: \"position\", positionAnchor: \"positionAnchor\", swipeGesture: \"swipeGesture\", translucent: \"translucent\", trigger: \"trigger\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonToast = __decorate([\n ProxyCmp({\n inputs: ['animated', 'buttons', 'color', 'cssClass', 'duration', 'enterAnimation', 'header', 'htmlAttributes', 'icon', 'isOpen', 'keyboardClose', 'layout', 'leaveAnimation', 'message', 'mode', 'position', 'positionAnchor', 'swipeGesture', 'translucent', 'trigger'],\n methods: ['present', 'dismiss', 'onDidDismiss', 'onWillDismiss']\n })\n], IonToast);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToast, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-toast',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['animated', 'buttons', 'color', 'cssClass', 'duration', 'enterAnimation', 'header', 'htmlAttributes', 'icon', 'isOpen', 'keyboardClose', 'layout', 'leaveAnimation', 'message', 'mode', 'position', 'positionAnchor', 'swipeGesture', 'translucent', 'trigger'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonToggle = class IonToggle {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n proxyOutputs(this, this.el, ['ionChange', 'ionFocus', 'ionBlur']);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToggle, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonToggle, selector: \"ion-toggle\", inputs: { alignment: \"alignment\", checked: \"checked\", color: \"color\", disabled: \"disabled\", enableOnOffLabels: \"enableOnOffLabels\", justify: \"justify\", labelPlacement: \"labelPlacement\", mode: \"mode\", name: \"name\", value: \"value\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonToggle = __decorate([\n ProxyCmp({\n inputs: ['alignment', 'checked', 'color', 'disabled', 'enableOnOffLabels', 'justify', 'labelPlacement', 'mode', 'name', 'value']\n })\n], IonToggle);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToggle, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-toggle',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['alignment', 'checked', 'color', 'disabled', 'enableOnOffLabels', 'justify', 'labelPlacement', 'mode', 'name', 'value'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\nlet IonToolbar = class IonToolbar {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToolbar, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonToolbar, selector: \"ion-toolbar\", inputs: { color: \"color\", mode: \"mode\" }, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n};\nIonToolbar = __decorate([\n ProxyCmp({\n inputs: ['color', 'mode']\n })\n], IonToolbar);\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonToolbar, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-toolbar',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ' ',\n // eslint-disable-next-line @angular-eslint/no-inputs-metadata-property\n inputs: ['color', 'mode'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }, { type: i0.ElementRef }, { type: i0.NgZone }]; } });\n\n// eslint-disable-next-line @angular-eslint/directive-class-suffix\nclass IonRouterOutlet extends IonRouterOutlet$1 {\n parentOutlet;\n /**\n * `static: true` must be set so the query results are resolved\n * before change detection runs. Otherwise, the view container\n * ref will be ion-router-outlet instead of ng-container, and\n * the first view will be added as a sibling of ion-router-outlet\n * instead of a child.\n */\n outletContent;\n /**\n * We need to pass in the correct instance of IonRouterOutlet\n * otherwise parentOutlet will be null in a nested outlet context.\n * This results in APIs such as NavController.pop not working\n * in nested outlets because the parent outlet cannot be found.\n */\n constructor(name, tabs, commonLocation, elementRef, router, zone, activatedRoute, parentOutlet) {\n super(name, tabs, commonLocation, elementRef, router, zone, activatedRoute, parentOutlet);\n this.parentOutlet = parentOutlet;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRouterOutlet, deps: [{ token: 'name', attribute: true }, { token: 'tabs', attribute: true, optional: true }, { token: i1.Location }, { token: i0.ElementRef }, { token: i2.Router }, { token: i0.NgZone }, { token: i2.ActivatedRoute }, { token: IonRouterOutlet, optional: true, skipSelf: true }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonRouterOutlet, selector: \"ion-router-outlet\", viewQueries: [{ propertyName: \"outletContent\", first: true, predicate: [\"outletContent\"], descendants: true, read: ViewContainerRef, static: true }], usesInheritance: true, ngImport: i0, template: ' ', isInline: true });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonRouterOutlet, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-router-outlet',\n template: ' ',\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['name']\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Attribute,\n args: ['tabs']\n }] }, { type: i1.Location }, { type: i0.ElementRef }, { type: i2.Router }, { type: i0.NgZone }, { type: i2.ActivatedRoute }, { type: IonRouterOutlet, decorators: [{\n type: SkipSelf\n }, {\n type: Optional\n }] }]; }, propDecorators: { outletContent: [{\n type: ViewChild,\n args: ['outletContent', { read: ViewContainerRef, static: true }]\n }] } });\n\n// eslint-disable-next-line @angular-eslint/component-class-suffix\nclass IonTabs extends IonTabs$1 {\n outlet;\n tabBar;\n tabBars;\n tabs;\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabs, deps: null, target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonTabs, selector: \"ion-tabs\", queries: [{ propertyName: \"tabBar\", first: true, predicate: IonTabBar, descendants: true }, { propertyName: \"tabBars\", predicate: IonTabBar }, { propertyName: \"tabs\", predicate: IonTab }], viewQueries: [{ propertyName: \"outlet\", first: true, predicate: [\"outlet\"], descendants: true, read: IonRouterOutlet }], usesInheritance: true, ngImport: i0, template: `\n \n \n \n 0\" select=\"ion-tab\"> \n
\n \n `, isInline: true, styles: [\":host{display:flex;position:absolute;inset:0;flex-direction:column;width:100%;height:100%;contain:layout size style}.tabs-inner{position:relative;flex:1;contain:layout size style}\\n\"], dependencies: [{ kind: \"directive\", type: i1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"component\", type: IonRouterOutlet, selector: \"ion-router-outlet\" }] });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonTabs, decorators: [{\n type: Component,\n args: [{ selector: 'ion-tabs', template: `\n \n \n \n 0\" select=\"ion-tab\"> \n
\n \n `, styles: [\":host{display:flex;position:absolute;inset:0;flex-direction:column;width:100%;height:100%;contain:layout size style}.tabs-inner{position:relative;flex:1;contain:layout size style}\\n\"] }]\n }], propDecorators: { outlet: [{\n type: ViewChild,\n args: ['outlet', { read: IonRouterOutlet, static: false }]\n }], tabBar: [{\n type: ContentChild,\n args: [IonTabBar, { static: false }]\n }], tabBars: [{\n type: ContentChildren,\n args: [IonTabBar]\n }], tabs: [{\n type: ContentChildren,\n args: [IonTab]\n }] } });\n\n// eslint-disable-next-line @angular-eslint/directive-class-suffix\nclass IonBackButton extends IonBackButton$1 {\n constructor(routerOutlet, navCtrl, config, r, z, c) {\n super(routerOutlet, navCtrl, config, r, z, c);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBackButton, deps: [{ token: IonRouterOutlet, optional: true }, { token: i2$1.NavController }, { token: i2$1.Config }, { token: i0.ElementRef }, { token: i0.NgZone }, { token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonBackButton, selector: \"ion-back-button\", usesInheritance: true, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonBackButton, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-back-button',\n template: ' ',\n changeDetection: ChangeDetectionStrategy.OnPush,\n }]\n }], ctorParameters: function () { return [{ type: IonRouterOutlet, decorators: [{\n type: Optional\n }] }, { type: i2$1.NavController }, { type: i2$1.Config }, { type: i0.ElementRef }, { type: i0.NgZone }, { type: i0.ChangeDetectorRef }]; } });\n\n// eslint-disable-next-line @angular-eslint/directive-class-suffix\nclass IonNav extends IonNav$1 {\n constructor(ref, environmentInjector, injector, angularDelegate, z, c) {\n super(ref, environmentInjector, injector, angularDelegate, z, c);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNav, deps: [{ token: i0.ElementRef }, { token: i0.EnvironmentInjector }, { token: i0.Injector }, { token: i2$1.AngularDelegate }, { token: i0.NgZone }, { token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonNav, selector: \"ion-nav\", usesInheritance: true, ngImport: i0, template: ' ', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonNav, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-nav',\n template: ' ',\n changeDetection: ChangeDetectionStrategy.OnPush,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.EnvironmentInjector }, { type: i0.Injector }, { type: i2$1.AngularDelegate }, { type: i0.NgZone }, { type: i0.ChangeDetectorRef }]; } });\n\n/**\n * Adds support for Ionic routing directions and animations to the base Angular router link directive.\n *\n * When the router link is clicked, the directive will assign the direction and\n * animation so that the routing integration will transition correctly.\n */\nclass RouterLinkDelegateDirective extends RouterLinkDelegateDirective$1 {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: RouterLinkDelegateDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: RouterLinkDelegateDirective, selector: \":not(a):not(area)[routerLink]\", usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: RouterLinkDelegateDirective, decorators: [{\n type: Directive,\n args: [{\n selector: ':not(a):not(area)[routerLink]',\n }]\n }] });\nclass RouterLinkWithHrefDelegateDirective extends RouterLinkWithHrefDelegateDirective$1 {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: RouterLinkWithHrefDelegateDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: RouterLinkWithHrefDelegateDirective, selector: \"a[routerLink],area[routerLink]\", usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: RouterLinkWithHrefDelegateDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'a[routerLink],area[routerLink]',\n }]\n }] });\n\nclass IonModal extends IonModal$1 {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonModal, deps: null, target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonModal, selector: \"ion-modal\", usesInheritance: true, ngImport: i0, template: `\n \n
`, isInline: true, dependencies: [{ kind: \"directive\", type: i1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i1.NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: [\"ngTemplateOutletContext\", \"ngTemplateOutlet\", \"ngTemplateOutletInjector\"] }], changeDetection: i0.ChangeDetectionStrategy.OnPush });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonModal, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-modal',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: `\n \n
`,\n }]\n }] });\n\nclass IonPopover extends IonPopover$1 {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPopover, deps: null, target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPopover, selector: \"ion-popover\", usesInheritance: true, ngImport: i0, template: ` `, isInline: true, dependencies: [{ kind: \"directive\", type: i1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i1.NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: [\"ngTemplateOutletContext\", \"ngTemplateOutlet\", \"ngTemplateOutletInjector\"] }], changeDetection: i0.ChangeDetectionStrategy.OnPush });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPopover, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-popover',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: ` `,\n }]\n }] });\n\n/**\n * @description\n * Provider which adds `MaxValidator` to the `NG_VALIDATORS` multi-provider list.\n */\nconst ION_MAX_VALIDATOR = {\n provide: NG_VALIDATORS,\n useExisting: forwardRef(() => IonMaxValidator),\n multi: true,\n};\n// eslint-disable-next-line @angular-eslint/directive-class-suffix\nclass IonMaxValidator extends MaxValidator {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMaxValidator, deps: null, target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonMaxValidator, selector: \"ion-input[type=number][max][formControlName],ion-input[type=number][max][formControl],ion-input[type=number][max][ngModel]\", host: { properties: { \"attr.max\": \"_enabled ? max : null\" } }, providers: [ION_MAX_VALIDATOR], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMaxValidator, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input[type=number][max][formControlName],ion-input[type=number][max][formControl],ion-input[type=number][max][ngModel]',\n providers: [ION_MAX_VALIDATOR],\n // eslint-disable-next-line @angular-eslint/no-host-metadata-property\n host: { '[attr.max]': '_enabled ? max : null' },\n }]\n }] });\n\n/**\n * @description\n * Provider which adds `MinValidator` to the `NG_VALIDATORS` multi-provider list.\n */\nconst ION_MIN_VALIDATOR = {\n provide: NG_VALIDATORS,\n useExisting: forwardRef(() => IonMinValidator),\n multi: true,\n};\n// eslint-disable-next-line @angular-eslint/directive-class-suffix\nclass IonMinValidator extends MinValidator {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMinValidator, deps: null, target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonMinValidator, selector: \"ion-input[type=number][min][formControlName],ion-input[type=number][min][formControl],ion-input[type=number][min][ngModel]\", host: { properties: { \"attr.min\": \"_enabled ? min : null\" } }, providers: [ION_MIN_VALIDATOR], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonMinValidator, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input[type=number][min][formControlName],ion-input[type=number][min][formControl],ion-input[type=number][min][ngModel]',\n providers: [ION_MIN_VALIDATOR],\n // eslint-disable-next-line @angular-eslint/no-host-metadata-property\n host: { '[attr.min]': '_enabled ? min : null' },\n }]\n }] });\n\nclass AlertController extends OverlayBaseController {\n constructor() {\n super(alertController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AlertController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AlertController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AlertController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\nclass AnimationController {\n /**\n * Create a new animation\n */\n create(animationId) {\n return createAnimation(animationId);\n }\n /**\n * EXPERIMENTAL\n *\n * Given a progression and a cubic bezier function,\n * this utility returns the time value(s) at which the\n * cubic bezier reaches the given time progression.\n *\n * If the cubic bezier never reaches the progression\n * the result will be an empty array.\n *\n * This is most useful for switching between easing curves\n * when doing a gesture animation (i.e. going from linear easing\n * during a drag, to another easing when `progressEnd` is called)\n */\n easingTime(p0, p1, p2, p3, progression) {\n return getTimeGivenProgression(p0, p1, p2, p3, progression);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AnimationController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AnimationController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AnimationController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }] });\n\nclass ActionSheetController extends OverlayBaseController {\n constructor() {\n super(actionSheetController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ActionSheetController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ActionSheetController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ActionSheetController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\nclass GestureController {\n zone;\n constructor(zone) {\n this.zone = zone;\n }\n /**\n * Create a new gesture\n */\n create(opts, runInsideAngularZone = false) {\n if (runInsideAngularZone) {\n Object.getOwnPropertyNames(opts).forEach((key) => {\n if (typeof opts[key] === 'function') {\n const fn = opts[key];\n opts[key] = (...props) => this.zone.run(() => fn(...props));\n }\n });\n }\n return createGesture(opts);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: GestureController, deps: [{ token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: GestureController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: GestureController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }]; } });\n\nclass LoadingController extends OverlayBaseController {\n constructor() {\n super(loadingController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LoadingController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LoadingController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LoadingController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\nclass MenuController extends MenuController$1 {\n constructor() {\n super(menuController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: MenuController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: MenuController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: MenuController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\nclass ModalController extends OverlayBaseController {\n angularDelegate = inject(AngularDelegate);\n injector = inject(Injector);\n environmentInjector = inject(EnvironmentInjector);\n constructor() {\n super(modalController);\n }\n create(opts) {\n return super.create({\n ...opts,\n delegate: this.angularDelegate.create(this.environmentInjector, this.injector, 'modal'),\n });\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ModalController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ModalController });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ModalController, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return []; } });\n\n/**\n * @deprecated Use the inline ion-picker component instead.\n */\nclass PickerController extends OverlayBaseController {\n constructor() {\n super(pickerController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PickerController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PickerController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PickerController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\nclass PopoverController extends OverlayBaseController {\n angularDelegate = inject(AngularDelegate);\n injector = inject(Injector);\n environmentInjector = inject(EnvironmentInjector);\n constructor() {\n super(popoverController);\n }\n create(opts) {\n return super.create({\n ...opts,\n delegate: this.angularDelegate.create(this.environmentInjector, this.injector, 'popover'),\n });\n }\n}\n\nclass ToastController extends OverlayBaseController {\n constructor() {\n super(toastController);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ToastController, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n /** @nocollapse */ static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ToastController, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: ToastController, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n }]\n }], ctorParameters: function () { return []; } });\n\n// TODO(FW-2827): types\nconst appInitialize = (config, doc, zone) => {\n return () => {\n const win = doc.defaultView;\n if (win && typeof window !== 'undefined') {\n setupConfig({\n ...config,\n _zoneGate: (h) => zone.run(h),\n });\n const aelFn = '__zone_symbol__addEventListener' in doc.body ? '__zone_symbol__addEventListener' : 'addEventListener';\n return applyPolyfills().then(() => {\n return defineCustomElements(win, {\n exclude: ['ion-tabs'],\n syncQueue: true,\n raf,\n jmp: (h) => zone.runOutsideAngular(h),\n ael(elm, eventName, cb, opts) {\n elm[aelFn](eventName, cb, opts);\n },\n rel(elm, eventName, cb, opts) {\n elm.removeEventListener(eventName, cb, opts);\n },\n });\n });\n }\n };\n};\n\nconst DIRECTIVES = [\n IonAccordion,\n IonAccordionGroup,\n IonActionSheet,\n IonAlert,\n IonApp,\n IonAvatar,\n IonBackdrop,\n IonBadge,\n IonBreadcrumb,\n IonBreadcrumbs,\n IonButton,\n IonButtons,\n IonCard,\n IonCardContent,\n IonCardHeader,\n IonCardSubtitle,\n IonCardTitle,\n IonCheckbox,\n IonChip,\n IonCol,\n IonContent,\n IonDatetime,\n IonDatetimeButton,\n IonFab,\n IonFabButton,\n IonFabList,\n IonFooter,\n IonGrid,\n IonHeader,\n IonIcon,\n IonImg,\n IonInfiniteScroll,\n IonInfiniteScrollContent,\n IonInput,\n IonInputPasswordToggle,\n IonItem,\n IonItemDivider,\n IonItemGroup,\n IonItemOption,\n IonItemOptions,\n IonItemSliding,\n IonLabel,\n IonList,\n IonListHeader,\n IonLoading,\n IonMenu,\n IonMenuButton,\n IonMenuToggle,\n IonNavLink,\n IonNote,\n IonPicker,\n IonPickerColumn,\n IonPickerColumnOption,\n IonPickerLegacy,\n IonProgressBar,\n IonRadio,\n IonRadioGroup,\n IonRange,\n IonRefresher,\n IonRefresherContent,\n IonReorder,\n IonReorderGroup,\n IonRippleEffect,\n IonRow,\n IonSearchbar,\n IonSegment,\n IonSegmentButton,\n IonSegmentContent,\n IonSegmentView,\n IonSelect,\n IonSelectModal,\n IonSelectOption,\n IonSkeletonText,\n IonSpinner,\n IonSplitPane,\n IonTab,\n IonTabBar,\n IonTabButton,\n IonText,\n IonTextarea,\n IonThumbnail,\n IonTitle,\n IonToast,\n IonToggle,\n IonToolbar\n];\n\nconst DECLARATIONS = [\n // generated proxies\n ...DIRECTIVES,\n // manual proxies\n IonModal,\n IonPopover,\n // ngModel accessors\n BooleanValueAccessorDirective,\n NumericValueAccessorDirective,\n SelectValueAccessorDirective,\n TextValueAccessorDirective,\n // navigation\n IonTabs,\n IonRouterOutlet,\n IonBackButton,\n IonNav,\n RouterLinkDelegateDirective,\n RouterLinkWithHrefDelegateDirective,\n // validators\n IonMinValidator,\n IonMaxValidator,\n];\nclass IonicModule {\n static forRoot(config = {}) {\n return {\n ngModule: IonicModule,\n providers: [\n {\n provide: ConfigToken,\n useValue: config,\n },\n {\n provide: APP_INITIALIZER,\n useFactory: appInitialize,\n multi: true,\n deps: [ConfigToken, DOCUMENT, NgZone],\n },\n AngularDelegate,\n provideComponentInputBinding(),\n ],\n };\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonicModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\n /** @nocollapse */ static ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: IonicModule, declarations: [IonAccordion, IonAccordionGroup, IonActionSheet, IonAlert, IonApp, IonAvatar, IonBackdrop, IonBadge, IonBreadcrumb, IonBreadcrumbs, IonButton, IonButtons, IonCard, IonCardContent, IonCardHeader, IonCardSubtitle, IonCardTitle, IonCheckbox, IonChip, IonCol, IonContent, IonDatetime, IonDatetimeButton, IonFab, IonFabButton, IonFabList, IonFooter, IonGrid, IonHeader, IonIcon, IonImg, IonInfiniteScroll, IonInfiniteScrollContent, IonInput, IonInputPasswordToggle, IonItem, IonItemDivider, IonItemGroup, IonItemOption, IonItemOptions, IonItemSliding, IonLabel, IonList, IonListHeader, IonLoading, IonMenu, IonMenuButton, IonMenuToggle, IonNavLink, IonNote, IonPicker, IonPickerColumn, IonPickerColumnOption, IonPickerLegacy, IonProgressBar, IonRadio, IonRadioGroup, IonRange, IonRefresher, IonRefresherContent, IonReorder, IonReorderGroup, IonRippleEffect, IonRow, IonSearchbar, IonSegment, IonSegmentButton, IonSegmentContent, IonSegmentView, IonSelect, IonSelectModal, IonSelectOption, IonSkeletonText, IonSpinner, IonSplitPane, IonTab, IonTabBar, IonTabButton, IonText, IonTextarea, IonThumbnail, IonTitle, IonToast, IonToggle, IonToolbar, \n // manual proxies\n IonModal,\n IonPopover,\n // ngModel accessors\n BooleanValueAccessorDirective,\n NumericValueAccessorDirective,\n SelectValueAccessorDirective,\n TextValueAccessorDirective,\n // navigation\n IonTabs,\n IonRouterOutlet,\n IonBackButton,\n IonNav,\n RouterLinkDelegateDirective,\n RouterLinkWithHrefDelegateDirective,\n // validators\n IonMinValidator,\n IonMaxValidator], imports: [CommonModule], exports: [IonAccordion, IonAccordionGroup, IonActionSheet, IonAlert, IonApp, IonAvatar, IonBackdrop, IonBadge, IonBreadcrumb, IonBreadcrumbs, IonButton, IonButtons, IonCard, IonCardContent, IonCardHeader, IonCardSubtitle, IonCardTitle, IonCheckbox, IonChip, IonCol, IonContent, IonDatetime, IonDatetimeButton, IonFab, IonFabButton, IonFabList, IonFooter, IonGrid, IonHeader, IonIcon, IonImg, IonInfiniteScroll, IonInfiniteScrollContent, IonInput, IonInputPasswordToggle, IonItem, IonItemDivider, IonItemGroup, IonItemOption, IonItemOptions, IonItemSliding, IonLabel, IonList, IonListHeader, IonLoading, IonMenu, IonMenuButton, IonMenuToggle, IonNavLink, IonNote, IonPicker, IonPickerColumn, IonPickerColumnOption, IonPickerLegacy, IonProgressBar, IonRadio, IonRadioGroup, IonRange, IonRefresher, IonRefresherContent, IonReorder, IonReorderGroup, IonRippleEffect, IonRow, IonSearchbar, IonSegment, IonSegmentButton, IonSegmentContent, IonSegmentView, IonSelect, IonSelectModal, IonSelectOption, IonSkeletonText, IonSpinner, IonSplitPane, IonTab, IonTabBar, IonTabButton, IonText, IonTextarea, IonThumbnail, IonTitle, IonToast, IonToggle, IonToolbar, \n // manual proxies\n IonModal,\n IonPopover,\n // ngModel accessors\n BooleanValueAccessorDirective,\n NumericValueAccessorDirective,\n SelectValueAccessorDirective,\n TextValueAccessorDirective,\n // navigation\n IonTabs,\n IonRouterOutlet,\n IonBackButton,\n IonNav,\n RouterLinkDelegateDirective,\n RouterLinkWithHrefDelegateDirective,\n // validators\n IonMinValidator,\n IonMaxValidator] });\n /** @nocollapse */ static ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonicModule, providers: [ModalController, PopoverController], imports: [CommonModule] });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonicModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: DECLARATIONS,\n exports: DECLARATIONS,\n providers: [ModalController, PopoverController],\n imports: [CommonModule],\n }]\n }] });\n\n// DIRECTIVES\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ActionSheetController, AlertController, AnimationController, BooleanValueAccessorDirective as BooleanValueAccessor, GestureController, ION_MAX_VALIDATOR, ION_MIN_VALIDATOR, IonAccordion, IonAccordionGroup, IonActionSheet, IonAlert, IonApp, IonAvatar, IonBackButton, IonBackdrop, IonBadge, IonBreadcrumb, IonBreadcrumbs, IonButton, IonButtons, IonCard, IonCardContent, IonCardHeader, IonCardSubtitle, IonCardTitle, IonCheckbox, IonChip, IonCol, IonContent, IonDatetime, IonDatetimeButton, IonFab, IonFabButton, IonFabList, IonFooter, IonGrid, IonHeader, IonIcon, IonImg, IonInfiniteScroll, IonInfiniteScrollContent, IonInput, IonInputPasswordToggle, IonItem, IonItemDivider, IonItemGroup, IonItemOption, IonItemOptions, IonItemSliding, IonLabel, IonList, IonListHeader, IonLoading, IonMaxValidator, IonMenu, IonMenuButton, IonMenuToggle, IonMinValidator, IonModal, IonNav, IonNavLink, IonNote, IonPicker, IonPickerColumn, IonPickerColumnOption, IonPickerLegacy, IonPopover, IonProgressBar, IonRadio, IonRadioGroup, IonRange, IonRefresher, IonRefresherContent, IonReorder, IonReorderGroup, IonRippleEffect, IonRouterOutlet, IonRow, IonSearchbar, IonSegment, IonSegmentButton, IonSegmentContent, IonSegmentView, IonSelect, IonSelectModal, IonSelectOption, IonSkeletonText, IonSpinner, IonSplitPane, IonTab, IonTabBar, IonTabButton, IonTabs, IonText, IonTextarea, IonThumbnail, IonTitle, IonToast, IonToggle, IonToolbar, IonicModule, LoadingController, MenuController, ModalController, NumericValueAccessorDirective as NumericValueAccessor, PickerController, PopoverController, RouterLinkDelegateDirective as RouterLinkDelegate, RouterLinkWithHrefDelegateDirective as RouterLinkWithHrefDelegate, SelectValueAccessorDirective as SelectValueAccessor, TextValueAccessorDirective as TextValueAccessor, ToastController };\n","export function applyPolyfills() {\n var promises = [];\n if (typeof window !== 'undefined') {\n var win = window;\n\n if (!win.customElements ||\n (win.Element && (!win.Element.prototype.closest || !win.Element.prototype.matches || !win.Element.prototype.remove || !win.Element.prototype.getRootNode))) {\n promises.push(import(/* webpackChunkName: \"polyfills-dom\" */ './dom.js'));\n }\n\n var checkIfURLIsSupported = function() {\n try {\n var u = new URL('b', 'http://a');\n u.pathname = 'c%20d';\n return (u.href === 'http://a/c%20d') && u.searchParams;\n } catch (e) {\n return false;\n }\n };\n\n if (\n 'function' !== typeof Object.assign || !Object.entries ||\n !Array.prototype.find || !Array.prototype.includes ||\n !String.prototype.startsWith || !String.prototype.endsWith ||\n (win.NodeList && !win.NodeList.prototype.forEach) ||\n !win.fetch ||\n !checkIfURLIsSupported() ||\n typeof WeakMap == 'undefined'\n ) {\n promises.push(import(/* webpackChunkName: \"polyfills-core-js\" */ './core-js.js'));\n }\n }\n return Promise.all(promises);\n}\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","\n \n Values \n \n \n \n \n \n \n \n\n\n \n \n\n\n \n \n \n \n","import { Component } from '@angular/core';\nimport { ModalClass } from '@core/class/modal.class';\nimport { ModalController } from '@ionic/angular';\n\n@Component({\n selector: 'app-values-modal',\n templateUrl: './values-modal.component.html',\n standalone: false\n})\nexport class ValuesModalComponent extends ModalClass {\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n protected close() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterBehaviors',\n standalone: true\n})\nexport class FilterBehaviorsPipe implements PipeTransform {\n public transform(\n items: MongoStoredObject[],\n filter: string\n ): MongoStoredObject[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n Select Value \n \n \n Learn More\n \n \n \n \n \n \n \n\n\n \n \n\n\n \n \n \n \n \n \n \n \n\n\n \n \n \n {{ behavior.name }}\n \n \n \n \n","import { AfterViewInit, Component, Input, ViewChild } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport { showModal } from '@app/utils/modal';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalClass } from '@core/class/modal.class';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { BehaviorApiService } from '@core/service/api/behavior.api.service';\nimport { TenantService } from '@core/service/tenant.service';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { IonModal } from '@ionic/angular/common';\nimport { take } from 'rxjs';\nimport { ValuesModalComponent } from '../values-modal/values-modal.component';\nimport { FilterBehaviorsPipe } from './filter-behaviors.pipe';\n\n@Component({\n selector: 'app-behavior-selector-modal',\n templateUrl: './behavior-selector-modal.component.html',\n standalone: false\n})\nexport class BehaviorSelectorModalComponent\n extends ModalClass\n implements AfterViewInit\n{\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n @ViewChild('learnMoreModal')\n public learnMoreModal!: IonModal;\n\n protected selectedBehaviorId: ObjectId;\n protected filter = '';\n protected behaviors: BehaviorModel[];\n protected isLoading = true;\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _behaviorApiService: BehaviorApiService,\n private readonly _tenantService: TenantService,\n private readonly _authenticationService: AuthenticationService\n ) {\n super();\n\n this._tenantService.tenant$.pipe(take(1)).subscribe((tenant) => {\n this._behaviorApiService\n .getNonSysGenBehaviors({\n path: { tenantId: tenant._id }\n })\n .subscribe((behaviorData) => {\n this.behaviors = behaviorData.filter(\n ({ isSystemGenerated, eligible }) =>\n isSystemGenerated === false &&\n (eligible.length === 0 ||\n eligible.find((e) =>\n this._authenticationService.user.roles.includes(e)\n ))\n );\n this.isLoading = false;\n });\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(_: number, item: BehaviorModel) {\n return item._id;\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n this._modalCtrl.dismiss(\n this.behaviors.find((t) => t._id === this.selectedBehaviorId),\n 'confirm',\n this._modalName\n );\n }\n\n protected itemClick(value: ObjectId) {\n this.selectedBehaviorId = value;\n this.confirmChanges();\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const behaviors = new FilterBehaviorsPipe().transform(\n this.behaviors,\n this.filter\n );\n\n if (behaviors.length > 0) {\n return behaviors[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n this.selectedBehaviorId = first._id;\n\n this.confirmChanges();\n }\n }\n\n protected async learnMore() {\n await showModal({ component: ValuesModalComponent }, this._modalCtrl, {\n parentModalName: this._modalName\n });\n }\n}\n","\n \n \n \n \n \n \n\n \n {{ createMode ? 'Send Recognition' : 'Edit Recognition' }}\n \n \n \n\n\n \n \n\n\n \n \n \n Recipient \n \n {{\n currentUser\n ? currentUser.firstName + ' ' + currentUser.lastName\n : 'Select Recipient'\n }}\n \n \n \n Value \n \n {{\n lastSelectedBehavior ? lastSelectedBehavior.name : 'Select Value'\n }}\n \n \n \n\n \n \n \n \n \n\n \n \n \n Private \n \n \n \n \n\n \n \n Submit\n \n
\n \n \n","import { Component, Input, OnInit, ViewChild } from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { ObjectId } from '@app/types/object-id';\nimport {\n showBehaviorSelectorModal,\n showUserSelectorModal\n} from '@app/utils/modal';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalClass } from '@core/class/modal.class';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { UserModel } from '@core/model/user.model';\nimport { UserListService } from '@core/service/user-list.service';\nimport { IonTextarea, ModalController } from '@ionic/angular';\nimport fastDeepEqual from 'fast-deep-equal';\n\nexport interface IEditRecognitionModalResult {\n recognition: {\n userId: string;\n behaviorId: string;\n description: string;\n isPrivate: boolean;\n };\n behavior: BehaviorModel;\n}\n\nexport interface IEditRecognitionModalInitialData {\n userId: ObjectId;\n behaviorId: ObjectId;\n description: string;\n isPrivate: boolean;\n}\n\nexport interface IEditRecognitionModalProps {\n initialData?: IEditRecognitionModalInitialData;\n createMode?: boolean;\n}\n\n@Component({\n selector: 'app-edit-recognition-modal',\n templateUrl: './edit-recognition-modal.component.html',\n standalone: false\n})\nexport class EditRecognitionModalComponent\n extends ModalClass\n implements OnInit\n{\n @Input()\n public readonly initialData?: IEditRecognitionModalInitialData;\n\n @Input()\n public readonly createMode?: boolean = false;\n\n @ViewChild('commentTextarea')\n public commentTextarea!: IonTextarea;\n\n protected form = new FormGroup({\n userId: new FormControl(null, Validators.required),\n behaviorId: new FormControl(null, Validators.required),\n description: new FormControl('', Validators.required),\n isPrivate: new FormControl(false)\n });\n protected allUsers: UserModel[] = [];\n protected lastSelectedBehavior: BehaviorModel = null;\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _userListService: UserListService,\n private readonly _authenticationService: AuthenticationService\n ) {\n super();\n }\n\n public ngOnInit(): void {\n if (this.initialData) {\n this.form.reset({\n userId: this.initialData.userId,\n behaviorId: this.initialData.behaviorId,\n description: this.initialData.description,\n isPrivate: this.initialData.isPrivate\n });\n }\n\n this._userListService.users$.subscribe((users) => {\n this.allUsers = users.filter(\n (user) =>\n user._id.toString() !==\n this._authenticationService.user._id.toString()\n );\n\n if (this.createMode) {\n this.selectUser();\n }\n });\n }\n\n protected get canSave() {\n if (this.createMode) {\n return (\n this.form.get('userId').value &&\n this.form.get('behaviorId').value &&\n this.form.get('description').value\n );\n } else {\n return (\n this.form.get('userId').value &&\n this.form.get('behaviorId').value &&\n this.form.get('description').value &&\n !fastDeepEqual(this.initialData, {\n userId: this.form.get('userId').value,\n behaviorId: this.form.get('behaviorId').value,\n description: this.form.get('description').value,\n isPrivate: this.form.get('isPrivate').value\n })\n );\n }\n }\n\n protected get selectedUserIds(): ObjectId[] {\n return [this.form.get('userId').value];\n }\n\n protected get currentUser(): UserModel | null {\n const user = this.allUsers.find(\n (user) => user._id === this.form.get('userId').value\n );\n return user;\n }\n\n protected get privateInfo() {\n if (this.form.get('isPrivate').value) {\n return {\n description: this.currentUser\n ? `Only visible to you, ${this.currentUser.firstName}, and administrators`\n : 'Only visible to you and administrators'\n };\n } else {\n return {\n description: 'Visible to everyone in your company'\n };\n }\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onSaveClick(): void {\n const result: IEditRecognitionModalResult = {\n recognition: {\n userId: this.form.get('userId').value,\n behaviorId: this.form.get('behaviorId').value,\n description: this.form.get('description').value,\n isPrivate: this.form.get('isPrivate').value\n },\n behavior: this.lastSelectedBehavior\n };\n\n this._modalCtrl.dismiss(result, 'confirm', this._modalName);\n }\n\n protected async selectUser() {\n const { success, selectedUsers } = await showUserSelectorModal(\n {\n users: this.allUsers,\n recipients: this.selectedUserIds,\n focusSearchbar: true,\n title: 'Select Recipient'\n },\n this._modalCtrl,\n { parentModalName: this._modalName }\n );\n\n if (success) {\n this.form.controls.userId.setValue(selectedUsers[0]);\n\n if (this.createMode && !this.form.controls.behaviorId.value) {\n this.selectBehavior();\n }\n }\n }\n\n protected async selectBehavior() {\n const { success, selectedBehavior } = await showBehaviorSelectorModal(\n {\n focusSearchbar: true\n },\n this._modalCtrl,\n { parentModalName: this._modalName }\n );\n\n if (success) {\n this.form.controls.behaviorId.setValue(selectedBehavior._id);\n this.lastSelectedBehavior = selectedBehavior;\n\n if (this.createMode && !this.form.controls.description.value) {\n setTimeout(() => {\n this.commentTextarea.setFocus();\n }, 600);\n }\n }\n }\n}\n","\n \n {{ title }} \n \n \n \n \n \n \n \n\n\n \n \n\n\n \n \n \n \n \n {{ option[1] }}\n \n \n \n \n\n \n \n \n \n\n \n \n {{ buttonText }}\n \n
\n \n \n","import {\n ChangeDetectionStrategy,\n ChangeDetectorRef,\n Component,\n Input,\n OnDestroy\n} from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { RangePresets } from '@app/types/range-presets';\nimport { DateInterval } from '@backend/types/date-interval';\nimport { ModalClass } from '@core/class/modal.class';\nimport { HapticsService } from '@core/service/haptics.service';\nimport { InsightsDateRangeHelperService } from '@core/service/insights-date-range-helper.service';\nimport { ModalController } from '@ionic/angular';\nimport { endOfDay, startOfDay } from 'date-fns';\nimport { Subscription, filter, switchMap } from 'rxjs';\n\n@Component({\n selector: 'app-insights-range-modal',\n templateUrl: 'insights-range-modal.component.html',\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class InsightsRangeModalComponent\n extends ModalClass\n implements OnDestroy\n{\n @Input()\n public readonly buttonText?: string = 'Apply';\n\n @Input()\n public readonly title?: string = 'Date Range';\n\n protected rangePresets = [\n [RangePresets.ThisPayPeriod, 'This Pay Period'],\n [RangePresets.LastPayPeriod, 'Last Pay Period'],\n [RangePresets.Today, 'Today'],\n [RangePresets.Yesterday, 'Yesterday'],\n [RangePresets.Last7Days, 'Last 7 Days'],\n [RangePresets.Last30Days, 'Last 30 Days'],\n [RangePresets.Last90Days, 'Last 90 Days'],\n [RangePresets.LastMonth, 'Last Month'],\n [RangePresets.ThisYear, 'This Year'],\n [RangePresets.LastYear, 'Last Year'],\n [RangePresets.AllTime, 'All Time'],\n [RangePresets.Custom, 'Custom']\n ];\n\n public set range(value: DateInterval) {\n this.form.reset(value, { emitEvent: false });\n this._rangeHelper.detectPreset(value).subscribe({\n next: (preset) => {\n this.selectedPreset = preset;\n this._cdr.markForCheck();\n },\n error: (e) => console.log('error detecting preset', e)\n });\n }\n protected selectedPreset: RangePresets;\n public form = new FormGroup({\n start: new FormControl(null, Validators.required),\n end: new FormControl(null, Validators.required)\n });\n\n private _subscriptions = new Subscription();\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _rangeHelper: InsightsDateRangeHelperService,\n private readonly _cdr: ChangeDetectorRef,\n private readonly _hapticsService: HapticsService\n ) {\n super();\n\n this._subscriptions.add(\n this.form.valueChanges\n .pipe(\n filter(\n ({ start, end }) =>\n start !== null && end !== null && start.getTime() > end.getTime()\n )\n )\n .subscribe(({ start, end }) => {\n this.form.setValue({ start: startOfDay(end), end: endOfDay(start) });\n this.form.updateValueAndValidity();\n })\n );\n this._subscriptions.add(\n this.form.valueChanges\n .pipe(\n filter(\n (range): range is DateInterval =>\n range.start !== null && range.end !== null\n ),\n switchMap((range) => this._rangeHelper.detectPreset(range))\n )\n .subscribe((preset) => {\n this.selectedPreset = preset;\n })\n );\n }\n\n public ngOnDestroy(): void {\n this._subscriptions.unsubscribe();\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onModelSelect(preset: RangePresets): void {\n this._hapticsService.hapticsImpact();\n\n if (preset !== RangePresets.Custom) {\n this._rangeHelper.getIntervalFromPreset(preset).subscribe((range) => {\n this.form.setValue(range);\n this.form.updateValueAndValidity();\n this.submit();\n });\n }\n }\n\n protected submit(): void {\n this._modalCtrl.dismiss(this.form.value, 'confirm', this._modalName);\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterTasks',\n standalone: true\n})\nexport class FilterTasksPipe implements PipeTransform {\n public transform(\n items: {\n id: ObjectId;\n name: string;\n checked: boolean;\n isDeleted: boolean;\n }[],\n filter: string\n ): { id: ObjectId; name: string; checked: boolean; isDeleted: boolean }[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n {{ title.toLowerCase() }} \n \n \n Done\n \n \n \n \n \n \n \n\n\n \n \n\n\n \n \n \n 0\"\n (ionChange)=\"allTasksChange($event)\"\n appHaptics\n [disableHaptics]=\"filter.length > 0\"\n >\n All Tasks \n \n \n \n \n \n {{ task.name }}\n \n \n Archived\n \n \n \n \n {{ task.name }}\n \n \n Archived\n \n \n \n \n\n \n \n \n \n \n\n\n \n \n","import {\n AfterViewInit,\n Component,\n Input,\n OnInit,\n ViewChild\n} from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { ObjectId } from '@app/types/object-id';\nimport { TaskDto } from '@app/types/task-dto';\nimport { ModalClass } from '@core/class/modal.class';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { FilterTasksPipe } from './filter-tasks.pipe';\n\n@Component({\n selector: 'app-task-selector-modal',\n templateUrl: './task-selector-modal.component.html',\n styleUrls: ['./task-selector-modal.component.scss'],\n standalone: false\n})\nexport class TaskSelectorModalComponent\n extends ModalClass\n implements OnInit, AfterViewInit\n{\n @Input()\n public set selectedTasks(value: ObjectId[]) {\n this.originalSelectedTasks = value;\n }\n\n @Input()\n public readonly title?: string = 'Tasks';\n\n @Input()\n public readonly tasks: MongoStoredObject[];\n\n @Input()\n public readonly hiddenTasks: ObjectId[] = [];\n\n @Input()\n public readonly multiple?: boolean = false;\n\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @Input()\n public readonly emptyText?: string = 'No Tasks';\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n protected originalSelectedTasks: ObjectId[] = [];\n public selected: {\n id: ObjectId;\n name: string;\n checked: boolean;\n isDeleted: boolean;\n }[] = [];\n public filter = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n protected get isAllChecked(): boolean {\n return (\n this.selected.filter((item) => item.checked).length ===\n this.tasks.length && this.tasks.length > 0\n );\n }\n\n protected get isIndeterminate(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n return checkedItems.length > 0 && checkedItems.length < this.tasks.length;\n }\n\n protected get canSave(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n\n if (checkedItems.length !== this.originalSelectedTasks.length) {\n return true;\n }\n\n return !this.originalSelectedTasks.reduce((prev, cur) => {\n if (prev === false) return false;\n return !!checkedItems.find((item) => item.id === cur);\n }, true);\n }\n\n public ngOnInit(): void {\n this.selected = this.tasks\n .map((task) => ({\n id: task._id,\n name: task.title,\n checked: this.originalSelectedTasks.includes(task._id),\n isDeleted: task.isDeleted\n }))\n .sort((a, b) => {\n const aChecked = a.checked;\n const bChecked = b.checked;\n if (aChecked && !bChecked) {\n return -1;\n }\n if (!aChecked && bChecked) {\n return 1;\n }\n return 0;\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(\n _: number,\n item: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }\n ) {\n return item.id;\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n const checkedItems = this.selected\n .filter((i) => i.checked)\n .map((i) => i.id);\n this._modalCtrl.dismiss(checkedItems, 'confirm', this._modalName);\n }\n\n protected checkboxClick(event: any, value: ObjectId) {\n event.preventDefault();\n\n if (this.multiple) {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value ? !item.checked : item.checked\n }));\n } else {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value\n }));\n\n this.confirmChanges();\n }\n }\n\n protected allTasksChange(event: any): void {\n const {\n detail: { checked }\n }: { detail: { checked: boolean } } = event;\n\n this.selected = this.selected.map((item) => ({\n ...item,\n checked\n }));\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected isTaskHidden(taskId: ObjectId) {\n return this.hiddenTasks.includes(taskId);\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const tasks = new FilterTasksPipe()\n .transform(this.selected, this.filter)\n .filter((task) => !this.isTaskHidden(task.id));\n\n if (tasks.length > 0) {\n return tasks[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n if (this.multiple) {\n first.checked = !first.checked;\n } else {\n this.selected = this.selected.map((task) => ({\n ...task,\n checked: task.id === first.id\n }));\n\n this.confirmChanges();\n }\n }\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterUsers',\n standalone: true\n})\nexport class FilterUsersPipe implements PipeTransform {\n public transform(\n items: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[],\n filter: string\n ): {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n {{ title }} \n \n \n {{ doneBtnText }}\n \n \n \n \n \n \n \n\n\n \n \n\n\n \n \n \n 0\"\n (ionChange)=\"allUsersChange($event)\"\n appHaptics\n [disableHaptics]=\"filter.length > 0\"\n >\n All Users\n \n \n \n \n {{ recipient.name }}\n \n \n \n {{ recipient.name }}\n \n \n \n \n \n \n","import {\n AfterViewInit,\n Component,\n Input,\n OnInit,\n ViewChild\n} from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport { ModalClass } from '@core/class/modal.class';\nimport { UserModel, UserNameModel } from '@core/model/user.model';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { FilterUsersPipe } from './filter-users.pipe';\n\n@Component({\n selector: 'app-user-selector-modal',\n templateUrl: './user-selector-modal.component.html',\n standalone: false\n})\nexport class UserSelectorModalComponent\n extends ModalClass\n implements OnInit, AfterViewInit\n{\n @Input()\n public set recipients(value: ObjectId[]) {\n this.originalRecipients = value;\n }\n\n @Input()\n public readonly hideSelectAllButton?: boolean = false;\n\n @Input()\n public readonly title?: string = 'Recipients';\n\n @Input()\n public readonly users: (UserModel | UserNameModel)[];\n\n @Input()\n public readonly hiddenUsers: string[] = [];\n\n @Input()\n public readonly multiple?: boolean = false;\n\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @Input()\n public readonly doneBtnText?: string = 'Done';\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n protected originalRecipients: ObjectId[] = [];\n public selected: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[] = [];\n public filter = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n public ngOnInit(): void {\n this.selected = this.users\n .map((user) => ({\n id: user._id,\n name: `${user.firstName} ${user.lastName}`,\n checked: this.originalRecipients.includes(user._id)\n }))\n .sort((a, b) => {\n const aChecked = a.checked;\n const bChecked = b.checked;\n if (aChecked && !bChecked) {\n return -1;\n }\n if (!aChecked && bChecked) {\n return 1;\n }\n return 0;\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(\n _: number,\n item: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }\n ) {\n return item.id;\n }\n\n protected get isAllChecked(): boolean {\n return (\n this.selected.filter((item) => item.checked).length ===\n this.users.length && this.users.length > 0\n );\n }\n\n protected get isIndeterminate(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n return checkedItems.length > 0 && checkedItems.length < this.users.length;\n }\n\n protected get canSave(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n\n if (checkedItems.length !== this.originalRecipients.length) {\n return true;\n }\n\n return !this.originalRecipients.reduce((prev, cur) => {\n if (prev === false) return false;\n return !!checkedItems.find((item) => item.id === cur);\n }, true);\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n const checkedItems = this.selected\n .filter((i) => i.checked)\n .map((i) => i.id);\n this._modalCtrl.dismiss(checkedItems, 'confirm', this._modalName);\n }\n\n protected checkboxClick(event: any, value: ObjectId) {\n event.preventDefault();\n\n if (this.multiple) {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value ? !item.checked : item.checked\n }));\n } else {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value\n }));\n\n this.confirmChanges();\n }\n }\n\n protected allUsersChange(event: any): void {\n const {\n detail: { checked }\n }: { detail: { checked: boolean } } = event;\n\n this.selected = this.selected.map((item) => ({\n ...item,\n checked\n }));\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected isUserHidden(userId: string) {\n return this.hiddenUsers.includes(userId);\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const users = new FilterUsersPipe()\n .transform(this.selected, this.filter)\n .filter((user) => !this.isUserHidden(user.id));\n\n if (users.length > 0) {\n return users[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n if (this.multiple) {\n first.checked = !first.checked;\n } else {\n this.selected = this.selected.map((user) => ({\n ...user,\n checked: user.id === first.id\n }));\n\n this.confirmChanges();\n }\n }\n }\n}\n","\n \n \n \n {{ cancelBtnText }}\n \n \n {{ title }} \n \n \n {{ saveBtnText }}\n \n \n \n \n {{ info.start }}
\n {{ info.end }}
\n \n \n\n\n \n \n\n\n \n \n \n \n","import {\n ChangeDetectionStrategy,\n Component,\n Input,\n OnInit\n} from '@angular/core';\nimport { ModalClass } from '@core/class/modal.class';\nimport { ModalController } from '@ionic/angular';\n\n@Component({\n selector: 'app-wysiwyg-modal',\n templateUrl: './wysiwyg-modal.component.html',\n styleUrls: ['./wysiwyg-modal.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class WysiwygModalComponent extends ModalClass implements OnInit {\n @Input()\n public readonly mode?: 'view' | 'edit' = 'edit';\n\n @Input()\n public readonly body?: string = '';\n\n @Input()\n public readonly bodyPlaceholder?: string = 'Body';\n\n @Input()\n public readonly disableAttachments?: boolean = false;\n\n @Input()\n public readonly saveBtnText?: string = 'Done';\n\n @Input()\n public readonly cancelBtnText?: string = 'Cancel';\n\n @Input()\n public readonly dismissable?: boolean = true;\n\n @Input()\n public readonly title?: string = '';\n\n @Input()\n public readonly info?: { start?: string; end?: string };\n\n @Input()\n public readonly toolbarMode?: 'full' | 'image-only' = 'full';\n\n @Input()\n public readonly allowEmptyValue?: boolean = false;\n\n protected value = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n public ngOnInit(): void {\n this.value = this.body;\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onSaveClick(): void {\n this._modalCtrl.dismiss(this.value, 'confirm', this._modalName);\n }\n}\n","import { BehaviorSelectorModalComponent } from '@app/modals/behavior-selector-modal/behavior-selector-modal.component';\nimport {\n EditRecognitionModalComponent,\n IEditRecognitionModalProps,\n IEditRecognitionModalResult\n} from '@app/modals/edit-recognition-modal/edit-recognition-modal.component';\nimport { InsightsRangeModalComponent } from '@app/modals/insights-range-modal/insights-range-modal.component';\nimport { TaskSelectorModalComponent } from '@app/modals/task-selector-modal/task-selector-modal.component';\nimport { UserSelectorModalComponent } from '@app/modals/user-selector-modal/user-selector-modal.component';\nimport { WysiwygModalComponent } from '@app/modals/wysiwyg-modal/wysiwyg-modal.component';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { ObjectId } from '@app/types/object-id';\nimport { TaskDto } from '@app/types/task-dto';\nimport { DateInterval } from '@backend/types/date-interval';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { UserModel, UserNameModel } from '@core/model/user.model';\nimport { ActionSheetController, ModalController } from '@ionic/angular';\nimport { ComponentProps, ComponentRef } from '@ionic/core';\nimport { isMobile } from './is-mobile';\n\nexport interface IModalOptions {\n parentModalName?: string;\n useTopModalAsParent?: boolean;\n canDismiss?: boolean | ((data: T, role: string) => Promise);\n backdropDismiss?: boolean;\n onDidDismiss?: () => void;\n}\n\nexport const showModal = async (\n params: {\n component: ComponentRef;\n props?: ComponentProps;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n role: string;\n data: T;\n}> => {\n const isM = isMobile();\n const modalName = (params.component as any).name;\n\n const exists = document.getElementById(modalName);\n if (exists) return;\n\n let parentModalName = options?.parentModalName;\n\n if (options?.useTopModalAsParent) {\n const topModal = await modalCtrl.getTop();\n if (topModal) {\n parentModalName = topModal.id;\n }\n }\n\n const modal = await modalCtrl.create({\n id: modalName,\n cssClass: isM ? undefined : 'modal-auto-height',\n component: params.component,\n componentProps: params.props,\n handle: false,\n presentingElement: isM\n ? parentModalName\n ? document.getElementById(parentModalName)\n : document.querySelector('ion-split-pane')\n : undefined,\n canDismiss: options?.canDismiss,\n backdropDismiss: options?.backdropDismiss\n });\n modal.present();\n\n const { role, data } = await modal.onWillDismiss();\n\n modal.onDidDismiss().then(() => {\n if (options?.onDidDismiss) {\n options.onDidDismiss();\n }\n });\n\n return {\n role,\n data\n };\n};\n\nexport const showUserSelectorModal = async (\n modalProps: {\n recipients?: ObjectId[];\n hideSelectAllButton?: boolean;\n title?: string;\n users: (UserModel | UserNameModel)[];\n hiddenUsers?: (ObjectId | string)[];\n multiple?: boolean;\n focusSearchbar?: boolean;\n doneBtnText?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedUsers: ObjectId[];\n}> => {\n const { role, data } = await showModal(\n {\n component: UserSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedUsers: data };\n }\n\n return { success: false, selectedUsers: [] };\n};\n\nexport const showTaskSelectorModal = async (\n modalProps: {\n selectedTasks?: ObjectId[];\n title?: string;\n tasks: MongoStoredObject[];\n hiddenTasks?: ObjectId[];\n multiple?: boolean;\n focusSearchbar?: boolean;\n emptyText?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedTasks: ObjectId[];\n}> => {\n const { role, data } = await showModal(\n {\n component: TaskSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedTasks: data };\n }\n\n return { success: false, selectedTasks: [] };\n};\n\nexport const showBehaviorSelectorModal = async (\n modalProps: {\n behaviors?: BehaviorModel[];\n focusSearchbar?: boolean;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedBehavior: BehaviorModel;\n}> => {\n const { role, data } = await showModal(\n {\n component: BehaviorSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedBehavior: data };\n }\n\n return { success: false, selectedBehavior: null };\n};\n\nexport const showWysiwygModal = async (\n modalProps: {\n mode?: 'view' | 'edit';\n body?: string;\n bodyPlaceholder?: string;\n disableAttachments?: boolean;\n saveBtnText?: string;\n cancelBtnText?: string;\n dismissable?: boolean;\n title?: string;\n info?: { start?: string; end?: string };\n toolbarMode?: 'full' | 'image-only';\n allowEmptyValue?: boolean;\n },\n modalCtrl: ModalController,\n options?: Omit, 'canDismiss' | 'backdropDismiss'>\n): Promise<{\n success: boolean;\n body: string;\n}> => {\n const { role, data } = await showModal(\n {\n component: WysiwygModalComponent,\n props: modalProps\n },\n modalCtrl,\n {\n ...options,\n canDismiss:\n typeof modalProps.dismissable === 'boolean' && !modalProps.dismissable\n ? async (_, role) => role === 'confirm'\n : true,\n backdropDismiss:\n typeof modalProps.dismissable === 'boolean'\n ? modalProps.dismissable\n : true\n }\n );\n\n if (role === 'confirm') {\n return { success: true, body: data };\n }\n\n return { success: false, body: '' };\n};\n\nexport const showDateRangeModal = async (\n modalProps: {\n range: DateInterval;\n buttonText?: string;\n title?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n range: DateInterval;\n}> => {\n const { role, data } = await showModal(\n {\n component: InsightsRangeModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, range: data };\n }\n\n return { success: false, range: null };\n};\n\nexport const showEditRecognitionModal = async (\n modalProps: IEditRecognitionModalProps,\n modalCtrl: ModalController,\n actionSheetCtrl: ActionSheetController,\n options?: Omit, 'canDismiss' | 'backdropDismiss'>\n) => {\n const { role, data } = await showModal(\n {\n component: EditRecognitionModalComponent,\n props: modalProps\n },\n modalCtrl,\n {\n ...options,\n canDismiss: async (_, r) => {\n if (r === 'cancel' || r === 'gesture' || r === 'backdrop') {\n const actionSheet = await actionSheetCtrl.create({\n header: 'Unsaved content',\n subHeader:\n 'Are you sure you want to discard your work and close the editor?',\n buttons: [\n {\n role: 'destructive',\n text: 'Discard and close'\n },\n {\n role: 'cancel',\n text: 'Continue editing'\n }\n ]\n });\n\n actionSheet.present();\n\n const { role } = await actionSheet.onWillDismiss();\n\n return role === 'destructive';\n }\n\n return true;\n }\n }\n );\n\n if (role === 'confirm') {\n return {\n success: true,\n recognition: data.recognition,\n behavior: data.behavior\n };\n }\n\n return { success: false, recognition: null, behavior: null };\n};\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport {\n TSpecPathAcknowledgeAnnouncement,\n TSpecRoute_acknowledgeAnnouncement\n} from '@backend/types/generated/Announcements/acknowledgeAnnouncement';\nimport {\n TSpecPathDeleteAnnouncement,\n TSpecRoute_deleteAnnouncement\n} from '@backend/types/generated/Announcements/deleteAnnouncement';\nimport {\n TSpecBodyEditAnnouncement,\n TSpecPathEditAnnouncement,\n TSpecRoute_editAnnouncement\n} from '@backend/types/generated/Announcements/editAnnouncement';\nimport {\n TSpecQueryGetAllAnnouncements,\n TSpecRoute_getAllAnnouncements\n} from '@backend/types/generated/Announcements/getAllAnnouncements';\nimport {\n TSpecPathGetAnnouncement,\n TSpecRoute_getAnnouncement\n} from '@backend/types/generated/Announcements/getAnnouncement';\nimport { TSpecRoute_getCriticalUnacknowledgedAnnouncements } from '@backend/types/generated/Announcements/getCriticalUnacknowledgedAnnouncements';\nimport {\n TSpecPathGetThreadOfAnnouncement,\n TSpecRoute_getThreadOfAnnouncement\n} from '@backend/types/generated/Announcements/getThreadOfAnnouncement';\nimport { TSpecRoute_getUnacknowledgedCount } from '@backend/types/generated/Announcements/getUnacknowledgedCount';\nimport {\n TSpecBodyPublishAnnouncement,\n TSpecRoute_publishAnnouncement\n} from '@backend/types/generated/Announcements/publishAnnouncement';\nimport {\n TSpecPathReadAnnouncement,\n TSpecRoute_readAnnouncement\n} from '@backend/types/generated/Announcements/readAnnouncement';\nimport {\n TSpecBodyRespondToAnnouncement,\n TSpecPathRespondToAnnouncement,\n TSpecRoute_respondToAnnouncement\n} from '@backend/types/generated/Announcements/respondToAnnouncement';\nimport { AnnouncementModel } from '@core/model/announcement.model';\nimport { Observable } from 'rxjs';\n\n@Injectable()\nexport class AnnouncementApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public getUnacknowledgedCount(): Observable<{\n unacknowledgedCount: number;\n }> {\n return this._httpClient.get<{ unacknowledgedCount: number }>(\n TSpecRoute_getUnacknowledgedCount()\n );\n }\n\n public getCriticalUnacknowledgedAnnouncements(): Observable<{\n items: AnnouncementModel[];\n count: number;\n totalCount: number;\n }> {\n return this._httpClient.get<{\n items: AnnouncementModel[];\n count: number;\n totalCount: number;\n }>(TSpecRoute_getCriticalUnacknowledgedAnnouncements());\n }\n\n public getAllAnnouncements(params: {\n query: TSpecQueryGetAllAnnouncements;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getAllAnnouncements(),\n { params: { ...params.query } }\n );\n }\n\n public getAnnouncement(params: {\n path: TSpecPathGetAnnouncement;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getAnnouncement(params.path)\n );\n }\n\n public publishAnnouncement(params: { body: TSpecBodyPublishAnnouncement }) {\n return this._httpClient.post(TSpecRoute_publishAnnouncement(), params.body);\n }\n\n public editAnnouncement(params: {\n path: TSpecPathEditAnnouncement;\n body: TSpecBodyEditAnnouncement;\n }) {\n return this._httpClient.patch(\n TSpecRoute_editAnnouncement(params.path),\n params.body\n );\n }\n\n public readAnnouncement(params: { path: TSpecPathReadAnnouncement }) {\n return this._httpClient.post(TSpecRoute_readAnnouncement(params.path), {});\n }\n\n public acknowledgeAnnouncement(params: {\n path: TSpecPathAcknowledgeAnnouncement;\n }) {\n return this._httpClient.post(\n TSpecRoute_acknowledgeAnnouncement(params.path),\n {}\n );\n }\n\n public deleteAnnouncement(params: { path: TSpecPathDeleteAnnouncement }) {\n return this._httpClient.delete(TSpecRoute_deleteAnnouncement(params.path));\n }\n\n public respondToAnnouncement(params: {\n path: TSpecPathRespondToAnnouncement;\n body: TSpecBodyRespondToAnnouncement;\n }): Observable {\n return this._httpClient.post(\n TSpecRoute_respondToAnnouncement(params.path),\n params.body\n );\n }\n\n public getThreadOfAnnouncement(params: {\n path: TSpecPathGetThreadOfAnnouncement;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getThreadOfAnnouncement(params.path)\n );\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getUnacknowledgedCount = () => \"/announcements/unacknowledged-count\";\n\nexport type TSpecHandler_getUnacknowledgedCount = RequestHandler;\n\nexport interface TSpecPathGetUnacknowledgedCount { }\n\nexport interface TSpecBodyGetUnacknowledgedCount {}\n\nexport interface TSpecQueryGetUnacknowledgedCount {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getCriticalUnacknowledgedAnnouncements = () => \"/announcements/critical-unacknowledged\";\n\nexport type TSpecHandler_getCriticalUnacknowledgedAnnouncements = RequestHandler;\n\nexport interface TSpecPathGetCriticalUnacknowledgedAnnouncements { }\n\nexport interface TSpecBodyGetCriticalUnacknowledgedAnnouncements {}\n\nexport interface TSpecQueryGetCriticalUnacknowledgedAnnouncements {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllAnnouncements = () => \"/announcements\";\n\nexport type TSpecHandler_getAllAnnouncements = RequestHandler;\n\nexport interface TSpecPathGetAllAnnouncements { }\n\nexport interface TSpecBodyGetAllAnnouncements {}\n\nexport interface TSpecQueryGetAllAnnouncements {\n page?: string;\n limit?: string;\n searchTerm?: string;\n showRewardReports?: boolean;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAnnouncement = (path: TSpecPathGetAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getAnnouncement = RequestHandler;\n\nexport interface TSpecPathGetAnnouncement { id: string; }\n\nexport interface TSpecBodyGetAnnouncement {}\n\nexport interface TSpecQueryGetAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_publishAnnouncement = () => \"/announcements\";\n\nexport type TSpecHandler_publishAnnouncement = RequestHandler;\n\nexport interface TSpecPathPublishAnnouncement { }\n\nexport interface TSpecBodyPublishAnnouncement {\n title: string;\n body: string;\n recipients: {\n id: string;\n }[];\n isCritical: boolean;\n attachments: string[];\n}\n\nexport interface TSpecQueryPublishAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_editAnnouncement = (path: TSpecPathEditAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_editAnnouncement = RequestHandler;\n\nexport interface TSpecPathEditAnnouncement { id: string; }\n\nexport interface TSpecBodyEditAnnouncement {\n title: string;\n body: string;\n isCritical: boolean;\n recipients: {\n id: string;\n }[];\n attachments: string[];\n keepStats?: boolean;\n}\n\nexport interface TSpecQueryEditAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_readAnnouncement = (path: TSpecPathReadAnnouncement) => {\n let res = \"/announcements/:id/read\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_readAnnouncement = RequestHandler;\n\nexport interface TSpecPathReadAnnouncement { id: string; }\n\nexport interface TSpecBodyReadAnnouncement {}\n\nexport interface TSpecQueryReadAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_acknowledgeAnnouncement = (path: TSpecPathAcknowledgeAnnouncement) => {\n let res = \"/announcements/:id/acknowledge\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_acknowledgeAnnouncement = RequestHandler;\n\nexport interface TSpecPathAcknowledgeAnnouncement { id: string; }\n\nexport interface TSpecBodyAcknowledgeAnnouncement {}\n\nexport interface TSpecQueryAcknowledgeAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteAnnouncement = (path: TSpecPathDeleteAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteAnnouncement = RequestHandler;\n\nexport interface TSpecPathDeleteAnnouncement { id: string; }\n\nexport interface TSpecBodyDeleteAnnouncement {}\n\nexport interface TSpecQueryDeleteAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_respondToAnnouncement = (path: TSpecPathRespondToAnnouncement) => {\n let res = \"/announcements/:id/respond\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_respondToAnnouncement = RequestHandler;\n\nexport interface TSpecPathRespondToAnnouncement { id: string; }\n\nexport interface TSpecBodyRespondToAnnouncement {\n body: string;\n}\n\nexport interface TSpecQueryRespondToAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getThreadOfAnnouncement = (path: TSpecPathGetThreadOfAnnouncement) => {\n let res = \"/announcements/:id/thread\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getThreadOfAnnouncement = RequestHandler;\n\nexport interface TSpecPathGetThreadOfAnnouncement { id: string; }\n\nexport interface TSpecBodyGetThreadOfAnnouncement {}\n\nexport interface TSpecQueryGetThreadOfAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","import toPropertyKey from \"./toPropertyKey.js\";\nfunction _defineProperty(e, r, t) {\n return (r = toPropertyKey(r)) in e ? Object.defineProperty(e, r, {\n value: t,\n enumerable: !0,\n configurable: !0,\n writable: !0\n }) : e[r] = t, e;\n}\nexport { _defineProperty as default };","export const config = {\n onUnhandledError: null,\n onStoppedNotification: null,\n Promise: undefined,\n useDeprecatedSynchronousErrorHandling: false,\n useDeprecatedNextContext: false,\n};\n","export const timeoutProvider = {\n setTimeout(handler, timeout, ...args) {\n const { delegate } = timeoutProvider;\n if (delegate === null || delegate === void 0 ? void 0 : delegate.setTimeout) {\n return delegate.setTimeout(handler, timeout, ...args);\n }\n return setTimeout(handler, timeout, ...args);\n },\n clearTimeout(handle) {\n const { delegate } = timeoutProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearTimeout) || clearTimeout)(handle);\n },\n delegate: undefined,\n};\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar _index = _interopRequireDefault(require(\"./_lib/formatDistance/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"./_lib/formatLong/index.js\"));\nvar _index3 = _interopRequireDefault(require(\"./_lib/formatRelative/index.js\"));\nvar _index4 = _interopRequireDefault(require(\"./_lib/localize/index.js\"));\nvar _index5 = _interopRequireDefault(require(\"./_lib/match/index.js\"));\n/**\n * @type {Locale}\n * @category Locales\n * @summary English locale (United States).\n * @language English\n * @iso-639-2 eng\n * @author Sasha Koss [@kossnocorp]{@link https://github.com/kossnocorp}\n * @author Lesha Koss [@leshakoss]{@link https://github.com/leshakoss}\n */\nvar locale = {\n code: 'en-US',\n formatDistance: _index.default,\n formatLong: _index2.default,\n formatRelative: _index3.default,\n localize: _index4.default,\n match: _index5.default,\n options: {\n weekStartsOn: 0 /* Sunday */,\n firstWeekContainsDate: 1\n }\n};\nvar _default = locale;\nexports.default = _default;\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = toDate;\nvar _typeof2 = _interopRequireDefault(require(\"@babel/runtime/helpers/typeof\"));\nvar _index = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\n/**\n * @name toDate\n * @category Common Helpers\n * @summary Convert the given argument to an instance of Date.\n *\n * @description\n * Convert the given argument to an instance of Date.\n *\n * If the argument is an instance of Date, the function returns its clone.\n *\n * If the argument is a number, it is treated as a timestamp.\n *\n * If the argument is none of the above, the function returns Invalid Date.\n *\n * **Note**: *all* Date arguments passed to any *date-fns* function is processed by `toDate`.\n *\n * @param {Date|Number} argument - the value to convert\n * @returns {Date} the parsed date in the local time zone\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Clone the date:\n * const result = toDate(new Date(2014, 1, 11, 11, 30, 30))\n * //=> Tue Feb 11 2014 11:30:30\n *\n * @example\n * // Convert the timestamp to date:\n * const result = toDate(1392098430000)\n * //=> Tue Feb 11 2014 11:30:30\n */\nfunction toDate(argument) {\n (0, _index.default)(1, arguments);\n var argStr = Object.prototype.toString.call(argument);\n\n // Clone the date\n if (argument instanceof Date || (0, _typeof2.default)(argument) === 'object' && argStr === '[object Date]') {\n // Prevent the date to lose the milliseconds when passed to new Date() in IE10\n return new Date(argument.getTime());\n } else if (typeof argument === 'number' || argStr === '[object Number]') {\n return new Date(argument);\n } else {\n if ((typeof argument === 'string' || argStr === '[object String]') && typeof console !== 'undefined') {\n // eslint-disable-next-line no-console\n console.warn(\"Starting with v2.0.0-beta.1 date-fns doesn't accept strings as date arguments. Please use `parseISO` to parse strings. See: https://github.com/date-fns/date-fns/blob/master/docs/upgradeGuide.md#string-arguments\");\n // eslint-disable-next-line no-console\n console.warn(new Error().stack);\n }\n return new Date(NaN);\n }\n}\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = isDate;\nvar _typeof2 = _interopRequireDefault(require(\"@babel/runtime/helpers/typeof\"));\nvar _index = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\n/**\n * @name isDate\n * @category Common Helpers\n * @summary Is the given value a date?\n *\n * @description\n * Returns true if the given value is an instance of Date. The function works for dates transferred across iframes.\n *\n * @param {*} value - the value to check\n * @returns {boolean} true if the given value is a date\n * @throws {TypeError} 1 arguments required\n *\n * @example\n * // For a valid date:\n * const result = isDate(new Date())\n * //=> true\n *\n * @example\n * // For an invalid date:\n * const result = isDate(new Date(NaN))\n * //=> true\n *\n * @example\n * // For some value:\n * const result = isDate('2014-02-31')\n * //=> false\n *\n * @example\n * // For an object:\n * const result = isDate({})\n * //=> false\n */\nfunction isDate(value) {\n (0, _index.default)(1, arguments);\n return value instanceof Date || (0, _typeof2.default)(value) === 'object' && Object.prototype.toString.call(value) === '[object Date]';\n}\nmodule.exports = exports.default;","import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nexport default function startOfUTCISOWeek(dirtyDate) {\n requiredArgs(1, arguments);\n var weekStartsOn = 1;\n var date = toDate(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}","import { Injectable } from '@angular/core';\nimport { Observable, Subject, map, repeat, shareReplay, tap } from 'rxjs';\nimport { InstantFeedbackApiService } from './api/instantFeedback.api.service';\nimport { TSpecQueryGetInstantFeedbacks } from '@backend/types/generated/InstantFeedback/getInstantFeedbacks';\nimport { TSpecBodySendInstantFeedback } from '@backend/types/generated/InstantFeedback/sendInstantFeedback';\n\n@Injectable({ providedIn: 'root' })\nexport class InstantFeedbackService {\n public readonly pageSize = 20;\n\n private readonly _update$ = new Subject();\n\n public unreadCount$: Observable = this._api.getUnreadCount().pipe(\n map(({ unreadCount }) => unreadCount),\n repeat({ delay: () => this._update$ }),\n shareReplay({ refCount: true, bufferSize: 1 })\n );\n\n public constructor(private readonly _api: InstantFeedbackApiService) {}\n\n private _update() {\n this._update$.next();\n }\n\n public readInstantFeedback(instantFeedbackId: string) {\n return this._api\n .readInstantFeedback({ path: { id: instantFeedbackId } })\n .pipe(tap(() => this._update()));\n }\n\n public getInstantFeedbacks(query: TSpecQueryGetInstantFeedbacks) {\n return this._api.getInstantFeedbacks({ query });\n }\n\n public sendInstantFeedback(body: TSpecBodySendInstantFeedback) {\n return this._api\n .sendInstantFeedback({ body })\n .pipe(tap(() => this._update()));\n }\n}\n","import { config } from '../config';\nlet context = null;\nexport function errorContext(cb) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n const isRoot = !context;\n if (isRoot) {\n context = { errorThrown: false, error: null };\n }\n cb();\n if (isRoot) {\n const { errorThrown, error } = context;\n context = null;\n if (errorThrown) {\n throw error;\n }\n }\n }\n else {\n cb();\n }\n}\nexport function captureError(err) {\n if (config.useDeprecatedSynchronousErrorHandling && context) {\n context.errorThrown = true;\n context.error = err;\n }\n}\n","import { registerPlugin } from '@capacitor/core';\nconst Haptics = registerPlugin('Haptics', {\n web: () => import('./web').then(m => new m.HapticsWeb()),\n});\nexport * from './definitions';\nexport { Haptics };\n","import { startOfDay, addDays, endOfDay } from 'date-fns';\n\nexport function lastNDays(n: number) {\n const start = startOfDay(addDays(new Date(), -(n - 1)));\n const end = endOfDay(addDays(start, n - 1));\n return { start, end };\n}\n","import { executeSchedule } from '../util/executeSchedule';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function observeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n source.subscribe(createOperatorSubscriber(subscriber, (value) => executeSchedule(subscriber, scheduler, () => subscriber.next(value), delay), () => executeSchedule(subscriber, scheduler, () => subscriber.complete(), delay), (err) => executeSchedule(subscriber, scheduler, () => subscriber.error(err), delay)));\n });\n}\n","import { operate } from '../util/lift';\nexport function subscribeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n subscriber.add(scheduler.schedule(() => source.subscribe(subscriber), delay));\n });\n}\n","import { Observable } from '../Observable';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleAsyncIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable((subscriber) => {\n executeSchedule(subscriber, scheduler, () => {\n const iterator = input[Symbol.asyncIterator]();\n executeSchedule(subscriber, scheduler, () => {\n iterator.next().then((result) => {\n if (result.done) {\n subscriber.complete();\n }\n else {\n subscriber.next(result.value);\n }\n });\n }, 0, true);\n });\n });\n}\n","import { scheduled } from '../scheduled/scheduled';\nimport { innerFrom } from './innerFrom';\nexport function from(input, scheduler) {\n return scheduler ? scheduled(input, scheduler) : innerFrom(input);\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isReadableStreamLike } from '../util/isReadableStreamLike';\nimport { scheduleReadableStreamLike } from './scheduleReadableStreamLike';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n if (isAsyncIterable(input)) {\n return scheduleAsyncIterable(input, scheduler);\n }\n if (isIterable(input)) {\n return scheduleIterable(input, scheduler);\n }\n if (isReadableStreamLike(input)) {\n return scheduleReadableStreamLike(input, scheduler);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function scheduleObservable(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nexport function scheduleArray(input, scheduler) {\n return new Observable((subscriber) => {\n let i = 0;\n return scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n }\n else {\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n this.schedule();\n }\n }\n });\n });\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function schedulePromise(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from '../util/isFunction';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleIterable(input, scheduler) {\n return new Observable((subscriber) => {\n let iterator;\n executeSchedule(subscriber, scheduler, () => {\n iterator = input[Symbol_iterator]();\n executeSchedule(subscriber, scheduler, () => {\n let value;\n let done;\n try {\n ({ value, done } = iterator.next());\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n }\n }, 0, true);\n });\n return () => isFunction(iterator === null || iterator === void 0 ? void 0 : iterator.return) && iterator.return();\n });\n}\n","import { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nexport function scheduleReadableStreamLike(input, scheduler) {\n return scheduleAsyncIterable(readableStreamLikeToAsyncGenerator(input), scheduler);\n}\n","import { ChangeDetectionStrategy, Component, Input } from '@angular/core';\nimport { IonicModule } from '@ionic/angular';\nimport { CommonModule } from '@angular/common';\nimport { DirectivesModule } from '@app/modules/directives.module';\n\n@Component({\n selector: 'app-read-eye',\n templateUrl: './read-eye.component.html',\n styleUrls: ['./read-eye.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n imports: [CommonModule, IonicModule, DirectivesModule],\n standalone: true\n})\nexport class ReadEyeComponent {\n @Input()\n public readonly label: string;\n\n @Input()\n public readonly button?: boolean = false;\n}\n","\n \n \n {{ label }}\n \n \n","\n \n \n \n \n \n \n \n \n\n\n \n \n \n
\n
\n \n \n\n 1\"\n >\n \n \n \n \n \n","import {\n Component,\n Input,\n ViewChild,\n ElementRef,\n AfterViewInit\n} from '@angular/core';\nimport { ModalController } from '@ionic/angular';\nimport { SwiperContainer } from 'swiper/element';\n\n@Component({\n selector: 'app-image-viewer-modal',\n templateUrl: './image-viewer-modal.component.html',\n styleUrls: ['./image-viewer-modal.component.scss'],\n standalone: false\n})\nexport class ImageViewerModalComponent implements AfterViewInit {\n @Input()\n public images: string[];\n\n @Input()\n public initialIndex: number;\n\n @ViewChild('swiper') swiper!: ElementRef;\n @ViewChild('swiperThumbs') swiperThumbs!: ElementRef;\n\n protected swiperConfig: any = {\n spaceBetween: 10\n };\n protected swiperThumbsConfig: any = {\n spaceBetween: 10,\n slidesPerView: 'auto',\n freeMode: true,\n watchSlidesProgress: true,\n centeredSlides: true\n };\n\n public constructor(private readonly _modalCtrl: ModalController) {}\n\n public ngAfterViewInit() {\n this.swiper.nativeElement.swiper.activeIndex = this.initialIndex;\n this.swiperThumbs.nativeElement.swiper.activeIndex = this.initialIndex;\n\n this.swiper.nativeElement.swiper.on(\n 'slideChange',\n (e: { activeIndex: number }) => {\n this.swiperThumbs.nativeElement.swiper.slideTo(e.activeIndex);\n }\n );\n this.swiper.nativeElement.swiper.on(\n 'zoomChange',\n (_: any, scale: number) => {\n this.swiper.nativeElement.swiper.allowTouchMove = scale === 1;\n }\n );\n\n this.swiperThumbs.nativeElement.swiper.on(\n 'touchEnd',\n (e: { activeIndex: number }) => {\n this.swiper.nativeElement.swiper.slideTo(e.activeIndex);\n }\n );\n }\n\n protected onThumbClick(index: number) {\n this.swiper.nativeElement.swiper.slideTo(index);\n }\n\n protected close() {\n this._modalCtrl.dismiss(null, 'destructive', 'image-viewer-modal');\n }\n}\n","import { Injectable } from '@angular/core';\nimport { ImageViewerModalComponent } from '@app/modules/image-viewer-modal/image-viewer-modal.component';\nimport { ModalController } from '@ionic/angular';\n\n@Injectable({ providedIn: 'root' })\nexport class ImageViewerService {\n public constructor(private readonly _modalCtrl: ModalController) {}\n\n public async viewImage(images: string[], initialIndex: number) {\n const modal = await this._modalCtrl.create({\n id: 'image-viewer-modal',\n component: ImageViewerModalComponent,\n handle: false,\n breakpoints: [0, 1],\n initialBreakpoint: 1,\n componentProps: {\n images,\n initialIndex\n },\n cssClass: 'fullscreen-modal'\n });\n modal.present();\n }\n}\n","import _typeof from \"./typeof.js\";\nimport toPrimitive from \"./toPrimitive.js\";\nfunction toPropertyKey(t) {\n var i = toPrimitive(t, \"string\");\n return \"symbol\" == _typeof(i) ? i : i + \"\";\n}\nexport { toPropertyKey as default };","import _typeof from \"./typeof.js\";\nfunction toPrimitive(t, r) {\n if (\"object\" != _typeof(t) || !t) return t;\n var e = t[Symbol.toPrimitive];\n if (void 0 !== e) {\n var i = e.call(t, r || \"default\");\n if (\"object\" != _typeof(i)) return i;\n throw new TypeError(\"@@toPrimitive must return a primitive value.\");\n }\n return (\"string\" === r ? String : Number)(t);\n}\nexport { toPrimitive as default };","const { isArray } = Array;\nconst { getPrototypeOf, prototype: objectProto, keys: getKeys } = Object;\nexport function argsArgArrayOrObject(args) {\n if (args.length === 1) {\n const first = args[0];\n if (isArray(first)) {\n return { args: first, keys: null };\n }\n if (isPOJO(first)) {\n const keys = getKeys(first);\n return {\n args: keys.map((key) => first[key]),\n keys,\n };\n }\n }\n return { args: args, keys: null };\n}\nfunction isPOJO(obj) {\n return obj && typeof obj === 'object' && getPrototypeOf(obj) === objectProto;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_updateBackdoorInfo = (path: TSpecPathUpdateBackdoorInfo) => {\n let res = \"/backdoor/info/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_updateBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathUpdateBackdoorInfo { id: string; }\n\nexport interface TSpecBodyUpdateBackdoorInfo {\n versionRange: string;\n title: string;\n message: string;\n links: {\n text?: string;\n url?: string;\n }[];\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n platformsToShow: EBackdoorInfoPlatform[];\n}\n\nexport enum EBackdoorInfoPlatform {\n web = \"web\",\n ios = \"ios\",\n android = \"android\"\n}\n\nexport interface TSpecQueryUpdateBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { IBackdoorEula } from '@backend/models/types/backdoor-eula';\nimport { IBackdoorInfo } from '@backend/models/types/backdoor-info';\nimport {\n TSpecBodyAcceptEula,\n TSpecPathAcceptEula,\n TSpecRoute_acceptEula\n} from '@backend/types/generated/Backdoor/acceptEula';\nimport {\n TSpecBodyAddBackdoorEula,\n TSpecRoute_addBackdoorEula\n} from '@backend/types/generated/Backdoor/addBackdoorEula';\nimport {\n TSpecBodyAddBackdoorInfo,\n TSpecRoute_addBackdoorInfo\n} from '@backend/types/generated/Backdoor/addBackdoorInfo';\nimport {\n TSpecPathDeleteBackdoorEula,\n TSpecRoute_deleteBackdoorEula\n} from '@backend/types/generated/Backdoor/deleteBackdoorEula';\nimport {\n TSpecPathDeleteBackdoorInfo,\n TSpecRoute_deleteBackdoorInfo\n} from '@backend/types/generated/Backdoor/deleteBackdoorInfo';\nimport { TSpecRoute_getAllBackdoorEulas } from '@backend/types/generated/Backdoor/getAllBackdoorEulas';\nimport { TSpecRoute_getAllBackdoorInfos } from '@backend/types/generated/Backdoor/getAllBackdoorInfos';\nimport {\n TSpecQueryGetBackdoorState,\n TSpecRoute_getBackdoorState\n} from '@backend/types/generated/Backdoor/getBackdoorState';\nimport {\n TSpecBodyUpdateBackdoorEula,\n TSpecPathUpdateBackdoorEula,\n TSpecRoute_updateBackdoorEula\n} from '@backend/types/generated/Backdoor/updateBackdoorEula';\nimport {\n TSpecBodyUpdateBackdoorInfo,\n TSpecPathUpdateBackdoorInfo,\n TSpecRoute_updateBackdoorInfo\n} from '@backend/types/generated/Backdoor/updateBackdoorInfo';\nimport { Observable } from 'rxjs';\n\n@Injectable()\nexport class BackdoorApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public acceptEula(params: {\n path: TSpecPathAcceptEula;\n body: TSpecBodyAcceptEula;\n }): Observable {\n return this._httpClient.post(\n TSpecRoute_acceptEula(params.path),\n params.body\n );\n }\n\n public getBackdoorState(params: {\n query: TSpecQueryGetBackdoorState;\n }): Observable<{\n currentInfo: MongoStoredObject | null;\n currentEula: MongoStoredObject | null;\n isUserDeleted: boolean;\n }> {\n return this._httpClient.get<{\n currentInfo: MongoStoredObject | null;\n currentEula: MongoStoredObject | null;\n isUserDeleted: boolean;\n }>(TSpecRoute_getBackdoorState(), {\n params: { ...params.query }\n });\n }\n\n public getAllBackdoorInfos(): Observable[]> {\n return this._httpClient.get[]>(\n TSpecRoute_getAllBackdoorInfos()\n );\n }\n\n public getAllBackdoorEulas(): Observable[]> {\n return this._httpClient.get[]>(\n TSpecRoute_getAllBackdoorEulas()\n );\n }\n\n public addBackdoorInfo(params: {\n body: TSpecBodyAddBackdoorInfo;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_addBackdoorInfo(),\n params.body\n );\n }\n\n public addBackdoorEula(params: {\n body: TSpecBodyAddBackdoorEula;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_addBackdoorEula(),\n params.body\n );\n }\n\n public updateBackdoorInfo(params: {\n path: TSpecPathUpdateBackdoorInfo;\n body: TSpecBodyUpdateBackdoorInfo;\n }): Observable> {\n return this._httpClient.put>(\n TSpecRoute_updateBackdoorInfo(params.path),\n params.body\n );\n }\n\n public updateBackdoorEula(params: {\n path: TSpecPathUpdateBackdoorEula;\n body: TSpecBodyUpdateBackdoorEula;\n }): Observable> {\n return this._httpClient.put>(\n TSpecRoute_updateBackdoorEula(params.path),\n params.body\n );\n }\n\n public deleteBackdoorInfo(params: { path: TSpecPathDeleteBackdoorInfo }) {\n return this._httpClient.delete(TSpecRoute_deleteBackdoorInfo(params.path));\n }\n\n public deleteBackdoorEula(params: { path: TSpecPathDeleteBackdoorEula }) {\n return this._httpClient.delete(TSpecRoute_deleteBackdoorEula(params.path));\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_acceptEula = (path: TSpecPathAcceptEula) => {\n let res = \"/backdoor/eula/:backdoorEulaId/accept\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_acceptEula = RequestHandler;\n\nexport interface TSpecPathAcceptEula { backdoorEulaId: string; }\n\nexport interface TSpecBodyAcceptEula {\n deviceId: string;\n deviceModel: string;\n deviceOperatingSystem: string;\n deviceOsVersion: string;\n deviceWebViewVersion: string;\n devicePlatform: string;\n}\n\nexport interface TSpecQueryAcceptEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getBackdoorState = () => \"/backdoor/current-info\";\n\nexport type TSpecHandler_getBackdoorState = RequestHandler;\n\nexport interface TSpecPathGetBackdoorState { }\n\nexport interface TSpecBodyGetBackdoorState {}\n\nexport interface TSpecQueryGetBackdoorState {\n version: string;\n platform?: string;\n manufacturer?: string;\n model?: string;\n osVersion?: string;\n operatingSystem?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllBackdoorInfos = () => \"/backdoor/info\";\n\nexport type TSpecHandler_getAllBackdoorInfos = RequestHandler;\n\nexport interface TSpecPathGetAllBackdoorInfos { }\n\nexport interface TSpecBodyGetAllBackdoorInfos {}\n\nexport interface TSpecQueryGetAllBackdoorInfos {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllBackdoorEulas = () => \"/backdoor/eula\";\n\nexport type TSpecHandler_getAllBackdoorEulas = RequestHandler;\n\nexport interface TSpecPathGetAllBackdoorEulas { }\n\nexport interface TSpecBodyGetAllBackdoorEulas {}\n\nexport interface TSpecQueryGetAllBackdoorEulas {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_addBackdoorInfo = () => \"/backdoor/info\";\n\nexport type TSpecHandler_addBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathAddBackdoorInfo { }\n\nexport interface TSpecBodyAddBackdoorInfo {\n versionRange: string;\n title: string;\n message: string;\n links: {\n text?: string;\n url?: string;\n }[];\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n platformsToShow: EBackdoorInfoPlatform[];\n}\n\nexport enum EBackdoorInfoPlatform {\n web = \"web\",\n ios = \"ios\",\n android = \"android\"\n}\n\nexport interface TSpecQueryAddBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_addBackdoorEula = () => \"/backdoor/eula\";\n\nexport type TSpecHandler_addBackdoorEula = RequestHandler;\n\nexport interface TSpecPathAddBackdoorEula { }\n\nexport interface TSpecBodyAddBackdoorEula {\n title: string;\n iframeCode: string;\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n}\n\nexport interface TSpecQueryAddBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_updateBackdoorEula = (path: TSpecPathUpdateBackdoorEula) => {\n let res = \"/backdoor/eula/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_updateBackdoorEula = RequestHandler;\n\nexport interface TSpecPathUpdateBackdoorEula { id: string; }\n\nexport interface TSpecBodyUpdateBackdoorEula {\n title: string;\n iframeCode: string;\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n}\n\nexport interface TSpecQueryUpdateBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteBackdoorInfo = (path: TSpecPathDeleteBackdoorInfo) => {\n let res = \"/backdoor/info/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathDeleteBackdoorInfo { id: string; }\n\nexport interface TSpecBodyDeleteBackdoorInfo {}\n\nexport interface TSpecQueryDeleteBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteBackdoorEula = (path: TSpecPathDeleteBackdoorEula) => {\n let res = \"/backdoor/eula/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteBackdoorEula = RequestHandler;\n\nexport interface TSpecPathDeleteBackdoorEula { id: string; }\n\nexport interface TSpecBodyDeleteBackdoorEula {}\n\nexport interface TSpecQueryDeleteBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","import * as i0 from '@angular/core';\nimport { Injectable, Inject, EventEmitter, forwardRef, Component, ViewEncapsulation, Input, HostBinding, Output, ViewChild, HostListener, SecurityContext, Attribute, ContentChild, NgModule } from '@angular/core';\nimport * as i1$1 from '@angular/common';\nimport { DOCUMENT, CommonModule } from '@angular/common';\nimport * as i1 from '@angular/common/http';\nimport * as i3 from '@angular/forms';\nimport { NG_VALUE_ACCESSOR, FormsModule, ReactiveFormsModule } from '@angular/forms';\nimport * as i2 from '@angular/platform-browser';\n\nclass AngularEditorService {\n constructor(http, doc) {\n this.http = http;\n this.doc = doc;\n /**\n * save selection when the editor is focussed out\n */\n this.saveSelection = () => {\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n if (sel.getRangeAt && sel.rangeCount) {\n this.savedSelection = sel.getRangeAt(0);\n this.selectedText = sel.toString();\n }\n }\n else if (this.doc.getSelection && this.doc.createRange) {\n this.savedSelection = document.createRange();\n }\n else {\n this.savedSelection = null;\n }\n };\n }\n /**\n * Executed command from editor header buttons exclude toggleEditorMode\n * @param command string from triggerCommand\n * @param value\n */\n executeCommand(command, value) {\n const commands = ['h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'p', 'pre'];\n if (commands.includes(command)) {\n this.doc.execCommand('formatBlock', false, command);\n return;\n }\n this.doc.execCommand(command, false, value);\n }\n /**\n * Create URL link\n * @param url string from UI prompt\n */\n createLink(url) {\n if (!url.includes('http')) {\n this.doc.execCommand('createlink', false, url);\n }\n else {\n const newUrl = '' + this.selectedText + ' ';\n this.insertHtml(newUrl);\n }\n }\n /**\n * insert color either font or background\n *\n * @param color color to be inserted\n * @param where where the color has to be inserted either text/background\n */\n insertColor(color, where) {\n const restored = this.restoreSelection();\n if (restored) {\n if (where === 'textColor') {\n this.doc.execCommand('foreColor', false, color);\n }\n else {\n this.doc.execCommand('hiliteColor', false, color);\n }\n }\n }\n /**\n * Set font name\n * @param fontName string\n */\n setFontName(fontName) {\n this.doc.execCommand('fontName', false, fontName);\n }\n /**\n * Set font size\n * @param fontSize string\n */\n setFontSize(fontSize) {\n this.doc.execCommand('fontSize', false, fontSize);\n }\n /**\n * Create raw HTML\n * @param html HTML string\n */\n insertHtml(html) {\n const isHTMLInserted = this.doc.execCommand('insertHTML', false, html);\n if (!isHTMLInserted) {\n throw new Error('Unable to perform the operation');\n }\n }\n /**\n * restore selection when the editor is focused in\n *\n * saved selection when the editor is focused out\n */\n restoreSelection() {\n if (this.savedSelection) {\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n sel.removeAllRanges();\n sel.addRange(this.savedSelection);\n return true;\n }\n else if (this.doc.getSelection /*&& this.savedSelection.select*/) {\n // this.savedSelection.select();\n return true;\n }\n }\n else {\n return false;\n }\n }\n /**\n * setTimeout used for execute 'saveSelection' method in next event loop iteration\n */\n executeInNextQueueIteration(callbackFn, timeout = 1e2) {\n setTimeout(callbackFn, timeout);\n }\n /** check any selection is made or not */\n checkSelection() {\n const selectedText = this.savedSelection.toString();\n if (selectedText.length === 0) {\n throw new Error('No Selection Made');\n }\n return true;\n }\n /**\n * Upload file to uploadUrl\n * @param file The file\n */\n uploadImage(file) {\n const uploadData = new FormData();\n uploadData.append('file', file, file.name);\n return this.http.post(this.uploadUrl, uploadData, {\n reportProgress: true,\n observe: 'events',\n withCredentials: this.uploadWithCredentials,\n });\n }\n /**\n * Insert image with Url\n * @param imageUrl The imageUrl.\n */\n insertImage(imageUrl) {\n this.doc.execCommand('insertImage', false, imageUrl);\n }\n setDefaultParagraphSeparator(separator) {\n this.doc.execCommand('defaultParagraphSeparator', false, separator);\n }\n createCustomClass(customClass) {\n let newTag = this.selectedText;\n if (customClass) {\n const tagName = customClass.tag ? customClass.tag : 'span';\n newTag = '<' + tagName + ' class=\"' + customClass.class + '\">' + this.selectedText + '' + tagName + '>';\n }\n this.insertHtml(newTag);\n }\n insertVideo(videoUrl) {\n if (videoUrl.match('www.youtube.com')) {\n this.insertYouTubeVideoTag(videoUrl);\n }\n if (videoUrl.match('vimeo.com')) {\n this.insertVimeoVideoTag(videoUrl);\n }\n }\n insertYouTubeVideoTag(videoUrl) {\n const id = videoUrl.split('v=')[1];\n const imageUrl = `https://img.youtube.com/vi/${id}/0.jpg`;\n const thumbnail = `\n `;\n this.insertHtml(thumbnail);\n }\n insertVimeoVideoTag(videoUrl) {\n const sub = this.http.get(`https://vimeo.com/api/oembed.json?url=${videoUrl}`).subscribe(data => {\n const imageUrl = data.thumbnail_url_with_play_button;\n const thumbnail = ``;\n this.insertHtml(thumbnail);\n sub.unsubscribe();\n });\n }\n nextNode(node) {\n if (node.hasChildNodes()) {\n return node.firstChild;\n }\n else {\n while (node && !node.nextSibling) {\n node = node.parentNode;\n }\n if (!node) {\n return null;\n }\n return node.nextSibling;\n }\n }\n getRangeSelectedNodes(range, includePartiallySelectedContainers) {\n let node = range.startContainer;\n const endNode = range.endContainer;\n let rangeNodes = [];\n // Special case for a range that is contained within a single node\n if (node === endNode) {\n rangeNodes = [node];\n }\n else {\n // Iterate nodes until we hit the end container\n while (node && node !== endNode) {\n rangeNodes.push(node = this.nextNode(node));\n }\n // Add partially selected nodes at the start of the range\n node = range.startContainer;\n while (node && node !== range.commonAncestorContainer) {\n rangeNodes.unshift(node);\n node = node.parentNode;\n }\n }\n // Add ancestors of the range container, if required\n if (includePartiallySelectedContainers) {\n node = range.commonAncestorContainer;\n while (node) {\n rangeNodes.push(node);\n node = node.parentNode;\n }\n }\n return rangeNodes;\n }\n getSelectedNodes() {\n const nodes = [];\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n for (let i = 0, len = sel.rangeCount; i < len; ++i) {\n nodes.push.apply(nodes, this.getRangeSelectedNodes(sel.getRangeAt(i), true));\n }\n }\n return nodes;\n }\n replaceWithOwnChildren(el) {\n const parent = el.parentNode;\n while (el.hasChildNodes()) {\n parent.insertBefore(el.firstChild, el);\n }\n parent.removeChild(el);\n }\n removeSelectedElements(tagNames) {\n const tagNamesArray = tagNames.toLowerCase().split(',');\n this.getSelectedNodes().forEach((node) => {\n if (node.nodeType === 1 &&\n tagNamesArray.indexOf(node.tagName.toLowerCase()) > -1) {\n // Remove the node and replace it with its children\n this.replaceWithOwnChildren(node);\n }\n });\n }\n}\nAngularEditorService.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService, deps: [{ token: i1.HttpClient }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nAngularEditorService.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i1.HttpClient }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\nconst angularEditorConfig = {\n editable: true,\n spellcheck: true,\n height: 'auto',\n minHeight: '0',\n maxHeight: 'auto',\n width: 'auto',\n minWidth: '0',\n translate: 'yes',\n enableToolbar: true,\n showToolbar: true,\n placeholder: 'Enter text here...',\n defaultParagraphSeparator: '',\n defaultFontName: '',\n defaultFontSize: '',\n fonts: [\n { class: 'arial', name: 'Arial' },\n { class: 'times-new-roman', name: 'Times New Roman' },\n { class: 'calibri', name: 'Calibri' },\n { class: 'comic-sans-ms', name: 'Comic Sans MS' }\n ],\n uploadUrl: 'v1/image',\n uploadWithCredentials: false,\n sanitize: true,\n toolbarPosition: 'top',\n outline: true,\n /*toolbarHiddenButtons: [\n ['bold', 'italic', 'underline', 'strikeThrough', 'superscript', 'subscript'],\n ['heading', 'fontName', 'fontSize', 'color'],\n ['justifyLeft', 'justifyCenter', 'justifyRight', 'justifyFull', 'indent', 'outdent'],\n ['cut', 'copy', 'delete', 'removeFormat', 'undo', 'redo'],\n ['paragraph', 'blockquote', 'removeBlockquote', 'horizontalLine', 'orderedList', 'unorderedList'],\n ['link', 'unlink', 'image', 'video']\n ]*/\n};\n\nfunction isDefined(value) {\n return value !== undefined && value !== null;\n}\n\nclass AeSelectComponent {\n constructor(elRef, r) {\n this.elRef = elRef;\n this.r = r;\n this.options = [];\n this.disabled = false;\n this.optionId = 0;\n this.opened = false;\n this.hidden = 'inline-block';\n // eslint-disable-next-line @angular-eslint/no-output-native, @angular-eslint/no-output-rename\n this.changeEvent = new EventEmitter();\n this.onChange = () => {\n };\n this.onTouched = () => {\n };\n }\n get label() {\n return this.selectedOption && this.selectedOption.hasOwnProperty('label') ? this.selectedOption.label : 'Select';\n }\n get value() {\n return this.selectedOption.value;\n }\n ngOnInit() {\n this.selectedOption = this.options[0];\n if (isDefined(this.isHidden) && this.isHidden) {\n this.hide();\n }\n }\n hide() {\n this.hidden = 'none';\n }\n optionSelect(option, event) {\n event.stopPropagation();\n this.setValue(option.value);\n this.onChange(this.selectedOption.value);\n this.changeEvent.emit(this.selectedOption.value);\n this.onTouched();\n this.opened = false;\n }\n toggleOpen(event) {\n // event.stopPropagation();\n if (this.disabled) {\n return;\n }\n this.opened = !this.opened;\n }\n onClick($event) {\n if (!this.elRef.nativeElement.contains($event.target)) {\n this.close();\n }\n }\n close() {\n this.opened = false;\n }\n get isOpen() {\n return this.opened;\n }\n writeValue(value) {\n if (!value || typeof value !== 'string') {\n return;\n }\n this.setValue(value);\n }\n setValue(value) {\n let index = 0;\n const selectedEl = this.options.find((el, i) => {\n index = i;\n return el.value === value;\n });\n if (selectedEl) {\n this.selectedOption = selectedEl;\n this.optionId = index;\n }\n }\n registerOnChange(fn) {\n this.onChange = fn;\n }\n registerOnTouched(fn) {\n this.onTouched = fn;\n }\n setDisabledState(isDisabled) {\n this.labelButton.nativeElement.disabled = isDisabled;\n const div = this.labelButton.nativeElement;\n const action = isDisabled ? 'addClass' : 'removeClass';\n this.r[action](div, 'disabled');\n this.disabled = isDisabled;\n }\n handleKeyDown($event) {\n if (!this.opened) {\n return;\n }\n // console.log($event.key);\n // if (KeyCode[$event.key]) {\n switch ($event.key) {\n case 'ArrowDown':\n this._handleArrowDown($event);\n break;\n case 'ArrowUp':\n this._handleArrowUp($event);\n break;\n case 'Space':\n this._handleSpace($event);\n break;\n case 'Enter':\n this._handleEnter($event);\n break;\n case 'Tab':\n this._handleTab($event);\n break;\n case 'Escape':\n this.close();\n $event.preventDefault();\n break;\n case 'Backspace':\n this._handleBackspace();\n break;\n }\n // } else if ($event.key && $event.key.length === 1) {\n // this._keyPress$.next($event.key.toLocaleLowerCase());\n // }\n }\n _handleArrowDown($event) {\n if (this.optionId < this.options.length - 1) {\n this.optionId++;\n }\n }\n _handleArrowUp($event) {\n if (this.optionId >= 1) {\n this.optionId--;\n }\n }\n _handleSpace($event) {\n }\n _handleEnter($event) {\n this.optionSelect(this.options[this.optionId], $event);\n }\n _handleTab($event) {\n }\n _handleBackspace() {\n }\n}\nAeSelectComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeSelectComponent, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Component });\nAeSelectComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AeSelectComponent, selector: \"ae-select\", inputs: { options: \"options\", isHidden: [\"hidden\", \"isHidden\"] }, outputs: { changeEvent: \"change\" }, host: { listeners: { \"document:click\": \"onClick($event)\", \"keydown\": \"handleKeyDown($event)\" }, properties: { \"style.display\": \"this.hidden\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AeSelectComponent),\n multi: true,\n }\n ], viewQueries: [{ propertyName: \"labelButton\", first: true, predicate: [\"labelButton\"], descendants: true, static: true }], ngImport: i0, template: \"\\n {{label}}\\n \\n \\n \\n \\n \\n \\n \\n \\n {{item.label}}\\n \\n No items for select \\n \\n \\n\", styles: [\".ae-font.ae-picker{color:#444;display:inline-block;float:left;width:100%;position:relative;vertical-align:middle}.ae-font .ae-picker-label{cursor:pointer;display:inline-block;height:100%;padding-left:8px;padding-right:10px;position:relative;width:100%;line-height:26px;vertical-align:middle;font-size:85%;text-align:left;background-color:#fff;min-width:2rem;float:left;border:1px solid #ddd;text-overflow:clip;overflow:hidden;white-space:nowrap}.ae-font .ae-picker-label:before{content:\\\"\\\";position:absolute;right:0;top:0;width:20px;height:100%;background:linear-gradient(to right,rgb(255,255,255),#ffffff 100%)}.ae-font .ae-picker-label:focus{outline:none}.ae-font .ae-picker-label:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.ae-font .ae-picker-label:hover:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.ae-font .ae-picker-label:disabled:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label svg{position:absolute;margin-top:-9px;right:0;top:50%;width:18px}.ae-font .ae-picker-label svg:not(:root){overflow:hidden}.ae-font .ae-picker-label svg .ae-stroke{fill:none;stroke:#444;stroke-linecap:round;stroke-linejoin:round;stroke-width:2}.ae-font .ae-picker-options{background-color:#fff;display:none;min-width:100%;position:absolute;white-space:nowrap;z-index:3;border:1px solid transparent;box-shadow:#0003 0 2px 8px}.ae-font .ae-picker-options .ae-picker-item{cursor:pointer;display:block;padding-bottom:5px;padding-top:5px;padding-left:5px;z-index:3;text-align:left;background-color:transparent;min-width:2rem;width:100%;border:0 solid #ddd}.ae-font .ae-picker-options .ae-picker-item.selected{color:#06c;background-color:#fff4c2}.ae-font .ae-picker-options .ae-picker-item.focused,.ae-font .ae-picker-options .ae-picker-item:hover{background-color:#fffa98}.ae-font.ae-expanded{display:block;margin-top:-1px;z-index:1}.ae-font.ae-expanded .ae-picker-label{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg .ae-stroke{stroke:#ccc}.ae-font.ae-expanded .ae-picker-options{display:block;margin-top:-1px;top:100%;z-index:3;border-color:#ccc}\\n\"], dependencies: [{ kind: \"directive\", type: i1$1.NgClass, selector: \"[ngClass]\", inputs: [\"class\", \"ngClass\"] }, { kind: \"directive\", type: i1$1.NgForOf, selector: \"[ngFor][ngForOf]\", inputs: [\"ngForOf\", \"ngForTrackBy\", \"ngForTemplate\"] }, { kind: \"directive\", type: i1$1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }], encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeSelectComponent, decorators: [{\n type: Component,\n args: [{ selector: 'ae-select', encapsulation: ViewEncapsulation.None, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AeSelectComponent),\n multi: true,\n }\n ], template: \"\\n {{label}}\\n \\n \\n \\n \\n \\n \\n \\n \\n {{item.label}}\\n \\n No items for select \\n \\n \\n\", styles: [\".ae-font.ae-picker{color:#444;display:inline-block;float:left;width:100%;position:relative;vertical-align:middle}.ae-font .ae-picker-label{cursor:pointer;display:inline-block;height:100%;padding-left:8px;padding-right:10px;position:relative;width:100%;line-height:26px;vertical-align:middle;font-size:85%;text-align:left;background-color:#fff;min-width:2rem;float:left;border:1px solid #ddd;text-overflow:clip;overflow:hidden;white-space:nowrap}.ae-font .ae-picker-label:before{content:\\\"\\\";position:absolute;right:0;top:0;width:20px;height:100%;background:linear-gradient(to right,rgb(255,255,255),#ffffff 100%)}.ae-font .ae-picker-label:focus{outline:none}.ae-font .ae-picker-label:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.ae-font .ae-picker-label:hover:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.ae-font .ae-picker-label:disabled:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label svg{position:absolute;margin-top:-9px;right:0;top:50%;width:18px}.ae-font .ae-picker-label svg:not(:root){overflow:hidden}.ae-font .ae-picker-label svg .ae-stroke{fill:none;stroke:#444;stroke-linecap:round;stroke-linejoin:round;stroke-width:2}.ae-font .ae-picker-options{background-color:#fff;display:none;min-width:100%;position:absolute;white-space:nowrap;z-index:3;border:1px solid transparent;box-shadow:#0003 0 2px 8px}.ae-font .ae-picker-options .ae-picker-item{cursor:pointer;display:block;padding-bottom:5px;padding-top:5px;padding-left:5px;z-index:3;text-align:left;background-color:transparent;min-width:2rem;width:100%;border:0 solid #ddd}.ae-font .ae-picker-options .ae-picker-item.selected{color:#06c;background-color:#fff4c2}.ae-font .ae-picker-options .ae-picker-item.focused,.ae-font .ae-picker-options .ae-picker-item:hover{background-color:#fffa98}.ae-font.ae-expanded{display:block;margin-top:-1px;z-index:1}.ae-font.ae-expanded .ae-picker-label{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg .ae-stroke{stroke:#ccc}.ae-font.ae-expanded .ae-picker-options{display:block;margin-top:-1px;top:100%;z-index:3;border-color:#ccc}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { options: [{\n type: Input\n }], isHidden: [{\n type: Input,\n args: ['hidden']\n }], hidden: [{\n type: HostBinding,\n args: ['style.display']\n }], changeEvent: [{\n type: Output,\n args: ['change']\n }], labelButton: [{\n type: ViewChild,\n args: ['labelButton', { static: true }]\n }], onClick: [{\n type: HostListener,\n args: ['document:click', ['$event']]\n }], handleKeyDown: [{\n type: HostListener,\n args: ['keydown', ['$event']]\n }] } });\n\nclass AngularEditorToolbarComponent {\n constructor(r, editorService, er, doc) {\n this.r = r;\n this.editorService = editorService;\n this.er = er;\n this.doc = doc;\n this.htmlMode = false;\n this.linkSelected = false;\n this.block = 'default';\n this.fontName = 'Times New Roman';\n this.fontSize = '3';\n this.headings = [\n {\n label: 'Heading 1',\n value: 'h1',\n },\n {\n label: 'Heading 2',\n value: 'h2',\n },\n {\n label: 'Heading 3',\n value: 'h3',\n },\n {\n label: 'Heading 4',\n value: 'h4',\n },\n {\n label: 'Heading 5',\n value: 'h5',\n },\n {\n label: 'Heading 6',\n value: 'h6',\n },\n {\n label: 'Heading 7',\n value: 'h7',\n },\n {\n label: 'Paragraph',\n value: 'p',\n },\n {\n label: 'Predefined',\n value: 'pre'\n },\n {\n label: 'Standard',\n value: 'div'\n },\n {\n label: 'default',\n value: 'default'\n }\n ];\n this.fontSizes = [\n {\n label: '1',\n value: '1',\n },\n {\n label: '2',\n value: '2',\n },\n {\n label: '3',\n value: '3',\n },\n {\n label: '4',\n value: '4',\n },\n {\n label: '5',\n value: '5',\n },\n {\n label: '6',\n value: '6',\n },\n {\n label: '7',\n value: '7',\n }\n ];\n this.customClassId = '-1';\n this.customClassList = [{ label: '', value: '' }];\n // uploadUrl: string;\n this.tagMap = {\n BLOCKQUOTE: 'indent',\n A: 'link'\n };\n this.select = ['H1', 'H2', 'H3', 'H4', 'H5', 'H6', 'P', 'PRE', 'DIV'];\n this.buttons = ['bold', 'italic', 'underline', 'strikeThrough', 'subscript', 'superscript', 'justifyLeft', 'justifyCenter',\n 'justifyRight', 'justifyFull', 'indent', 'outdent', 'insertUnorderedList', 'insertOrderedList', 'link'];\n this.fonts = [{ label: '', value: '' }];\n this.execute = new EventEmitter();\n }\n set customClasses(classes) {\n if (classes) {\n this._customClasses = classes;\n this.customClassList = this._customClasses.map((x, i) => ({ label: x.name, value: i.toString() }));\n this.customClassList.unshift({ label: 'Clear Class', value: '-1' });\n }\n }\n set defaultFontName(value) {\n if (value) {\n this.fontName = value;\n }\n }\n set defaultFontSize(value) {\n if (value) {\n this.fontSize = value;\n }\n }\n get isLinkButtonDisabled() {\n return this.htmlMode || !Boolean(this.editorService.selectedText);\n }\n /**\n * Trigger command from editor header buttons\n * @param command string from toolbar buttons\n */\n triggerCommand(command) {\n this.execute.emit(command);\n }\n /**\n * highlight editor buttons when cursor moved or positioning\n */\n triggerButtons() {\n if (!this.showToolbar) {\n return;\n }\n this.buttons.forEach(e => {\n const result = this.doc.queryCommandState(e);\n const elementById = this.doc.getElementById(e + '-' + this.id);\n if (result) {\n this.r.addClass(elementById, 'active');\n }\n else {\n this.r.removeClass(elementById, 'active');\n }\n });\n }\n /**\n * trigger highlight editor buttons when cursor moved or positioning in block\n */\n triggerBlocks(nodes) {\n if (!this.showToolbar) {\n return;\n }\n this.linkSelected = nodes.findIndex(x => x.nodeName === 'A') > -1;\n let found = false;\n this.select.forEach(y => {\n const node = nodes.find(x => x.nodeName === y);\n if (node !== undefined && y === node.nodeName) {\n if (found === false) {\n this.block = node.nodeName.toLowerCase();\n found = true;\n }\n }\n else if (found === false) {\n this.block = 'default';\n }\n });\n found = false;\n if (this._customClasses) {\n this._customClasses.forEach((y, index) => {\n const node = nodes.find(x => {\n if (x instanceof Element) {\n return x.className === y.class;\n }\n });\n if (node !== undefined) {\n if (found === false) {\n this.customClassId = index.toString();\n found = true;\n }\n }\n else if (found === false) {\n this.customClassId = '-1';\n }\n });\n }\n Object.keys(this.tagMap).map(e => {\n const elementById = this.doc.getElementById(this.tagMap[e] + '-' + this.id);\n const node = nodes.find(x => x.nodeName === e);\n if (node !== undefined && e === node.nodeName) {\n this.r.addClass(elementById, 'active');\n }\n else {\n this.r.removeClass(elementById, 'active');\n }\n });\n this.foreColour = this.doc.queryCommandValue('ForeColor');\n this.fontSize = this.doc.queryCommandValue('FontSize');\n this.fontName = this.doc.queryCommandValue('FontName').replace(/\"/g, '');\n this.backColor = this.doc.queryCommandValue('backColor');\n }\n /**\n * insert URL link\n */\n insertUrl() {\n let url = 'https:\\/\\/';\n const selection = this.editorService.savedSelection;\n if (selection && selection.commonAncestorContainer.parentElement.nodeName === 'A') {\n const parent = selection.commonAncestorContainer.parentElement;\n if (parent.href !== '') {\n url = parent.href;\n }\n }\n url = prompt('Insert URL link', url);\n if (url && url !== '' && url !== 'https://') {\n this.editorService.createLink(url);\n }\n }\n /**\n * insert Video link\n */\n insertVideo() {\n this.execute.emit('');\n const url = prompt('Insert Video link', `https://`);\n if (url && url !== '' && url !== `https://`) {\n this.editorService.insertVideo(url);\n }\n }\n /** insert color */\n insertColor(color, where) {\n this.editorService.insertColor(color, where);\n this.execute.emit('');\n }\n /**\n * set font Name/family\n * @param foreColor string\n */\n setFontName(foreColor) {\n this.editorService.setFontName(foreColor);\n this.execute.emit('');\n }\n /**\n * set font Size\n * @param fontSize string\n */\n setFontSize(fontSize) {\n this.editorService.setFontSize(fontSize);\n this.execute.emit('');\n }\n /**\n * toggle editor mode (WYSIWYG or SOURCE)\n * @param m boolean\n */\n setEditorMode(m) {\n const toggleEditorModeButton = this.doc.getElementById('toggleEditorMode' + '-' + this.id);\n if (m) {\n this.r.addClass(toggleEditorModeButton, 'active');\n }\n else {\n this.r.removeClass(toggleEditorModeButton, 'active');\n }\n this.htmlMode = m;\n }\n /**\n * Upload image when file is selected.\n */\n onFileChanged(event) {\n const file = event.target.files[0];\n if (file.type.includes('image/')) {\n if (this.upload) {\n this.upload(file).subscribe((response) => this.watchUploadImage(response, event));\n }\n else if (this.uploadUrl) {\n this.editorService.uploadImage(file).subscribe((response) => this.watchUploadImage(response, event));\n }\n else {\n const reader = new FileReader();\n reader.onload = (e) => {\n const fr = e.currentTarget;\n this.editorService.insertImage(fr.result.toString());\n };\n reader.readAsDataURL(file);\n }\n }\n }\n watchUploadImage(response, event) {\n const { imageUrl } = response.body;\n this.editorService.insertImage(imageUrl);\n event.srcElement.value = null;\n }\n /**\n * Set custom class\n */\n setCustomClass(classId) {\n if (classId === '-1') {\n this.execute.emit('clear');\n }\n else {\n this.editorService.createCustomClass(this._customClasses[+classId]);\n }\n }\n isButtonHidden(name) {\n if (!name) {\n return false;\n }\n if (!(this.hiddenButtons instanceof Array)) {\n return false;\n }\n let result;\n for (const arr of this.hiddenButtons) {\n if (arr instanceof Array) {\n result = arr.find(item => item === name);\n }\n if (result) {\n break;\n }\n }\n return result !== undefined;\n }\n focus() {\n this.execute.emit('focus');\n console.log('focused');\n }\n}\nAngularEditorToolbarComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorToolbarComponent, deps: [{ token: i0.Renderer2 }, { token: AngularEditorService }, { token: i0.ElementRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Component });\nAngularEditorToolbarComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AngularEditorToolbarComponent, selector: \"angular-editor-toolbar\", inputs: { id: \"id\", uploadUrl: \"uploadUrl\", upload: \"upload\", showToolbar: \"showToolbar\", fonts: \"fonts\", customClasses: \"customClasses\", defaultFontName: \"defaultFontName\", defaultFontSize: \"defaultFontSize\", hiddenButtons: \"hiddenButtons\" }, outputs: { execute: \"execute\" }, viewQueries: [{ propertyName: \"myInputFile\", first: true, predicate: [\"fileInput\"], descendants: true, static: true }], ngImport: i0, template: \"\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}\\n\"], dependencies: [{ kind: \"directive\", type: i1$1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i3.NgControlStatus, selector: \"[formControlName],[ngModel],[formControl]\" }, { kind: \"directive\", type: i3.NgModel, selector: \"[ngModel]:not([formControlName]):not([formControl])\", inputs: [\"name\", \"disabled\", \"ngModel\", \"ngModelOptions\"], outputs: [\"ngModelChange\"], exportAs: [\"ngModel\"] }, { kind: \"component\", type: AeSelectComponent, selector: \"ae-select\", inputs: [\"options\", \"hidden\"], outputs: [\"change\"] }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorToolbarComponent, decorators: [{\n type: Component,\n args: [{ selector: 'angular-editor-toolbar', template: \"\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.Renderer2 }, { type: AngularEditorService }, { type: i0.ElementRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { id: [{\n type: Input\n }], uploadUrl: [{\n type: Input\n }], upload: [{\n type: Input\n }], showToolbar: [{\n type: Input\n }], fonts: [{\n type: Input\n }], customClasses: [{\n type: Input\n }], defaultFontName: [{\n type: Input\n }], defaultFontSize: [{\n type: Input\n }], hiddenButtons: [{\n type: Input\n }], execute: [{\n type: Output\n }], myInputFile: [{\n type: ViewChild,\n args: ['fileInput', { static: true }]\n }] } });\n\nclass AngularEditorComponent {\n constructor(r, editorService, doc, sanitizer, cdRef, defaultTabIndex, autoFocus) {\n this.r = r;\n this.editorService = editorService;\n this.doc = doc;\n this.sanitizer = sanitizer;\n this.cdRef = cdRef;\n this.autoFocus = autoFocus;\n this.modeVisual = true;\n this.showPlaceholder = false;\n this.disabled = false;\n this.focused = false;\n this.touched = false;\n this.changed = false;\n this.id = '';\n this.config = angularEditorConfig;\n this.placeholder = '';\n this.executeCommandFn = this.executeCommand.bind(this);\n this.viewMode = new EventEmitter();\n /** emits `blur` event when focused out from the textarea */\n // eslint-disable-next-line @angular-eslint/no-output-native, @angular-eslint/no-output-rename\n this.blurEvent = new EventEmitter();\n /** emits `focus` event when focused in to the textarea */\n // eslint-disable-next-line @angular-eslint/no-output-rename, @angular-eslint/no-output-native\n this.focusEvent = new EventEmitter();\n this.tabindex = -1;\n const parsedTabIndex = Number(defaultTabIndex);\n this.tabIndex = (parsedTabIndex || parsedTabIndex === 0) ? parsedTabIndex : null;\n }\n onFocus() {\n this.focus();\n }\n ngOnInit() {\n this.config.toolbarPosition = this.config.toolbarPosition ? this.config.toolbarPosition : angularEditorConfig.toolbarPosition;\n }\n ngAfterViewInit() {\n if (isDefined(this.autoFocus)) {\n this.focus();\n }\n }\n onPaste(event) {\n if (this.config.rawPaste) {\n event.preventDefault();\n const text = event.clipboardData.getData('text/plain');\n document.execCommand('insertHTML', false, text);\n return text;\n }\n }\n /**\n * Executed command from editor header buttons\n * @param command string from triggerCommand\n * @param value\n */\n executeCommand(command, value) {\n this.focus();\n if (command === 'focus') {\n return;\n }\n if (command === 'toggleEditorMode') {\n this.toggleEditorMode(this.modeVisual);\n }\n else if (command !== '') {\n if (command === 'clear') {\n this.editorService.removeSelectedElements(this.getCustomTags());\n this.onContentChange(this.textArea.nativeElement);\n }\n else if (command === 'default') {\n this.editorService.removeSelectedElements('h1,h2,h3,h4,h5,h6,p,pre');\n this.onContentChange(this.textArea.nativeElement);\n }\n else {\n this.editorService.executeCommand(command, value);\n }\n this.exec();\n }\n }\n /**\n * focus event\n */\n onTextAreaFocus(event) {\n if (this.focused) {\n event.stopPropagation();\n return;\n }\n this.focused = true;\n this.focusEvent.emit(event);\n if (!this.touched || !this.changed) {\n this.editorService.executeInNextQueueIteration(() => {\n this.configure();\n this.touched = true;\n });\n }\n }\n /**\n * @description fires when cursor leaves textarea\n */\n onTextAreaMouseOut(event) {\n this.editorService.saveSelection();\n }\n /**\n * blur event\n */\n onTextAreaBlur(event) {\n /**\n * save selection if focussed out\n */\n this.editorService.executeInNextQueueIteration(this.editorService.saveSelection);\n if (typeof this.onTouched === 'function') {\n this.onTouched();\n }\n if (event.relatedTarget !== null) {\n const parent = event.relatedTarget.parentElement;\n if (!parent.classList.contains('angular-editor-toolbar-set') && !parent.classList.contains('ae-picker')) {\n this.blurEvent.emit(event);\n this.focused = false;\n }\n }\n }\n /**\n * focus the text area when the editor is focused\n */\n focus() {\n if (this.modeVisual) {\n this.textArea.nativeElement.focus();\n }\n else {\n const sourceText = this.doc.getElementById('sourceText' + this.id);\n sourceText.focus();\n this.focused = true;\n }\n }\n /**\n * Executed from the contenteditable section while the input property changes\n * @param element html element from contenteditable\n */\n onContentChange(element) {\n let html = '';\n if (this.modeVisual) {\n html = element.innerHTML;\n }\n else {\n html = element.innerText;\n }\n if ((!html || html === ' ')) {\n html = '';\n }\n if (typeof this.onChange === 'function') {\n this.onChange(this.config.sanitize || this.config.sanitize === undefined ?\n this.sanitizer.sanitize(SecurityContext.HTML, html) : html);\n if ((!html) !== this.showPlaceholder) {\n this.togglePlaceholder(this.showPlaceholder);\n }\n }\n this.changed = true;\n }\n /**\n * Set the function to be called\n * when the control receives a change event.\n *\n * @param fn a function\n */\n registerOnChange(fn) {\n this.onChange = e => (e === ' ' ? fn('') : fn(e));\n }\n /**\n * Set the function to be called\n * when the control receives a touch event.\n *\n * @param fn a function\n */\n registerOnTouched(fn) {\n this.onTouched = fn;\n }\n /**\n * Write a new value to the element.\n *\n * @param value value to be executed when there is a change in contenteditable\n */\n writeValue(value) {\n if ((!value || value === ' ' || value === '') !== this.showPlaceholder) {\n this.togglePlaceholder(this.showPlaceholder);\n }\n if (value === undefined || value === '' || value === ' ') {\n value = null;\n }\n this.refreshView(value);\n }\n /**\n * refresh view/HTML of the editor\n *\n * @param value html string from the editor\n */\n refreshView(value) {\n const normalizedValue = value === null ? '' : value;\n this.r.setProperty(this.textArea.nativeElement, 'innerHTML', normalizedValue);\n return;\n }\n /**\n * toggles placeholder based on input string\n *\n * @param value A HTML string from the editor\n */\n togglePlaceholder(value) {\n if (!value) {\n this.r.addClass(this.editorWrapper.nativeElement, 'show-placeholder');\n this.showPlaceholder = true;\n }\n else {\n this.r.removeClass(this.editorWrapper.nativeElement, 'show-placeholder');\n this.showPlaceholder = false;\n }\n }\n /**\n * Implements disabled state for this element\n *\n * @param isDisabled Disabled flag\n */\n setDisabledState(isDisabled) {\n const div = this.textArea.nativeElement;\n const action = isDisabled ? 'addClass' : 'removeClass';\n this.r[action](div, 'disabled');\n this.disabled = isDisabled;\n }\n /**\n * toggles editor mode based on bToSource bool\n *\n * @param bToSource A boolean value from the editor\n */\n toggleEditorMode(bToSource) {\n let oContent;\n const editableElement = this.textArea.nativeElement;\n if (bToSource) {\n oContent = this.r.createText(editableElement.innerHTML);\n this.r.setProperty(editableElement, 'innerHTML', '');\n this.r.setProperty(editableElement, 'contentEditable', false);\n const oPre = this.r.createElement('pre');\n this.r.setStyle(oPre, 'margin', '0');\n this.r.setStyle(oPre, 'outline', 'none');\n const oCode = this.r.createElement('code');\n this.r.setProperty(oCode, 'id', 'sourceText' + this.id);\n this.r.setStyle(oCode, 'display', 'block');\n this.r.setStyle(oCode, 'white-space', 'pre-wrap');\n this.r.setStyle(oCode, 'word-break', 'keep-all');\n this.r.setStyle(oCode, 'outline', 'none');\n this.r.setStyle(oCode, 'margin', '0');\n this.r.setStyle(oCode, 'background-color', '#fff5b9');\n this.r.setProperty(oCode, 'contentEditable', true);\n this.r.appendChild(oCode, oContent);\n this.focusInstance = this.r.listen(oCode, 'focus', (event) => this.onTextAreaFocus(event));\n this.blurInstance = this.r.listen(oCode, 'blur', (event) => this.onTextAreaBlur(event));\n this.r.appendChild(oPre, oCode);\n this.r.appendChild(editableElement, oPre);\n // ToDo move to service\n this.doc.execCommand('defaultParagraphSeparator', false, 'div');\n this.modeVisual = false;\n this.viewMode.emit(false);\n oCode.focus();\n }\n else {\n if (this.doc.querySelectorAll) {\n this.r.setProperty(editableElement, 'innerHTML', editableElement.innerText);\n }\n else {\n oContent = this.doc.createRange();\n oContent.selectNodeContents(editableElement.firstChild);\n this.r.setProperty(editableElement, 'innerHTML', oContent.toString());\n }\n this.r.setProperty(editableElement, 'contentEditable', true);\n this.modeVisual = true;\n this.viewMode.emit(true);\n this.onContentChange(editableElement);\n editableElement.focus();\n }\n this.editorToolbar.setEditorMode(!this.modeVisual);\n }\n /**\n * toggles editor buttons when cursor moved or positioning\n *\n * Send a node array from the contentEditable of the editor\n */\n exec() {\n this.editorToolbar.triggerButtons();\n let userSelection;\n if (this.doc.getSelection) {\n userSelection = this.doc.getSelection();\n this.editorService.executeInNextQueueIteration(this.editorService.saveSelection);\n }\n let a = userSelection.focusNode;\n const els = [];\n while (a && a.id !== 'editor') {\n els.unshift(a);\n a = a.parentNode;\n }\n this.editorToolbar.triggerBlocks(els);\n }\n configure() {\n this.editorService.uploadUrl = this.config.uploadUrl;\n this.editorService.uploadWithCredentials = this.config.uploadWithCredentials;\n if (this.config.defaultParagraphSeparator) {\n this.editorService.setDefaultParagraphSeparator(this.config.defaultParagraphSeparator);\n }\n if (this.config.defaultFontName) {\n this.editorService.setFontName(this.config.defaultFontName);\n }\n if (this.config.defaultFontSize) {\n this.editorService.setFontSize(this.config.defaultFontSize);\n }\n }\n getFonts() {\n const fonts = this.config.fonts ? this.config.fonts : angularEditorConfig.fonts;\n return fonts.map(x => {\n return { label: x.name, value: x.name };\n });\n }\n getCustomTags() {\n const tags = ['span'];\n this.config.customClasses.forEach(x => {\n if (x.tag !== undefined) {\n if (!tags.includes(x.tag)) {\n tags.push(x.tag);\n }\n }\n });\n return tags.join(',');\n }\n ngOnDestroy() {\n if (this.blurInstance) {\n this.blurInstance();\n }\n if (this.focusInstance) {\n this.focusInstance();\n }\n }\n filterStyles(html) {\n html = html.replace('position: fixed;', '');\n return html;\n }\n}\nAngularEditorComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorComponent, deps: [{ token: i0.Renderer2 }, { token: AngularEditorService }, { token: DOCUMENT }, { token: i2.DomSanitizer }, { token: i0.ChangeDetectorRef }, { token: 'tabindex', attribute: true }, { token: 'autofocus', attribute: true }], target: i0.ɵɵFactoryTarget.Component });\nAngularEditorComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AngularEditorComponent, selector: \"angular-editor\", inputs: { id: \"id\", config: \"config\", placeholder: \"placeholder\", tabIndex: \"tabIndex\" }, outputs: { html: \"html\", viewMode: \"viewMode\", blurEvent: \"blur\", focusEvent: \"focus\" }, host: { listeners: { \"focus\": \"onFocus()\" }, properties: { \"attr.tabindex\": \"this.tabindex\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AngularEditorComponent),\n multi: true\n },\n AngularEditorService\n ], queries: [{ propertyName: \"customButtonsTemplateRef\", first: true, predicate: [\"customButtons\"], descendants: true }], viewQueries: [{ propertyName: \"textArea\", first: true, predicate: [\"editor\"], descendants: true, static: true }, { propertyName: \"editorWrapper\", first: true, predicate: [\"editorWrapper\"], descendants: true, static: true }, { propertyName: \"editorToolbar\", first: true, predicate: [\"editorToolbar\"], descendants: true }], ngImport: i0, template: \"\\n
\\n \\n \\n \\n\\n
\\n
\\n
\\n
{{ placeholder || config['placeholder'] }} \\n
\\n
\\n
\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}.angular-editor{position:relative}.angular-editor ::ng-deep [contenteditable=true]:empty:before{content:attr(placeholder);color:#868e96;opacity:1}.angular-editor .angular-editor-wrapper{position:relative}.angular-editor .angular-editor-wrapper .angular-editor-textarea{min-height:5rem;padding:.5rem .8rem 1rem;border:1px solid #ddd;background-color:transparent;overflow-x:hidden;overflow-y:auto;position:relative}.angular-editor .angular-editor-wrapper .angular-editor-textarea ::ng-deep blockquote{margin-left:1rem;border-left:.2em solid #dfe2e5;padding-left:.5rem}.angular-editor .angular-editor-wrapper ::ng-deep p{margin-bottom:0}.angular-editor .angular-editor-wrapper .angular-editor-placeholder{display:none;position:absolute;top:0;padding:.5rem .8rem 1rem .9rem;color:#6c757d;opacity:.75}.angular-editor .angular-editor-wrapper.show-placeholder .angular-editor-placeholder{display:block}.angular-editor .angular-editor-wrapper.disabled{cursor:not-allowed;opacity:.5;pointer-events:none}\\n\"], dependencies: [{ kind: \"directive\", type: i1$1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i1$1.NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: [\"ngTemplateOutletContext\", \"ngTemplateOutlet\", \"ngTemplateOutletInjector\"] }, { kind: \"component\", type: AngularEditorToolbarComponent, selector: \"angular-editor-toolbar\", inputs: [\"id\", \"uploadUrl\", \"upload\", \"showToolbar\", \"fonts\", \"customClasses\", \"defaultFontName\", \"defaultFontSize\", \"hiddenButtons\"], outputs: [\"execute\"] }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorComponent, decorators: [{\n type: Component,\n args: [{ selector: 'angular-editor', providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AngularEditorComponent),\n multi: true\n },\n AngularEditorService\n ], template: \"\\n
\\n \\n \\n \\n\\n
\\n
\\n
\\n
{{ placeholder || config['placeholder'] }} \\n
\\n
\\n
\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}.angular-editor{position:relative}.angular-editor ::ng-deep [contenteditable=true]:empty:before{content:attr(placeholder);color:#868e96;opacity:1}.angular-editor .angular-editor-wrapper{position:relative}.angular-editor .angular-editor-wrapper .angular-editor-textarea{min-height:5rem;padding:.5rem .8rem 1rem;border:1px solid #ddd;background-color:transparent;overflow-x:hidden;overflow-y:auto;position:relative}.angular-editor .angular-editor-wrapper .angular-editor-textarea ::ng-deep blockquote{margin-left:1rem;border-left:.2em solid #dfe2e5;padding-left:.5rem}.angular-editor .angular-editor-wrapper ::ng-deep p{margin-bottom:0}.angular-editor .angular-editor-wrapper .angular-editor-placeholder{display:none;position:absolute;top:0;padding:.5rem .8rem 1rem .9rem;color:#6c757d;opacity:.75}.angular-editor .angular-editor-wrapper.show-placeholder .angular-editor-placeholder{display:block}.angular-editor .angular-editor-wrapper.disabled{cursor:not-allowed;opacity:.5;pointer-events:none}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.Renderer2 }, { type: AngularEditorService }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i2.DomSanitizer }, { type: i0.ChangeDetectorRef }, { type: undefined, decorators: [{\n type: Attribute,\n args: ['tabindex']\n }] }, { type: undefined, decorators: [{\n type: Attribute,\n args: ['autofocus']\n }] }]; }, propDecorators: { id: [{\n type: Input\n }], config: [{\n type: Input\n }], placeholder: [{\n type: Input\n }], tabIndex: [{\n type: Input\n }], html: [{\n type: Output\n }], textArea: [{\n type: ViewChild,\n args: ['editor', { static: true }]\n }], editorWrapper: [{\n type: ViewChild,\n args: ['editorWrapper', { static: true }]\n }], editorToolbar: [{\n type: ViewChild,\n args: ['editorToolbar']\n }], customButtonsTemplateRef: [{\n type: ContentChild,\n args: [\"customButtons\"]\n }], viewMode: [{\n type: Output\n }], blurEvent: [{\n type: Output,\n args: ['blur']\n }], focusEvent: [{\n type: Output,\n args: ['focus']\n }], tabindex: [{\n type: HostBinding,\n args: ['attr.tabindex']\n }], onFocus: [{\n type: HostListener,\n args: ['focus']\n }] } });\n\nclass AeButtonComponent {\n constructor() {\n this.iconClass = '';\n this.title = '';\n this.buttonClick = new EventEmitter();\n }\n}\nAeButtonComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeButtonComponent, deps: [], target: i0.ɵɵFactoryTarget.Component });\nAeButtonComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AeButtonComponent, selector: \"ae-button\", inputs: { iconClass: \"iconClass\", title: \"title\" }, outputs: { buttonClick: \"buttonClick\" }, ngImport: i0, template: \" \\n\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}.select-button{display:inline-block}.select-button.disabled{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}\\n\"], encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeButtonComponent, decorators: [{\n type: Component,\n args: [{ selector: 'ae-button', encapsulation: ViewEncapsulation.None, template: \" \\n\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}.select-button{display:inline-block}.select-button.disabled{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}\\n\"] }]\n }], ctorParameters: function () { return []; }, propDecorators: { iconClass: [{\n type: Input\n }], title: [{\n type: Input\n }], buttonClick: [{\n type: Output\n }] } });\n\nclass AeToolbarSetComponent {\n constructor() { }\n}\nAeToolbarSetComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeToolbarSetComponent, deps: [], target: i0.ɵɵFactoryTarget.Component });\nAeToolbarSetComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AeToolbarSetComponent, selector: \"ae-toolbar-set\", ngImport: i0, template: \"\\n \\n
\\n\", styles: [\"\"], encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeToolbarSetComponent, decorators: [{\n type: Component,\n args: [{ selector: 'ae-toolbar-set', encapsulation: ViewEncapsulation.None, template: \"\\n \\n
\\n\" }]\n }], ctorParameters: function () { return []; } });\n\nclass AngularEditorModule {\n}\nAngularEditorModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nAngularEditorModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorModule, declarations: [AngularEditorComponent, AngularEditorToolbarComponent, AeSelectComponent, AeButtonComponent, AeToolbarSetComponent], imports: [CommonModule, FormsModule, ReactiveFormsModule], exports: [AngularEditorComponent, AngularEditorToolbarComponent, AeButtonComponent, AeToolbarSetComponent] });\nAngularEditorModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorModule, imports: [CommonModule, FormsModule, ReactiveFormsModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n CommonModule, FormsModule, ReactiveFormsModule\n ],\n declarations: [AngularEditorComponent, AngularEditorToolbarComponent, AeSelectComponent, AeButtonComponent, AeToolbarSetComponent],\n exports: [AngularEditorComponent, AngularEditorToolbarComponent, AeButtonComponent, AeToolbarSetComponent]\n }]\n }] });\n\n/*\n * Public API Surface of angular-editor\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AeButtonComponent, AeSelectComponent, AeToolbarSetComponent, AngularEditorComponent, AngularEditorModule, AngularEditorService, AngularEditorToolbarComponent };\n","import { CommonModule } from '@angular/common';\nimport {\n ChangeDetectionStrategy,\n Component,\n Input,\n Output,\n OnInit,\n EventEmitter,\n ViewChild,\n OnChanges,\n SimpleChanges\n} from '@angular/core';\nimport { FormsModule } from '@angular/forms';\nimport {\n AngularEditorComponent,\n AngularEditorConfig,\n AngularEditorModule\n} from '@kolkov/angular-editor';\nimport { AfterContentInit } from '@angular/core';\nimport { DomSanitizer } from '@angular/platform-browser';\nimport { removeInlineStyles } from '@app/utils/wysiwyg-editor';\n\n@Component({\n selector: 'app-wysiwyg-editor',\n templateUrl: './wysiwyg-editor.component.html',\n styleUrls: ['./wysiwyg-editor.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n imports: [CommonModule, AngularEditorModule, FormsModule],\n standalone: true\n})\nexport class WysiwygEditorComponent\n implements OnInit, OnChanges, AfterContentInit\n{\n @Input()\n public readonly mode?: 'view' | 'edit' = 'edit';\n\n @Input()\n public readonly value?: string = '';\n\n @Input()\n public readonly bodyPlaceholder?: string = 'Body';\n\n @Input()\n public readonly minHeight?: string = '100px';\n\n @Input()\n public readonly disableAttachments?: boolean = false;\n\n @Input()\n public readonly toolbarMode?: 'full' | 'image-only' = 'full';\n\n @Output()\n public valueChange = new EventEmitter();\n\n @ViewChild('wysiwygEditor', { static: true })\n public wysiwygEditor!: AngularEditorComponent;\n\n protected body = '';\n protected editorConfig: AngularEditorConfig = {\n editable: false,\n sanitize: true,\n // rawPaste: true,\n showToolbar: false,\n spellcheck: true,\n height: 'auto',\n maxHeight: 'auto',\n toolbarHiddenButtons: [\n [\n 'subscript',\n 'superscript',\n 'fontName',\n 'toggleEditorMode',\n 'backgroundColor',\n 'customClasses',\n 'insertVideo',\n 'justifyRight',\n 'justifyFull',\n 'justifyLeft',\n 'justifyCenter',\n 'textColor',\n 'strikeThrough',\n 'insertHorizontalRule',\n 'undo',\n 'redo',\n 'heading'\n ]\n ]\n };\n\n public constructor(private readonly _sanitizer: DomSanitizer) {}\n\n public ngAfterContentInit(): void {\n setTimeout(() => {\n const contenteditableDiv = document.querySelector(\n `#wysiwyg-editor .angular-editor-textarea`\n );\n\n const isSafari =\n navigator.userAgent.includes('Safari/') &&\n navigator.userAgent.includes('Version/');\n\n if (isSafari) {\n contenteditableDiv.addEventListener(\n 'keydown',\n (e: any) => {\n // bold\n if (e.metaKey) {\n if (e.keyCode === 66 || e.keyCode === 73 || e.keyCode === 85) {\n e.preventDefault();\n }\n\n switch (e.keyCode) {\n // bold\n case 66:\n document.execCommand('Bold', false, '');\n break;\n // italic\n case 73:\n document.execCommand('Italic', false, '');\n break;\n // underline\n case 85:\n document.execCommand('Underline', false, '');\n break;\n }\n }\n },\n true\n );\n }\n });\n }\n\n public ngOnInit(): void {\n this.editorConfig.placeholder = this.bodyPlaceholder;\n this.editorConfig.minHeight = this.minHeight;\n\n if (this.mode === 'edit') {\n this.editorConfig.editable = true;\n this.editorConfig.showToolbar = true;\n }\n\n if (this.disableAttachments) {\n this.editorConfig.toolbarHiddenButtons[0].push('insertImage');\n }\n\n this.wysiwygEditor.onPaste = (e) => {\n // cancel paste\n e.preventDefault();\n\n // get text representation of clipboard\n let text = '';\n if (this.toolbarMode === 'image-only') {\n text = e.clipboardData.getData('text/plain');\n } else {\n text = e.clipboardData.getData('text/html');\n }\n\n // sanitize html\n const safeHtml = this._sanitizer.bypassSecurityTrustHtml(text);\n //@ts-expect-error safeHtml fields are not visible in this context\n const html: string = safeHtml['changingThisBreaksApplicationSecurity'];\n const clearedHtml = removeInlineStyles(html);\n\n // insert html\n document.execCommand('insertHTML', false, clearedHtml);\n return '';\n };\n }\n\n public ngOnChanges(changes: SimpleChanges): void {\n if (changes) {\n if (changes.value && changes.value.currentValue) {\n this.body = this.value;\n }\n\n if (changes.disableAttachments) {\n if (changes.disableAttachments.currentValue) {\n if (\n !this.editorConfig.toolbarHiddenButtons[0].includes('insertImage')\n ) {\n this.editorConfig.toolbarHiddenButtons[0].push('insertImage');\n }\n } else {\n this.editorConfig.toolbarHiddenButtons[0] =\n this.editorConfig.toolbarHiddenButtons[0].filter(\n (btn) => btn !== 'insertImage'\n );\n }\n }\n }\n }\n\n protected onChange(e: string) {\n this.body = e;\n this.valueChange.emit(e);\n }\n\n protected setFocus() {\n this.wysiwygEditor.focus();\n }\n\n protected get currentFontSize() {\n return this.wysiwygEditor && this.wysiwygEditor.editorToolbar\n ? this.wysiwygEditor.editorToolbar.fontSize\n : '';\n }\n}\n","\n","import addMilliseconds from \"../addMilliseconds/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name subMilliseconds\n * @category Millisecond Helpers\n * @summary Subtract the specified number of milliseconds from the given date.\n *\n * @description\n * Subtract the specified number of milliseconds from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of milliseconds to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the milliseconds subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 750 milliseconds from 10 July 2014 12:45:30.000:\n * const result = subMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)\n * //=> Thu Jul 10 2014 12:45:29.250\n */\nexport default function subMilliseconds(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var amount = toInteger(dirtyAmount);\n return addMilliseconds(dirtyDate, -amount);\n}","import tzParseTimezone from '../_lib/tzParseTimezone/index.js'\nimport toDate from '../toDate/index.js'\n\n/**\n * @name utcToZonedTime\n * @category Time Zone Helpers\n * @summary Get a date/time representing local time in a given time zone from the UTC date\n *\n * @description\n * Returns a date instance with values representing the local time in the time zone\n * specified of the UTC time from the date provided. In other words, when the new date\n * is formatted it will show the equivalent hours in the target time zone regardless\n * of the current system time zone.\n *\n * @param {Date|String|Number} date - the date with the relevant UTC time\n * @param {String} timeZone - the time zone to get local time for, can be an offset or IANA time zone\n * @param {OptionsWithTZ} [options] - the object with options. See [Options]{@link https://date-fns.org/docs/Options}\n * @param {0|1|2} [options.additionalDigits=2] - passed to `toDate`. See [toDate]{@link https://date-fns.org/docs/toDate}\n * @returns {Date} the new date with the equivalent time in the time zone\n * @throws {TypeError} 2 arguments required\n * @throws {RangeError} `options.additionalDigits` must be 0, 1 or 2\n *\n * @example\n * // In June 10am UTC is 6am in New York (-04:00)\n * const result = utcToZonedTime('2014-06-25T10:00:00.000Z', 'America/New_York')\n * //=> Jun 25 2014 06:00:00\n */\nexport default function utcToZonedTime(dirtyDate, timeZone, options) {\n var date = toDate(dirtyDate, options)\n\n var offsetMilliseconds = tzParseTimezone(timeZone, date, true)\n\n var d = new Date(date.getTime() - offsetMilliseconds)\n\n var resultDate = new Date(0)\n\n resultDate.setFullYear(d.getUTCFullYear(), d.getUTCMonth(), d.getUTCDate())\n\n resultDate.setHours(d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), d.getUTCMilliseconds())\n\n return resultDate\n}\n","import { NgModule } from '@angular/core';\nimport { CommonModule } from '@angular/common';\nimport { WidthRestrictedContainerComponent } from './width-restricted-container.component';\n\n@NgModule({\n declarations: [WidthRestrictedContainerComponent],\n imports: [CommonModule],\n exports: [WidthRestrictedContainerComponent]\n})\nexport class WidthRestrictedContainerModule {}\n","import { isFunction } from './isFunction';\nexport function hasLift(source) {\n return isFunction(source === null || source === void 0 ? void 0 : source.lift);\n}\nexport function operate(init) {\n return (source) => {\n if (hasLift(source)) {\n return source.lift(function (liftedSource) {\n try {\n return init(liftedSource, this);\n }\n catch (err) {\n this.error(err);\n }\n });\n }\n throw new TypeError('Unable to lift unknown Observable type');\n };\n}\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nconst transitionEndAsync = (el, expectedDuration = 0) => {\n return new Promise((resolve) => {\n transitionEnd(el, expectedDuration, resolve);\n });\n};\n/**\n * Allows developer to wait for a transition\n * to finish and fallback to a timer if the\n * transition is cancelled or otherwise\n * never finishes. Also see transitionEndAsync\n * which is an await-able version of this.\n */\nconst transitionEnd = (el, expectedDuration = 0, callback) => {\n let unRegTrans;\n let animationTimeout;\n const opts = { passive: true };\n const ANIMATION_FALLBACK_TIMEOUT = 500;\n const unregister = () => {\n if (unRegTrans) {\n unRegTrans();\n }\n };\n const onTransitionEnd = (ev) => {\n if (ev === undefined || el === ev.target) {\n unregister();\n callback(ev);\n }\n };\n if (el) {\n el.addEventListener('webkitTransitionEnd', onTransitionEnd, opts);\n el.addEventListener('transitionend', onTransitionEnd, opts);\n animationTimeout = setTimeout(onTransitionEnd, expectedDuration + ANIMATION_FALLBACK_TIMEOUT);\n unRegTrans = () => {\n if (animationTimeout !== undefined) {\n clearTimeout(animationTimeout);\n animationTimeout = undefined;\n }\n el.removeEventListener('webkitTransitionEnd', onTransitionEnd, opts);\n el.removeEventListener('transitionend', onTransitionEnd, opts);\n };\n }\n return unregister;\n};\n/**\n * Waits for a component to be ready for\n * both custom element and non-custom element builds.\n * If non-custom element build, el.componentOnReady\n * will be used.\n * For custom element builds, we wait a frame\n * so that the inner contents of the component\n * have a chance to render.\n *\n * Use this utility rather than calling\n * el.componentOnReady yourself.\n */\nconst componentOnReady = (el, callback) => {\n if (el.componentOnReady) {\n // eslint-disable-next-line custom-rules/no-component-on-ready-method\n el.componentOnReady().then((resolvedEl) => callback(resolvedEl));\n }\n else {\n raf(() => callback(el));\n }\n};\n/**\n * This functions checks if a Stencil component is using\n * the lazy loaded build of Stencil. Returns `true` if\n * the component is lazy loaded. Returns `false` otherwise.\n */\nconst hasLazyBuild = (stencilEl) => {\n return stencilEl.componentOnReady !== undefined;\n};\n/**\n * Elements inside of web components sometimes need to inherit global attributes\n * set on the host. For example, the inner input in `ion-input` should inherit\n * the `title` attribute that developers set directly on `ion-input`. This\n * helper function should be called in componentWillLoad and assigned to a variable\n * that is later used in the render function.\n *\n * This does not need to be reactive as changing attributes on the host element\n * does not trigger a re-render.\n */\nconst inheritAttributes = (el, attributes = []) => {\n const attributeObject = {};\n attributes.forEach((attr) => {\n if (el.hasAttribute(attr)) {\n const value = el.getAttribute(attr);\n if (value !== null) {\n attributeObject[attr] = el.getAttribute(attr);\n }\n el.removeAttribute(attr);\n }\n });\n return attributeObject;\n};\n/**\n * List of available ARIA attributes + `role`.\n * Removed deprecated attributes.\n * https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/Attributes\n */\nconst ariaAttributes = [\n 'role',\n 'aria-activedescendant',\n 'aria-atomic',\n 'aria-autocomplete',\n 'aria-braillelabel',\n 'aria-brailleroledescription',\n 'aria-busy',\n 'aria-checked',\n 'aria-colcount',\n 'aria-colindex',\n 'aria-colindextext',\n 'aria-colspan',\n 'aria-controls',\n 'aria-current',\n 'aria-describedby',\n 'aria-description',\n 'aria-details',\n 'aria-disabled',\n 'aria-errormessage',\n 'aria-expanded',\n 'aria-flowto',\n 'aria-haspopup',\n 'aria-hidden',\n 'aria-invalid',\n 'aria-keyshortcuts',\n 'aria-label',\n 'aria-labelledby',\n 'aria-level',\n 'aria-live',\n 'aria-multiline',\n 'aria-multiselectable',\n 'aria-orientation',\n 'aria-owns',\n 'aria-placeholder',\n 'aria-posinset',\n 'aria-pressed',\n 'aria-readonly',\n 'aria-relevant',\n 'aria-required',\n 'aria-roledescription',\n 'aria-rowcount',\n 'aria-rowindex',\n 'aria-rowindextext',\n 'aria-rowspan',\n 'aria-selected',\n 'aria-setsize',\n 'aria-sort',\n 'aria-valuemax',\n 'aria-valuemin',\n 'aria-valuenow',\n 'aria-valuetext',\n];\n/**\n * Returns an array of aria attributes that should be copied from\n * the shadow host element to a target within the light DOM.\n * @param el The element that the attributes should be copied from.\n * @param ignoreList The list of aria-attributes to ignore reflecting and removing from the host.\n * Use this in instances where we manually specify aria attributes on the `` element.\n */\nconst inheritAriaAttributes = (el, ignoreList) => {\n let attributesToInherit = ariaAttributes;\n if (ignoreList && ignoreList.length > 0) {\n attributesToInherit = attributesToInherit.filter((attr) => !ignoreList.includes(attr));\n }\n return inheritAttributes(el, attributesToInherit);\n};\nconst addEventListener = (el, eventName, callback, opts) => {\n var _a;\n if (typeof window !== 'undefined') {\n const win = window;\n const config = (_a = win === null || win === void 0 ? void 0 : win.Ionic) === null || _a === void 0 ? void 0 : _a.config;\n if (config) {\n const ael = config.get('_ael');\n if (ael) {\n return ael(el, eventName, callback, opts);\n }\n else if (config._ael) {\n return config._ael(el, eventName, callback, opts);\n }\n }\n }\n return el.addEventListener(eventName, callback, opts);\n};\nconst removeEventListener = (el, eventName, callback, opts) => {\n var _a;\n if (typeof window !== 'undefined') {\n const win = window;\n const config = (_a = win === null || win === void 0 ? void 0 : win.Ionic) === null || _a === void 0 ? void 0 : _a.config;\n if (config) {\n const rel = config.get('_rel');\n if (rel) {\n return rel(el, eventName, callback, opts);\n }\n else if (config._rel) {\n return config._rel(el, eventName, callback, opts);\n }\n }\n }\n return el.removeEventListener(eventName, callback, opts);\n};\n/**\n * Gets the root context of a shadow dom element\n * On newer browsers this will be the shadowRoot,\n * but for older browser this may just be the\n * element itself.\n *\n * Useful for whenever you need to explicitly\n * do \"myElement.shadowRoot!.querySelector(...)\".\n */\nconst getElementRoot = (el, fallback = el) => {\n return el.shadowRoot || fallback;\n};\n/**\n * Patched version of requestAnimationFrame that avoids ngzone\n * Use only when you know ngzone should not run\n */\nconst raf = (h) => {\n if (typeof __zone_symbol__requestAnimationFrame === 'function') {\n return __zone_symbol__requestAnimationFrame(h);\n }\n if (typeof requestAnimationFrame === 'function') {\n return requestAnimationFrame(h);\n }\n return setTimeout(h);\n};\nconst hasShadowDom = (el) => {\n return !!el.shadowRoot && !!el.attachShadow;\n};\nconst focusVisibleElement = (el) => {\n el.focus();\n /**\n * When programmatically focusing an element,\n * the focus-visible utility will not run because\n * it is expecting a keyboard event to have triggered this;\n * however, there are times when we need to manually control\n * this behavior so we call the `setFocus` method on ion-app\n * which will let us explicitly set the elements to focus.\n */\n if (el.classList.contains('ion-focusable')) {\n const app = el.closest('ion-app');\n if (app) {\n app.setFocus([el]);\n }\n }\n};\n/**\n * This method is used to add a hidden input to a host element that contains\n * a Shadow DOM. It does not add the input inside of the Shadow root which\n * allows it to be picked up inside of forms. It should contain the same\n * values as the host element.\n *\n * @param always Add a hidden input even if the container does not use Shadow\n * @param container The element where the input will be added\n * @param name The name of the input\n * @param value The value of the input\n * @param disabled If true, the input is disabled\n */\nconst renderHiddenInput = (always, container, name, value, disabled) => {\n if (always || hasShadowDom(container)) {\n let input = container.querySelector('input.aux-input');\n if (!input) {\n input = container.ownerDocument.createElement('input');\n input.type = 'hidden';\n input.classList.add('aux-input');\n container.appendChild(input);\n }\n input.disabled = disabled;\n input.name = name;\n input.value = value || '';\n }\n};\nconst clamp = (min, n, max) => {\n return Math.max(min, Math.min(n, max));\n};\nconst assert = (actual, reason) => {\n if (!actual) {\n const message = 'ASSERT: ' + reason;\n console.error(message);\n debugger; // eslint-disable-line\n throw new Error(message);\n }\n};\nconst pointerCoord = (ev) => {\n // get X coordinates for either a mouse click\n // or a touch depending on the given event\n if (ev) {\n const changedTouches = ev.changedTouches;\n if (changedTouches && changedTouches.length > 0) {\n const touch = changedTouches[0];\n return { x: touch.clientX, y: touch.clientY };\n }\n if (ev.pageX !== undefined) {\n return { x: ev.pageX, y: ev.pageY };\n }\n }\n return { x: 0, y: 0 };\n};\n/**\n * @hidden\n * Given a side, return if it should be on the end\n * based on the value of dir\n * @param side the side\n * @param isRTL whether the application dir is rtl\n */\nconst isEndSide = (side) => {\n const isRTL = document.dir === 'rtl';\n switch (side) {\n case 'start':\n return isRTL;\n case 'end':\n return !isRTL;\n default:\n throw new Error(`\"${side}\" is not a valid value for [side]. Use \"start\" or \"end\" instead.`);\n }\n};\nconst debounceEvent = (event, wait) => {\n const original = event._original || event;\n return {\n _original: event,\n emit: debounce(original.emit.bind(original), wait),\n };\n};\nconst debounce = (func, wait = 0) => {\n let timer;\n return (...args) => {\n clearTimeout(timer);\n timer = setTimeout(func, wait, ...args);\n };\n};\n/**\n * Check whether the two string maps are shallow equal.\n *\n * undefined is treated as an empty map.\n *\n * @returns whether the keys are the same and the values are shallow equal.\n */\nconst shallowEqualStringMap = (map1, map2) => {\n map1 !== null && map1 !== void 0 ? map1 : (map1 = {});\n map2 !== null && map2 !== void 0 ? map2 : (map2 = {});\n if (map1 === map2) {\n return true;\n }\n const keys1 = Object.keys(map1);\n if (keys1.length !== Object.keys(map2).length) {\n return false;\n }\n for (const k1 of keys1) {\n if (!(k1 in map2)) {\n return false;\n }\n if (map1[k1] !== map2[k1]) {\n return false;\n }\n }\n return true;\n};\n\nexport { addEventListener as a, removeEventListener as b, componentOnReady as c, renderHiddenInput as d, debounceEvent as e, focusVisibleElement as f, getElementRoot as g, inheritAttributes as h, inheritAriaAttributes as i, clamp as j, hasLazyBuild as k, hasShadowDom as l, assert as m, isEndSide as n, debounce as o, pointerCoord as p, raf as r, shallowEqualStringMap as s, transitionEndAsync as t };\n","import toInteger from \"../_lib/toInteger/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name setMinutes\n * @category Minute Helpers\n * @summary Set the minutes to the given date.\n *\n * @description\n * Set the minutes to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} minutes - the minutes of the new date\n * @returns {Date} the new date with the minutes set\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Set 45 minutes to 1 September 2014 11:30:40:\n * const result = setMinutes(new Date(2014, 8, 1, 11, 30, 40), 45)\n * //=> Mon Sep 01 2014 11:45:40\n */\nexport default function setMinutes(dirtyDate, dirtyMinutes) {\n requiredArgs(2, arguments);\n var date = toDate(dirtyDate);\n var minutes = toInteger(dirtyMinutes);\n date.setMinutes(minutes);\n return date;\n}","import { Injectable } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ConnectedAccountModel } from '@core/model/connected-account-model';\nimport { BehaviorSubject, Observable, combineLatest, tap } from 'rxjs';\nimport { ConnectedAccountsApiService } from './api/connected-accounts.api.service';\nimport { GlobalSettingsService } from './global-settings.service';\n\n@Injectable({ providedIn: 'root' })\nexport class ConnectedAccountsListService {\n private _myConnectedAccounts$ = new BehaviorSubject(\n []\n );\n private _connectedAccountsGroups$ = new BehaviorSubject<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n >([]);\n\n public myConnectedAccounts$: Observable =\n this._myConnectedAccounts$.asObservable();\n public connectedAccountsGroups$: Observable<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n > = this._connectedAccountsGroups$.asObservable();\n\n protected isUser: boolean = null;\n protected isSuperAdmin: boolean = null;\n\n public constructor(\n private readonly _connectedAccountsApiService: ConnectedAccountsApiService,\n private readonly _authenticationService: AuthenticationService,\n private readonly _globalSettingsService: GlobalSettingsService\n ) {\n combineLatest([\n this._authenticationService.user$,\n this._globalSettingsService.globalSettings$\n ]).subscribe(([user, globalSettings]) => {\n if (user && this.isUser === null && this.isSuperAdmin === null) {\n this.isUser = !!user;\n this.isSuperAdmin = !!globalSettings.superAdmins.find(\n (user) =>\n user._id.toString() ===\n this._authenticationService.user._id.toString()\n );\n\n this.fetchMyConnectedAccounts();\n this.fetchConnectedAccountsGroups();\n }\n });\n }\n\n public fetchMyConnectedAccounts(): void {\n if (this.isUser) {\n this._connectedAccountsApiService.getMyConnectedAccounts().subscribe({\n next: (accounts) => {\n this._myConnectedAccounts$.next(accounts);\n }\n });\n }\n }\n\n public fetchConnectedAccountsGroups(): void {\n if (this.isSuperAdmin) {\n this._connectedAccountsApiService.getConnectedAccountsGroups().subscribe({\n next: (groups) => {\n this._connectedAccountsGroups$.next(\n groups.map((g) => ({\n ...g,\n accounts: g.accounts.sort((a, b) => {\n if (a.email < b.email) {\n return -1;\n }\n if (a.email > b.email) {\n return 1;\n }\n return 0;\n })\n }))\n );\n }\n });\n }\n }\n\n public removeMyConnectedAccount(userId: string) {\n return this._connectedAccountsApiService\n .removeMyConnectedAccount({ query: { userId } })\n .pipe(\n tap((accounts) => {\n this._myConnectedAccounts$.next(accounts);\n this.fetchConnectedAccountsGroups();\n })\n );\n }\n\n public removeConnectedAccountFromGroup(groupId: string, userId: string) {\n return this._connectedAccountsApiService\n .removeConnectedAccountFromGroup({ query: { groupId, userId } })\n .pipe(\n tap((groups) => {\n this._connectedAccountsGroups$.next(groups);\n this.fetchMyConnectedAccounts();\n })\n );\n }\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport {\n TSpecPathDeleteLedger,\n TSpecRoute_deleteLedger\n} from '@backend/types/generated/Ledger/deleteLedger';\nimport {\n TSpecPathGetLedger,\n TSpecQueryGetLedger,\n TSpecRoute_getLedger\n} from '@backend/types/generated/Ledger/getLedger';\nimport {\n TSpecPathGetLedgerById,\n TSpecRoute_getLedgerById\n} from '@backend/types/generated/Ledger/getLedgerById';\nimport { TSpecRoute_getUnreadLedgers } from '@backend/types/generated/Ledger/getUnreadLedgers';\nimport {\n TSpecBodyReadLedgerById,\n TSpecPathReadLedgerById,\n TSpecRoute_readLedgerById\n} from '@backend/types/generated/Ledger/readLedgerById';\nimport {\n TSpecBodyUpdateLedger,\n TSpecPathUpdateLedger,\n TSpecRoute_updateLedger\n} from '@backend/types/generated/Ledger/updateLedger';\nimport {\n TSpecPathGetReceivedLedger,\n TSpecQueryGetReceivedLedger,\n TSpecRoute_getReceivedLedger\n} from '@backend/types/generated/Users/getReceivedLedger';\nimport {\n TSpecPathGetSentLedger,\n TSpecQueryGetSentLedger,\n TSpecRoute_getSentLedger\n} from '@backend/types/generated/Users/getSentLedger';\nimport { LedgerModel } from '@core/model/ledger.model';\nimport { Observable } from 'rxjs';\n\ninterface IGetAllLedgersPaginatedResult {\n ledgers: LedgerModel[];\n totalItems: number;\n message: string;\n currentPage: string;\n totalPages: number;\n}\n\n@Injectable({\n providedIn: 'root'\n})\nexport class LedgerApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public getUnreadLedgers(): Observable<{\n items: LedgerModel[];\n count: number;\n totalCount: number;\n }> {\n return this._httpClient.get<{\n items: LedgerModel[];\n count: number;\n totalCount: number;\n }>(TSpecRoute_getUnreadLedgers());\n }\n\n public getLedger(params: {\n path: TSpecPathGetLedger;\n query: TSpecQueryGetLedger;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getLedger(params.path),\n { params: { ...params.query } }\n );\n }\n\n public getSentLedger(params: {\n path: TSpecPathGetSentLedger;\n query: TSpecQueryGetSentLedger;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getSentLedger(params.path),\n { params: { ...params.query } }\n );\n }\n\n public getReceivedLedger(params: {\n path: TSpecPathGetReceivedLedger;\n query: TSpecQueryGetReceivedLedger;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getReceivedLedger(params.path),\n { params: { ...params.query } }\n );\n }\n\n public getLedgerById(params: {\n path: TSpecPathGetLedgerById;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getLedgerById(params.path)\n );\n }\n\n public readLedgerById(params: {\n path: TSpecPathReadLedgerById;\n body: TSpecBodyReadLedgerById;\n }): Observable {\n return this._httpClient.post(\n TSpecRoute_readLedgerById(params.path),\n params.body\n );\n }\n\n public deleteLedger(params: {\n path: TSpecPathDeleteLedger;\n }): Observable {\n return this._httpClient.delete(TSpecRoute_deleteLedger(params.path));\n }\n\n public updateLedger(params: {\n path: TSpecPathUpdateLedger;\n body: TSpecBodyUpdateLedger;\n }): Observable {\n return this._httpClient.patch(\n TSpecRoute_updateLedger(params.path),\n params.body\n );\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getUnreadLedgers = () => \"/ledger/unread\";\n\nexport type TSpecHandler_getUnreadLedgers = RequestHandler;\n\nexport interface TSpecPathGetUnreadLedgers { }\n\nexport interface TSpecBodyGetUnreadLedgers {}\n\nexport interface TSpecQueryGetUnreadLedgers {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getLedger = (path: TSpecPathGetLedger) => {\n let res = \"/tenant/:tenantId/ledger\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getLedger = RequestHandler;\n\nexport interface TSpecPathGetLedger { tenantId: string; }\n\nexport interface TSpecBodyGetLedger {}\n\nexport interface TSpecQueryGetLedger {\n page?: string;\n limit?: string;\n searchTerm?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getSentLedger = (path: TSpecPathGetSentLedger) => {\n let res = \"/users/:id/ledger-sent\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getSentLedger = RequestHandler;\n\nexport interface TSpecPathGetSentLedger { id: string; }\n\nexport interface TSpecBodyGetSentLedger {}\n\nexport interface TSpecQueryGetSentLedger {\n searchTerm?: string;\n limit?: string;\n page?: string;\n from?: string;\n to?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getReceivedLedger = (path: TSpecPathGetReceivedLedger) => {\n let res = \"/users/:id/ledger-received\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getReceivedLedger = RequestHandler;\n\nexport interface TSpecPathGetReceivedLedger { id: string; }\n\nexport interface TSpecBodyGetReceivedLedger {}\n\nexport interface TSpecQueryGetReceivedLedger {\n searchTerm?: string;\n limit?: string;\n page?: string;\n from?: string;\n to?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getLedgerById = (path: TSpecPathGetLedgerById) => {\n let res = \"/tenant/:tenantId/ledger/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getLedgerById = RequestHandler;\n\nexport interface TSpecPathGetLedgerById { tenantId: string; id: string; }\n\nexport interface TSpecBodyGetLedgerById {}\n\nexport interface TSpecQueryGetLedgerById {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_readLedgerById = (path: TSpecPathReadLedgerById) => {\n let res = \"/tenant/:tenantId/ledger/:id/read\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_readLedgerById = RequestHandler;\n\nexport interface TSpecPathReadLedgerById { tenantId: string; id: string; }\n\nexport interface TSpecBodyReadLedgerById {\n recipientId: string;\n}\n\nexport interface TSpecQueryReadLedgerById {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteLedger = (path: TSpecPathDeleteLedger) => {\n let res = \"/ledger/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteLedger = RequestHandler;\n\nexport interface TSpecPathDeleteLedger { id: string; }\n\nexport interface TSpecBodyDeleteLedger {}\n\nexport interface TSpecQueryDeleteLedger {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_updateLedger = (path: TSpecPathUpdateLedger) => {\n let res = \"/tenant/:tenantId/ledger/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_updateLedger = RequestHandler;\n\nexport interface TSpecPathUpdateLedger { tenantId: string; id: string; }\n\nexport interface TSpecBodyUpdateLedger {\n description: string;\n recipientId: string;\n behaviorId: string;\n isPrivate: boolean;\n}\n\nexport interface TSpecQueryUpdateLedger {\n AppVersion?: string;\n AppUser?: string;\n}\n","export function createObject(keys, values) {\n return keys.reduce((result, key, i) => ((result[key] = values[i]), result), {});\n}\n","\n \n \n \n \n Back \n \n \n \n \n\n\n \n
\n \n \n
\n \n \n \n \n \n \n
\n \n","import { Component, EventEmitter, Input, OnInit, Output } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { IPsychologicalSurvey } from '@backend/models/types/psychological-survey';\nimport { IMoodCheckResult } from '@backend/models/types/psychological-survey-answer';\nimport {\n IMoodCheckParams,\n IPsychologicalSurveyQuestion\n} from '@backend/models/types/psychological-survey-question';\n\n@Component({\n selector: 'app-mood-check-question',\n templateUrl: './mood-check-question.component.html',\n styleUrls: ['./mood-check-question.component.scss'],\n standalone: false\n})\nexport class MoodCheckQuestionComponent implements OnInit {\n @Input()\n public readonly survey: MongoStoredObject;\n\n @Input()\n public readonly question: MongoStoredObject<\n IPsychologicalSurveyQuestion & { params: IMoodCheckParams }\n >;\n\n @Input()\n public readonly previousAnswer?: IMoodCheckResult = null;\n\n @Output()\n public completed = new EventEmitter<{\n questionId: string;\n result: IMoodCheckResult;\n }>();\n\n @Output()\n public goBack = new EventEmitter();\n\n protected result: IMoodCheckResult = {\n moodValue: 0\n };\n\n public constructor() {}\n\n public ngOnInit(): void {\n if (this.previousAnswer) {\n this.result = this.previousAnswer;\n }\n }\n\n protected completeQuestion() {\n this.completed.emit({\n questionId: this.question._id,\n result: this.result\n });\n }\n\n protected onBackButtonClick() {\n this.goBack.emit();\n }\n\n protected selectMood(mood: number) {\n this.result.moodValue = mood;\n\n this.completeQuestion();\n }\n}\n","export enum PayFrequency {\n EVERY_WEEK = 'EVERY_WEEK',\n EVERY_TWO_WEEKS = 'EVERY_TWO_WEEKS',\n ONCE_PER_MONTH = 'ONCE_PER_MONTH',\n TWICE_PER_MONTH = 'TWICE_PER_MONTH'\n}\n\nexport interface PayrollDefinitionWeek {\n frequency: PayFrequency.EVERY_WEEK;\n date1: string;\n}\n\nexport interface PayrollDefinitionTwoWeek {\n frequency: PayFrequency.EVERY_TWO_WEEKS;\n date1: string;\n}\n\nexport interface PayrollDefinitionMonth {\n frequency: PayFrequency.ONCE_PER_MONTH;\n date1: string;\n}\n\nexport interface PayrollDefinitionTwicePerMonth {\n frequency: PayFrequency.TWICE_PER_MONTH;\n date1: string;\n date2: string;\n}\n\nexport type PayrollDefinition =\n | PayrollDefinitionWeek\n | PayrollDefinitionTwoWeek\n | PayrollDefinitionMonth\n | PayrollDefinitionTwicePerMonth;\n","function _typeof(o) {\n \"@babel/helpers - typeof\";\n\n return _typeof = \"function\" == typeof Symbol && \"symbol\" == typeof Symbol.iterator ? function (o) {\n return typeof o;\n } : function (o) {\n return o && \"function\" == typeof Symbol && o.constructor === Symbol && o !== Symbol.prototype ? \"symbol\" : typeof o;\n }, _typeof(o);\n}\nexport { _typeof as default };","import { Injectable } from '@angular/core';\nimport { TenantApiService } from './api/tenant.api.service';\nimport { UserEntityService } from './user-entity.service';\nimport {\n Subject,\n distinctUntilChanged,\n map,\n repeat,\n shareReplay,\n switchMap\n} from 'rxjs';\nimport { ToastService } from './toast.service';\nimport { TSpecBodyPatchTenant } from '@backend/types/generated/Tenants/patchTenant';\n\n@Injectable({ providedIn: 'root' })\nexport class TenantService {\n protected refetchTenant = false;\n\n private readonly _update$ = new Subject();\n\n public readonly tenant$ = this._user.user$.pipe(\n map(({ tenant }) => tenant),\n distinctUntilChanged((prev, cur) => {\n if (this.refetchTenant) return false;\n\n return prev.toString() === cur.toString();\n }),\n switchMap((tenant) => {\n this.refetchTenant = false;\n\n return this._api\n .getTenantById({ path: { id: tenant } })\n .pipe(repeat({ delay: () => this._update$ }));\n }),\n shareReplay(1)\n );\n\n public constructor(\n private readonly _api: TenantApiService,\n private readonly _user: UserEntityService,\n private readonly _toastService: ToastService\n ) {}\n\n public update(): void {\n this.refetchTenant = true;\n this._user.update();\n }\n\n public patch(data: TSpecBodyPatchTenant) {\n this._api.patchTenant({ body: data }).subscribe({\n next: () => this._update$.next(),\n error: (e: { error: { message: string } }) => {\n console.log('[ERR]', e);\n this._toastService.presentToast(\n e.error?.message || 'Unable to change the tenant settings'\n );\n }\n });\n }\n}\n","import { addDays, getDay, isAfter, isSameDay, setDay } from 'date-fns';\n\nexport function nextWeeklyPeriodStart(value: Date) {\n const dow = getDay(value);\n const now = new Date();\n let result = setDay(now, dow);\n\n if (isSameDay(now, result) || isAfter(now, result)) {\n result = addDays(result, 7);\n }\n return result;\n}\n","import addDays from \"../addDays/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport { getDefaultOptions } from \"../_lib/defaultOptions/index.js\";\n/**\n * @name setDay\n * @category Weekday Helpers\n * @summary Set the day of the week to the given date.\n *\n * @description\n * Set the day of the week to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} day - the day of the week of the new date\n * @param {Object} [options] - an object with options.\n * @param {Locale} [options.locale=defaultLocale] - the locale object. See [Locale]{@link https://date-fns.org/docs/Locale}\n * @param {0|1|2|3|4|5|6} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)\n * @returns {Date} the new date with the day of the week set\n * @throws {TypeError} 2 arguments required\n * @throws {RangeError} `options.weekStartsOn` must be between 0 and 6\n *\n * @example\n * // Set week day to Sunday, with the default weekStartsOn of Sunday:\n * const result = setDay(new Date(2014, 8, 1), 0)\n * //=> Sun Aug 31 2014 00:00:00\n *\n * @example\n * // Set week day to Sunday, with a weekStartsOn of Monday:\n * const result = setDay(new Date(2014, 8, 1), 0, { weekStartsOn: 1 })\n * //=> Sun Sep 07 2014 00:00:00\n */\nexport default function setDay(dirtyDate, dirtyDay, options) {\n var _ref, _ref2, _ref3, _options$weekStartsOn, _options$locale, _options$locale$optio, _defaultOptions$local, _defaultOptions$local2;\n requiredArgs(2, arguments);\n var defaultOptions = getDefaultOptions();\n var weekStartsOn = toInteger((_ref = (_ref2 = (_ref3 = (_options$weekStartsOn = options === null || options === void 0 ? void 0 : options.weekStartsOn) !== null && _options$weekStartsOn !== void 0 ? _options$weekStartsOn : options === null || options === void 0 ? void 0 : (_options$locale = options.locale) === null || _options$locale === void 0 ? void 0 : (_options$locale$optio = _options$locale.options) === null || _options$locale$optio === void 0 ? void 0 : _options$locale$optio.weekStartsOn) !== null && _ref3 !== void 0 ? _ref3 : defaultOptions.weekStartsOn) !== null && _ref2 !== void 0 ? _ref2 : (_defaultOptions$local = defaultOptions.locale) === null || _defaultOptions$local === void 0 ? void 0 : (_defaultOptions$local2 = _defaultOptions$local.options) === null || _defaultOptions$local2 === void 0 ? void 0 : _defaultOptions$local2.weekStartsOn) !== null && _ref !== void 0 ? _ref : 0);\n\n // Test if weekStartsOn is between 0 and 6 _and_ is not NaN\n if (!(weekStartsOn >= 0 && weekStartsOn <= 6)) {\n throw new RangeError('weekStartsOn must be between 0 and 6 inclusively');\n }\n var date = toDate(dirtyDate);\n var day = toInteger(dirtyDay);\n var currentDay = date.getDay();\n var remainder = day % 7;\n var dayIndex = (remainder + 7) % 7;\n var delta = 7 - weekStartsOn;\n var diff = day < 0 || day > 6 ? day - (currentDay + delta) % 7 : (dayIndex + delta) % 7 - (currentDay + delta) % 7;\n return addDays(date, diff);\n}","import { addMonths, getDate, isBefore, isSameDay } from 'date-fns';\nimport { setDayOfMonth } from './set-day-of-month';\n\nexport function nextMonthlyPeriodStart(value: Date) {\n const now = new Date();\n const dayOfMonth = getDate(value);\n const currentPeriodStart = setDayOfMonth(now, dayOfMonth);\n if (isSameDay(currentPeriodStart, now) || isBefore(currentPeriodStart, now)) {\n return addMonths(currentPeriodStart, 1);\n }\n return currentPeriodStart;\n}\n","import toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name getDate\n * @category Day Helpers\n * @summary Get the day of the month of the given date.\n *\n * @description\n * Get the day of the month of the given date.\n *\n * @param {Date|Number} date - the given date\n * @returns {Number} the day of month\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Which day of the month is 29 February 2012?\n * const result = getDate(new Date(2012, 1, 29))\n * //=> 29\n */\nexport default function getDate(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var dayOfMonth = date.getDate();\n return dayOfMonth;\n}","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_setIntegration = () => \"/integrations\";\n\nexport type TSpecHandler_setIntegration = RequestHandler;\n\nexport interface TSpecPathSetIntegration { }\n\nexport interface TSpecBodySetIntegration {\n provider: EIntegrationProvider;\n tenantId: string;\n settings?: unknown;\n publicSettingsFields?: string[];\n}\n\nexport enum EIntegrationProvider {\n AIRTABLE = \"AIRTABLE\",\n GOHIGHLEVEL = \"GOHIGHLEVEL\"\n}\n\nexport interface TSpecQuerySetIntegration {\n AppVersion?: string;\n AppUser?: string;\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { IIntegration } from '@backend/models/types/integration';\nimport {\n TSpecPathDeleteIntegration,\n TSpecQueryDeleteIntegration,\n TSpecRoute_deleteIntegration\n} from '@backend/types/generated/Integrations/deleteIntegration';\nimport {\n TSpecPathGetIntegration,\n TSpecQueryGetIntegration,\n TSpecRoute_getIntegration\n} from '@backend/types/generated/Integrations/getIntegration';\nimport {\n TSpecQueryGetIntegrations,\n TSpecRoute_getIntegrations\n} from '@backend/types/generated/Integrations/getIntegrations';\nimport {\n TSpecQueryGetPublicSettings,\n TSpecRoute_getPublicSettings\n} from '@backend/types/generated/Integrations/getPublicSettings';\nimport {\n TSpecBodyInitIntegration,\n TSpecPathInitIntegration,\n TSpecRoute_initIntegration\n} from '@backend/types/generated/Integrations/initIntegration';\nimport {\n TSpecBodySetIntegration,\n TSpecRoute_setIntegration\n} from '@backend/types/generated/Integrations/setIntegration';\nimport { Observable, Subject, repeat, shareReplay } from 'rxjs';\n\n@Injectable()\nexport class IntegrationApiService {\n private readonly _update$ = new Subject();\n public tenantIntegrations$: Observable> =\n this.getIntegrations({ query: {} }).pipe(\n repeat({ delay: () => this._update$ }),\n shareReplay(1)\n );\n\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public getIntegrations(params: {\n query: TSpecQueryGetIntegrations;\n }): Observable> {\n return this._httpClient.get>(\n TSpecRoute_getIntegrations(),\n { params: { ...params.query } }\n );\n }\n\n public getPublicSettings(params: {\n query: TSpecQueryGetPublicSettings;\n }): Observable {\n return this._httpClient.get(TSpecRoute_getPublicSettings(), {\n params: { ...params.query }\n });\n }\n\n public initIntegration(params: {\n path: TSpecPathInitIntegration;\n body: TSpecBodyInitIntegration;\n }): Observable & { initUrl: string }> {\n return this._httpClient.post<\n MongoStoredObject & { initUrl: string }\n >(TSpecRoute_initIntegration(params.path), params.body);\n }\n\n public setIntegration(params: {\n body: TSpecBodySetIntegration;\n }): Observable> {\n return this._httpClient.put>(\n TSpecRoute_setIntegration(),\n params.body\n );\n }\n\n public getIntegration(params: {\n path: TSpecPathGetIntegration;\n query: TSpecQueryGetIntegration;\n }): Observable> {\n return this._httpClient.get>(\n TSpecRoute_getIntegration(params.path),\n { params: { ...params.query } }\n );\n }\n\n public deleteIntegration(params: {\n path: TSpecPathDeleteIntegration;\n query: TSpecQueryDeleteIntegration;\n }): Observable {\n return this._httpClient.delete(\n TSpecRoute_deleteIntegration(params.path),\n { params: { ...params.query } }\n );\n }\n\n public update(): void {\n this._update$.next();\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getIntegrations = () => \"/integrations\";\n\nexport type TSpecHandler_getIntegrations = RequestHandler;\n\nexport interface TSpecPathGetIntegrations { }\n\nexport interface TSpecBodyGetIntegrations {}\n\nexport interface TSpecQueryGetIntegrations {\n tenantId?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getPublicSettings = () => \"/integrations/public-settings\";\n\nexport type TSpecHandler_getPublicSettings = RequestHandler;\n\nexport interface TSpecPathGetPublicSettings { }\n\nexport interface TSpecBodyGetPublicSettings {}\n\nexport interface TSpecQueryGetPublicSettings {\n provider: EIntegrationProvider;\n AppVersion?: string;\n AppUser?: string;\n}\n\nexport enum EIntegrationProvider {\n AIRTABLE = \"AIRTABLE\",\n GOHIGHLEVEL = \"GOHIGHLEVEL\"\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_initIntegration = (path: TSpecPathInitIntegration) => {\n let res = \"/integrations/:provider/init\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_initIntegration = RequestHandler;\n\nexport interface TSpecPathInitIntegration { provider: string; }\n\nexport interface TSpecBodyInitIntegration {\n tenantId: string;\n settings: unknown;\n publicSettingsFields?: string[];\n}\n\nexport interface TSpecQueryInitIntegration {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getIntegration = (path: TSpecPathGetIntegration) => {\n let res = \"/integrations/:provider\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getIntegration = RequestHandler;\n\nexport interface TSpecPathGetIntegration { provider: string; }\n\nexport interface TSpecBodyGetIntegration {}\n\nexport interface TSpecQueryGetIntegration {\n tenantId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteIntegration = (path: TSpecPathDeleteIntegration) => {\n let res = \"/integrations/:provider\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteIntegration = RequestHandler;\n\nexport interface TSpecPathDeleteIntegration { provider: string; }\n\nexport interface TSpecBodyDeleteIntegration {}\n\nexport interface TSpecQueryDeleteIntegration {\n tenantId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","import { concat } from '../observable/concat';\nimport { popScheduler } from '../util/args';\nimport { operate } from '../util/lift';\nexport function startWith(...values) {\n const scheduler = popScheduler(values);\n return operate((source, subscriber) => {\n (scheduler ? concat(values, source, scheduler) : concat(values, source)).subscribe(subscriber);\n });\n}\n","import {\n ChangeDetectionStrategy,\n Component,\n Input,\n Output,\n EventEmitter,\n HostBinding\n} from '@angular/core';\nimport { IonicModule } from '@ionic/angular';\nimport { CommonModule } from '@angular/common';\nimport { DirectivesModule } from '@app/modules/directives.module';\n\n@Component({\n selector: 'app-wide-button',\n templateUrl: './wide-button.component.html',\n styleUrls: ['./wide-button.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n imports: [CommonModule, IonicModule, DirectivesModule],\n standalone: true\n})\nexport class WideButtonComponent {\n @Input()\n public readonly label: string;\n\n @Input()\n public readonly overflow?: boolean = true;\n\n @Input()\n public readonly disabled?: boolean = false;\n\n @Output()\n public readonly buttonClicked = new EventEmitter();\n\n @HostBinding('class.disabled')\n public get isDisabled() {\n return this.disabled;\n }\n}\n","\n \n
{{ label }}
\n
\n \n
\n
\n \n","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = buildLocalizeFn;\nfunction buildLocalizeFn(args) {\n return function (dirtyIndex, options) {\n var context = options !== null && options !== void 0 && options.context ? String(options.context) : 'standalone';\n var valuesArray;\n if (context === 'formatting' && args.formattingValues) {\n var defaultWidth = args.defaultFormattingWidth || args.defaultWidth;\n var width = options !== null && options !== void 0 && options.width ? String(options.width) : defaultWidth;\n valuesArray = args.formattingValues[width] || args.formattingValues[defaultWidth];\n } else {\n var _defaultWidth = args.defaultWidth;\n var _width = options !== null && options !== void 0 && options.width ? String(options.width) : args.defaultWidth;\n valuesArray = args.values[_width] || args.values[_defaultWidth];\n }\n var index = args.argumentCallback ? args.argumentCallback(dirtyIndex) : dirtyIndex;\n // @ts-ignore: For some reason TypeScript just don't want to match it, no matter how hard we try. I challenge you to try to remove it!\n return valuesArray[index];\n };\n}\nmodule.exports = exports.default;","\n
\n
\n
\n {{ announcement.authorName }}\n
\n
\n
\n
\n","import { Component, Input } from '@angular/core';\nimport { AnnouncementModel } from '@core/model/announcement.model';\n\n@Component({\n selector: 'app-announcement-thread',\n templateUrl: './announcement-thread.component.html',\n styleUrls: ['./announcement-thread.component.scss'],\n standalone: false\n})\nexport class AnnouncementThreadComponent {\n @Input()\n public readonly announcements: AnnouncementModel[];\n\n public constructor() {}\n}\n","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = buildMatchPatternFn;\nfunction buildMatchPatternFn(args) {\n return function (string) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var matchResult = string.match(args.matchPattern);\n if (!matchResult) return null;\n var matchedString = matchResult[0];\n var parseResult = string.match(args.parsePattern);\n if (!parseResult) return null;\n var value = args.valueCallback ? args.valueCallback(parseResult[0]) : parseResult[0];\n value = options.valueCallback ? options.valueCallback(value) : value;\n var rest = string.slice(matchedString.length);\n return {\n value: value,\n rest: rest\n };\n };\n}\nmodule.exports = exports.default;","import toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name endOfDay\n * @category Day Helpers\n * @summary Return the end of a day for the given date.\n *\n * @description\n * Return the end of a day for the given date.\n * The result will be in the local timezone.\n *\n * @param {Date|Number} date - the original date\n * @returns {Date} the end of a day\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // The end of a day for 2 September 2014 11:55:00:\n * const result = endOfDay(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Tue Sep 02 2014 23:59:59.999\n */\nexport default function endOfDay(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n date.setHours(23, 59, 59, 999);\n return date;\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar dateLongFormatter = function dateLongFormatter(pattern, formatLong) {\n switch (pattern) {\n case 'P':\n return formatLong.date({\n width: 'short'\n });\n case 'PP':\n return formatLong.date({\n width: 'medium'\n });\n case 'PPP':\n return formatLong.date({\n width: 'long'\n });\n case 'PPPP':\n default:\n return formatLong.date({\n width: 'full'\n });\n }\n};\nvar timeLongFormatter = function timeLongFormatter(pattern, formatLong) {\n switch (pattern) {\n case 'p':\n return formatLong.time({\n width: 'short'\n });\n case 'pp':\n return formatLong.time({\n width: 'medium'\n });\n case 'ppp':\n return formatLong.time({\n width: 'long'\n });\n case 'pppp':\n default:\n return formatLong.time({\n width: 'full'\n });\n }\n};\nvar dateTimeLongFormatter = function dateTimeLongFormatter(pattern, formatLong) {\n var matchResult = pattern.match(/(P+)(p+)?/) || [];\n var datePattern = matchResult[1];\n var timePattern = matchResult[2];\n if (!timePattern) {\n return dateLongFormatter(pattern, formatLong);\n }\n var dateTimeFormat;\n switch (datePattern) {\n case 'P':\n dateTimeFormat = formatLong.dateTime({\n width: 'short'\n });\n break;\n case 'PP':\n dateTimeFormat = formatLong.dateTime({\n width: 'medium'\n });\n break;\n case 'PPP':\n dateTimeFormat = formatLong.dateTime({\n width: 'long'\n });\n break;\n case 'PPPP':\n default:\n dateTimeFormat = formatLong.dateTime({\n width: 'full'\n });\n break;\n }\n return dateTimeFormat.replace('{{date}}', dateLongFormatter(datePattern, formatLong)).replace('{{time}}', timeLongFormatter(timePattern, formatLong));\n};\nvar longFormatters = {\n p: timeLongFormatter,\n P: dateTimeLongFormatter\n};\nvar _default = longFormatters;\nexports.default = _default;\nmodule.exports = exports.default;","import { innerFrom } from '../observable/innerFrom';\nimport { Observable } from '../Observable';\nimport { mergeMap } from '../operators/mergeMap';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isFunction } from '../util/isFunction';\nimport { mapOneOrManyArgs } from '../util/mapOneOrManyArgs';\nconst nodeEventEmitterMethods = ['addListener', 'removeListener'];\nconst eventTargetMethods = ['addEventListener', 'removeEventListener'];\nconst jqueryMethods = ['on', 'off'];\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(mapOneOrManyArgs(resultSelector));\n }\n const [add, remove] = isEventTarget(target)\n ? eventTargetMethods.map((methodName) => (handler) => target[methodName](eventName, handler, options))\n :\n isNodeStyleEventEmitter(target)\n ? nodeEventEmitterMethods.map(toCommonHandlerRegistry(target, eventName))\n : isJQueryStyleEventEmitter(target)\n ? jqueryMethods.map(toCommonHandlerRegistry(target, eventName))\n : [];\n if (!add) {\n if (isArrayLike(target)) {\n return mergeMap((subTarget) => fromEvent(subTarget, eventName, options))(innerFrom(target));\n }\n }\n if (!add) {\n throw new TypeError('Invalid event target');\n }\n return new Observable((subscriber) => {\n const handler = (...args) => subscriber.next(1 < args.length ? args : args[0]);\n add(handler);\n return () => remove(handler);\n });\n}\nfunction toCommonHandlerRegistry(target, eventName) {\n return (methodName) => (handler) => target[methodName](eventName, handler);\n}\nfunction isNodeStyleEventEmitter(target) {\n return isFunction(target.addListener) && isFunction(target.removeListener);\n}\nfunction isJQueryStyleEventEmitter(target) {\n return isFunction(target.on) && isFunction(target.off);\n}\nfunction isEventTarget(target) {\n return isFunction(target.addEventListener) && isFunction(target.removeEventListener);\n}\n","import { format } from 'date-fns-tz';\n\nexport function formatZonedTime(\n zonedTime: Date,\n userTimeZone?: string\n): string {\n // Create a formatted string from the zoned time\n return format(zonedTime, \"yyyy-MM-dd'T'HH:mm:ssXXX\", {\n timeZone: userTimeZone\n });\n}\n","\n {{ label }} \n {{ value | formatTime : 'Select time' }} \n \n\n\n \n \n
{{ label }}
\n
{{ value | formatTime : 'Select time' }}
\n
\n \n \n\n\n \n \n \n \n \n Cancel\n \n \n Done\n \n \n
\n \n \n \n","import {\n ChangeDetectionStrategy,\n ChangeDetectorRef,\n Component,\n Input,\n ViewChild\n} from '@angular/core';\nimport { ControlValueAccessor, NG_VALUE_ACCESSOR } from '@angular/forms';\nimport { formatZonedTime } from '@app/utils/format-zoned-time';\nimport { getZonedTime } from '@app/utils/get-zoned-time';\nimport { IonDatetime, IonPopover } from '@ionic/angular';\nimport {\n parse,\n addHours,\n setMinutes,\n setSeconds,\n setMilliseconds\n} from 'date-fns';\nimport { toDate, format } from 'date-fns-tz';\nimport { getFormattedZonedTime } from '@app/utils/get-formatted-zoned-time';\n\nfunction getClosestTime(time: Date, sortedMinuteValues: number[]): Date {\n const baseTime = setMilliseconds(setSeconds(setMinutes(time, 0), 0), 0);\n let compareDates = sortedMinuteValues.map((minutes) =>\n setMinutes(baseTime, minutes)\n );\n compareDates.push(addHours(baseTime, 1));\n compareDates = compareDates.filter((d) => d.getTime() >= time.getTime());\n return compareDates[0];\n}\n\n@Component({\n selector: 'app-time-form-control',\n templateUrl: './time-form-control.component.html',\n styleUrls: ['./time-form-control.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n multi: true,\n useExisting: TimeFormControlComponent\n }\n ],\n standalone: false\n})\nexport class TimeFormControlComponent implements ControlValueAccessor {\n @Input()\n public readonly minuteStep? = 15;\n\n @Input()\n public readonly label: string;\n\n @Input()\n public readonly isItem?: boolean = false;\n\n @Input()\n public readonly itemLines?: boolean = false;\n\n @ViewChild('popover')\n protected popover: IonPopover;\n\n @ViewChild('datetime')\n protected datetime: IonDatetime;\n\n protected isOpen = false;\n protected value: string | null;\n\n // eslint-disable-next-line @typescript-eslint/no-empty-function, @typescript-eslint/no-unused-vars\n private _onChange = (value: string) => {};\n\n // eslint-disable-next-line @typescript-eslint/no-empty-function\n private _onTouched = () => {};\n\n private _touched = false;\n\n protected disabled = false;\n\n public constructor(private _cdr: ChangeDetectorRef) {}\n\n protected get minuteValues() {\n return new Array(60 / this.minuteStep)\n .fill(0)\n .map((_, index) => index * this.minuteStep);\n }\n\n public writeValue(value: string) {\n this.value = value;\n this._cdr.markForCheck();\n }\n\n public registerOnChange(onChange: (v: string) => void) {\n this._onChange = onChange;\n }\n\n public registerOnTouched(onTouched: () => void) {\n this._onTouched = onTouched;\n }\n\n public markAsTouched() {\n if (!this._touched) {\n this._onTouched();\n this._touched = true;\n }\n }\n\n public setDisabledState(disabled: boolean) {\n this.disabled = disabled;\n }\n\n protected onTriggerClick(e: Event) {\n this.popover.event = e;\n const parsedTime =\n this.value !== null\n ? parse(this.value, 'HH:mm', new Date())\n : getClosestTime(getZonedTime(new Date()), this.minuteValues);\n this.datetime.reset(formatZonedTime(parsedTime));\n this.isOpen = true;\n }\n\n protected onPopovedDismiss(): void {\n this.isOpen = false;\n }\n\n protected onCalendarDoneClick(): void {\n this.datetime.confirm().then(() => {\n const zonedTime =\n (this.datetime.value as string) ?? getFormattedZonedTime(new Date());\n const date = toDate(zonedTime);\n const time = format(date, 'HH:mm');\n this._touched = true;\n this.value = time;\n this._onChange(time);\n this._onTouched();\n });\n this.isOpen = false;\n }\n}\n","import toInteger from \"../_lib/toInteger/index.js\";\nimport addMilliseconds from \"../addMilliseconds/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nvar MILLISECONDS_IN_HOUR = 3600000;\n\n/**\n * @name addHours\n * @category Hour Helpers\n * @summary Add the specified number of hours to the given date.\n *\n * @description\n * Add the specified number of hours to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of hours to be added. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the hours added\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Add 2 hours to 10 July 2014 23:00:00:\n * const result = addHours(new Date(2014, 6, 10, 23, 0), 2)\n * //=> Fri Jul 11 2014 01:00:00\n */\nexport default function addHours(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var amount = toInteger(dirtyAmount);\n return addMilliseconds(dirtyDate, amount * MILLISECONDS_IN_HOUR);\n}","import { utcToZonedTime } from 'date-fns-tz';\nimport { formatZonedTime } from './format-zoned-time';\nimport { getClientTimeZone } from './get-client-time-zone';\n\nexport function getFormattedZonedTime(date: Date): string {\n // Get the time zone set on the user's device\n const userTimeZone = getClientTimeZone();\n\n // Use date-fns-tz to convert from UTC to a zoned time\n const zonedTime = utcToZonedTime(date, userTimeZone);\n\n // Create a formatted string from the zoned time\n return formatZonedTime(zonedTime, userTimeZone);\n}\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * The default equality function used for `signal` and `computed`, which uses referential equality.\n */\nfunction defaultEquals(a, b) {\n return Object.is(a, b);\n}\n\n/**\n * The currently active consumer `ReactiveNode`, if running code in a reactive context.\n *\n * Change this via `setActiveConsumer`.\n */\nlet activeConsumer = null;\nlet inNotificationPhase = false;\n/**\n * Global epoch counter. Incremented whenever a source signal is set.\n */\nlet epoch = 1;\n/**\n * Symbol used to tell `Signal`s apart from other functions.\n *\n * This can be used to auto-unwrap signals in various cases, or to auto-wrap non-signal values.\n */\nconst SIGNAL = /* @__PURE__ */ Symbol('SIGNAL');\nfunction setActiveConsumer(consumer) {\n const prev = activeConsumer;\n activeConsumer = consumer;\n return prev;\n}\nfunction getActiveConsumer() {\n return activeConsumer;\n}\nfunction isInNotificationPhase() {\n return inNotificationPhase;\n}\nfunction isReactive(value) {\n return value[SIGNAL] !== undefined;\n}\nconst REACTIVE_NODE = {\n version: 0,\n lastCleanEpoch: 0,\n dirty: false,\n producerNode: undefined,\n producerLastReadVersion: undefined,\n producerIndexOfThis: undefined,\n nextProducerIndex: 0,\n liveConsumerNode: undefined,\n liveConsumerIndexOfThis: undefined,\n consumerAllowSignalWrites: false,\n consumerIsAlwaysLive: false,\n kind: 'unknown',\n producerMustRecompute: () => false,\n producerRecomputeValue: () => { },\n consumerMarkedDirty: () => { },\n consumerOnSignalRead: () => { },\n};\n/**\n * Called by implementations when a producer's signal is read.\n */\nfunction producerAccessed(node) {\n if (inNotificationPhase) {\n throw new Error(typeof ngDevMode !== 'undefined' && ngDevMode\n ? `Assertion error: signal read during notification phase`\n : '');\n }\n if (activeConsumer === null) {\n // Accessed outside of a reactive context, so nothing to record.\n return;\n }\n activeConsumer.consumerOnSignalRead(node);\n // This producer is the `idx`th dependency of `activeConsumer`.\n const idx = activeConsumer.nextProducerIndex++;\n assertConsumerNode(activeConsumer);\n if (idx < activeConsumer.producerNode.length && activeConsumer.producerNode[idx] !== node) {\n // There's been a change in producers since the last execution of `activeConsumer`.\n // `activeConsumer.producerNode[idx]` holds a stale dependency which will be be removed and\n // replaced with `this`.\n //\n // If `activeConsumer` isn't live, then this is a no-op, since we can replace the producer in\n // `activeConsumer.producerNode` directly. However, if `activeConsumer` is live, then we need\n // to remove it from the stale producer's `liveConsumer`s.\n if (consumerIsLive(activeConsumer)) {\n const staleProducer = activeConsumer.producerNode[idx];\n producerRemoveLiveConsumerAtIndex(staleProducer, activeConsumer.producerIndexOfThis[idx]);\n // At this point, the only record of `staleProducer` is the reference at\n // `activeConsumer.producerNode[idx]` which will be overwritten below.\n }\n }\n if (activeConsumer.producerNode[idx] !== node) {\n // We're a new dependency of the consumer (at `idx`).\n activeConsumer.producerNode[idx] = node;\n // If the active consumer is live, then add it as a live consumer. If not, then use 0 as a\n // placeholder value.\n activeConsumer.producerIndexOfThis[idx] = consumerIsLive(activeConsumer)\n ? producerAddLiveConsumer(node, activeConsumer, idx)\n : 0;\n }\n activeConsumer.producerLastReadVersion[idx] = node.version;\n}\n/**\n * Increment the global epoch counter.\n *\n * Called by source producers (that is, not computeds) whenever their values change.\n */\nfunction producerIncrementEpoch() {\n epoch++;\n}\n/**\n * Ensure this producer's `version` is up-to-date.\n */\nfunction producerUpdateValueVersion(node) {\n if (consumerIsLive(node) && !node.dirty) {\n // A live consumer will be marked dirty by producers, so a clean state means that its version\n // is guaranteed to be up-to-date.\n return;\n }\n if (!node.dirty && node.lastCleanEpoch === epoch) {\n // Even non-live consumers can skip polling if they previously found themselves to be clean at\n // the current epoch, since their dependencies could not possibly have changed (such a change\n // would've increased the epoch).\n return;\n }\n if (!node.producerMustRecompute(node) && !consumerPollProducersForChange(node)) {\n // None of our producers report a change since the last time they were read, so no\n // recomputation of our value is necessary, and we can consider ourselves clean.\n producerMarkClean(node);\n return;\n }\n node.producerRecomputeValue(node);\n // After recomputing the value, we're no longer dirty.\n producerMarkClean(node);\n}\n/**\n * Propagate a dirty notification to live consumers of this producer.\n */\nfunction producerNotifyConsumers(node) {\n if (node.liveConsumerNode === undefined) {\n return;\n }\n // Prevent signal reads when we're updating the graph\n const prev = inNotificationPhase;\n inNotificationPhase = true;\n try {\n for (const consumer of node.liveConsumerNode) {\n if (!consumer.dirty) {\n consumerMarkDirty(consumer);\n }\n }\n }\n finally {\n inNotificationPhase = prev;\n }\n}\n/**\n * Whether this `ReactiveNode` in its producer capacity is currently allowed to initiate updates,\n * based on the current consumer context.\n */\nfunction producerUpdatesAllowed() {\n return activeConsumer?.consumerAllowSignalWrites !== false;\n}\nfunction consumerMarkDirty(node) {\n node.dirty = true;\n producerNotifyConsumers(node);\n node.consumerMarkedDirty?.(node);\n}\nfunction producerMarkClean(node) {\n node.dirty = false;\n node.lastCleanEpoch = epoch;\n}\n/**\n * Prepare this consumer to run a computation in its reactive context.\n *\n * Must be called by subclasses which represent reactive computations, before those computations\n * begin.\n */\nfunction consumerBeforeComputation(node) {\n node && (node.nextProducerIndex = 0);\n return setActiveConsumer(node);\n}\n/**\n * Finalize this consumer's state after a reactive computation has run.\n *\n * Must be called by subclasses which represent reactive computations, after those computations\n * have finished.\n */\nfunction consumerAfterComputation(node, prevConsumer) {\n setActiveConsumer(prevConsumer);\n if (!node ||\n node.producerNode === undefined ||\n node.producerIndexOfThis === undefined ||\n node.producerLastReadVersion === undefined) {\n return;\n }\n if (consumerIsLive(node)) {\n // For live consumers, we need to remove the producer -> consumer edge for any stale producers\n // which weren't dependencies after the recomputation.\n for (let i = node.nextProducerIndex; i < node.producerNode.length; i++) {\n producerRemoveLiveConsumerAtIndex(node.producerNode[i], node.producerIndexOfThis[i]);\n }\n }\n // Truncate the producer tracking arrays.\n // Perf note: this is essentially truncating the length to `node.nextProducerIndex`, but\n // benchmarking has shown that individual pop operations are faster.\n while (node.producerNode.length > node.nextProducerIndex) {\n node.producerNode.pop();\n node.producerLastReadVersion.pop();\n node.producerIndexOfThis.pop();\n }\n}\n/**\n * Determine whether this consumer has any dependencies which have changed since the last time\n * they were read.\n */\nfunction consumerPollProducersForChange(node) {\n assertConsumerNode(node);\n // Poll producers for change.\n for (let i = 0; i < node.producerNode.length; i++) {\n const producer = node.producerNode[i];\n const seenVersion = node.producerLastReadVersion[i];\n // First check the versions. A mismatch means that the producer's value is known to have\n // changed since the last time we read it.\n if (seenVersion !== producer.version) {\n return true;\n }\n // The producer's version is the same as the last time we read it, but it might itself be\n // stale. Force the producer to recompute its version (calculating a new value if necessary).\n producerUpdateValueVersion(producer);\n // Now when we do this check, `producer.version` is guaranteed to be up to date, so if the\n // versions still match then it has not changed since the last time we read it.\n if (seenVersion !== producer.version) {\n return true;\n }\n }\n return false;\n}\n/**\n * Disconnect this consumer from the graph.\n */\nfunction consumerDestroy(node) {\n assertConsumerNode(node);\n if (consumerIsLive(node)) {\n // Drop all connections from the graph to this node.\n for (let i = 0; i < node.producerNode.length; i++) {\n producerRemoveLiveConsumerAtIndex(node.producerNode[i], node.producerIndexOfThis[i]);\n }\n }\n // Truncate all the arrays to drop all connection from this node to the graph.\n node.producerNode.length =\n node.producerLastReadVersion.length =\n node.producerIndexOfThis.length =\n 0;\n if (node.liveConsumerNode) {\n node.liveConsumerNode.length = node.liveConsumerIndexOfThis.length = 0;\n }\n}\n/**\n * Add `consumer` as a live consumer of this node.\n *\n * Note that this operation is potentially transitive. If this node becomes live, then it becomes\n * a live consumer of all of its current producers.\n */\nfunction producerAddLiveConsumer(node, consumer, indexOfThis) {\n assertProducerNode(node);\n if (node.liveConsumerNode.length === 0 && isConsumerNode(node)) {\n // When going from 0 to 1 live consumers, we become a live consumer to our producers.\n for (let i = 0; i < node.producerNode.length; i++) {\n node.producerIndexOfThis[i] = producerAddLiveConsumer(node.producerNode[i], node, i);\n }\n }\n node.liveConsumerIndexOfThis.push(indexOfThis);\n return node.liveConsumerNode.push(consumer) - 1;\n}\n/**\n * Remove the live consumer at `idx`.\n */\nfunction producerRemoveLiveConsumerAtIndex(node, idx) {\n assertProducerNode(node);\n if (typeof ngDevMode !== 'undefined' && ngDevMode && idx >= node.liveConsumerNode.length) {\n throw new Error(`Assertion error: active consumer index ${idx} is out of bounds of ${node.liveConsumerNode.length} consumers)`);\n }\n if (node.liveConsumerNode.length === 1 && isConsumerNode(node)) {\n // When removing the last live consumer, we will no longer be live. We need to remove\n // ourselves from our producers' tracking (which may cause consumer-producers to lose\n // liveness as well).\n for (let i = 0; i < node.producerNode.length; i++) {\n producerRemoveLiveConsumerAtIndex(node.producerNode[i], node.producerIndexOfThis[i]);\n }\n }\n // Move the last value of `liveConsumers` into `idx`. Note that if there's only a single\n // live consumer, this is a no-op.\n const lastIdx = node.liveConsumerNode.length - 1;\n node.liveConsumerNode[idx] = node.liveConsumerNode[lastIdx];\n node.liveConsumerIndexOfThis[idx] = node.liveConsumerIndexOfThis[lastIdx];\n // Truncate the array.\n node.liveConsumerNode.length--;\n node.liveConsumerIndexOfThis.length--;\n // If the index is still valid, then we need to fix the index pointer from the producer to this\n // consumer, and update it from `lastIdx` to `idx` (accounting for the move above).\n if (idx < node.liveConsumerNode.length) {\n const idxProducer = node.liveConsumerIndexOfThis[idx];\n const consumer = node.liveConsumerNode[idx];\n assertConsumerNode(consumer);\n consumer.producerIndexOfThis[idxProducer] = idx;\n }\n}\nfunction consumerIsLive(node) {\n return node.consumerIsAlwaysLive || (node?.liveConsumerNode?.length ?? 0) > 0;\n}\nfunction assertConsumerNode(node) {\n node.producerNode ??= [];\n node.producerIndexOfThis ??= [];\n node.producerLastReadVersion ??= [];\n}\nfunction assertProducerNode(node) {\n node.liveConsumerNode ??= [];\n node.liveConsumerIndexOfThis ??= [];\n}\nfunction isConsumerNode(node) {\n return node.producerNode !== undefined;\n}\n\n/**\n * Create a computed signal which derives a reactive value from an expression.\n */\nfunction createComputed(computation) {\n const node = Object.create(COMPUTED_NODE);\n node.computation = computation;\n const computed = () => {\n // Check if the value needs updating before returning it.\n producerUpdateValueVersion(node);\n // Record that someone looked at this signal.\n producerAccessed(node);\n if (node.value === ERRORED) {\n throw node.error;\n }\n return node.value;\n };\n computed[SIGNAL] = node;\n return computed;\n}\n/**\n * A dedicated symbol used before a computed value has been calculated for the first time.\n * Explicitly typed as `any` so we can use it as signal's value.\n */\nconst UNSET = /* @__PURE__ */ Symbol('UNSET');\n/**\n * A dedicated symbol used in place of a computed signal value to indicate that a given computation\n * is in progress. Used to detect cycles in computation chains.\n * Explicitly typed as `any` so we can use it as signal's value.\n */\nconst COMPUTING = /* @__PURE__ */ Symbol('COMPUTING');\n/**\n * A dedicated symbol used in place of a computed signal value to indicate that a given computation\n * failed. The thrown error is cached until the computation gets dirty again.\n * Explicitly typed as `any` so we can use it as signal's value.\n */\nconst ERRORED = /* @__PURE__ */ Symbol('ERRORED');\n// Note: Using an IIFE here to ensure that the spread assignment is not considered\n// a side-effect, ending up preserving `COMPUTED_NODE` and `REACTIVE_NODE`.\n// TODO: remove when https://github.com/evanw/esbuild/issues/3392 is resolved.\nconst COMPUTED_NODE = /* @__PURE__ */ (() => {\n return {\n ...REACTIVE_NODE,\n value: UNSET,\n dirty: true,\n error: null,\n equal: defaultEquals,\n kind: 'computed',\n producerMustRecompute(node) {\n // Force a recomputation if there's no current value, or if the current value is in the\n // process of being calculated (which should throw an error).\n return node.value === UNSET || node.value === COMPUTING;\n },\n producerRecomputeValue(node) {\n if (node.value === COMPUTING) {\n // Our computation somehow led to a cyclic read of itself.\n throw new Error('Detected cycle in computations.');\n }\n const oldValue = node.value;\n node.value = COMPUTING;\n const prevConsumer = consumerBeforeComputation(node);\n let newValue;\n let wasEqual = false;\n try {\n newValue = node.computation();\n // We want to mark this node as errored if calling `equal` throws; however, we don't want\n // to track any reactive reads inside `equal`.\n setActiveConsumer(null);\n wasEqual =\n oldValue !== UNSET &&\n oldValue !== ERRORED &&\n newValue !== ERRORED &&\n node.equal(oldValue, newValue);\n }\n catch (err) {\n newValue = ERRORED;\n node.error = err;\n }\n finally {\n consumerAfterComputation(node, prevConsumer);\n }\n if (wasEqual) {\n // No change to `valueVersion` - old and new values are\n // semantically equivalent.\n node.value = oldValue;\n return;\n }\n node.value = newValue;\n node.version++;\n },\n };\n})();\n\nfunction defaultThrowError() {\n throw new Error();\n}\nlet throwInvalidWriteToSignalErrorFn = defaultThrowError;\nfunction throwInvalidWriteToSignalError(node) {\n throwInvalidWriteToSignalErrorFn(node);\n}\nfunction setThrowInvalidWriteToSignalError(fn) {\n throwInvalidWriteToSignalErrorFn = fn;\n}\n\n/**\n * If set, called after `WritableSignal`s are updated.\n *\n * This hook can be used to achieve various effects, such as running effects synchronously as part\n * of setting a signal.\n */\nlet postSignalSetFn = null;\n/**\n * Create a `Signal` that can be set or updated directly.\n */\nfunction createSignal(initialValue) {\n const node = Object.create(SIGNAL_NODE);\n node.value = initialValue;\n const getter = (() => {\n producerAccessed(node);\n return node.value;\n });\n getter[SIGNAL] = node;\n return getter;\n}\nfunction setPostSignalSetFn(fn) {\n const prev = postSignalSetFn;\n postSignalSetFn = fn;\n return prev;\n}\nfunction signalGetFn() {\n producerAccessed(this);\n return this.value;\n}\nfunction signalSetFn(node, newValue) {\n if (!producerUpdatesAllowed()) {\n throwInvalidWriteToSignalError(node);\n }\n if (!node.equal(node.value, newValue)) {\n node.value = newValue;\n signalValueChanged(node);\n }\n}\nfunction signalUpdateFn(node, updater) {\n if (!producerUpdatesAllowed()) {\n throwInvalidWriteToSignalError(node);\n }\n signalSetFn(node, updater(node.value));\n}\nfunction runPostSignalSetFn() {\n postSignalSetFn?.();\n}\n// Note: Using an IIFE here to ensure that the spread assignment is not considered\n// a side-effect, ending up preserving `COMPUTED_NODE` and `REACTIVE_NODE`.\n// TODO: remove when https://github.com/evanw/esbuild/issues/3392 is resolved.\nconst SIGNAL_NODE = /* @__PURE__ */ (() => {\n return {\n ...REACTIVE_NODE,\n equal: defaultEquals,\n value: undefined,\n kind: 'signal',\n };\n})();\nfunction signalValueChanged(node) {\n node.version++;\n producerIncrementEpoch();\n producerNotifyConsumers(node);\n postSignalSetFn?.();\n}\n\nfunction createLinkedSignal(sourceFn, computationFn, equalityFn) {\n const node = Object.create(LINKED_SIGNAL_NODE);\n node.source = sourceFn;\n node.computation = computationFn;\n if (equalityFn != undefined) {\n node.equal = equalityFn;\n }\n const linkedSignalGetter = () => {\n // Check if the value needs updating before returning it.\n producerUpdateValueVersion(node);\n // Record that someone looked at this signal.\n producerAccessed(node);\n if (node.value === ERRORED) {\n throw node.error;\n }\n return node.value;\n };\n const getter = linkedSignalGetter;\n getter[SIGNAL] = node;\n return getter;\n}\nfunction linkedSignalSetFn(node, newValue) {\n producerUpdateValueVersion(node);\n signalSetFn(node, newValue);\n producerMarkClean(node);\n}\nfunction linkedSignalUpdateFn(node, updater) {\n producerUpdateValueVersion(node);\n signalUpdateFn(node, updater);\n producerMarkClean(node);\n}\n// Note: Using an IIFE here to ensure that the spread assignment is not considered\n// a side-effect, ending up preserving `LINKED_SIGNAL_NODE` and `REACTIVE_NODE`.\n// TODO: remove when https://github.com/evanw/esbuild/issues/3392 is resolved.\nconst LINKED_SIGNAL_NODE = /* @__PURE__ */ (() => {\n return {\n ...REACTIVE_NODE,\n value: UNSET,\n dirty: true,\n error: null,\n equal: defaultEquals,\n producerMustRecompute(node) {\n // Force a recomputation if there's no current value, or if the current value is in the\n // process of being calculated (which should throw an error).\n return node.value === UNSET || node.value === COMPUTING;\n },\n producerRecomputeValue(node) {\n if (node.value === COMPUTING) {\n // Our computation somehow led to a cyclic read of itself.\n throw new Error('Detected cycle in computations.');\n }\n const oldValue = node.value;\n node.value = COMPUTING;\n const prevConsumer = consumerBeforeComputation(node);\n let newValue;\n try {\n const newSourceValue = node.source();\n const prev = oldValue === UNSET || oldValue === ERRORED\n ? undefined\n : {\n source: node.sourceValue,\n value: oldValue,\n };\n newValue = node.computation(newSourceValue, prev);\n node.sourceValue = newSourceValue;\n }\n catch (err) {\n newValue = ERRORED;\n node.error = err;\n }\n finally {\n consumerAfterComputation(node, prevConsumer);\n }\n if (oldValue !== UNSET && newValue !== ERRORED && node.equal(oldValue, newValue)) {\n // No change to `valueVersion` - old and new values are\n // semantically equivalent.\n node.value = oldValue;\n return;\n }\n node.value = newValue;\n node.version++;\n },\n };\n})();\n\nfunction createWatch(fn, schedule, allowSignalWrites) {\n const node = Object.create(WATCH_NODE);\n if (allowSignalWrites) {\n node.consumerAllowSignalWrites = true;\n }\n node.fn = fn;\n node.schedule = schedule;\n const registerOnCleanup = (cleanupFn) => {\n node.cleanupFn = cleanupFn;\n };\n function isWatchNodeDestroyed(node) {\n return node.fn === null && node.schedule === null;\n }\n function destroyWatchNode(node) {\n if (!isWatchNodeDestroyed(node)) {\n consumerDestroy(node); // disconnect watcher from the reactive graph\n node.cleanupFn();\n // nullify references to the integration functions to mark node as destroyed\n node.fn = null;\n node.schedule = null;\n node.cleanupFn = NOOP_CLEANUP_FN;\n }\n }\n const run = () => {\n if (node.fn === null) {\n // trying to run a destroyed watch is noop\n return;\n }\n if (isInNotificationPhase()) {\n throw new Error(`Schedulers cannot synchronously execute watches while scheduling.`);\n }\n node.dirty = false;\n if (node.hasRun && !consumerPollProducersForChange(node)) {\n return;\n }\n node.hasRun = true;\n const prevConsumer = consumerBeforeComputation(node);\n try {\n node.cleanupFn();\n node.cleanupFn = NOOP_CLEANUP_FN;\n node.fn(registerOnCleanup);\n }\n finally {\n consumerAfterComputation(node, prevConsumer);\n }\n };\n node.ref = {\n notify: () => consumerMarkDirty(node),\n run,\n cleanup: () => node.cleanupFn(),\n destroy: () => destroyWatchNode(node),\n [SIGNAL]: node,\n };\n return node.ref;\n}\nconst NOOP_CLEANUP_FN = () => { };\n// Note: Using an IIFE here to ensure that the spread assignment is not considered\n// a side-effect, ending up preserving `COMPUTED_NODE` and `REACTIVE_NODE`.\n// TODO: remove when https://github.com/evanw/esbuild/issues/3392 is resolved.\nconst WATCH_NODE = /* @__PURE__ */ (() => {\n return {\n ...REACTIVE_NODE,\n consumerIsAlwaysLive: true,\n consumerAllowSignalWrites: false,\n consumerMarkedDirty: (node) => {\n if (node.schedule !== null) {\n node.schedule(node.ref);\n }\n },\n hasRun: false,\n cleanupFn: NOOP_CLEANUP_FN,\n };\n})();\n\nfunction setAlternateWeakRefImpl(impl) {\n // TODO: remove this function\n}\n\nexport { REACTIVE_NODE, SIGNAL, SIGNAL_NODE, consumerAfterComputation, consumerBeforeComputation, consumerDestroy, consumerMarkDirty, consumerPollProducersForChange, createComputed, createLinkedSignal, createSignal, createWatch, defaultEquals, getActiveConsumer, isInNotificationPhase, isReactive, linkedSignalSetFn, linkedSignalUpdateFn, producerAccessed, producerIncrementEpoch, producerMarkClean, producerNotifyConsumers, producerUpdateValueVersion, producerUpdatesAllowed, runPostSignalSetFn, setActiveConsumer, setAlternateWeakRefImpl, setPostSignalSetFn, setThrowInvalidWriteToSignalError, signalSetFn, signalUpdateFn };\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * Current injector value used by `inject`.\n * - `undefined`: it is an error to call `inject`\n * - `null`: `inject` can be called but there is no injector (limp-mode).\n * - Injector instance: Use the injector for resolution.\n */\nlet _currentInjector = undefined;\nfunction getCurrentInjector() {\n return _currentInjector;\n}\nfunction setCurrentInjector(injector) {\n const former = _currentInjector;\n _currentInjector = injector;\n return former;\n}\n\n/**\n * Value returned if the key-value pair couldn't be found in the context\n * hierarchy.\n */\nconst NOT_FOUND = Symbol('NotFound');\n/**\n * Error thrown when the key-value pair couldn't be found in the context\n * hierarchy. Context can be attached below.\n */\nclass NotFoundError extends Error {\n constructor(message) {\n super(message);\n }\n}\n/**\n * Type guard for checking if an unknown value is a NotFound.\n */\nfunction isNotFound(e) {\n return e === NOT_FOUND || e instanceof NotFoundError;\n}\n\nexport { NOT_FOUND, NotFoundError, getCurrentInjector, isNotFound, setCurrentInjector };\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { SIGNAL_NODE as SIGNAL_NODE$1, signalSetFn as signalSetFn$1, producerAccessed as producerAccessed$1, SIGNAL as SIGNAL$1, getActiveConsumer as getActiveConsumer$1, setActiveConsumer as setActiveConsumer$1, createSignal as createSignal$1, signalUpdateFn as signalUpdateFn$1, consumerDestroy as consumerDestroy$1, REACTIVE_NODE as REACTIVE_NODE$1, consumerBeforeComputation as consumerBeforeComputation$1, consumerAfterComputation as consumerAfterComputation$1, consumerPollProducersForChange as consumerPollProducersForChange$1, createComputed as createComputed$1, setThrowInvalidWriteToSignalError as setThrowInvalidWriteToSignalError$1, createWatch as createWatch$1, isInNotificationPhase as isInNotificationPhase$1, createLinkedSignal as createLinkedSignal$1, linkedSignalSetFn as linkedSignalSetFn$1, linkedSignalUpdateFn as linkedSignalUpdateFn$1 } from '@angular/core/primitives/signals';\nexport { SIGNAL as ɵSIGNAL } from '@angular/core/primitives/signals';\nimport * as di from '@angular/core/primitives/di';\nimport { BehaviorSubject, Subject, Subscription } from 'rxjs';\nimport { Attribute as Attribute$1, clearAppScopedEarlyEventContract, EventContract, EventContractContainer, getAppScopedQueuedEventInfos, EventDispatcher, registerDispatcher, isEarlyEventType, isCaptureEventType, EventPhase } from '@angular/core/primitives/event-dispatch';\nimport { map } from 'rxjs/operators';\n\n/**\n * Base URL for the error details page.\n *\n * Keep this constant in sync across:\n * - packages/compiler-cli/src/ngtsc/diagnostics/src/error_details_base_url.ts\n * - packages/core/src/error_details_base_url.ts\n */\nconst ERROR_DETAILS_PAGE_BASE_URL = 'https://angular.dev/errors';\n/**\n * URL for the XSS security documentation.\n */\nconst XSS_SECURITY_URL = 'https://g.co/ng/security#xss';\n\n/**\n * Class that represents a runtime error.\n * Formats and outputs the error message in a consistent way.\n *\n * Example:\n * ```ts\n * throw new RuntimeError(\n * RuntimeErrorCode.INJECTOR_ALREADY_DESTROYED,\n * ngDevMode && 'Injector has already been destroyed.');\n * ```\n *\n * Note: the `message` argument contains a descriptive error message as a string in development\n * mode (when the `ngDevMode` is defined). In production mode (after tree-shaking pass), the\n * `message` argument becomes `false`, thus we account for it in the typings and the runtime\n * logic.\n */\nclass RuntimeError extends Error {\n code;\n constructor(code, message) {\n super(formatRuntimeError(code, message));\n this.code = code;\n }\n}\n/**\n * Called to format a runtime error.\n * See additional info on the `message` argument type in the `RuntimeError` class description.\n */\nfunction formatRuntimeError(code, message) {\n // Error code might be a negative number, which is a special marker that instructs the logic to\n // generate a link to the error details page on angular.io.\n // We also prepend `0` to non-compile-time errors.\n const fullCode = `NG0${Math.abs(code)}`;\n let errorMessage = `${fullCode}${message ? ': ' + message : ''}`;\n if (ngDevMode && code < 0) {\n const addPeriodSeparator = !errorMessage.match(/[.,;!?\\n]$/);\n const separator = addPeriodSeparator ? '.' : '';\n errorMessage = `${errorMessage}${separator} Find more at ${ERROR_DETAILS_PAGE_BASE_URL}/${fullCode}`;\n }\n return errorMessage;\n}\n\nconst REQUIRED_UNSET_VALUE = /* @__PURE__ */ Symbol('InputSignalNode#UNSET');\n// Note: Using an IIFE here to ensure that the spread assignment is not considered\n// a side-effect, ending up preserving `COMPUTED_NODE` and `REACTIVE_NODE`.\n// TODO: remove when https://github.com/evanw/esbuild/issues/3392 is resolved.\nconst INPUT_SIGNAL_NODE = /* @__PURE__ */ (() => {\n return {\n ...SIGNAL_NODE$1,\n transformFn: undefined,\n applyValueToInputSignal(node, value) {\n signalSetFn$1(node, value);\n },\n };\n})();\n\nconst ɵINPUT_SIGNAL_BRAND_READ_TYPE = /* @__PURE__ */ Symbol();\nconst ɵINPUT_SIGNAL_BRAND_WRITE_TYPE = /* @__PURE__ */ Symbol();\n/**\n * Creates an input signal.\n *\n * @param initialValue The initial value.\n * Can be set to {@link REQUIRED_UNSET_VALUE} for required inputs.\n * @param options Additional options for the input. e.g. a transform, or an alias.\n */\nfunction createInputSignal(initialValue, options) {\n const node = Object.create(INPUT_SIGNAL_NODE);\n node.value = initialValue;\n // Perf note: Always set `transformFn` here to ensure that `node` always\n // has the same v8 class shape, allowing monomorphic reads on input signals.\n node.transformFn = options?.transform;\n function inputValueFn() {\n // Record that someone looked at this signal.\n producerAccessed$1(node);\n if (node.value === REQUIRED_UNSET_VALUE) {\n throw new RuntimeError(-950 /* RuntimeErrorCode.REQUIRED_INPUT_NO_VALUE */, ngDevMode && 'Input is required but no value is available yet.');\n }\n return node.value;\n }\n inputValueFn[SIGNAL$1] = node;\n if (ngDevMode) {\n inputValueFn.toString = () => `[Input Signal: ${inputValueFn()}]`;\n node.debugName = options?.debugName;\n }\n return inputValueFn;\n}\n\n/**\n * Convince closure compiler that the wrapped function has no side-effects.\n *\n * Closure compiler always assumes that `toString` has no side-effects. We use this quirk to\n * allow us to execute a function but have closure compiler mark the call as no-side-effects.\n * It is important that the return value for the `noSideEffects` function be assigned\n * to something which is retained otherwise the call to `noSideEffects` will be removed by closure\n * compiler.\n */\nfunction noSideEffects(fn) {\n return { toString: fn }.toString();\n}\n\nconst ANNOTATIONS = '__annotations__';\nconst PARAMETERS = '__parameters__';\nconst PROP_METADATA = '__prop__metadata__';\n/**\n * @suppress {globalThis}\n */\nfunction makeDecorator(name, props, parentClass, additionalProcessing, typeFn) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function DecoratorFactory(...args) {\n if (this instanceof DecoratorFactory) {\n metaCtor.call(this, ...args);\n return this;\n }\n const annotationInstance = new DecoratorFactory(...args);\n return function TypeDecorator(cls) {\n if (typeFn)\n typeFn(cls, ...args);\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const annotations = cls.hasOwnProperty(ANNOTATIONS)\n ? cls[ANNOTATIONS]\n : Object.defineProperty(cls, ANNOTATIONS, { value: [] })[ANNOTATIONS];\n annotations.push(annotationInstance);\n if (additionalProcessing)\n additionalProcessing(cls);\n return cls;\n };\n }\n if (parentClass) {\n DecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n DecoratorFactory.prototype.ngMetadataName = name;\n DecoratorFactory.annotationCls = DecoratorFactory;\n return DecoratorFactory;\n });\n}\nfunction makeMetadataCtor(props) {\n return function ctor(...args) {\n if (props) {\n const values = props(...args);\n for (const propName in values) {\n this[propName] = values[propName];\n }\n }\n };\n}\nfunction makeParamDecorator(name, props, parentClass) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function ParamDecoratorFactory(...args) {\n if (this instanceof ParamDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const annotationInstance = new ParamDecoratorFactory(...args);\n ParamDecorator.annotation = annotationInstance;\n return ParamDecorator;\n function ParamDecorator(cls, unusedKey, index) {\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const parameters = cls.hasOwnProperty(PARAMETERS)\n ? cls[PARAMETERS]\n : Object.defineProperty(cls, PARAMETERS, { value: [] })[PARAMETERS];\n // there might be gaps if some in between parameters do not have annotations.\n // we pad with nulls.\n while (parameters.length <= index) {\n parameters.push(null);\n }\n (parameters[index] = parameters[index] || []).push(annotationInstance);\n return cls;\n }\n }\n if (parentClass) {\n ParamDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n ParamDecoratorFactory.prototype.ngMetadataName = name;\n ParamDecoratorFactory.annotationCls = ParamDecoratorFactory;\n return ParamDecoratorFactory;\n });\n}\nfunction makePropDecorator(name, props, parentClass, additionalProcessing) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function PropDecoratorFactory(...args) {\n if (this instanceof PropDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const decoratorInstance = new PropDecoratorFactory(...args);\n function PropDecorator(target, name) {\n // target is undefined with standard decorators. This case is not supported and will throw\n // if this decorator is used in JIT mode with standard decorators.\n if (target === undefined) {\n throw new Error('Standard Angular field decorators are not supported in JIT mode.');\n }\n const constructor = target.constructor;\n // Use of Object.defineProperty is important because it creates a non-enumerable property\n // which prevents the property from being copied during subclassing.\n const meta = constructor.hasOwnProperty(PROP_METADATA)\n ? constructor[PROP_METADATA]\n : Object.defineProperty(constructor, PROP_METADATA, { value: {} })[PROP_METADATA];\n meta[name] = (meta.hasOwnProperty(name) && meta[name]) || [];\n meta[name].unshift(decoratorInstance);\n if (additionalProcessing)\n additionalProcessing(target, name, ...args);\n }\n return PropDecorator;\n }\n if (parentClass) {\n PropDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n PropDecoratorFactory.prototype.ngMetadataName = name;\n PropDecoratorFactory.annotationCls = PropDecoratorFactory;\n return PropDecoratorFactory;\n });\n}\n\nconst _global = globalThis;\n\nfunction ngDevModeResetPerfCounters() {\n const locationString = typeof location !== 'undefined' ? location.toString() : '';\n const newCounters = {\n namedConstructors: locationString.indexOf('ngDevMode=namedConstructors') != -1,\n firstCreatePass: 0,\n tNode: 0,\n tView: 0,\n rendererCreateTextNode: 0,\n rendererSetText: 0,\n rendererCreateElement: 0,\n rendererAddEventListener: 0,\n rendererSetAttribute: 0,\n rendererRemoveAttribute: 0,\n rendererSetProperty: 0,\n rendererSetClassName: 0,\n rendererAddClass: 0,\n rendererRemoveClass: 0,\n rendererSetStyle: 0,\n rendererRemoveStyle: 0,\n rendererDestroy: 0,\n rendererDestroyNode: 0,\n rendererMoveNode: 0,\n rendererRemoveNode: 0,\n rendererAppendChild: 0,\n rendererInsertBefore: 0,\n rendererCreateComment: 0,\n hydratedNodes: 0,\n hydratedComponents: 0,\n dehydratedViewsRemoved: 0,\n dehydratedViewsCleanupRuns: 0,\n componentsSkippedHydration: 0,\n deferBlocksWithIncrementalHydration: 0,\n };\n // Make sure to refer to ngDevMode as ['ngDevMode'] for closure.\n const allowNgDevModeTrue = locationString.indexOf('ngDevMode=false') === -1;\n if (!allowNgDevModeTrue) {\n _global['ngDevMode'] = false;\n }\n else {\n if (typeof _global['ngDevMode'] !== 'object') {\n _global['ngDevMode'] = {};\n }\n Object.assign(_global['ngDevMode'], newCounters);\n }\n return newCounters;\n}\n/**\n * This function checks to see if the `ngDevMode` has been set. If yes,\n * then we honor it, otherwise we default to dev mode with additional checks.\n *\n * The idea is that unless we are doing production build where we explicitly\n * set `ngDevMode == false` we should be helping the developer by providing\n * as much early warning and errors as possible.\n *\n * `ɵɵdefineComponent` is guaranteed to have been called before any component template functions\n * (and thus Ivy instructions), so a single initialization there is sufficient to ensure ngDevMode\n * is defined for the entire instruction set.\n *\n * When checking `ngDevMode` on toplevel, always init it before referencing it\n * (e.g. `((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode())`), otherwise you can\n * get a `ReferenceError` like in https://github.com/angular/angular/issues/31595.\n *\n * Details on possible values for `ngDevMode` can be found on its docstring.\n *\n * NOTE:\n * - changes to the `ngDevMode` name must be synced with `compiler-cli/src/tooling.ts`.\n */\nfunction initNgDevMode() {\n // The below checks are to ensure that calling `initNgDevMode` multiple times does not\n // reset the counters.\n // If the `ngDevMode` is not an object, then it means we have not created the perf counters\n // yet.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (typeof ngDevMode !== 'object' || Object.keys(ngDevMode).length === 0) {\n ngDevModeResetPerfCounters();\n }\n return typeof ngDevMode !== 'undefined' && !!ngDevMode;\n }\n return false;\n}\n\nfunction getClosureSafeProperty(objWithPropertyToExtract) {\n for (let key in objWithPropertyToExtract) {\n if (objWithPropertyToExtract[key] === getClosureSafeProperty) {\n return key;\n }\n }\n throw Error('Could not find renamed property on target object.');\n}\n/**\n * Sets properties on a target object from a source object, but only if\n * the property doesn't already exist on the target object.\n * @param target The target to set properties on\n * @param source The source of the property keys and values to set\n */\nfunction fillProperties(target, source) {\n for (const key in source) {\n if (source.hasOwnProperty(key) && !target.hasOwnProperty(key)) {\n target[key] = source[key];\n }\n }\n}\n\nfunction stringify(token) {\n if (typeof token === 'string') {\n return token;\n }\n if (Array.isArray(token)) {\n return `[${token.map(stringify).join(', ')}]`;\n }\n if (token == null) {\n return '' + token;\n }\n const name = token.overriddenName || token.name;\n if (name) {\n return `${name}`;\n }\n const result = token.toString();\n if (result == null) {\n return '' + result;\n }\n const newLineIndex = result.indexOf('\\n');\n return newLineIndex >= 0 ? result.slice(0, newLineIndex) : result;\n}\n/**\n * Concatenates two strings with separator, allocating new strings only when necessary.\n *\n * @param before before string.\n * @param separator separator string.\n * @param after after string.\n * @returns concatenated string.\n */\nfunction concatStringsWithSpace(before, after) {\n if (!before)\n return after || '';\n if (!after)\n return before;\n return `${before} ${after}`;\n}\n/**\n * Ellipses the string in the middle when longer than the max length\n *\n * @param string\n * @param maxLength of the output string\n * @returns ellipsed string with ... in the middle\n */\nfunction truncateMiddle(str, maxLength = 100) {\n if (!str || maxLength < 1 || str.length <= maxLength)\n return str;\n if (maxLength == 1)\n return str.substring(0, 1) + '...';\n const halfLimit = Math.round(maxLength / 2);\n return str.substring(0, halfLimit) + '...' + str.substring(str.length - halfLimit);\n}\n\nconst __forward_ref__ = getClosureSafeProperty({ __forward_ref__: getClosureSafeProperty });\n/**\n * Allows to refer to references which are not yet defined.\n *\n * For instance, `forwardRef` is used when the `token` which we need to refer to for the purposes of\n * DI is declared, but not yet defined. It is also used when the `token` which we use when creating\n * a query is not yet defined.\n *\n * `forwardRef` is also used to break circularities in standalone components imports.\n *\n * @usageNotes\n * ### Circular dependency example\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='forward_ref'}\n *\n * ### Circular standalone reference import example\n * ```angular-ts\n * @Component({\n * standalone: true,\n * imports: [ChildComponent],\n * selector: 'app-parent',\n * template: ` `,\n * })\n * export class ParentComponent {\n * @Input() hideParent: boolean;\n * }\n *\n *\n * @Component({\n * standalone: true,\n * imports: [CommonModule, forwardRef(() => ParentComponent)],\n * selector: 'app-child',\n * template: ` `,\n * })\n * export class ChildComponent {\n * @Input() hideParent: boolean;\n * }\n * ```\n *\n * @publicApi\n */\nfunction forwardRef(forwardRefFn) {\n forwardRefFn.__forward_ref__ = forwardRef;\n forwardRefFn.toString = function () {\n return stringify(this());\n };\n return forwardRefFn;\n}\n/**\n * Lazily retrieves the reference value from a forwardRef.\n *\n * Acts as the identity function when given a non-forward-ref value.\n *\n * @usageNotes\n * ### Example\n *\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='resolve_forward_ref'}\n *\n * @see {@link forwardRef}\n * @publicApi\n */\nfunction resolveForwardRef(type) {\n return isForwardRef(type) ? type() : type;\n}\n/** Checks whether a function is wrapped by a `forwardRef`. */\nfunction isForwardRef(fn) {\n return (typeof fn === 'function' &&\n fn.hasOwnProperty(__forward_ref__) &&\n fn.__forward_ref__ === forwardRef);\n}\n\n// The functions in this file verify that the assumptions we are making\nfunction assertNumber(actual, msg) {\n if (!(typeof actual === 'number')) {\n throwError(msg, typeof actual, 'number', '===');\n }\n}\nfunction assertNumberInRange(actual, minInclusive, maxInclusive) {\n assertNumber(actual, 'Expected a number');\n assertLessThanOrEqual(actual, maxInclusive, 'Expected number to be less than or equal to');\n assertGreaterThanOrEqual(actual, minInclusive, 'Expected number to be greater than or equal to');\n}\nfunction assertString(actual, msg) {\n if (!(typeof actual === 'string')) {\n throwError(msg, actual === null ? 'null' : typeof actual, 'string', '===');\n }\n}\nfunction assertFunction(actual, msg) {\n if (!(typeof actual === 'function')) {\n throwError(msg, actual === null ? 'null' : typeof actual, 'function', '===');\n }\n}\nfunction assertEqual(actual, expected, msg) {\n if (!(actual == expected)) {\n throwError(msg, actual, expected, '==');\n }\n}\nfunction assertNotEqual(actual, expected, msg) {\n if (!(actual != expected)) {\n throwError(msg, actual, expected, '!=');\n }\n}\nfunction assertSame(actual, expected, msg) {\n if (!(actual === expected)) {\n throwError(msg, actual, expected, '===');\n }\n}\nfunction assertNotSame(actual, expected, msg) {\n if (!(actual !== expected)) {\n throwError(msg, actual, expected, '!==');\n }\n}\nfunction assertLessThan(actual, expected, msg) {\n if (!(actual < expected)) {\n throwError(msg, actual, expected, '<');\n }\n}\nfunction assertLessThanOrEqual(actual, expected, msg) {\n if (!(actual <= expected)) {\n throwError(msg, actual, expected, '<=');\n }\n}\nfunction assertGreaterThan(actual, expected, msg) {\n if (!(actual > expected)) {\n throwError(msg, actual, expected, '>');\n }\n}\nfunction assertGreaterThanOrEqual(actual, expected, msg) {\n if (!(actual >= expected)) {\n throwError(msg, actual, expected, '>=');\n }\n}\nfunction assertNotDefined(actual, msg) {\n if (actual != null) {\n throwError(msg, actual, null, '==');\n }\n}\nfunction assertDefined(actual, msg) {\n if (actual == null) {\n throwError(msg, actual, null, '!=');\n }\n}\nfunction throwError(msg, actual, expected, comparison) {\n throw new Error(`ASSERTION ERROR: ${msg}` +\n (comparison == null ? '' : ` [Expected=> ${expected} ${comparison} ${actual} <=Actual]`));\n}\nfunction assertDomNode(node) {\n if (!(node instanceof Node)) {\n throwError(`The provided value must be an instance of a DOM Node but got ${stringify(node)}`);\n }\n}\nfunction assertElement(node) {\n if (!(node instanceof Element)) {\n throwError(`The provided value must be an element but got ${stringify(node)}`);\n }\n}\nfunction assertIndexInRange(arr, index) {\n assertDefined(arr, 'Array must be defined.');\n const maxLen = arr.length;\n if (index < 0 || index >= maxLen) {\n throwError(`Index expected to be less than ${maxLen} but got ${index}`);\n }\n}\nfunction assertOneOf(value, ...validValues) {\n if (validValues.indexOf(value) !== -1)\n return true;\n throwError(`Expected value to be one of ${JSON.stringify(validValues)} but was ${JSON.stringify(value)}.`);\n}\nfunction assertNotReactive(fn) {\n if (getActiveConsumer$1() !== null) {\n throwError(`${fn}() should never be called in a reactive context.`);\n }\n}\n\n/**\n * Construct an injectable definition which defines how a token will be constructed by the DI\n * system, and in which injectors (if any) it will be available.\n *\n * This should be assigned to a static `ɵprov` field on a type, which will then be an\n * `InjectableType`.\n *\n * Options:\n * * `providedIn` determines which injectors will include the injectable, by either associating it\n * with an `@NgModule` or other `InjectorType`, or by specifying that this injectable should be\n * provided in the `'root'` injector, which will be the application-level injector in most apps.\n * * `factory` gives the zero argument function which will create an instance of the injectable.\n * The factory can call [`inject`](api/core/inject) to access the `Injector` and request injection\n * of dependencies.\n *\n * @codeGenApi\n * @publicApi This instruction has been emitted by ViewEngine for some time and is deployed to npm.\n */\nfunction ɵɵdefineInjectable(opts) {\n return {\n token: opts.token,\n providedIn: opts.providedIn || null,\n factory: opts.factory,\n value: undefined,\n };\n}\n/**\n * @deprecated in v8, delete after v10. This API should be used only by generated code, and that\n * code should now use ɵɵdefineInjectable instead.\n * @publicApi\n */\nconst defineInjectable = ɵɵdefineInjectable;\n/**\n * Construct an `InjectorDef` which configures an injector.\n *\n * This should be assigned to a static injector def (`ɵinj`) field on a type, which will then be an\n * `InjectorType`.\n *\n * Options:\n *\n * * `providers`: an optional array of providers to add to the injector. Each provider must\n * either have a factory or point to a type which has a `ɵprov` static property (the\n * type must be an `InjectableType`).\n * * `imports`: an optional array of imports of other `InjectorType`s or `InjectorTypeWithModule`s\n * whose providers will also be added to the injector. Locally provided types will override\n * providers from imports.\n *\n * @codeGenApi\n */\nfunction ɵɵdefineInjector(options) {\n return { providers: options.providers || [], imports: options.imports || [] };\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` in a way which is immune to accidentally reading\n * inherited value.\n *\n * @param type A type which may have its own (non-inherited) `ɵprov`.\n */\nfunction getInjectableDef(type) {\n return getOwnDefinition(type, NG_PROV_DEF) || getOwnDefinition(type, NG_INJECTABLE_DEF);\n}\nfunction isInjectable(type) {\n return getInjectableDef(type) !== null;\n}\n/**\n * Return definition only if it is defined directly on `type` and is not inherited from a base\n * class of `type`.\n */\nfunction getOwnDefinition(type, field) {\n return type.hasOwnProperty(field) ? type[field] : null;\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` or read the `ɵprov` from one of its ancestors.\n *\n * @param type A type which may have `ɵprov`, via inheritance.\n *\n * @deprecated Will be removed in a future version of Angular, where an error will occur in the\n * scenario if we find the `ɵprov` on an ancestor only.\n */\nfunction getInheritedInjectableDef(type) {\n const def = type && (type[NG_PROV_DEF] || type[NG_INJECTABLE_DEF]);\n if (def) {\n ngDevMode &&\n console.warn(`DEPRECATED: DI is instantiating a token \"${type.name}\" that inherits its @Injectable decorator but does not provide one itself.\\n` +\n `This will become an error in a future version of Angular. Please add @Injectable() to the \"${type.name}\" class.`);\n return def;\n }\n else {\n return null;\n }\n}\n/**\n * Read the injector def type in a way which is immune to accidentally reading inherited value.\n *\n * @param type type which may have an injector def (`ɵinj`)\n */\nfunction getInjectorDef(type) {\n return type && (type.hasOwnProperty(NG_INJ_DEF) || type.hasOwnProperty(NG_INJECTOR_DEF))\n ? type[NG_INJ_DEF]\n : null;\n}\nconst NG_PROV_DEF = getClosureSafeProperty({ ɵprov: getClosureSafeProperty });\nconst NG_INJ_DEF = getClosureSafeProperty({ ɵinj: getClosureSafeProperty });\n// We need to keep these around so we can read off old defs if new defs are unavailable\nconst NG_INJECTABLE_DEF = getClosureSafeProperty({ ngInjectableDef: getClosureSafeProperty });\nconst NG_INJECTOR_DEF = getClosureSafeProperty({ ngInjectorDef: getClosureSafeProperty });\n\n/**\n * Creates a token that can be used in a DI Provider.\n *\n * Use an `InjectionToken` whenever the type you are injecting is not reified (does not have a\n * runtime representation) such as when injecting an interface, callable type, array or\n * parameterized type.\n *\n * `InjectionToken` is parameterized on `T` which is the type of object which will be returned by\n * the `Injector`. This provides an additional level of type safety.\n *\n * \n *\n * **Important Note**: Ensure that you use the same instance of the `InjectionToken` in both the\n * provider and the injection call. Creating a new instance of `InjectionToken` in different places,\n * even with the same description, will be treated as different tokens by Angular's DI system,\n * leading to a `NullInjectorError`.\n *\n *
\n *\n * {@example injection-token/src/main.ts region='InjectionToken'}\n *\n * When creating an `InjectionToken`, you can optionally specify a factory function which returns\n * (possibly by creating) a default value of the parameterized type `T`. This sets up the\n * `InjectionToken` using this factory as a provider as if it was defined explicitly in the\n * application's root injector. If the factory function, which takes zero arguments, needs to inject\n * dependencies, it can do so using the [`inject`](api/core/inject) function.\n * As you can see in the Tree-shakable InjectionToken example below.\n *\n * Additionally, if a `factory` is specified you can also specify the `providedIn` option, which\n * overrides the above behavior and marks the token as belonging to a particular `@NgModule` (note:\n * this option is now deprecated). As mentioned above, `'root'` is the default value for\n * `providedIn`.\n *\n * The `providedIn: NgModule` and `providedIn: 'any'` options are deprecated.\n *\n * @usageNotes\n * ### Basic Examples\n *\n * ### Plain InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='InjectionToken'}\n *\n * ### Tree-shakable InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='ShakableInjectionToken'}\n *\n * @publicApi\n */\nclass InjectionToken {\n _desc;\n /** @internal */\n ngMetadataName = 'InjectionToken';\n ɵprov;\n /**\n * @param _desc Description for the token,\n * used only for debugging purposes,\n * it should but does not need to be unique\n * @param options Options for the token's usage, as described above\n */\n constructor(_desc, options) {\n this._desc = _desc;\n this.ɵprov = undefined;\n if (typeof options == 'number') {\n (typeof ngDevMode === 'undefined' || ngDevMode) &&\n assertLessThan(options, 0, 'Only negative numbers are supported here');\n // This is a special hack to assign __NG_ELEMENT_ID__ to this instance.\n // See `InjectorMarkers`\n this.__NG_ELEMENT_ID__ = options;\n }\n else if (options !== undefined) {\n this.ɵprov = ɵɵdefineInjectable({\n token: this,\n providedIn: options.providedIn || 'root',\n factory: options.factory,\n });\n }\n }\n /**\n * @internal\n */\n get multi() {\n return this;\n }\n toString() {\n return `InjectionToken ${this._desc}`;\n }\n}\n\nlet _injectorProfilerContext;\nfunction getInjectorProfilerContext() {\n !ngDevMode && throwError('getInjectorProfilerContext should never be called in production mode');\n return _injectorProfilerContext;\n}\nfunction setInjectorProfilerContext(context) {\n !ngDevMode && throwError('setInjectorProfilerContext should never be called in production mode');\n const previous = _injectorProfilerContext;\n _injectorProfilerContext = context;\n return previous;\n}\nlet injectorProfilerCallback = null;\n/**\n * Sets the callback function which will be invoked during certain DI events within the\n * runtime (for example: injecting services, creating injectable instances, configuring providers)\n *\n * Warning: this function is *INTERNAL* and should not be relied upon in application's code.\n * The contract of the function might be changed in any release and/or the function can be removed\n * completely.\n *\n * @param profiler function provided by the caller or null value to disable profiling.\n */\nconst setInjectorProfiler = (injectorProfiler) => {\n !ngDevMode && throwError('setInjectorProfiler should never be called in production mode');\n injectorProfilerCallback = injectorProfiler;\n};\n/**\n * Injector profiler function which emits on DI events executed by the runtime.\n *\n * @param event InjectorProfilerEvent corresponding to the DI event being emitted\n */\nfunction injectorProfiler(event) {\n !ngDevMode && throwError('Injector profiler should never be called in production mode');\n if (injectorProfilerCallback != null /* both `null` and `undefined` */) {\n injectorProfilerCallback(event);\n }\n}\n/**\n * Emits an InjectorProfilerEventType.ProviderConfigured to the injector profiler. The data in the\n * emitted event includes the raw provider, as well as the token that provider is providing.\n *\n * @param eventProvider A provider object\n */\nfunction emitProviderConfiguredEvent(eventProvider, isViewProvider = false) {\n !ngDevMode && throwError('Injector profiler should never be called in production mode');\n let token;\n // if the provider is a TypeProvider (typeof provider is function) then the token is the\n // provider itself\n if (typeof eventProvider === 'function') {\n token = eventProvider;\n }\n // if the provider is an injection token, then the token is the injection token.\n else if (eventProvider instanceof InjectionToken) {\n token = eventProvider;\n }\n // in all other cases we can access the token via the `provide` property of the provider\n else {\n token = resolveForwardRef(eventProvider.provide);\n }\n let provider = eventProvider;\n // Injection tokens may define their own default provider which gets attached to the token itself\n // as `ɵprov`. In this case, we want to emit the provider that is attached to the token, not the\n // token itself.\n if (eventProvider instanceof InjectionToken) {\n provider = eventProvider.ɵprov || eventProvider;\n }\n injectorProfiler({\n type: 2 /* InjectorProfilerEventType.ProviderConfigured */,\n context: getInjectorProfilerContext(),\n providerRecord: { token, provider, isViewProvider },\n });\n}\n/**\n * Emits an event to the injector profiler with the instance that was created. Note that\n * the injector associated with this emission can be accessed by using getDebugInjectContext()\n *\n * @param instance an object created by an injector\n */\nfunction emitInstanceCreatedByInjectorEvent(instance) {\n !ngDevMode && throwError('Injector profiler should never be called in production mode');\n injectorProfiler({\n type: 1 /* InjectorProfilerEventType.InstanceCreatedByInjector */,\n context: getInjectorProfilerContext(),\n instance: { value: instance },\n });\n}\n/**\n * @param token DI token associated with injected service\n * @param value the instance of the injected service (i.e the result of `inject(token)`)\n * @param flags the flags that the token was injected with\n */\nfunction emitInjectEvent(token, value, flags) {\n !ngDevMode && throwError('Injector profiler should never be called in production mode');\n injectorProfiler({\n type: 0 /* InjectorProfilerEventType.Inject */,\n context: getInjectorProfilerContext(),\n service: { token, value, flags },\n });\n}\nfunction emitEffectCreatedEvent(effect) {\n !ngDevMode && throwError('Injector profiler should never be called in production mode');\n injectorProfiler({\n type: 3 /* InjectorProfilerEventType.EffectCreated */,\n context: getInjectorProfilerContext(),\n effect,\n });\n}\nfunction runInInjectorProfilerContext(injector, token, callback) {\n !ngDevMode &&\n throwError('runInInjectorProfilerContext should never be called in production mode');\n const prevInjectContext = setInjectorProfilerContext({ injector, token });\n try {\n callback();\n }\n finally {\n setInjectorProfilerContext(prevInjectContext);\n }\n}\n\nfunction isEnvironmentProviders(value) {\n return value && !!value.ɵproviders;\n}\n\nconst NG_COMP_DEF = getClosureSafeProperty({ ɵcmp: getClosureSafeProperty });\nconst NG_DIR_DEF = getClosureSafeProperty({ ɵdir: getClosureSafeProperty });\nconst NG_PIPE_DEF = getClosureSafeProperty({ ɵpipe: getClosureSafeProperty });\nconst NG_MOD_DEF = getClosureSafeProperty({ ɵmod: getClosureSafeProperty });\nconst NG_FACTORY_DEF = getClosureSafeProperty({ ɵfac: getClosureSafeProperty });\n/**\n * If a directive is diPublic, bloomAdd sets a property on the type with this constant as\n * the key and the directive's unique ID as the value. This allows us to map directives to their\n * bloom filter bit for DI.\n */\n// TODO(misko): This is wrong. The NG_ELEMENT_ID should never be minified.\nconst NG_ELEMENT_ID = getClosureSafeProperty({ __NG_ELEMENT_ID__: getClosureSafeProperty });\n/**\n * The `NG_ENV_ID` field on a DI token indicates special processing in the `EnvironmentInjector`:\n * getting such tokens from the `EnvironmentInjector` will bypass the standard DI resolution\n * strategy and instead will return implementation produced by the `NG_ENV_ID` factory function.\n *\n * This particular retrieval of DI tokens is mostly done to eliminate circular dependencies and\n * improve tree-shaking.\n */\nconst NG_ENV_ID = getClosureSafeProperty({ __NG_ENV_ID__: getClosureSafeProperty });\n\n/**\n * Used for stringify render output in Ivy.\n * Important! This function is very performance-sensitive and we should\n * be extra careful not to introduce megamorphic reads in it.\n * Check `core/test/render3/perf/render_stringify` for benchmarks and alternate implementations.\n */\nfunction renderStringify(value) {\n if (typeof value === 'string')\n return value;\n if (value == null)\n return '';\n // Use `String` so that it invokes the `toString` method of the value. Note that this\n // appears to be faster than calling `value.toString` (see `render_stringify` benchmark).\n return String(value);\n}\n/**\n * Used to stringify a value so that it can be displayed in an error message.\n *\n * Important! This function contains a megamorphic read and should only be\n * used for error messages.\n */\nfunction stringifyForError(value) {\n if (typeof value === 'function')\n return value.name || value.toString();\n if (typeof value === 'object' && value != null && typeof value.type === 'function') {\n return value.type.name || value.type.toString();\n }\n return renderStringify(value);\n}\n/**\n * Used to stringify a `Type` and including the file path and line number in which it is defined, if\n * possible, for better debugging experience.\n *\n * Important! This function contains a megamorphic read and should only be used for error messages.\n */\nfunction debugStringifyTypeForError(type) {\n // TODO(pmvald): Do some refactoring so that we can use getComponentDef here without creating\n // circular deps.\n let componentDef = type[NG_COMP_DEF] || null;\n if (componentDef !== null && componentDef.debugInfo) {\n return stringifyTypeFromDebugInfo(componentDef.debugInfo);\n }\n return stringifyForError(type);\n}\n// TODO(pmvald): Do some refactoring so that we can use the type ClassDebugInfo for the param\n// debugInfo here without creating circular deps.\nfunction stringifyTypeFromDebugInfo(debugInfo) {\n if (!debugInfo.filePath || !debugInfo.lineNumber) {\n return debugInfo.className;\n }\n else {\n return `${debugInfo.className} (at ${debugInfo.filePath}:${debugInfo.lineNumber})`;\n }\n}\n\n/** Called when directives inject each other (creating a circular dependency) */\nfunction throwCyclicDependencyError(token, path) {\n throw new RuntimeError(-200 /* RuntimeErrorCode.CYCLIC_DI_DEPENDENCY */, ngDevMode\n ? `Circular dependency in DI detected for ${token}${path ? `. Dependency path: ${path.join(' > ')} > ${token}` : ''}`\n : token);\n}\nfunction throwMixedMultiProviderError() {\n throw new Error(`Cannot mix multi providers and regular providers`);\n}\nfunction throwInvalidProviderError(ngModuleType, providers, provider) {\n if (ngModuleType && providers) {\n const providerDetail = providers.map((v) => (v == provider ? '?' + provider + '?' : '...'));\n throw new Error(`Invalid provider for the NgModule '${stringify(ngModuleType)}' - only instances of Provider and Type are allowed, got: [${providerDetail.join(', ')}]`);\n }\n else if (isEnvironmentProviders(provider)) {\n if (provider.ɵfromNgModule) {\n throw new RuntimeError(207 /* RuntimeErrorCode.PROVIDER_IN_WRONG_CONTEXT */, `Invalid providers from 'importProvidersFrom' present in a non-environment injector. 'importProvidersFrom' can't be used for component providers.`);\n }\n else {\n throw new RuntimeError(207 /* RuntimeErrorCode.PROVIDER_IN_WRONG_CONTEXT */, `Invalid providers present in a non-environment injector. 'EnvironmentProviders' can't be used for component providers.`);\n }\n }\n else {\n throw new Error('Invalid provider');\n }\n}\n/** Throws an error when a token is not found in DI. */\nfunction throwProviderNotFoundError(token, injectorName) {\n const errorMessage = ngDevMode &&\n `No provider for ${stringifyForError(token)} found${injectorName ? ` in ${injectorName}` : ''}`;\n throw new RuntimeError(-201 /* RuntimeErrorCode.PROVIDER_NOT_FOUND */, errorMessage);\n}\n\n/**\n * Injection flags for DI.\n *\n * @publicApi\n * @deprecated use an options object for [`inject`](api/core/inject) instead.\n */\nvar InjectFlags;\n(function (InjectFlags) {\n // TODO(alxhub): make this 'const' (and remove `InternalInjectFlags` enum) when ngc no longer\n // writes exports of it into ngfactory files.\n /** Check self and check parent injector if needed */\n InjectFlags[InjectFlags[\"Default\"] = 0] = \"Default\";\n /**\n * Specifies that an injector should retrieve a dependency from any injector until reaching the\n * host element of the current component. (Only used with Element Injector)\n */\n InjectFlags[InjectFlags[\"Host\"] = 1] = \"Host\";\n /** Don't ascend to ancestors of the node requesting injection. */\n InjectFlags[InjectFlags[\"Self\"] = 2] = \"Self\";\n /** Skip the node that is requesting injection. */\n InjectFlags[InjectFlags[\"SkipSelf\"] = 4] = \"SkipSelf\";\n /** Inject `defaultValue` instead if token not found. */\n InjectFlags[InjectFlags[\"Optional\"] = 8] = \"Optional\";\n})(InjectFlags || (InjectFlags = {}));\n\n/**\n * Current implementation of inject.\n *\n * By default, it is `injectInjectorOnly`, which makes it `Injector`-only aware. It can be changed\n * to `directiveInject`, which brings in the `NodeInjector` system of ivy. It is designed this\n * way for two reasons:\n * 1. `Injector` should not depend on ivy logic.\n * 2. To maintain tree shake-ability we don't want to bring in unnecessary code.\n */\nlet _injectImplementation;\nfunction getInjectImplementation() {\n return _injectImplementation;\n}\n/**\n * Sets the current inject implementation.\n */\nfunction setInjectImplementation(impl) {\n const previous = _injectImplementation;\n _injectImplementation = impl;\n return previous;\n}\n/**\n * Injects `root` tokens in limp mode.\n *\n * If no injector exists, we can still inject tree-shakable providers which have `providedIn` set to\n * `\"root\"`. This is known as the limp mode injection. In such case the value is stored in the\n * injectable definition.\n */\nfunction injectRootLimpMode(token, notFoundValue, flags) {\n const injectableDef = getInjectableDef(token);\n if (injectableDef && injectableDef.providedIn == 'root') {\n return injectableDef.value === undefined\n ? (injectableDef.value = injectableDef.factory())\n : injectableDef.value;\n }\n if (flags & InjectFlags.Optional)\n return null;\n if (notFoundValue !== undefined)\n return notFoundValue;\n throwProviderNotFoundError(token, 'Injector');\n}\n/**\n * Assert that `_injectImplementation` is not `fn`.\n *\n * This is useful, to prevent infinite recursion.\n *\n * @param fn Function which it should not equal to\n */\nfunction assertInjectImplementationNotEqual(fn) {\n ngDevMode &&\n assertNotEqual(_injectImplementation, fn, 'Calling ɵɵinject would cause infinite recursion');\n}\n\nconst _THROW_IF_NOT_FOUND = {};\nconst THROW_IF_NOT_FOUND = _THROW_IF_NOT_FOUND;\nfunction getCurrentInjector() {\n return di.getCurrentInjector();\n}\nfunction setCurrentInjector(injector) {\n return di.setCurrentInjector(injector);\n}\n/*\n * Name of a property (that we patch onto DI decorator), which is used as an annotation of which\n * InjectFlag this decorator represents. This allows to avoid direct references to the DI decorators\n * in the code, thus making them tree-shakable.\n */\nconst DI_DECORATOR_FLAG = '__NG_DI_FLAG__';\nconst NG_TEMP_TOKEN_PATH = 'ngTempTokenPath';\nconst NG_TOKEN_PATH = 'ngTokenPath';\nconst NEW_LINE = /\\n/gm;\nconst NO_NEW_LINE = 'ɵ';\nconst SOURCE = '__source';\nfunction injectInjectorOnly(token, flags = InjectFlags.Default) {\n if (getCurrentInjector() === undefined) {\n throw new RuntimeError(-203 /* RuntimeErrorCode.MISSING_INJECTION_CONTEXT */, ngDevMode &&\n `inject() must be called from an injection context such as a constructor, a factory function, a field initializer, or a function used with \\`runInInjectionContext\\`.`);\n }\n else if (getCurrentInjector() === null) {\n return injectRootLimpMode(token, undefined, flags);\n }\n else {\n const value = getCurrentInjector().get(token, flags & InjectFlags.Optional ? null : undefined, flags);\n ngDevMode && emitInjectEvent(token, value, flags);\n return value;\n }\n}\nfunction ɵɵinject(token, flags = InjectFlags.Default) {\n return (getInjectImplementation() || injectInjectorOnly)(resolveForwardRef(token), flags);\n}\n/**\n * Throws an error indicating that a factory function could not be generated by the compiler for a\n * particular class.\n *\n * The name of the class is not mentioned here, but will be in the generated factory function name\n * and thus in the stack trace.\n *\n * @codeGenApi\n */\nfunction ɵɵinvalidFactoryDep(index) {\n throw new RuntimeError(202 /* RuntimeErrorCode.INVALID_FACTORY_DEPENDENCY */, ngDevMode &&\n `This constructor is not compatible with Angular Dependency Injection because its dependency at index ${index} of the parameter list is invalid.\nThis can happen if the dependency type is a primitive like a string or if an ancestor of this class is missing an Angular decorator.\n\nPlease check that 1) the type for the parameter at index ${index} is correct and 2) the correct Angular decorators are defined for this class and its ancestors.`);\n}\n/**\n * Injects a token from the currently active injector.\n * `inject` is only supported in an [injection context](guide/di/dependency-injection-context). It\n * can be used during:\n * - Construction (via the `constructor`) of a class being instantiated by the DI system, such\n * as an `@Injectable` or `@Component`.\n * - In the initializer for fields of such classes.\n * - In the factory function specified for `useFactory` of a `Provider` or an `@Injectable`.\n * - In the `factory` function specified for an `InjectionToken`.\n * - In a stackframe of a function call in a DI context\n *\n * @param token A token that represents a dependency that should be injected.\n * @param flags Optional flags that control how injection is executed.\n * The flags correspond to injection strategies that can be specified with\n * parameter decorators `@Host`, `@Self`, `@SkipSelf`, and `@Optional`.\n * @returns the injected value if operation is successful, `null` otherwise.\n * @throws if called outside of a supported context.\n *\n * @usageNotes\n * In practice the `inject()` calls are allowed in a constructor, a constructor parameter and a\n * field initializer:\n *\n * ```ts\n * @Injectable({providedIn: 'root'})\n * export class Car {\n * radio: Radio|undefined;\n * // OK: field initializer\n * spareTyre = inject(Tyre);\n *\n * constructor() {\n * // OK: constructor body\n * this.radio = inject(Radio);\n * }\n * }\n * ```\n *\n * It is also legal to call `inject` from a provider's factory:\n *\n * ```ts\n * providers: [\n * {provide: Car, useFactory: () => {\n * // OK: a class factory\n * const engine = inject(Engine);\n * return new Car(engine);\n * }}\n * ]\n * ```\n *\n * Calls to the `inject()` function outside of the class creation context will result in error. Most\n * notably, calls to `inject()` are disallowed after a class instance was created, in methods\n * (including lifecycle hooks):\n *\n * ```ts\n * @Component({ ... })\n * export class CarComponent {\n * ngOnInit() {\n * // ERROR: too late, the component instance was already created\n * const engine = inject(Engine);\n * engine.start();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction inject(token, flags = InjectFlags.Default) {\n // The `as any` here _shouldn't_ be necessary, but without it JSCompiler\n // throws a disambiguation error due to the multiple signatures.\n return ɵɵinject(token, convertToBitFlags(flags));\n}\n// Converts object-based DI flags (`InjectOptions`) to bit flags (`InjectFlags`).\nfunction convertToBitFlags(flags) {\n if (typeof flags === 'undefined' || typeof flags === 'number') {\n return flags;\n }\n // While TypeScript doesn't accept it without a cast, bitwise OR with false-y values in\n // JavaScript is a no-op. We can use that for a very codesize-efficient conversion from\n // `InjectOptions` to `InjectFlags`.\n return (0 /* InternalInjectFlags.Default */ | // comment to force a line break in the formatter\n (flags.optional && 8 /* InternalInjectFlags.Optional */) |\n (flags.host && 1 /* InternalInjectFlags.Host */) |\n (flags.self && 2 /* InternalInjectFlags.Self */) |\n (flags.skipSelf && 4 /* InternalInjectFlags.SkipSelf */));\n}\nfunction injectArgs(types) {\n const args = [];\n for (let i = 0; i < types.length; i++) {\n const arg = resolveForwardRef(types[i]);\n if (Array.isArray(arg)) {\n if (arg.length === 0) {\n throw new RuntimeError(900 /* RuntimeErrorCode.INVALID_DIFFER_INPUT */, ngDevMode && 'Arguments array must have arguments.');\n }\n let type = undefined;\n let flags = InjectFlags.Default;\n for (let j = 0; j < arg.length; j++) {\n const meta = arg[j];\n const flag = getInjectFlag(meta);\n if (typeof flag === 'number') {\n // Special case when we handle @Inject decorator.\n if (flag === -1 /* DecoratorFlags.Inject */) {\n type = meta.token;\n }\n else {\n flags |= flag;\n }\n }\n else {\n type = meta;\n }\n }\n args.push(ɵɵinject(type, flags));\n }\n else {\n args.push(ɵɵinject(arg));\n }\n }\n return args;\n}\n/**\n * Attaches a given InjectFlag to a given decorator using monkey-patching.\n * Since DI decorators can be used in providers `deps` array (when provider is configured using\n * `useFactory`) without initialization (e.g. `Host`) and as an instance (e.g. `new Host()`), we\n * attach the flag to make it available both as a static property and as a field on decorator\n * instance.\n *\n * @param decorator Provided DI decorator.\n * @param flag InjectFlag that should be applied.\n */\nfunction attachInjectFlag(decorator, flag) {\n decorator[DI_DECORATOR_FLAG] = flag;\n decorator.prototype[DI_DECORATOR_FLAG] = flag;\n return decorator;\n}\n/**\n * Reads monkey-patched property that contains InjectFlag attached to a decorator.\n *\n * @param token Token that may contain monkey-patched DI flags property.\n */\nfunction getInjectFlag(token) {\n return token[DI_DECORATOR_FLAG];\n}\nfunction catchInjectorError(e, token, injectorErrorName, source) {\n const tokenPath = e[NG_TEMP_TOKEN_PATH];\n if (token[SOURCE]) {\n tokenPath.unshift(token[SOURCE]);\n }\n e.message = formatError('\\n' + e.message, tokenPath, injectorErrorName, source);\n e[NG_TOKEN_PATH] = tokenPath;\n e[NG_TEMP_TOKEN_PATH] = null;\n throw e;\n}\nfunction formatError(text, obj, injectorErrorName, source = null) {\n text = text && text.charAt(0) === '\\n' && text.charAt(1) == NO_NEW_LINE ? text.slice(2) : text;\n let context = stringify(obj);\n if (Array.isArray(obj)) {\n context = obj.map(stringify).join(' -> ');\n }\n else if (typeof obj === 'object') {\n let parts = [];\n for (let key in obj) {\n if (obj.hasOwnProperty(key)) {\n let value = obj[key];\n parts.push(key + ':' + (typeof value === 'string' ? JSON.stringify(value) : stringify(value)));\n }\n }\n context = `{${parts.join(', ')}}`;\n }\n return `${injectorErrorName}${source ? '(' + source + ')' : ''}[${context}]: ${text.replace(NEW_LINE, '\\n ')}`;\n}\n\n/**\n * Inject decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Inject = attachInjectFlag(\n// Disable tslint because `DecoratorFlags` is a const enum which gets inlined.\nmakeParamDecorator('Inject', (token) => ({ token })), -1 /* DecoratorFlags.Inject */);\n/**\n * Optional decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Optional = \n// Disable tslint because `InternalInjectFlags` is a const enum which gets inlined.\n// tslint:disable-next-line: no-toplevel-property-access\nattachInjectFlag(makeParamDecorator('Optional'), 8 /* InternalInjectFlags.Optional */);\n/**\n * Self decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Self = \n// Disable tslint because `InternalInjectFlags` is a const enum which gets inlined.\n// tslint:disable-next-line: no-toplevel-property-access\nattachInjectFlag(makeParamDecorator('Self'), 2 /* InternalInjectFlags.Self */);\n/**\n * `SkipSelf` decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst SkipSelf = \n// Disable tslint because `InternalInjectFlags` is a const enum which gets inlined.\n// tslint:disable-next-line: no-toplevel-property-access\nattachInjectFlag(makeParamDecorator('SkipSelf'), 4 /* InternalInjectFlags.SkipSelf */);\n/**\n * Host decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Host = \n// Disable tslint because `InternalInjectFlags` is a const enum which gets inlined.\n// tslint:disable-next-line: no-toplevel-property-access\nattachInjectFlag(makeParamDecorator('Host'), 1 /* InternalInjectFlags.Host */);\n\nfunction getFactoryDef(type, throwNotFound) {\n const hasFactoryDef = type.hasOwnProperty(NG_FACTORY_DEF);\n if (!hasFactoryDef && throwNotFound === true && ngDevMode) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵfac' property.`);\n }\n return hasFactoryDef ? type[NG_FACTORY_DEF] : null;\n}\n\n/**\n * Determines if the contents of two arrays is identical\n *\n * @param a first array\n * @param b second array\n * @param identityAccessor Optional function for extracting stable object identity from a value in\n * the array.\n */\nfunction arrayEquals(a, b, identityAccessor) {\n if (a.length !== b.length)\n return false;\n for (let i = 0; i < a.length; i++) {\n let valueA = a[i];\n let valueB = b[i];\n if (identityAccessor) {\n valueA = identityAccessor(valueA);\n valueB = identityAccessor(valueB);\n }\n if (valueB !== valueA) {\n return false;\n }\n }\n return true;\n}\n/**\n * Flattens an array.\n */\nfunction flatten(list) {\n return list.flat(Number.POSITIVE_INFINITY);\n}\nfunction deepForEach(input, fn) {\n input.forEach((value) => (Array.isArray(value) ? deepForEach(value, fn) : fn(value)));\n}\nfunction addToArray(arr, index, value) {\n // perf: array.push is faster than array.splice!\n if (index >= arr.length) {\n arr.push(value);\n }\n else {\n arr.splice(index, 0, value);\n }\n}\nfunction removeFromArray(arr, index) {\n // perf: array.pop is faster than array.splice!\n if (index >= arr.length - 1) {\n return arr.pop();\n }\n else {\n return arr.splice(index, 1)[0];\n }\n}\nfunction newArray(size, value) {\n const list = [];\n for (let i = 0; i < size; i++) {\n list.push(value);\n }\n return list;\n}\n/**\n * Remove item from array (Same as `Array.splice()` but faster.)\n *\n * `Array.splice()` is not as fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * https://jsperf.com/fast-array-splice (About 20x faster)\n *\n * @param array Array to splice\n * @param index Index of element in array to remove.\n * @param count Number of items to remove.\n */\nfunction arraySplice(array, index, count) {\n const length = array.length - count;\n while (index < length) {\n array[index] = array[index + count];\n index++;\n }\n while (count--) {\n array.pop(); // shrink the array\n }\n}\n/**\n * Same as `Array.splice(index, 0, value)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value Value to add to array.\n */\nfunction arrayInsert(array, index, value) {\n ngDevMode && assertLessThanOrEqual(index, array.length, \"Can't insert past array end.\");\n let end = array.length;\n while (end > index) {\n const previousEnd = end - 1;\n array[end] = array[previousEnd];\n end = previousEnd;\n }\n array[index] = value;\n}\n/**\n * Same as `Array.splice2(index, 0, value1, value2)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value1 Value to add to array.\n * @param value2 Value to add to array.\n */\nfunction arrayInsert2(array, index, value1, value2) {\n ngDevMode && assertLessThanOrEqual(index, array.length, \"Can't insert past array end.\");\n let end = array.length;\n if (end == index) {\n // inserting at the end.\n array.push(value1, value2);\n }\n else if (end === 1) {\n // corner case when we have less items in array than we have items to insert.\n array.push(value2, array[0]);\n array[0] = value1;\n }\n else {\n end--;\n array.push(array[end - 1], array[end]);\n while (end > index) {\n const previousEnd = end - 2;\n array[end] = array[previousEnd];\n end--;\n }\n array[index] = value1;\n array[index + 1] = value2;\n }\n}\n/**\n * Get an index of an `value` in a sorted `array`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * located)\n */\nfunction arrayIndexOfSorted(array, value) {\n return _arrayIndexOfSorted(array, value, 0);\n}\n/**\n * Set a `value` for a `key`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or create.\n * @param value The value to set for a `key`.\n * @returns index (always even) of where the value vas set.\n */\nfunction keyValueArraySet(keyValueArray, key, value) {\n let index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it set it.\n keyValueArray[index | 1] = value;\n }\n else {\n index = ~index;\n arrayInsert2(keyValueArray, index, key, value);\n }\n return index;\n}\n/**\n * Retrieve a `value` for a `key` (on `undefined` if not found.)\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @return The `value` stored at the `key` location or `undefined if not found.\n */\nfunction keyValueArrayGet(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it retrieve it.\n return keyValueArray[index | 1];\n }\n return undefined;\n}\n/**\n * Retrieve a `key` index value in the array or `-1` if not found.\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @returns index of where the key is (or should have been.)\n * - positive (even) index if key found.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been inserted.)\n */\nfunction keyValueArrayIndexOf(keyValueArray, key) {\n return _arrayIndexOfSorted(keyValueArray, key, 1);\n}\n/**\n * Delete a `key` (and `value`) from the `KeyValueArray`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or delete (if exist).\n * @returns index of where the key was (or should have been.)\n * - positive (even) index if key found and deleted.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been.)\n */\nfunction keyValueArrayDelete(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it remove it.\n arraySplice(keyValueArray, index, 2);\n }\n return index;\n}\n/**\n * INTERNAL: Get an index of an `value` in a sorted `array` by grouping search by `shift`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @param shift grouping shift.\n * - `0` means look at every location\n * - `1` means only look at every other (even) location (the odd locations are to be ignored as\n * they are values.)\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * inserted)\n */\nfunction _arrayIndexOfSorted(array, value, shift) {\n ngDevMode && assertEqual(Array.isArray(array), true, 'Expecting an array');\n let start = 0;\n let end = array.length >> shift;\n while (end !== start) {\n const middle = start + ((end - start) >> 1); // find the middle.\n const current = array[middle << shift];\n if (value === current) {\n return middle << shift;\n }\n else if (current > value) {\n end = middle;\n }\n else {\n start = middle + 1; // We already searched middle so make it non-inclusive by adding 1\n }\n }\n return ~(end << shift);\n}\n\n/**\n * This file contains reuseable \"empty\" symbols that can be used as default return values\n * in different parts of the rendering code. Because the same symbols are returned, this\n * allows for identity checks against these values to be consistently used by the framework\n * code.\n */\nconst EMPTY_OBJ = {};\nconst EMPTY_ARRAY = [];\n// freezing the values prevents any code from accidentally inserting new values in\nif ((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode()) {\n // These property accesses can be ignored because ngDevMode will be set to false\n // when optimizing code and the whole if statement will be dropped.\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_OBJ);\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_ARRAY);\n}\n\n/**\n * A multi-provider token for initialization functions that will run upon construction of an\n * environment injector.\n *\n * @deprecated from v19.0.0, use provideEnvironmentInitializer instead\n *\n * @see {@link provideEnvironmentInitializer}\n *\n * Note: As opposed to the `APP_INITIALIZER` token, the `ENVIRONMENT_INITIALIZER` functions are not awaited,\n * hence they should not be `async`.\n *\n * @publicApi\n */\nconst ENVIRONMENT_INITIALIZER = new InjectionToken(ngDevMode ? 'ENVIRONMENT_INITIALIZER' : '');\n\n/**\n * An InjectionToken that gets the current `Injector` for `createInjector()`-style injectors.\n *\n * Requesting this token instead of `Injector` allows `StaticInjector` to be tree-shaken from a\n * project.\n *\n * @publicApi\n */\nconst INJECTOR$1 = new InjectionToken(ngDevMode ? 'INJECTOR' : '', \n// Disable tslint because this is const enum which gets inlined not top level prop access.\n// tslint:disable-next-line: no-toplevel-property-access\n-1 /* InjectorMarkers.Injector */);\n\nconst INJECTOR_DEF_TYPES = new InjectionToken(ngDevMode ? 'INJECTOR_DEF_TYPES' : '');\n\nclass NullInjector {\n get(token, notFoundValue = THROW_IF_NOT_FOUND) {\n if (notFoundValue === THROW_IF_NOT_FOUND) {\n const error = new Error(`NullInjectorError: No provider for ${stringify(token)}!`);\n error.name = 'NullInjectorError';\n throw error;\n }\n return notFoundValue;\n }\n}\n\nfunction getNgModuleDef(type, throwNotFound) {\n const ngModuleDef = type[NG_MOD_DEF] || null;\n if (!ngModuleDef && throwNotFound === true) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵmod' property.`);\n }\n return ngModuleDef;\n}\n/**\n * The following getter methods retrieve the definition from the type. Currently the retrieval\n * honors inheritance, but in the future we may change the rule to require that definitions are\n * explicit. This would require some sort of migration strategy.\n */\nfunction getComponentDef(type) {\n return type[NG_COMP_DEF] || null;\n}\nfunction getDirectiveDef(type) {\n return type[NG_DIR_DEF] || null;\n}\nfunction getPipeDef$1(type) {\n return type[NG_PIPE_DEF] || null;\n}\n/**\n * Checks whether a given Component, Directive or Pipe is marked as standalone.\n * This will return false if passed anything other than a Component, Directive, or Pipe class\n * See [this guide](guide/components/importing) for additional information:\n *\n * @param type A reference to a Component, Directive or Pipe.\n * @publicApi\n */\nfunction isStandalone(type) {\n const def = getComponentDef(type) || getDirectiveDef(type) || getPipeDef$1(type);\n return def !== null && def.standalone;\n}\n\n/**\n * Wrap an array of `Provider`s into `EnvironmentProviders`, preventing them from being accidentally\n * referenced in `@Component` in a component injector.\n */\nfunction makeEnvironmentProviders(providers) {\n return {\n ɵproviders: providers,\n };\n}\n/**\n * @description\n * This function is used to provide initialization functions that will be executed upon construction\n * of an environment injector.\n *\n * Note that the provided initializer is run in the injection context.\n *\n * Previously, this was achieved using the `ENVIRONMENT_INITIALIZER` token which is now deprecated.\n *\n * @see {@link ENVIRONMENT_INITIALIZER}\n *\n * @usageNotes\n * The following example illustrates how to configure an initialization function using\n * `provideEnvironmentInitializer()`\n * ```ts\n * createEnvironmentInjector(\n * [\n * provideEnvironmentInitializer(() => {\n * console.log('environment initialized');\n * }),\n * ],\n * parentInjector\n * );\n * ```\n *\n * @publicApi\n */\nfunction provideEnvironmentInitializer(initializerFn) {\n return makeEnvironmentProviders([\n {\n provide: ENVIRONMENT_INITIALIZER,\n multi: true,\n useValue: initializerFn,\n },\n ]);\n}\n/**\n * Collects providers from all NgModules and standalone components, including transitively imported\n * ones.\n *\n * Providers extracted via `importProvidersFrom` are only usable in an application injector or\n * another environment injector (such as a route injector). They should not be used in component\n * providers.\n *\n * More information about standalone components can be found in [this\n * guide](guide/components/importing).\n *\n * @usageNotes\n * The results of the `importProvidersFrom` call can be used in the `bootstrapApplication` call:\n *\n * ```ts\n * await bootstrapApplication(RootComponent, {\n * providers: [\n * importProvidersFrom(NgModuleOne, NgModuleTwo)\n * ]\n * });\n * ```\n *\n * You can also use the `importProvidersFrom` results in the `providers` field of a route, when a\n * standalone component is used:\n *\n * ```ts\n * export const ROUTES: Route[] = [\n * {\n * path: 'foo',\n * providers: [\n * importProvidersFrom(NgModuleOne, NgModuleTwo)\n * ],\n * component: YourStandaloneComponent\n * }\n * ];\n * ```\n *\n * @returns Collected providers from the specified list of types.\n * @publicApi\n */\nfunction importProvidersFrom(...sources) {\n return {\n ɵproviders: internalImportProvidersFrom(true, sources),\n ɵfromNgModule: true,\n };\n}\nfunction internalImportProvidersFrom(checkForStandaloneCmp, ...sources) {\n const providersOut = [];\n const dedup = new Set(); // already seen types\n let injectorTypesWithProviders;\n const collectProviders = (provider) => {\n providersOut.push(provider);\n };\n deepForEach(sources, (source) => {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && checkForStandaloneCmp) {\n const cmpDef = getComponentDef(source);\n if (cmpDef?.standalone) {\n throw new RuntimeError(800 /* RuntimeErrorCode.IMPORT_PROVIDERS_FROM_STANDALONE */, `Importing providers supports NgModule or ModuleWithProviders but got a standalone component \"${stringifyForError(source)}\"`);\n }\n }\n // Narrow `source` to access the internal type analogue for `ModuleWithProviders`.\n const internalSource = source;\n if (walkProviderTree(internalSource, collectProviders, [], dedup)) {\n injectorTypesWithProviders ||= [];\n injectorTypesWithProviders.push(internalSource);\n }\n });\n // Collect all providers from `ModuleWithProviders` types.\n if (injectorTypesWithProviders !== undefined) {\n processInjectorTypesWithProviders(injectorTypesWithProviders, collectProviders);\n }\n return providersOut;\n}\n/**\n * Collects all providers from the list of `ModuleWithProviders` and appends them to the provided\n * array.\n */\nfunction processInjectorTypesWithProviders(typesWithProviders, visitor) {\n for (let i = 0; i < typesWithProviders.length; i++) {\n const { ngModule, providers } = typesWithProviders[i];\n deepForEachProvider(providers, (provider) => {\n ngDevMode && validateProvider(provider, providers || EMPTY_ARRAY, ngModule);\n visitor(provider, ngModule);\n });\n }\n}\n/**\n * The logic visits an `InjectorType`, an `InjectorTypeWithProviders`, or a standalone\n * `ComponentType`, and all of its transitive providers and collects providers.\n *\n * If an `InjectorTypeWithProviders` that declares providers besides the type is specified,\n * the function will return \"true\" to indicate that the providers of the type definition need\n * to be processed. This allows us to process providers of injector types after all imports of\n * an injector definition are processed. (following View Engine semantics: see FW-1349)\n */\nfunction walkProviderTree(container, visitor, parents, dedup) {\n container = resolveForwardRef(container);\n if (!container)\n return false;\n // The actual type which had the definition. Usually `container`, but may be an unwrapped type\n // from `InjectorTypeWithProviders`.\n let defType = null;\n let injDef = getInjectorDef(container);\n const cmpDef = !injDef && getComponentDef(container);\n if (!injDef && !cmpDef) {\n // `container` is not an injector type or a component type. It might be:\n // * An `InjectorTypeWithProviders` that wraps an injector type.\n // * A standalone directive or pipe that got pulled in from a standalone component's\n // dependencies.\n // Try to unwrap it as an `InjectorTypeWithProviders` first.\n const ngModule = container\n .ngModule;\n injDef = getInjectorDef(ngModule);\n if (injDef) {\n defType = ngModule;\n }\n else {\n // Not a component or injector type, so ignore it.\n return false;\n }\n }\n else if (cmpDef && !cmpDef.standalone) {\n return false;\n }\n else {\n defType = container;\n }\n // Check for circular dependencies.\n if (ngDevMode && parents.indexOf(defType) !== -1) {\n const defName = stringify(defType);\n const path = parents.map(stringify);\n throwCyclicDependencyError(defName, path);\n }\n // Check for multiple imports of the same module\n const isDuplicate = dedup.has(defType);\n if (cmpDef) {\n if (isDuplicate) {\n // This component definition has already been processed.\n return false;\n }\n dedup.add(defType);\n if (cmpDef.dependencies) {\n const deps = typeof cmpDef.dependencies === 'function' ? cmpDef.dependencies() : cmpDef.dependencies;\n for (const dep of deps) {\n walkProviderTree(dep, visitor, parents, dedup);\n }\n }\n }\n else if (injDef) {\n // First, include providers from any imports.\n if (injDef.imports != null && !isDuplicate) {\n // Before processing defType's imports, add it to the set of parents. This way, if it ends\n // up deeply importing itself, this can be detected.\n ngDevMode && parents.push(defType);\n // Add it to the set of dedups. This way we can detect multiple imports of the same module\n dedup.add(defType);\n let importTypesWithProviders;\n try {\n deepForEach(injDef.imports, (imported) => {\n if (walkProviderTree(imported, visitor, parents, dedup)) {\n importTypesWithProviders ||= [];\n // If the processed import is an injector type with providers, we store it in the\n // list of import types with providers, so that we can process those afterwards.\n importTypesWithProviders.push(imported);\n }\n });\n }\n finally {\n // Remove it from the parents set when finished.\n ngDevMode && parents.pop();\n }\n // Imports which are declared with providers (TypeWithProviders) need to be processed\n // after all imported modules are processed. This is similar to how View Engine\n // processes/merges module imports in the metadata resolver. See: FW-1349.\n if (importTypesWithProviders !== undefined) {\n processInjectorTypesWithProviders(importTypesWithProviders, visitor);\n }\n }\n if (!isDuplicate) {\n // Track the InjectorType and add a provider for it.\n // It's important that this is done after the def's imports.\n const factory = getFactoryDef(defType) || (() => new defType());\n // Append extra providers to make more info available for consumers (to retrieve an injector\n // type), as well as internally (to calculate an injection scope correctly and eagerly\n // instantiate a `defType` when an injector is created).\n // Provider to create `defType` using its factory.\n visitor({ provide: defType, useFactory: factory, deps: EMPTY_ARRAY }, defType);\n // Make this `defType` available to an internal logic that calculates injector scope.\n visitor({ provide: INJECTOR_DEF_TYPES, useValue: defType, multi: true }, defType);\n // Provider to eagerly instantiate `defType` via `INJECTOR_INITIALIZER`.\n visitor({ provide: ENVIRONMENT_INITIALIZER, useValue: () => ɵɵinject(defType), multi: true }, defType);\n }\n // Next, include providers listed on the definition itself.\n const defProviders = injDef.providers;\n if (defProviders != null && !isDuplicate) {\n const injectorType = container;\n deepForEachProvider(defProviders, (provider) => {\n ngDevMode && validateProvider(provider, defProviders, injectorType);\n visitor(provider, injectorType);\n });\n }\n }\n else {\n // Should not happen, but just in case.\n return false;\n }\n return (defType !== container && container.providers !== undefined);\n}\nfunction validateProvider(provider, providers, containerType) {\n if (isTypeProvider(provider) ||\n isValueProvider(provider) ||\n isFactoryProvider(provider) ||\n isExistingProvider(provider)) {\n return;\n }\n // Here we expect the provider to be a `useClass` provider (by elimination).\n const classRef = resolveForwardRef(provider && (provider.useClass || provider.provide));\n if (!classRef) {\n throwInvalidProviderError(containerType, providers, provider);\n }\n}\nfunction deepForEachProvider(providers, fn) {\n for (let provider of providers) {\n if (isEnvironmentProviders(provider)) {\n provider = provider.ɵproviders;\n }\n if (Array.isArray(provider)) {\n deepForEachProvider(provider, fn);\n }\n else {\n fn(provider);\n }\n }\n}\nconst USE_VALUE$1 = getClosureSafeProperty({\n provide: String,\n useValue: getClosureSafeProperty,\n});\nfunction isValueProvider(value) {\n return value !== null && typeof value == 'object' && USE_VALUE$1 in value;\n}\nfunction isExistingProvider(value) {\n return !!(value && value.useExisting);\n}\nfunction isFactoryProvider(value) {\n return !!(value && value.useFactory);\n}\nfunction isTypeProvider(value) {\n return typeof value === 'function';\n}\nfunction isClassProvider(value) {\n return !!value.useClass;\n}\n\n/**\n * An internal token whose presence in an injector indicates that the injector should treat itself\n * as a root scoped injector when processing requests for unknown tokens which may indicate\n * they are provided in the root scope.\n */\nconst INJECTOR_SCOPE = new InjectionToken(ngDevMode ? 'Set Injector scope.' : '');\n\n/**\n * Marker which indicates that a value has not yet been created from the factory function.\n */\nconst NOT_YET = {};\n/**\n * Marker which indicates that the factory function for a token is in the process of being called.\n *\n * If the injector is asked to inject a token with its value set to CIRCULAR, that indicates\n * injection of a dependency has recursively attempted to inject the original token, and there is\n * a circular dependency among the providers.\n */\nconst CIRCULAR = {};\n/**\n * A lazily initialized NullInjector.\n */\nlet NULL_INJECTOR = undefined;\nfunction getNullInjector() {\n if (NULL_INJECTOR === undefined) {\n NULL_INJECTOR = new NullInjector();\n }\n return NULL_INJECTOR;\n}\n/**\n * An `Injector` that's part of the environment injector hierarchy, which exists outside of the\n * component tree.\n */\nclass EnvironmentInjector {\n}\nclass R3Injector extends EnvironmentInjector {\n parent;\n source;\n scopes;\n /**\n * Map of tokens to records which contain the instances of those tokens.\n * - `null` value implies that we don't have the record. Used by tree-shakable injectors\n * to prevent further searches.\n */\n records = new Map();\n /**\n * Set of values instantiated by this injector which contain `ngOnDestroy` lifecycle hooks.\n */\n _ngOnDestroyHooks = new Set();\n _onDestroyHooks = [];\n /**\n * Flag indicating that this injector was previously destroyed.\n */\n get destroyed() {\n return this._destroyed;\n }\n _destroyed = false;\n injectorDefTypes;\n constructor(providers, parent, source, scopes) {\n super();\n this.parent = parent;\n this.source = source;\n this.scopes = scopes;\n // Start off by creating Records for every provider.\n forEachSingleProvider(providers, (provider) => this.processProvider(provider));\n // Make sure the INJECTOR token provides this injector.\n this.records.set(INJECTOR$1, makeRecord(undefined, this));\n // And `EnvironmentInjector` if the current injector is supposed to be env-scoped.\n if (scopes.has('environment')) {\n this.records.set(EnvironmentInjector, makeRecord(undefined, this));\n }\n // Detect whether this injector has the APP_ROOT_SCOPE token and thus should provide\n // any injectable scoped to APP_ROOT_SCOPE.\n const record = this.records.get(INJECTOR_SCOPE);\n if (record != null && typeof record.value === 'string') {\n this.scopes.add(record.value);\n }\n this.injectorDefTypes = new Set(this.get(INJECTOR_DEF_TYPES, EMPTY_ARRAY, InjectFlags.Self));\n }\n /**\n * Destroy the injector and release references to every instance or provider associated with it.\n *\n * Also calls the `OnDestroy` lifecycle hooks of every instance that was created for which a\n * hook was found.\n */\n destroy() {\n assertNotDestroyed(this);\n // Set destroyed = true first, in case lifecycle hooks re-enter destroy().\n this._destroyed = true;\n const prevConsumer = setActiveConsumer$1(null);\n try {\n // Call all the lifecycle hooks.\n for (const service of this._ngOnDestroyHooks) {\n service.ngOnDestroy();\n }\n const onDestroyHooks = this._onDestroyHooks;\n // Reset the _onDestroyHooks array before iterating over it to prevent hooks that unregister\n // themselves from mutating the array during iteration.\n this._onDestroyHooks = [];\n for (const hook of onDestroyHooks) {\n hook();\n }\n }\n finally {\n // Release all references.\n this.records.clear();\n this._ngOnDestroyHooks.clear();\n this.injectorDefTypes.clear();\n setActiveConsumer$1(prevConsumer);\n }\n }\n onDestroy(callback) {\n assertNotDestroyed(this);\n this._onDestroyHooks.push(callback);\n return () => this.removeOnDestroy(callback);\n }\n runInContext(fn) {\n assertNotDestroyed(this);\n const previousInjector = setCurrentInjector(this);\n const previousInjectImplementation = setInjectImplementation(undefined);\n let prevInjectContext;\n if (ngDevMode) {\n prevInjectContext = setInjectorProfilerContext({ injector: this, token: null });\n }\n try {\n return fn();\n }\n finally {\n setCurrentInjector(previousInjector);\n setInjectImplementation(previousInjectImplementation);\n ngDevMode && setInjectorProfilerContext(prevInjectContext);\n }\n }\n get(token, notFoundValue = THROW_IF_NOT_FOUND, flags = InjectFlags.Default) {\n assertNotDestroyed(this);\n if (token.hasOwnProperty(NG_ENV_ID)) {\n return token[NG_ENV_ID](this);\n }\n flags = convertToBitFlags(flags);\n // Set the injection context.\n let prevInjectContext;\n if (ngDevMode) {\n prevInjectContext = setInjectorProfilerContext({ injector: this, token: token });\n }\n const previousInjector = setCurrentInjector(this);\n const previousInjectImplementation = setInjectImplementation(undefined);\n try {\n // Check for the SkipSelf flag.\n if (!(flags & InjectFlags.SkipSelf)) {\n // SkipSelf isn't set, check if the record belongs to this injector.\n let record = this.records.get(token);\n if (record === undefined) {\n // No record, but maybe the token is scoped to this injector. Look for an injectable\n // def with a scope matching this injector.\n const def = couldBeInjectableType(token) && getInjectableDef(token);\n if (def && this.injectableDefInScope(def)) {\n // Found an injectable def and it's scoped to this injector. Pretend as if it was here\n // all along.\n if (ngDevMode) {\n runInInjectorProfilerContext(this, token, () => {\n emitProviderConfiguredEvent(token);\n });\n }\n record = makeRecord(injectableDefOrInjectorDefFactory(token), NOT_YET);\n }\n else {\n record = null;\n }\n this.records.set(token, record);\n }\n // If a record was found, get the instance for it and return it.\n if (record != null /* NOT null || undefined */) {\n return this.hydrate(token, record);\n }\n }\n // Select the next injector based on the Self flag - if self is set, the next injector is\n // the NullInjector, otherwise it's the parent.\n const nextInjector = !(flags & InjectFlags.Self) ? this.parent : getNullInjector();\n // Set the notFoundValue based on the Optional flag - if optional is set and notFoundValue\n // is undefined, the value is null, otherwise it's the notFoundValue.\n notFoundValue =\n flags & InjectFlags.Optional && notFoundValue === THROW_IF_NOT_FOUND ? null : notFoundValue;\n return nextInjector.get(token, notFoundValue);\n }\n catch (e) {\n if (e.name === 'NullInjectorError') {\n const path = (e[NG_TEMP_TOKEN_PATH] = e[NG_TEMP_TOKEN_PATH] || []);\n path.unshift(stringify(token));\n if (previousInjector) {\n // We still have a parent injector, keep throwing\n throw e;\n }\n else {\n // Format & throw the final error message when we don't have any previous injector\n return catchInjectorError(e, token, 'R3InjectorError', this.source);\n }\n }\n else {\n throw e;\n }\n }\n finally {\n // Lastly, restore the previous injection context.\n setInjectImplementation(previousInjectImplementation);\n setCurrentInjector(previousInjector);\n ngDevMode && setInjectorProfilerContext(prevInjectContext);\n }\n }\n /** @internal */\n resolveInjectorInitializers() {\n const prevConsumer = setActiveConsumer$1(null);\n const previousInjector = setCurrentInjector(this);\n const previousInjectImplementation = setInjectImplementation(undefined);\n let prevInjectContext;\n if (ngDevMode) {\n prevInjectContext = setInjectorProfilerContext({ injector: this, token: null });\n }\n try {\n const initializers = this.get(ENVIRONMENT_INITIALIZER, EMPTY_ARRAY, InjectFlags.Self);\n if (ngDevMode && !Array.isArray(initializers)) {\n throw new RuntimeError(-209 /* RuntimeErrorCode.INVALID_MULTI_PROVIDER */, 'Unexpected type of the `ENVIRONMENT_INITIALIZER` token value ' +\n `(expected an array, but got ${typeof initializers}). ` +\n 'Please check that the `ENVIRONMENT_INITIALIZER` token is configured as a ' +\n '`multi: true` provider.');\n }\n for (const initializer of initializers) {\n initializer();\n }\n }\n finally {\n setCurrentInjector(previousInjector);\n setInjectImplementation(previousInjectImplementation);\n ngDevMode && setInjectorProfilerContext(prevInjectContext);\n setActiveConsumer$1(prevConsumer);\n }\n }\n toString() {\n const tokens = [];\n const records = this.records;\n for (const token of records.keys()) {\n tokens.push(stringify(token));\n }\n return `R3Injector[${tokens.join(', ')}]`;\n }\n /**\n * Process a `SingleProvider` and add it.\n */\n processProvider(provider) {\n // Determine the token from the provider. Either it's its own token, or has a {provide: ...}\n // property.\n provider = resolveForwardRef(provider);\n let token = isTypeProvider(provider)\n ? provider\n : resolveForwardRef(provider && provider.provide);\n // Construct a `Record` for the provider.\n const record = providerToRecord(provider);\n if (ngDevMode) {\n runInInjectorProfilerContext(this, token, () => {\n // Emit InjectorProfilerEventType.Create if provider is a value provider because\n // these are the only providers that do not go through the value hydration logic\n // where this event would normally be emitted from.\n if (isValueProvider(provider)) {\n emitInstanceCreatedByInjectorEvent(provider.useValue);\n }\n emitProviderConfiguredEvent(provider);\n });\n }\n if (!isTypeProvider(provider) && provider.multi === true) {\n // If the provider indicates that it's a multi-provider, process it specially.\n // First check whether it's been defined already.\n let multiRecord = this.records.get(token);\n if (multiRecord) {\n // It has. Throw a nice error if\n if (ngDevMode && multiRecord.multi === undefined) {\n throwMixedMultiProviderError();\n }\n }\n else {\n multiRecord = makeRecord(undefined, NOT_YET, true);\n multiRecord.factory = () => injectArgs(multiRecord.multi);\n this.records.set(token, multiRecord);\n }\n token = provider;\n multiRecord.multi.push(provider);\n }\n else {\n if (ngDevMode) {\n const existing = this.records.get(token);\n if (existing && existing.multi !== undefined) {\n throwMixedMultiProviderError();\n }\n }\n }\n this.records.set(token, record);\n }\n hydrate(token, record) {\n const prevConsumer = setActiveConsumer$1(null);\n try {\n if (record.value === CIRCULAR) {\n throwCyclicDependencyError(stringify(token));\n }\n else if (record.value === NOT_YET) {\n record.value = CIRCULAR;\n if (ngDevMode) {\n runInInjectorProfilerContext(this, token, () => {\n record.value = record.factory();\n emitInstanceCreatedByInjectorEvent(record.value);\n });\n }\n else {\n record.value = record.factory();\n }\n }\n if (typeof record.value === 'object' && record.value && hasOnDestroy(record.value)) {\n this._ngOnDestroyHooks.add(record.value);\n }\n return record.value;\n }\n finally {\n setActiveConsumer$1(prevConsumer);\n }\n }\n injectableDefInScope(def) {\n if (!def.providedIn) {\n return false;\n }\n const providedIn = resolveForwardRef(def.providedIn);\n if (typeof providedIn === 'string') {\n return providedIn === 'any' || this.scopes.has(providedIn);\n }\n else {\n return this.injectorDefTypes.has(providedIn);\n }\n }\n removeOnDestroy(callback) {\n const destroyCBIdx = this._onDestroyHooks.indexOf(callback);\n if (destroyCBIdx !== -1) {\n this._onDestroyHooks.splice(destroyCBIdx, 1);\n }\n }\n}\nfunction injectableDefOrInjectorDefFactory(token) {\n // Most tokens will have an injectable def directly on them, which specifies a factory directly.\n const injectableDef = getInjectableDef(token);\n const factory = injectableDef !== null ? injectableDef.factory : getFactoryDef(token);\n if (factory !== null) {\n return factory;\n }\n // InjectionTokens should have an injectable def (ɵprov) and thus should be handled above.\n // If it's missing that, it's an error.\n if (token instanceof InjectionToken) {\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode && `Token ${stringify(token)} is missing a ɵprov definition.`);\n }\n // Undecorated types can sometimes be created if they have no constructor arguments.\n if (token instanceof Function) {\n return getUndecoratedInjectableFactory(token);\n }\n // There was no way to resolve a factory for this token.\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode && 'unreachable');\n}\nfunction getUndecoratedInjectableFactory(token) {\n // If the token has parameters then it has dependencies that we cannot resolve implicitly.\n const paramLength = token.length;\n if (paramLength > 0) {\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode &&\n `Can't resolve all parameters for ${stringify(token)}: (${newArray(paramLength, '?').join(', ')}).`);\n }\n // The constructor function appears to have no parameters.\n // This might be because it inherits from a super-class. In which case, use an injectable\n // def from an ancestor if there is one.\n // Otherwise this really is a simple class with no dependencies, so return a factory that\n // just instantiates the zero-arg constructor.\n const inheritedInjectableDef = getInheritedInjectableDef(token);\n if (inheritedInjectableDef !== null) {\n return () => inheritedInjectableDef.factory(token);\n }\n else {\n return () => new token();\n }\n}\nfunction providerToRecord(provider) {\n if (isValueProvider(provider)) {\n return makeRecord(undefined, provider.useValue);\n }\n else {\n const factory = providerToFactory(provider);\n return makeRecord(factory, NOT_YET);\n }\n}\n/**\n * Converts a `SingleProvider` into a factory function.\n *\n * @param provider provider to convert to factory\n */\nfunction providerToFactory(provider, ngModuleType, providers) {\n let factory = undefined;\n if (ngDevMode && isEnvironmentProviders(provider)) {\n throwInvalidProviderError(undefined, providers, provider);\n }\n if (isTypeProvider(provider)) {\n const unwrappedProvider = resolveForwardRef(provider);\n return getFactoryDef(unwrappedProvider) || injectableDefOrInjectorDefFactory(unwrappedProvider);\n }\n else {\n if (isValueProvider(provider)) {\n factory = () => resolveForwardRef(provider.useValue);\n }\n else if (isFactoryProvider(provider)) {\n factory = () => provider.useFactory(...injectArgs(provider.deps || []));\n }\n else if (isExistingProvider(provider)) {\n factory = () => ɵɵinject(resolveForwardRef(provider.useExisting));\n }\n else {\n const classRef = resolveForwardRef(provider &&\n (provider.useClass || provider.provide));\n if (ngDevMode && !classRef) {\n throwInvalidProviderError(ngModuleType, providers, provider);\n }\n if (hasDeps(provider)) {\n factory = () => new classRef(...injectArgs(provider.deps));\n }\n else {\n return getFactoryDef(classRef) || injectableDefOrInjectorDefFactory(classRef);\n }\n }\n }\n return factory;\n}\nfunction assertNotDestroyed(injector) {\n if (injector.destroyed) {\n throw new RuntimeError(205 /* RuntimeErrorCode.INJECTOR_ALREADY_DESTROYED */, ngDevMode && 'Injector has already been destroyed.');\n }\n}\nfunction makeRecord(factory, value, multi = false) {\n return {\n factory: factory,\n value: value,\n multi: multi ? [] : undefined,\n };\n}\nfunction hasDeps(value) {\n return !!value.deps;\n}\nfunction hasOnDestroy(value) {\n return (value !== null &&\n typeof value === 'object' &&\n typeof value.ngOnDestroy === 'function');\n}\nfunction couldBeInjectableType(value) {\n return (typeof value === 'function' || (typeof value === 'object' && value instanceof InjectionToken));\n}\nfunction forEachSingleProvider(providers, fn) {\n for (const provider of providers) {\n if (Array.isArray(provider)) {\n forEachSingleProvider(provider, fn);\n }\n else if (provider && isEnvironmentProviders(provider)) {\n forEachSingleProvider(provider.ɵproviders, fn);\n }\n else {\n fn(provider);\n }\n }\n}\n\n/**\n * Runs the given function in the [context](guide/di/dependency-injection-context) of the given\n * `Injector`.\n *\n * Within the function's stack frame, [`inject`](api/core/inject) can be used to inject dependencies\n * from the given `Injector`. Note that `inject` is only usable synchronously, and cannot be used in\n * any asynchronous callbacks or after any `await` points.\n *\n * @param injector the injector which will satisfy calls to [`inject`](api/core/inject) while `fn`\n * is executing\n * @param fn the closure to be run in the context of `injector`\n * @returns the return value of the function, if any\n * @publicApi\n */\nfunction runInInjectionContext(injector, fn) {\n if (injector instanceof R3Injector) {\n assertNotDestroyed(injector);\n }\n let prevInjectorProfilerContext;\n if (ngDevMode) {\n prevInjectorProfilerContext = setInjectorProfilerContext({ injector, token: null });\n }\n const prevInjector = setCurrentInjector(injector);\n const previousInjectImplementation = setInjectImplementation(undefined);\n try {\n return fn();\n }\n finally {\n setCurrentInjector(prevInjector);\n ngDevMode && setInjectorProfilerContext(prevInjectorProfilerContext);\n setInjectImplementation(previousInjectImplementation);\n }\n}\n/**\n * Whether the current stack frame is inside an injection context.\n */\nfunction isInInjectionContext() {\n return getInjectImplementation() !== undefined || getCurrentInjector() != null;\n}\n/**\n * Asserts that the current stack frame is within an [injection\n * context](guide/di/dependency-injection-context) and has access to `inject`.\n *\n * @param debugFn a reference to the function making the assertion (used for the error message).\n *\n * @publicApi\n */\nfunction assertInInjectionContext(debugFn) {\n // Taking a `Function` instead of a string name here prevents the unminified name of the function\n // from being retained in the bundle regardless of minification.\n if (!isInInjectionContext()) {\n throw new RuntimeError(-203 /* RuntimeErrorCode.MISSING_INJECTION_CONTEXT */, ngDevMode &&\n debugFn.name +\n '() can only be used within an injection context such as a constructor, a factory function, a field initializer, or a function used with `runInInjectionContext`');\n }\n}\n\nvar FactoryTarget;\n(function (FactoryTarget) {\n FactoryTarget[FactoryTarget[\"Directive\"] = 0] = \"Directive\";\n FactoryTarget[FactoryTarget[\"Component\"] = 1] = \"Component\";\n FactoryTarget[FactoryTarget[\"Injectable\"] = 2] = \"Injectable\";\n FactoryTarget[FactoryTarget[\"Pipe\"] = 3] = \"Pipe\";\n FactoryTarget[FactoryTarget[\"NgModule\"] = 4] = \"NgModule\";\n})(FactoryTarget || (FactoryTarget = {}));\nvar R3TemplateDependencyKind;\n(function (R3TemplateDependencyKind) {\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"Directive\"] = 0] = \"Directive\";\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"Pipe\"] = 1] = \"Pipe\";\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"NgModule\"] = 2] = \"NgModule\";\n})(R3TemplateDependencyKind || (R3TemplateDependencyKind = {}));\nvar ViewEncapsulation$1;\n(function (ViewEncapsulation) {\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n // Historically the 1 value was for `Native` encapsulation which has been removed as of v11.\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation$1 || (ViewEncapsulation$1 = {}));\n\nfunction getCompilerFacade(request) {\n const globalNg = _global['ng'];\n if (globalNg && globalNg.ɵcompilerFacade) {\n return globalNg.ɵcompilerFacade;\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n // Log the type as an error so that a developer can easily navigate to the type from the\n // console.\n console.error(`JIT compilation failed for ${request.kind}`, request.type);\n let message = `The ${request.kind} '${request.type.name}' needs to be compiled using the JIT compiler, but '@angular/compiler' is not available.\\n\\n`;\n if (request.usage === 1 /* JitCompilerUsage.PartialDeclaration */) {\n message += `The ${request.kind} is part of a library that has been partially compiled.\\n`;\n message += `However, the Angular Linker has not processed the library such that JIT compilation is used as fallback.\\n`;\n message += '\\n';\n message += `Ideally, the library is processed using the Angular Linker to become fully AOT compiled.\\n`;\n }\n else {\n message += `JIT compilation is discouraged for production use-cases! Consider using AOT mode instead.\\n`;\n }\n message += `Alternatively, the JIT compiler should be loaded by bootstrapping using '@angular/platform-browser-dynamic' or '@angular/platform-server',\\n`;\n message += `or manually provide the compiler with 'import \"@angular/compiler\";' before bootstrapping.`;\n throw new Error(message);\n }\n else {\n throw new Error('JIT compiler unavailable');\n }\n}\n\n/**\n * A mapping of the @angular/core API surface used in generated expressions to the actual symbols.\n *\n * This should be kept up to date with the public exports of @angular/core.\n */\nconst angularCoreDiEnv = {\n 'ɵɵdefineInjectable': ɵɵdefineInjectable,\n 'ɵɵdefineInjector': ɵɵdefineInjector,\n 'ɵɵinject': ɵɵinject,\n 'ɵɵinvalidFactoryDep': ɵɵinvalidFactoryDep,\n 'resolveForwardRef': resolveForwardRef,\n};\n\n/**\n * @description\n *\n * Represents a type that a Component or other object is instances of.\n *\n * An example of a `Type` is `MyCustomComponent` class, which in JavaScript is represented by\n * the `MyCustomComponent` constructor function.\n *\n * @publicApi\n */\nconst Type = Function;\nfunction isType(v) {\n return typeof v === 'function';\n}\n\n/*\n * #########################\n * Attention: These Regular expressions have to hold even if the code is minified!\n * ##########################\n */\n/**\n * Regular expression that detects pass-through constructors for ES5 output. This Regex\n * intends to capture the common delegation pattern emitted by TypeScript and Babel. Also\n * it intends to capture the pattern where existing constructors have been downleveled from\n * ES2015 to ES5 using TypeScript w/ downlevel iteration. e.g.\n *\n * ```ts\n * function MyClass() {\n * var _this = _super.apply(this, arguments) || this;\n * ```\n *\n * downleveled to ES5 with `downlevelIteration` for TypeScript < 4.2:\n * ```ts\n * function MyClass() {\n * var _this = _super.apply(this, __spread(arguments)) || this;\n * ```\n *\n * or downleveled to ES5 with `downlevelIteration` for TypeScript >= 4.2:\n * ```ts\n * function MyClass() {\n * var _this = _super.apply(this, __spreadArray([], __read(arguments), false)) || this;\n * ```\n *\n * More details can be found in: https://github.com/angular/angular/issues/38453.\n */\nconst ES5_DELEGATE_CTOR = /^function\\s+\\S+\\(\\)\\s*{[\\s\\S]+\\.apply\\(this,\\s*(arguments|(?:[^()]+\\(\\[\\],)?[^()]+\\(arguments\\).*)\\)/;\n/** Regular expression that detects ES2015 classes which extend from other classes. */\nconst ES2015_INHERITED_CLASS = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{/;\n/**\n * Regular expression that detects ES2015 classes which extend from other classes and\n * have an explicit constructor defined.\n */\nconst ES2015_INHERITED_CLASS_WITH_CTOR = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{[\\s\\S]*constructor\\s*\\(/;\n/**\n * Regular expression that detects ES2015 classes which extend from other classes\n * and inherit a constructor.\n */\nconst ES2015_INHERITED_CLASS_WITH_DELEGATE_CTOR = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{[\\s\\S]*constructor\\s*\\(\\)\\s*{[^}]*super\\(\\.\\.\\.arguments\\)/;\n/**\n * Determine whether a stringified type is a class which delegates its constructor\n * to its parent.\n *\n * This is not trivial since compiled code can actually contain a constructor function\n * even if the original source code did not. For instance, when the child class contains\n * an initialized instance property.\n */\nfunction isDelegateCtor(typeStr) {\n return (ES5_DELEGATE_CTOR.test(typeStr) ||\n ES2015_INHERITED_CLASS_WITH_DELEGATE_CTOR.test(typeStr) ||\n (ES2015_INHERITED_CLASS.test(typeStr) && !ES2015_INHERITED_CLASS_WITH_CTOR.test(typeStr)));\n}\nclass ReflectionCapabilities {\n _reflect;\n constructor(reflect) {\n this._reflect = reflect || _global['Reflect'];\n }\n factory(t) {\n return (...args) => new t(...args);\n }\n /** @internal */\n _zipTypesAndAnnotations(paramTypes, paramAnnotations) {\n let result;\n if (typeof paramTypes === 'undefined') {\n result = newArray(paramAnnotations.length);\n }\n else {\n result = newArray(paramTypes.length);\n }\n for (let i = 0; i < result.length; i++) {\n // TS outputs Object for parameters without types, while Traceur omits\n // the annotations. For now we preserve the Traceur behavior to aid\n // migration, but this can be revisited.\n if (typeof paramTypes === 'undefined') {\n result[i] = [];\n }\n else if (paramTypes[i] && paramTypes[i] != Object) {\n result[i] = [paramTypes[i]];\n }\n else {\n result[i] = [];\n }\n if (paramAnnotations && paramAnnotations[i] != null) {\n result[i] = result[i].concat(paramAnnotations[i]);\n }\n }\n return result;\n }\n _ownParameters(type, parentCtor) {\n const typeStr = type.toString();\n // If we have no decorators, we only have function.length as metadata.\n // In that case, to detect whether a child class declared an own constructor or not,\n // we need to look inside of that constructor to check whether it is\n // just calling the parent.\n // This also helps to work around for https://github.com/Microsoft/TypeScript/issues/12439\n // that sets 'design:paramtypes' to []\n // if a class inherits from another class but has no ctor declared itself.\n if (isDelegateCtor(typeStr)) {\n return null;\n }\n // Prefer the direct API.\n if (type.parameters && type.parameters !== parentCtor.parameters) {\n return type.parameters;\n }\n // API of tsickle for lowering decorators to properties on the class.\n const tsickleCtorParams = type.ctorParameters;\n if (tsickleCtorParams && tsickleCtorParams !== parentCtor.ctorParameters) {\n // Newer tsickle uses a function closure\n // Retain the non-function case for compatibility with older tsickle\n const ctorParameters = typeof tsickleCtorParams === 'function' ? tsickleCtorParams() : tsickleCtorParams;\n const paramTypes = ctorParameters.map((ctorParam) => ctorParam && ctorParam.type);\n const paramAnnotations = ctorParameters.map((ctorParam) => ctorParam && convertTsickleDecoratorIntoMetadata(ctorParam.decorators));\n return this._zipTypesAndAnnotations(paramTypes, paramAnnotations);\n }\n // API for metadata created by invoking the decorators.\n const paramAnnotations = type.hasOwnProperty(PARAMETERS) && type[PARAMETERS];\n const paramTypes = this._reflect &&\n this._reflect.getOwnMetadata &&\n this._reflect.getOwnMetadata('design:paramtypes', type);\n if (paramTypes || paramAnnotations) {\n return this._zipTypesAndAnnotations(paramTypes, paramAnnotations);\n }\n // If a class has no decorators, at least create metadata\n // based on function.length.\n // Note: We know that this is a real constructor as we checked\n // the content of the constructor above.\n return newArray(type.length);\n }\n parameters(type) {\n // Note: only report metadata if we have at least one class decorator\n // to stay in sync with the static reflector.\n if (!isType(type)) {\n return [];\n }\n const parentCtor = getParentCtor(type);\n let parameters = this._ownParameters(type, parentCtor);\n if (!parameters && parentCtor !== Object) {\n parameters = this.parameters(parentCtor);\n }\n return parameters || [];\n }\n _ownAnnotations(typeOrFunc, parentCtor) {\n // Prefer the direct API.\n if (typeOrFunc.annotations && typeOrFunc.annotations !== parentCtor.annotations) {\n let annotations = typeOrFunc.annotations;\n if (typeof annotations === 'function' && annotations.annotations) {\n annotations = annotations.annotations;\n }\n return annotations;\n }\n // API of tsickle for lowering decorators to properties on the class.\n if (typeOrFunc.decorators && typeOrFunc.decorators !== parentCtor.decorators) {\n return convertTsickleDecoratorIntoMetadata(typeOrFunc.decorators);\n }\n // API for metadata created by invoking the decorators.\n if (typeOrFunc.hasOwnProperty(ANNOTATIONS)) {\n return typeOrFunc[ANNOTATIONS];\n }\n return null;\n }\n annotations(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return [];\n }\n const parentCtor = getParentCtor(typeOrFunc);\n const ownAnnotations = this._ownAnnotations(typeOrFunc, parentCtor) || [];\n const parentAnnotations = parentCtor !== Object ? this.annotations(parentCtor) : [];\n return parentAnnotations.concat(ownAnnotations);\n }\n _ownPropMetadata(typeOrFunc, parentCtor) {\n // Prefer the direct API.\n if (typeOrFunc.propMetadata &&\n typeOrFunc.propMetadata !== parentCtor.propMetadata) {\n let propMetadata = typeOrFunc.propMetadata;\n if (typeof propMetadata === 'function' && propMetadata.propMetadata) {\n propMetadata = propMetadata.propMetadata;\n }\n return propMetadata;\n }\n // API of tsickle for lowering decorators to properties on the class.\n if (typeOrFunc.propDecorators &&\n typeOrFunc.propDecorators !== parentCtor.propDecorators) {\n const propDecorators = typeOrFunc.propDecorators;\n const propMetadata = {};\n Object.keys(propDecorators).forEach((prop) => {\n propMetadata[prop] = convertTsickleDecoratorIntoMetadata(propDecorators[prop]);\n });\n return propMetadata;\n }\n // API for metadata created by invoking the decorators.\n if (typeOrFunc.hasOwnProperty(PROP_METADATA)) {\n return typeOrFunc[PROP_METADATA];\n }\n return null;\n }\n propMetadata(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return {};\n }\n const parentCtor = getParentCtor(typeOrFunc);\n const propMetadata = {};\n if (parentCtor !== Object) {\n const parentPropMetadata = this.propMetadata(parentCtor);\n Object.keys(parentPropMetadata).forEach((propName) => {\n propMetadata[propName] = parentPropMetadata[propName];\n });\n }\n const ownPropMetadata = this._ownPropMetadata(typeOrFunc, parentCtor);\n if (ownPropMetadata) {\n Object.keys(ownPropMetadata).forEach((propName) => {\n const decorators = [];\n if (propMetadata.hasOwnProperty(propName)) {\n decorators.push(...propMetadata[propName]);\n }\n decorators.push(...ownPropMetadata[propName]);\n propMetadata[propName] = decorators;\n });\n }\n return propMetadata;\n }\n ownPropMetadata(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return {};\n }\n return this._ownPropMetadata(typeOrFunc, getParentCtor(typeOrFunc)) || {};\n }\n hasLifecycleHook(type, lcProperty) {\n return type instanceof Type && lcProperty in type.prototype;\n }\n}\nfunction convertTsickleDecoratorIntoMetadata(decoratorInvocations) {\n if (!decoratorInvocations) {\n return [];\n }\n return decoratorInvocations.map((decoratorInvocation) => {\n const decoratorType = decoratorInvocation.type;\n const annotationCls = decoratorType.annotationCls;\n const annotationArgs = decoratorInvocation.args ? decoratorInvocation.args : [];\n return new annotationCls(...annotationArgs);\n });\n}\nfunction getParentCtor(ctor) {\n const parentProto = ctor.prototype ? Object.getPrototypeOf(ctor.prototype) : null;\n const parentCtor = parentProto ? parentProto.constructor : null;\n // Note: We always use `Object` as the null value\n // to simplify checking later on.\n return parentCtor || Object;\n}\n\n// Below are constants for LView indices to help us look up LView members\n// without having to remember the specific indices.\n// Uglify will inline these when minifying so there shouldn't be a cost.\nconst HOST = 0;\nconst TVIEW = 1;\n// Shared with LContainer\nconst FLAGS = 2;\nconst PARENT = 3;\nconst NEXT = 4;\nconst T_HOST = 5;\n// End shared with LContainer\nconst HYDRATION = 6;\nconst CLEANUP = 7;\nconst CONTEXT = 8;\nconst INJECTOR = 9;\nconst ENVIRONMENT = 10;\nconst RENDERER = 11;\nconst CHILD_HEAD = 12;\nconst CHILD_TAIL = 13;\n// FIXME(misko): Investigate if the three declarations aren't all same thing.\nconst DECLARATION_VIEW = 14;\nconst DECLARATION_COMPONENT_VIEW = 15;\nconst DECLARATION_LCONTAINER = 16;\nconst PREORDER_HOOK_FLAGS = 17;\nconst QUERIES = 18;\nconst ID = 19;\nconst EMBEDDED_VIEW_INJECTOR = 20;\nconst ON_DESTROY_HOOKS = 21;\nconst EFFECTS_TO_SCHEDULE = 22;\nconst EFFECTS = 23;\nconst REACTIVE_TEMPLATE_CONSUMER = 24;\nconst AFTER_RENDER_SEQUENCES_TO_ADD = 25;\n/**\n * Size of LView's header. Necessary to adjust for it when setting slots.\n *\n * IMPORTANT: `HEADER_OFFSET` should only be referred to the in the `ɵɵ*` instructions to translate\n * instruction index into `LView` index. All other indexes should be in the `LView` index space and\n * there should be no need to refer to `HEADER_OFFSET` anywhere else.\n */\nconst HEADER_OFFSET = 26;\n\n/**\n * Special location which allows easy identification of type. If we have an array which was\n * retrieved from the `LView` and that array has `true` at `TYPE` location, we know it is\n * `LContainer`.\n */\nconst TYPE = 1;\n/**\n * Below are constants for LContainer indices to help us look up LContainer members\n * without having to remember the specific indices.\n * Uglify will inline these when minifying so there shouldn't be a cost.\n */\n// FLAGS, PARENT, NEXT, and T_HOST are indices 2, 3, 4, and 5\n// As we already have these constants in LView, we don't need to re-create them.\nconst DEHYDRATED_VIEWS = 6;\nconst NATIVE = 7;\nconst VIEW_REFS = 8;\nconst MOVED_VIEWS = 9;\n/**\n * Size of LContainer's header. Represents the index after which all views in the\n * container will be inserted. We need to keep a record of current views so we know\n * which views are already in the DOM (and don't need to be re-added) and so we can\n * remove views from the DOM when they are no longer required.\n */\nconst CONTAINER_HEADER_OFFSET = 10;\n\n/**\n * True if `value` is `LView`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLView(value) {\n return Array.isArray(value) && typeof value[TYPE] === 'object';\n}\n/**\n * True if `value` is `LContainer`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLContainer(value) {\n return Array.isArray(value) && value[TYPE] === true;\n}\nfunction isContentQueryHost(tNode) {\n return (tNode.flags & 4 /* TNodeFlags.hasContentQuery */) !== 0;\n}\nfunction isComponentHost(tNode) {\n return tNode.componentOffset > -1;\n}\nfunction isDirectiveHost(tNode) {\n return (tNode.flags & 1 /* TNodeFlags.isDirectiveHost */) === 1 /* TNodeFlags.isDirectiveHost */;\n}\nfunction isComponentDef(def) {\n return !!def.template;\n}\nfunction isRootView(target) {\n // Determines whether a given LView is marked as a root view.\n return (target[FLAGS] & 512 /* LViewFlags.IsRoot */) !== 0;\n}\nfunction isProjectionTNode(tNode) {\n return (tNode.type & 16 /* TNodeType.Projection */) === 16 /* TNodeType.Projection */;\n}\nfunction hasI18n(lView) {\n return (lView[FLAGS] & 32 /* LViewFlags.HasI18n */) === 32 /* LViewFlags.HasI18n */;\n}\nfunction isDestroyed(lView) {\n // Determines whether a given LView is marked as destroyed.\n return (lView[FLAGS] & 256 /* LViewFlags.Destroyed */) === 256 /* LViewFlags.Destroyed */;\n}\n\n// [Assert functions do not constraint type when they are guarded by a truthy\n// expression.](https://github.com/microsoft/TypeScript/issues/37295)\nfunction assertTNodeForLView(tNode, lView) {\n assertTNodeForTView(tNode, lView[TVIEW]);\n}\nfunction assertTNodeForTView(tNode, tView) {\n assertTNode(tNode);\n const tData = tView.data;\n for (let i = HEADER_OFFSET; i < tData.length; i++) {\n if (tData[i] === tNode) {\n return;\n }\n }\n throwError('This TNode does not belong to this TView.');\n}\nfunction assertTNode(tNode) {\n assertDefined(tNode, 'TNode must be defined');\n if (!(tNode && typeof tNode === 'object' && tNode.hasOwnProperty('directiveStylingLast'))) {\n throwError('Not of type TNode, got: ' + tNode);\n }\n}\nfunction assertTIcu(tIcu) {\n assertDefined(tIcu, 'Expected TIcu to be defined');\n if (!(typeof tIcu.currentCaseLViewIndex === 'number')) {\n throwError('Object is not of TIcu type.');\n }\n}\nfunction assertComponentType(actual, msg = \"Type passed in is not ComponentType, it does not have 'ɵcmp' property.\") {\n if (!getComponentDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertNgModuleType(actual, msg = \"Type passed in is not NgModuleType, it does not have 'ɵmod' property.\") {\n if (!getNgModuleDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertCurrentTNodeIsParent(isParent) {\n assertEqual(isParent, true, 'currentTNode should be a parent');\n}\nfunction assertHasParent(tNode) {\n assertDefined(tNode, 'currentTNode should exist!');\n assertDefined(tNode.parent, 'currentTNode should have a parent');\n}\nfunction assertLContainer(value) {\n assertDefined(value, 'LContainer must be defined');\n assertEqual(isLContainer(value), true, 'Expecting LContainer');\n}\nfunction assertLViewOrUndefined(value) {\n value && assertEqual(isLView(value), true, 'Expecting LView or undefined or null');\n}\nfunction assertLView(value) {\n assertDefined(value, 'LView must be defined');\n assertEqual(isLView(value), true, 'Expecting LView');\n}\nfunction assertFirstCreatePass(tView, errMessage) {\n assertEqual(tView.firstCreatePass, true, errMessage || 'Should only be called in first create pass.');\n}\nfunction assertFirstUpdatePass(tView, errMessage) {\n assertEqual(tView.firstUpdatePass, true, errMessage || 'Should only be called in first update pass.');\n}\n/**\n * This is a basic sanity check that an object is probably a directive def. DirectiveDef is\n * an interface, so we can't do a direct instanceof check.\n */\nfunction assertDirectiveDef(obj) {\n if (obj.type === undefined || obj.selectors == undefined || obj.inputs === undefined) {\n throwError(`Expected a DirectiveDef/ComponentDef and this object does not seem to have the expected shape.`);\n }\n}\nfunction assertIndexInDeclRange(tView, index) {\n assertBetween(HEADER_OFFSET, tView.bindingStartIndex, index);\n}\nfunction assertIndexInExpandoRange(lView, index) {\n const tView = lView[1];\n assertBetween(tView.expandoStartIndex, lView.length, index);\n}\nfunction assertBetween(lower, upper, index) {\n if (!(lower <= index && index < upper)) {\n throwError(`Index out of range (expecting ${lower} <= ${index} < ${upper})`);\n }\n}\nfunction assertProjectionSlots(lView, errMessage) {\n assertDefined(lView[DECLARATION_COMPONENT_VIEW], 'Component views should exist.');\n assertDefined(lView[DECLARATION_COMPONENT_VIEW][T_HOST].projection, errMessage ||\n 'Components with projection nodes () must have projection slots defined.');\n}\nfunction assertParentView(lView, errMessage) {\n assertDefined(lView, errMessage || \"Component views should always have a parent view (component's host view)\");\n}\nfunction assertNoDuplicateDirectives$1(directives) {\n // The array needs at least two elements in order to have duplicates.\n if (directives.length < 2) {\n return;\n }\n const seenDirectives = new Set();\n for (const current of directives) {\n if (seenDirectives.has(current)) {\n throw new RuntimeError(309 /* RuntimeErrorCode.DUPLICATE_DIRECTIVE */, `Directive ${current.type.name} matches multiple times on the same element. ` +\n `Directives can only match an element once.`);\n }\n seenDirectives.add(current);\n }\n}\n/**\n * This is a basic sanity check that the `injectorIndex` seems to point to what looks like a\n * NodeInjector data structure.\n *\n * @param lView `LView` which should be checked.\n * @param injectorIndex index into the `LView` where the `NodeInjector` is expected.\n */\nfunction assertNodeInjector(lView, injectorIndex) {\n assertIndexInExpandoRange(lView, injectorIndex);\n assertIndexInExpandoRange(lView, injectorIndex + 8 /* NodeInjectorOffset.PARENT */);\n assertNumber(lView[injectorIndex + 0], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 1], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 2], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 3], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 4], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 5], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 6], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 7], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 8 /* NodeInjectorOffset.PARENT */], 'injectorIndex should point to parent injector');\n}\n\n/**\n * Represents a basic change from a previous to a new value for a single\n * property on a directive instance. Passed as a value in a\n * {@link SimpleChanges} object to the `ngOnChanges` hook.\n *\n * @see {@link OnChanges}\n *\n * @publicApi\n */\nclass SimpleChange {\n previousValue;\n currentValue;\n firstChange;\n constructor(previousValue, currentValue, firstChange) {\n this.previousValue = previousValue;\n this.currentValue = currentValue;\n this.firstChange = firstChange;\n }\n /**\n * Check whether the new value is the first value assigned.\n */\n isFirstChange() {\n return this.firstChange;\n }\n}\n\nfunction applyValueToInputField(instance, inputSignalNode, privateName, value) {\n if (inputSignalNode !== null) {\n inputSignalNode.applyValueToInputSignal(inputSignalNode, value);\n }\n else {\n instance[privateName] = value;\n }\n}\n\n/**\n * The NgOnChangesFeature decorates a component with support for the ngOnChanges\n * lifecycle hook, so it should be included in any component that implements\n * that hook.\n *\n * If the component or directive uses inheritance, the NgOnChangesFeature MUST\n * be included as a feature AFTER {@link InheritDefinitionFeature}, otherwise\n * inherited properties will not be propagated to the ngOnChanges lifecycle\n * hook.\n *\n * Example usage:\n *\n * ```ts\n * static ɵcmp = defineComponent({\n * ...\n * inputs: {name: 'publicName'},\n * features: [NgOnChangesFeature]\n * });\n * ```\n *\n * @codeGenApi\n */\nconst ɵɵNgOnChangesFeature = /* @__PURE__ */ (() => {\n const ɵɵNgOnChangesFeatureImpl = () => NgOnChangesFeatureImpl;\n // This option ensures that the ngOnChanges lifecycle hook will be inherited\n // from superclasses (in InheritDefinitionFeature).\n /** @nocollapse */\n ɵɵNgOnChangesFeatureImpl.ngInherit = true;\n return ɵɵNgOnChangesFeatureImpl;\n})();\nfunction NgOnChangesFeatureImpl(definition) {\n if (definition.type.prototype.ngOnChanges) {\n definition.setInput = ngOnChangesSetInput;\n }\n return rememberChangeHistoryAndInvokeOnChangesHook;\n}\n/**\n * This is a synthetic lifecycle hook which gets inserted into `TView.preOrderHooks` to simulate\n * `ngOnChanges`.\n *\n * The hook reads the `NgSimpleChangesStore` data from the component instance and if changes are\n * found it invokes `ngOnChanges` on the component instance.\n *\n * @param this Component instance. Because this function gets inserted into `TView.preOrderHooks`,\n * it is guaranteed to be called with component instance.\n */\nfunction rememberChangeHistoryAndInvokeOnChangesHook() {\n const simpleChangesStore = getSimpleChangesStore(this);\n const current = simpleChangesStore?.current;\n if (current) {\n const previous = simpleChangesStore.previous;\n if (previous === EMPTY_OBJ) {\n simpleChangesStore.previous = current;\n }\n else {\n // New changes are copied to the previous store, so that we don't lose history for inputs\n // which were not changed this time\n for (let key in current) {\n previous[key] = current[key];\n }\n }\n simpleChangesStore.current = null;\n this.ngOnChanges(current);\n }\n}\nfunction ngOnChangesSetInput(instance, inputSignalNode, value, publicName, privateName) {\n const declaredName = this.declaredInputs[publicName];\n ngDevMode && assertString(declaredName, 'Name of input in ngOnChanges has to be a string');\n const simpleChangesStore = getSimpleChangesStore(instance) ||\n setSimpleChangesStore(instance, { previous: EMPTY_OBJ, current: null });\n const current = simpleChangesStore.current || (simpleChangesStore.current = {});\n const previous = simpleChangesStore.previous;\n const previousChange = previous[declaredName];\n current[declaredName] = new SimpleChange(previousChange && previousChange.currentValue, value, previous === EMPTY_OBJ);\n applyValueToInputField(instance, inputSignalNode, privateName, value);\n}\nconst SIMPLE_CHANGES_STORE = '__ngSimpleChanges__';\nfunction getSimpleChangesStore(instance) {\n return instance[SIMPLE_CHANGES_STORE] || null;\n}\nfunction setSimpleChangesStore(instance, store) {\n return (instance[SIMPLE_CHANGES_STORE] = store);\n}\n\nlet profilerCallback = null;\n/**\n * Sets the callback function which will be invoked before and after performing certain actions at\n * runtime (for example, before and after running change detection).\n *\n * Warning: this function is *INTERNAL* and should not be relied upon in application's code.\n * The contract of the function might be changed in any release and/or the function can be removed\n * completely.\n *\n * @param profiler function provided by the caller or null value to disable profiling.\n */\nconst setProfiler = (profiler) => {\n profilerCallback = profiler;\n};\n/**\n * Profiler function which wraps user code executed by the runtime.\n *\n * @param event ProfilerEvent corresponding to the execution context\n * @param instance component instance\n * @param hookOrListener lifecycle hook function or output listener. The value depends on the\n * execution context\n * @returns\n */\nconst profiler = function (event, instance = null, hookOrListener) {\n if (profilerCallback != null /* both `null` and `undefined` */) {\n profilerCallback(event, instance, hookOrListener);\n }\n};\n\nconst SVG_NAMESPACE = 'svg';\nconst MATH_ML_NAMESPACE = 'math';\n\n/**\n * For efficiency reasons we often put several different data types (`RNode`, `LView`, `LContainer`)\n * in same location in `LView`. This is because we don't want to pre-allocate space for it\n * because the storage is sparse. This file contains utilities for dealing with such data types.\n *\n * How do we know what is stored at a given location in `LView`.\n * - `Array.isArray(value) === false` => `RNode` (The normal storage value)\n * - `Array.isArray(value) === true` => then the `value[0]` represents the wrapped value.\n * - `typeof value[TYPE] === 'object'` => `LView`\n * - This happens when we have a component at a given location\n * - `typeof value[TYPE] === true` => `LContainer`\n * - This happens when we have `LContainer` binding at a given location.\n *\n *\n * NOTE: it is assumed that `Array.isArray` and `typeof` operations are very efficient.\n */\n/**\n * Returns `RNode`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapRNode(value) {\n while (Array.isArray(value)) {\n value = value[HOST];\n }\n return value;\n}\n/**\n * Returns `LView` or `null` if not found.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapLView(value) {\n while (Array.isArray(value)) {\n // This check is same as `isLView()` but we don't call at as we don't want to call\n // `Array.isArray()` twice and give JITer more work for inlining.\n if (typeof value[TYPE] === 'object')\n return value;\n value = value[HOST];\n }\n return null;\n}\n/**\n * Retrieves an element value from the provided `viewData`, by unwrapping\n * from any containers, component views, or style contexts.\n */\nfunction getNativeByIndex(index, lView) {\n ngDevMode && assertIndexInRange(lView, index);\n ngDevMode && assertGreaterThanOrEqual(index, HEADER_OFFSET, 'Expected to be past HEADER_OFFSET');\n return unwrapRNode(lView[index]);\n}\n/**\n * Retrieve an `RNode` for a given `TNode` and `LView`.\n *\n * This function guarantees in dev mode to retrieve a non-null `RNode`.\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNode(tNode, lView) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n ngDevMode && assertIndexInRange(lView, tNode.index);\n const node = unwrapRNode(lView[tNode.index]);\n return node;\n}\n/**\n * Retrieve an `RNode` or `null` for a given `TNode` and `LView`.\n *\n * Some `TNode`s don't have associated `RNode`s. For example `Projection`\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNodeOrNull(tNode, lView) {\n const index = tNode === null ? -1 : tNode.index;\n if (index !== -1) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n const node = unwrapRNode(lView[index]);\n return node;\n }\n return null;\n}\n// fixme(misko): The return Type should be `TNode|null`\nfunction getTNode(tView, index) {\n ngDevMode && assertGreaterThan(index, -1, 'wrong index for TNode');\n ngDevMode && assertLessThan(index, tView.data.length, 'wrong index for TNode');\n const tNode = tView.data[index];\n ngDevMode && tNode !== null && assertTNode(tNode);\n return tNode;\n}\n/** Retrieves a value from any `LView` or `TData`. */\nfunction load(view, index) {\n ngDevMode && assertIndexInRange(view, index);\n return view[index];\n}\nfunction getComponentLViewByIndex(nodeIndex, hostView) {\n // Could be an LView or an LContainer. If LContainer, unwrap to find LView.\n ngDevMode && assertIndexInRange(hostView, nodeIndex);\n const slotValue = hostView[nodeIndex];\n const lView = isLView(slotValue) ? slotValue : slotValue[HOST];\n return lView;\n}\n/** Checks whether a given view is in creation mode */\nfunction isCreationMode(view) {\n return (view[FLAGS] & 4 /* LViewFlags.CreationMode */) === 4 /* LViewFlags.CreationMode */;\n}\n/**\n * Returns a boolean for whether the view is attached to the change detection tree.\n *\n * Note: This determines whether a view should be checked, not whether it's inserted\n * into a container. For that, you'll want `viewAttachedToContainer` below.\n */\nfunction viewAttachedToChangeDetector(view) {\n return (view[FLAGS] & 128 /* LViewFlags.Attached */) === 128 /* LViewFlags.Attached */;\n}\n/** Returns a boolean for whether the view is attached to a container. */\nfunction viewAttachedToContainer(view) {\n return isLContainer(view[PARENT]);\n}\nfunction getConstant(consts, index) {\n if (index === null || index === undefined)\n return null;\n ngDevMode && assertIndexInRange(consts, index);\n return consts[index];\n}\n/**\n * Resets the pre-order hook flags of the view.\n * @param lView the LView on which the flags are reset\n */\nfunction resetPreOrderHookFlags(lView) {\n lView[PREORDER_HOOK_FLAGS] = 0;\n}\n/**\n * Adds the `RefreshView` flag from the lView and updates HAS_CHILD_VIEWS_TO_REFRESH flag of\n * parents.\n */\nfunction markViewForRefresh(lView) {\n if (lView[FLAGS] & 1024 /* LViewFlags.RefreshView */) {\n return;\n }\n lView[FLAGS] |= 1024 /* LViewFlags.RefreshView */;\n if (viewAttachedToChangeDetector(lView)) {\n markAncestorsForTraversal(lView);\n }\n}\n/**\n * Walks up the LView hierarchy.\n * @param nestingLevel Number of times to walk up in hierarchy.\n * @param currentView View from which to start the lookup.\n */\nfunction walkUpViews(nestingLevel, currentView) {\n while (nestingLevel > 0) {\n ngDevMode &&\n assertDefined(currentView[DECLARATION_VIEW], 'Declaration view should be defined if nesting level is greater than 0.');\n currentView = currentView[DECLARATION_VIEW];\n nestingLevel--;\n }\n return currentView;\n}\nfunction requiresRefreshOrTraversal(lView) {\n return !!(lView[FLAGS] & (1024 /* LViewFlags.RefreshView */ | 8192 /* LViewFlags.HasChildViewsToRefresh */) ||\n lView[REACTIVE_TEMPLATE_CONSUMER]?.dirty);\n}\n/**\n * Updates the `HasChildViewsToRefresh` flag on the parents of the `LView` as well as the\n * parents above.\n */\nfunction updateAncestorTraversalFlagsOnAttach(lView) {\n lView[ENVIRONMENT].changeDetectionScheduler?.notify(8 /* NotificationSource.ViewAttached */);\n if (lView[FLAGS] & 64 /* LViewFlags.Dirty */) {\n lView[FLAGS] |= 1024 /* LViewFlags.RefreshView */;\n }\n if (requiresRefreshOrTraversal(lView)) {\n markAncestorsForTraversal(lView);\n }\n}\n/**\n * Ensures views above the given `lView` are traversed during change detection even when they are\n * not dirty.\n *\n * This is done by setting the `HAS_CHILD_VIEWS_TO_REFRESH` flag up to the root, stopping when the\n * flag is already `true` or the `lView` is detached.\n */\nfunction markAncestorsForTraversal(lView) {\n lView[ENVIRONMENT].changeDetectionScheduler?.notify(0 /* NotificationSource.MarkAncestorsForTraversal */);\n let parent = getLViewParent(lView);\n while (parent !== null) {\n // We stop adding markers to the ancestors once we reach one that already has the marker. This\n // is to avoid needlessly traversing all the way to the root when the marker already exists.\n if (parent[FLAGS] & 8192 /* LViewFlags.HasChildViewsToRefresh */) {\n break;\n }\n parent[FLAGS] |= 8192 /* LViewFlags.HasChildViewsToRefresh */;\n if (!viewAttachedToChangeDetector(parent)) {\n break;\n }\n parent = getLViewParent(parent);\n }\n}\n/**\n * Stores a LView-specific destroy callback.\n */\nfunction storeLViewOnDestroy(lView, onDestroyCallback) {\n if (isDestroyed(lView)) {\n throw new RuntimeError(911 /* RuntimeErrorCode.VIEW_ALREADY_DESTROYED */, ngDevMode && 'View has already been destroyed.');\n }\n if (lView[ON_DESTROY_HOOKS] === null) {\n lView[ON_DESTROY_HOOKS] = [];\n }\n lView[ON_DESTROY_HOOKS].push(onDestroyCallback);\n}\n/**\n * Removes previously registered LView-specific destroy callback.\n */\nfunction removeLViewOnDestroy(lView, onDestroyCallback) {\n if (lView[ON_DESTROY_HOOKS] === null)\n return;\n const destroyCBIdx = lView[ON_DESTROY_HOOKS].indexOf(onDestroyCallback);\n if (destroyCBIdx !== -1) {\n lView[ON_DESTROY_HOOKS].splice(destroyCBIdx, 1);\n }\n}\n/**\n * Gets the parent LView of the passed LView, if the PARENT is an LContainer, will get the parent of\n * that LContainer, which is an LView\n * @param lView the lView whose parent to get\n */\nfunction getLViewParent(lView) {\n ngDevMode && assertLView(lView);\n const parent = lView[PARENT];\n return isLContainer(parent) ? parent[PARENT] : parent;\n}\nfunction getOrCreateLViewCleanup(view) {\n // top level variables should not be exported for performance reasons (PERF_NOTES.md)\n return (view[CLEANUP] ??= []);\n}\nfunction getOrCreateTViewCleanup(tView) {\n return (tView.cleanup ??= []);\n}\n/**\n * Saves context for this cleanup function in LView.cleanupInstances.\n *\n * On the first template pass, saves in TView:\n * - Cleanup function\n * - Index of context we just saved in LView.cleanupInstances\n */\nfunction storeCleanupWithContext(tView, lView, context, cleanupFn) {\n const lCleanup = getOrCreateLViewCleanup(lView);\n // Historically the `storeCleanupWithContext` was used to register both framework-level and\n // user-defined cleanup callbacks, but over time those two types of cleanups were separated.\n // This dev mode checks assures that user-level cleanup callbacks are _not_ stored in data\n // structures reserved for framework-specific hooks.\n ngDevMode &&\n assertDefined(context, 'Cleanup context is mandatory when registering framework-level destroy hooks');\n lCleanup.push(context);\n if (tView.firstCreatePass) {\n getOrCreateTViewCleanup(tView).push(cleanupFn, lCleanup.length - 1);\n }\n else {\n // Make sure that no new framework-level cleanup functions are registered after the first\n // template pass is done (and TView data structures are meant to fully constructed).\n if (ngDevMode) {\n Object.freeze(getOrCreateTViewCleanup(tView));\n }\n }\n}\n\nconst instructionState = {\n lFrame: createLFrame(null),\n bindingsEnabled: true,\n skipHydrationRootTNode: null,\n};\nvar CheckNoChangesMode;\n(function (CheckNoChangesMode) {\n CheckNoChangesMode[CheckNoChangesMode[\"Off\"] = 0] = \"Off\";\n CheckNoChangesMode[CheckNoChangesMode[\"Exhaustive\"] = 1] = \"Exhaustive\";\n CheckNoChangesMode[CheckNoChangesMode[\"OnlyDirtyViews\"] = 2] = \"OnlyDirtyViews\";\n})(CheckNoChangesMode || (CheckNoChangesMode = {}));\n/**\n * In this mode, any changes in bindings will throw an ExpressionChangedAfterChecked error.\n *\n * Necessary to support ChangeDetectorRef.checkNoChanges().\n *\n * The `checkNoChanges` function is invoked only in ngDevMode=true and verifies that no unintended\n * changes exist in the change detector or its children.\n */\nlet _checkNoChangesMode = 0; /* CheckNoChangesMode.Off */\n/**\n * Flag used to indicate that we are in the middle running change detection on a view\n *\n * @see detectChangesInViewWhileDirty\n */\nlet _isRefreshingViews = false;\n/**\n * Returns true if the instruction state stack is empty.\n *\n * Intended to be called from tests only (tree shaken otherwise).\n */\nfunction specOnlyIsInstructionStateEmpty() {\n return instructionState.lFrame.parent === null;\n}\nfunction getElementDepthCount() {\n return instructionState.lFrame.elementDepthCount;\n}\nfunction increaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount++;\n}\nfunction decreaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount--;\n}\nfunction getBindingsEnabled() {\n return instructionState.bindingsEnabled;\n}\n/**\n * Returns true if currently inside a skip hydration block.\n * @returns boolean\n */\nfunction isInSkipHydrationBlock$1() {\n return instructionState.skipHydrationRootTNode !== null;\n}\n/**\n * Returns true if this is the root TNode of the skip hydration block.\n * @param tNode the current TNode\n * @returns boolean\n */\nfunction isSkipHydrationRootTNode(tNode) {\n return instructionState.skipHydrationRootTNode === tNode;\n}\n/**\n * Enables directive matching on elements.\n *\n * * Example:\n * ```html\n * \n * Should match component / directive.\n * \n * \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵenableBindings() {\n instructionState.bindingsEnabled = true;\n}\n/**\n * Sets a flag to specify that the TNode is in a skip hydration block.\n * @param tNode the current TNode\n */\nfunction enterSkipHydrationBlock(tNode) {\n instructionState.skipHydrationRootTNode = tNode;\n}\n/**\n * Disables directive matching on element.\n *\n * * Example:\n * ```html\n * \n * Should match component / directive.\n * \n * \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵdisableBindings() {\n instructionState.bindingsEnabled = false;\n}\n/**\n * Clears the root skip hydration node when leaving a skip hydration block.\n */\nfunction leaveSkipHydrationBlock() {\n instructionState.skipHydrationRootTNode = null;\n}\n/**\n * Return the current `LView`.\n */\nfunction getLView() {\n return instructionState.lFrame.lView;\n}\n/**\n * Return the current `TView`.\n */\nfunction getTView() {\n return instructionState.lFrame.tView;\n}\n/**\n * Restores `contextViewData` to the given OpaqueViewState instance.\n *\n * Used in conjunction with the getCurrentView() instruction to save a snapshot\n * of the current view and restore it when listeners are invoked. This allows\n * walking the declaration view tree in listeners to get vars from parent views.\n *\n * @param viewToRestore The OpaqueViewState instance to restore.\n * @returns Context of the restored OpaqueViewState instance.\n *\n * @codeGenApi\n */\nfunction ɵɵrestoreView(viewToRestore) {\n instructionState.lFrame.contextLView = viewToRestore;\n return viewToRestore[CONTEXT];\n}\n/**\n * Clears the view set in `ɵɵrestoreView` from memory. Returns the passed in\n * value so that it can be used as a return value of an instruction.\n *\n * @codeGenApi\n */\nfunction ɵɵresetView(value) {\n instructionState.lFrame.contextLView = null;\n return value;\n}\nfunction getCurrentTNode() {\n let currentTNode = getCurrentTNodePlaceholderOk();\n while (currentTNode !== null && currentTNode.type === 64 /* TNodeType.Placeholder */) {\n currentTNode = currentTNode.parent;\n }\n return currentTNode;\n}\nfunction getCurrentTNodePlaceholderOk() {\n return instructionState.lFrame.currentTNode;\n}\nfunction getCurrentParentTNode() {\n const lFrame = instructionState.lFrame;\n const currentTNode = lFrame.currentTNode;\n return lFrame.isParent ? currentTNode : currentTNode.parent;\n}\nfunction setCurrentTNode(tNode, isParent) {\n ngDevMode && tNode && assertTNodeForTView(tNode, instructionState.lFrame.tView);\n const lFrame = instructionState.lFrame;\n lFrame.currentTNode = tNode;\n lFrame.isParent = isParent;\n}\nfunction isCurrentTNodeParent() {\n return instructionState.lFrame.isParent;\n}\nfunction setCurrentTNodeAsNotParent() {\n instructionState.lFrame.isParent = false;\n}\nfunction getContextLView() {\n const contextLView = instructionState.lFrame.contextLView;\n ngDevMode && assertDefined(contextLView, 'contextLView must be defined.');\n return contextLView;\n}\nfunction isInCheckNoChangesMode() {\n !ngDevMode && throwError('Must never be called in production mode');\n return _checkNoChangesMode !== CheckNoChangesMode.Off;\n}\nfunction isExhaustiveCheckNoChanges() {\n !ngDevMode && throwError('Must never be called in production mode');\n return _checkNoChangesMode === CheckNoChangesMode.Exhaustive;\n}\nfunction setIsInCheckNoChangesMode(mode) {\n !ngDevMode && throwError('Must never be called in production mode');\n _checkNoChangesMode = mode;\n}\nfunction isRefreshingViews() {\n return _isRefreshingViews;\n}\nfunction setIsRefreshingViews(mode) {\n const prev = _isRefreshingViews;\n _isRefreshingViews = mode;\n return prev;\n}\n// top level variables should not be exported for performance reasons (PERF_NOTES.md)\nfunction getBindingRoot() {\n const lFrame = instructionState.lFrame;\n let index = lFrame.bindingRootIndex;\n if (index === -1) {\n index = lFrame.bindingRootIndex = lFrame.tView.bindingStartIndex;\n }\n return index;\n}\nfunction getBindingIndex() {\n return instructionState.lFrame.bindingIndex;\n}\nfunction setBindingIndex(value) {\n return (instructionState.lFrame.bindingIndex = value);\n}\nfunction nextBindingIndex() {\n return instructionState.lFrame.bindingIndex++;\n}\nfunction incrementBindingIndex(count) {\n const lFrame = instructionState.lFrame;\n const index = lFrame.bindingIndex;\n lFrame.bindingIndex = lFrame.bindingIndex + count;\n return index;\n}\nfunction isInI18nBlock() {\n return instructionState.lFrame.inI18n;\n}\nfunction setInI18nBlock(isInI18nBlock) {\n instructionState.lFrame.inI18n = isInI18nBlock;\n}\n/**\n * Set a new binding root index so that host template functions can execute.\n *\n * Bindings inside the host template are 0 index. But because we don't know ahead of time\n * how many host bindings we have we can't pre-compute them. For this reason they are all\n * 0 index and we just shift the root so that they match next available location in the LView.\n *\n * @param bindingRootIndex Root index for `hostBindings`\n * @param currentDirectiveIndex `TData[currentDirectiveIndex]` will point to the current directive\n * whose `hostBindings` are being processed.\n */\nfunction setBindingRootForHostBindings(bindingRootIndex, currentDirectiveIndex) {\n const lFrame = instructionState.lFrame;\n lFrame.bindingIndex = lFrame.bindingRootIndex = bindingRootIndex;\n setCurrentDirectiveIndex(currentDirectiveIndex);\n}\n/**\n * When host binding is executing this points to the directive index.\n * `TView.data[getCurrentDirectiveIndex()]` is `DirectiveDef`\n * `LView[getCurrentDirectiveIndex()]` is directive instance.\n */\nfunction getCurrentDirectiveIndex() {\n return instructionState.lFrame.currentDirectiveIndex;\n}\n/**\n * Sets an index of a directive whose `hostBindings` are being processed.\n *\n * @param currentDirectiveIndex `TData` index where current directive instance can be found.\n */\nfunction setCurrentDirectiveIndex(currentDirectiveIndex) {\n instructionState.lFrame.currentDirectiveIndex = currentDirectiveIndex;\n}\n/**\n * Retrieve the current `DirectiveDef` which is active when `hostBindings` instruction is being\n * executed.\n *\n * @param tData Current `TData` where the `DirectiveDef` will be looked up at.\n */\nfunction getCurrentDirectiveDef(tData) {\n const currentDirectiveIndex = instructionState.lFrame.currentDirectiveIndex;\n return currentDirectiveIndex === -1 ? null : tData[currentDirectiveIndex];\n}\nfunction getCurrentQueryIndex() {\n return instructionState.lFrame.currentQueryIndex;\n}\nfunction setCurrentQueryIndex(value) {\n instructionState.lFrame.currentQueryIndex = value;\n}\n/**\n * Returns a `TNode` of the location where the current `LView` is declared at.\n *\n * @param lView an `LView` that we want to find parent `TNode` for.\n */\nfunction getDeclarationTNode(lView) {\n const tView = lView[TVIEW];\n // Return the declaration parent for embedded views\n if (tView.type === 2 /* TViewType.Embedded */) {\n ngDevMode && assertDefined(tView.declTNode, 'Embedded TNodes should have declaration parents.');\n return tView.declTNode;\n }\n // Components don't have `TView.declTNode` because each instance of component could be\n // inserted in different location, hence `TView.declTNode` is meaningless.\n // Falling back to `T_HOST` in case we cross component boundary.\n if (tView.type === 1 /* TViewType.Component */) {\n return lView[T_HOST];\n }\n // Remaining TNode type is `TViewType.Root` which doesn't have a parent TNode.\n return null;\n}\n/**\n * This is a light weight version of the `enterView` which is needed by the DI system.\n *\n * @param lView `LView` location of the DI context.\n * @param tNode `TNode` for DI context\n * @param flags DI context flags. if `SkipSelf` flag is set than we walk up the declaration\n * tree from `tNode` until we find parent declared `TElementNode`.\n * @returns `true` if we have successfully entered DI associated with `tNode` (or with declared\n * `TNode` if `flags` has `SkipSelf`). Failing to enter DI implies that no associated\n * `NodeInjector` can be found and we should instead use `ModuleInjector`.\n * - If `true` than this call must be fallowed by `leaveDI`\n * - If `false` than this call failed and we should NOT call `leaveDI`\n */\nfunction enterDI(lView, tNode, flags) {\n ngDevMode && assertLViewOrUndefined(lView);\n if (flags & InjectFlags.SkipSelf) {\n ngDevMode && assertTNodeForTView(tNode, lView[TVIEW]);\n let parentTNode = tNode;\n let parentLView = lView;\n while (true) {\n ngDevMode && assertDefined(parentTNode, 'Parent TNode should be defined');\n parentTNode = parentTNode.parent;\n if (parentTNode === null && !(flags & InjectFlags.Host)) {\n parentTNode = getDeclarationTNode(parentLView);\n if (parentTNode === null)\n break;\n // In this case, a parent exists and is definitely an element. So it will definitely\n // have an existing lView as the declaration view, which is why we can assume it's defined.\n ngDevMode && assertDefined(parentLView, 'Parent LView should be defined');\n parentLView = parentLView[DECLARATION_VIEW];\n // In Ivy there are Comment nodes that correspond to ngIf and NgFor embedded directives\n // We want to skip those and look only at Elements and ElementContainers to ensure\n // we're looking at true parent nodes, and not content or other types.\n if (parentTNode.type & (2 /* TNodeType.Element */ | 8 /* TNodeType.ElementContainer */)) {\n break;\n }\n }\n else {\n break;\n }\n }\n if (parentTNode === null) {\n // If we failed to find a parent TNode this means that we should use module injector.\n return false;\n }\n else {\n tNode = parentTNode;\n lView = parentLView;\n }\n }\n ngDevMode && assertTNodeForLView(tNode, lView);\n const lFrame = (instructionState.lFrame = allocLFrame());\n lFrame.currentTNode = tNode;\n lFrame.lView = lView;\n return true;\n}\n/**\n * Swap the current lView with a new lView.\n *\n * For performance reasons we store the lView in the top level of the module.\n * This way we minimize the number of properties to read. Whenever a new view\n * is entered we have to store the lView for later, and when the view is\n * exited the state has to be restored\n *\n * @param newView New lView to become active\n * @returns the previously active lView;\n */\nfunction enterView(newView) {\n ngDevMode && assertNotEqual(newView[0], newView[1], '????');\n ngDevMode && assertLViewOrUndefined(newView);\n const newLFrame = allocLFrame();\n if (ngDevMode) {\n assertEqual(newLFrame.isParent, true, 'Expected clean LFrame');\n assertEqual(newLFrame.lView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.tView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.selectedIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.elementDepthCount, 0, 'Expected clean LFrame');\n assertEqual(newLFrame.currentDirectiveIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentNamespace, null, 'Expected clean LFrame');\n assertEqual(newLFrame.bindingRootIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentQueryIndex, 0, 'Expected clean LFrame');\n }\n const tView = newView[TVIEW];\n instructionState.lFrame = newLFrame;\n ngDevMode && tView.firstChild && assertTNodeForTView(tView.firstChild, tView);\n newLFrame.currentTNode = tView.firstChild;\n newLFrame.lView = newView;\n newLFrame.tView = tView;\n newLFrame.contextLView = newView;\n newLFrame.bindingIndex = tView.bindingStartIndex;\n newLFrame.inI18n = false;\n}\n/**\n * Allocates next free LFrame. This function tries to reuse the `LFrame`s to lower memory pressure.\n */\nfunction allocLFrame() {\n const currentLFrame = instructionState.lFrame;\n const childLFrame = currentLFrame === null ? null : currentLFrame.child;\n const newLFrame = childLFrame === null ? createLFrame(currentLFrame) : childLFrame;\n return newLFrame;\n}\nfunction createLFrame(parent) {\n const lFrame = {\n currentTNode: null,\n isParent: true,\n lView: null,\n tView: null,\n selectedIndex: -1,\n contextLView: null,\n elementDepthCount: 0,\n currentNamespace: null,\n currentDirectiveIndex: -1,\n bindingRootIndex: -1,\n bindingIndex: -1,\n currentQueryIndex: 0,\n parent: parent,\n child: null,\n inI18n: false,\n };\n parent !== null && (parent.child = lFrame); // link the new LFrame for reuse.\n return lFrame;\n}\n/**\n * A lightweight version of leave which is used with DI.\n *\n * This function only resets `currentTNode` and `LView` as those are the only properties\n * used with DI (`enterDI()`).\n *\n * NOTE: This function is reexported as `leaveDI`. However `leaveDI` has return type of `void` where\n * as `leaveViewLight` has `LFrame`. This is so that `leaveViewLight` can be used in `leaveView`.\n */\nfunction leaveViewLight() {\n const oldLFrame = instructionState.lFrame;\n instructionState.lFrame = oldLFrame.parent;\n oldLFrame.currentTNode = null;\n oldLFrame.lView = null;\n return oldLFrame;\n}\n/**\n * This is a lightweight version of the `leaveView` which is needed by the DI system.\n *\n * NOTE: this function is an alias so that we can change the type of the function to have `void`\n * return type.\n */\nconst leaveDI = leaveViewLight;\n/**\n * Leave the current `LView`\n *\n * This pops the `LFrame` with the associated `LView` from the stack.\n *\n * IMPORTANT: We must zero out the `LFrame` values here otherwise they will be retained. This is\n * because for performance reasons we don't release `LFrame` but rather keep it for next use.\n */\nfunction leaveView() {\n const oldLFrame = leaveViewLight();\n oldLFrame.isParent = true;\n oldLFrame.tView = null;\n oldLFrame.selectedIndex = -1;\n oldLFrame.contextLView = null;\n oldLFrame.elementDepthCount = 0;\n oldLFrame.currentDirectiveIndex = -1;\n oldLFrame.currentNamespace = null;\n oldLFrame.bindingRootIndex = -1;\n oldLFrame.bindingIndex = -1;\n oldLFrame.currentQueryIndex = 0;\n}\nfunction nextContextImpl(level) {\n const contextLView = (instructionState.lFrame.contextLView = walkUpViews(level, instructionState.lFrame.contextLView));\n return contextLView[CONTEXT];\n}\n/**\n * Gets the currently selected element index.\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n */\nfunction getSelectedIndex() {\n return instructionState.lFrame.selectedIndex;\n}\n/**\n * Sets the most recent index passed to {@link select}\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n *\n * (Note that if an \"exit function\" was set earlier (via `setElementExitFn()`) then that will be\n * run if and when the provided `index` value is different from the current selected index value.)\n */\nfunction setSelectedIndex(index) {\n ngDevMode &&\n index !== -1 &&\n assertGreaterThanOrEqual(index, HEADER_OFFSET, 'Index must be past HEADER_OFFSET (or -1).');\n ngDevMode &&\n assertLessThan(index, instructionState.lFrame.lView.length, \"Can't set index passed end of LView\");\n instructionState.lFrame.selectedIndex = index;\n}\n/**\n * Gets the `tNode` that represents currently selected element.\n */\nfunction getSelectedTNode() {\n const lFrame = instructionState.lFrame;\n return getTNode(lFrame.tView, lFrame.selectedIndex);\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/2000/svg'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceSVG() {\n instructionState.lFrame.currentNamespace = SVG_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/1998/MathML/'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceMathML() {\n instructionState.lFrame.currentNamespace = MATH_ML_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceHTML() {\n namespaceHTMLInternal();\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n */\nfunction namespaceHTMLInternal() {\n instructionState.lFrame.currentNamespace = null;\n}\nfunction getNamespace() {\n return instructionState.lFrame.currentNamespace;\n}\nlet _wasLastNodeCreated = true;\n/**\n * Retrieves a global flag that indicates whether the most recent DOM node\n * was created or hydrated.\n */\nfunction wasLastNodeCreated() {\n return _wasLastNodeCreated;\n}\n/**\n * Sets a global flag to indicate whether the most recent DOM node\n * was created or hydrated.\n */\nfunction lastNodeWasCreated(flag) {\n _wasLastNodeCreated = flag;\n}\n\n/**\n * Adds all directive lifecycle hooks from the given `DirectiveDef` to the given `TView`.\n *\n * Must be run *only* on the first template pass.\n *\n * Sets up the pre-order hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * @param directiveIndex The index of the directive in LView\n * @param directiveDef The definition containing the hooks to setup in tView\n * @param tView The current TView\n */\nfunction registerPreOrderHooks(directiveIndex, directiveDef, tView) {\n ngDevMode && assertFirstCreatePass(tView);\n const { ngOnChanges, ngOnInit, ngDoCheck } = directiveDef.type.prototype;\n if (ngOnChanges) {\n const wrappedOnChanges = NgOnChangesFeatureImpl(directiveDef);\n (tView.preOrderHooks ??= []).push(directiveIndex, wrappedOnChanges);\n (tView.preOrderCheckHooks ??= []).push(directiveIndex, wrappedOnChanges);\n }\n if (ngOnInit) {\n (tView.preOrderHooks ??= []).push(0 - directiveIndex, ngOnInit);\n }\n if (ngDoCheck) {\n (tView.preOrderHooks ??= []).push(directiveIndex, ngDoCheck);\n (tView.preOrderCheckHooks ??= []).push(directiveIndex, ngDoCheck);\n }\n}\n/**\n *\n * Loops through the directives on the provided `tNode` and queues hooks to be\n * run that are not initialization hooks.\n *\n * Should be executed during `elementEnd()` and similar to\n * preserve hook execution order. Content, view, and destroy hooks for projected\n * components and directives must be called *before* their hosts.\n *\n * Sets up the content, view, and destroy hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * NOTE: This does not set up `onChanges`, `onInit` or `doCheck`, those are set up\n * separately at `elementStart`.\n *\n * @param tView The current TView\n * @param tNode The TNode whose directives are to be searched for hooks to queue\n */\nfunction registerPostOrderHooks(tView, tNode) {\n ngDevMode && assertFirstCreatePass(tView);\n // It's necessary to loop through the directives at elementEnd() (rather than processing in\n // directiveCreate) so we can preserve the current hook order. Content, view, and destroy\n // hooks for projected components and directives must be called *before* their hosts.\n for (let i = tNode.directiveStart, end = tNode.directiveEnd; i < end; i++) {\n const directiveDef = tView.data[i];\n ngDevMode && assertDefined(directiveDef, 'Expecting DirectiveDef');\n const lifecycleHooks = directiveDef.type.prototype;\n const { ngAfterContentInit, ngAfterContentChecked, ngAfterViewInit, ngAfterViewChecked, ngOnDestroy, } = lifecycleHooks;\n if (ngAfterContentInit) {\n (tView.contentHooks ??= []).push(-i, ngAfterContentInit);\n }\n if (ngAfterContentChecked) {\n (tView.contentHooks ??= []).push(i, ngAfterContentChecked);\n (tView.contentCheckHooks ??= []).push(i, ngAfterContentChecked);\n }\n if (ngAfterViewInit) {\n (tView.viewHooks ??= []).push(-i, ngAfterViewInit);\n }\n if (ngAfterViewChecked) {\n (tView.viewHooks ??= []).push(i, ngAfterViewChecked);\n (tView.viewCheckHooks ??= []).push(i, ngAfterViewChecked);\n }\n if (ngOnDestroy != null) {\n (tView.destroyHooks ??= []).push(i, ngOnDestroy);\n }\n }\n}\n/**\n * Executing hooks requires complex logic as we need to deal with 2 constraints.\n *\n * 1. Init hooks (ngOnInit, ngAfterContentInit, ngAfterViewInit) must all be executed once and only\n * once, across many change detection cycles. This must be true even if some hooks throw, or if\n * some recursively trigger a change detection cycle.\n * To solve that, it is required to track the state of the execution of these init hooks.\n * This is done by storing and maintaining flags in the view: the {@link InitPhaseState},\n * and the index within that phase. They can be seen as a cursor in the following structure:\n * [[onInit1, onInit2], [afterContentInit1], [afterViewInit1, afterViewInit2, afterViewInit3]]\n * They are stored as flags in LView[FLAGS].\n *\n * 2. Pre-order hooks can be executed in batches, because of the select instruction.\n * To be able to pause and resume their execution, we also need some state about the hook's array\n * that is being processed:\n * - the index of the next hook to be executed\n * - the number of init hooks already found in the processed part of the array\n * They are stored as flags in LView[PREORDER_HOOK_FLAGS].\n */\n/**\n * Executes pre-order check hooks ( OnChanges, DoChanges) given a view where all the init hooks were\n * executed once. This is a light version of executeInitAndCheckPreOrderHooks where we can skip read\n * / write of the init-hooks related flags.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeCheckHooks(lView, hooks, nodeIndex) {\n callHooks(lView, hooks, 3 /* InitPhaseState.InitPhaseCompleted */, nodeIndex);\n}\n/**\n * Executes post-order init and check hooks (one of AfterContentInit, AfterContentChecked,\n * AfterViewInit, AfterViewChecked) given a view where there are pending init hooks to be executed.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param initPhase A phase for which hooks should be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeInitAndCheckHooks(lView, hooks, initPhase, nodeIndex) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseState.InitPhaseCompleted */, 'Init pre-order hooks should not be called more than once');\n if ((lView[FLAGS] & 3 /* LViewFlags.InitPhaseStateMask */) === initPhase) {\n callHooks(lView, hooks, initPhase, nodeIndex);\n }\n}\nfunction incrementInitPhaseFlags(lView, initPhase) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseState.InitPhaseCompleted */, 'Init hooks phase should not be incremented after all init hooks have been run.');\n let flags = lView[FLAGS];\n if ((flags & 3 /* LViewFlags.InitPhaseStateMask */) === initPhase) {\n flags &= 16383 /* LViewFlags.IndexWithinInitPhaseReset */;\n flags += 1 /* LViewFlags.InitPhaseStateIncrementer */;\n lView[FLAGS] = flags;\n }\n}\n/**\n * Calls lifecycle hooks with their contexts, skipping init hooks if it's not\n * the first LView pass\n *\n * @param currentView The current view\n * @param arr The array in which the hooks are found\n * @param initPhaseState the current state of the init phase\n * @param currentNodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction callHooks(currentView, arr, initPhase, currentNodeIndex) {\n ngDevMode &&\n assertEqual(isInCheckNoChangesMode(), false, 'Hooks should never be run when in check no changes mode.');\n const startIndex = currentNodeIndex !== undefined\n ? currentView[PREORDER_HOOK_FLAGS] & 65535 /* PreOrderHookFlags.IndexOfTheNextPreOrderHookMaskMask */\n : 0;\n const nodeIndexLimit = currentNodeIndex != null ? currentNodeIndex : -1;\n const max = arr.length - 1; // Stop the loop at length - 1, because we look for the hook at i + 1\n let lastNodeIndexFound = 0;\n for (let i = startIndex; i < max; i++) {\n const hook = arr[i + 1];\n if (typeof hook === 'number') {\n lastNodeIndexFound = arr[i];\n if (currentNodeIndex != null && lastNodeIndexFound >= currentNodeIndex) {\n break;\n }\n }\n else {\n const isInitHook = arr[i] < 0;\n if (isInitHook) {\n currentView[PREORDER_HOOK_FLAGS] += 65536 /* PreOrderHookFlags.NumberOfInitHooksCalledIncrementer */;\n }\n if (lastNodeIndexFound < nodeIndexLimit || nodeIndexLimit == -1) {\n callHook(currentView, initPhase, arr, i);\n currentView[PREORDER_HOOK_FLAGS] =\n (currentView[PREORDER_HOOK_FLAGS] & 4294901760 /* PreOrderHookFlags.NumberOfInitHooksCalledMask */) +\n i +\n 2;\n }\n i++;\n }\n }\n}\n/**\n * Executes a single lifecycle hook, making sure that:\n * - it is called in the non-reactive context;\n * - profiling data are registered.\n */\nfunction callHookInternal(directive, hook) {\n profiler(4 /* ProfilerEvent.LifecycleHookStart */, directive, hook);\n const prevConsumer = setActiveConsumer$1(null);\n try {\n hook.call(directive);\n }\n finally {\n setActiveConsumer$1(prevConsumer);\n profiler(5 /* ProfilerEvent.LifecycleHookEnd */, directive, hook);\n }\n}\n/**\n * Execute one hook against the current `LView`.\n *\n * @param currentView The current view\n * @param initPhaseState the current state of the init phase\n * @param arr The array in which the hooks are found\n * @param i The current index within the hook data array\n */\nfunction callHook(currentView, initPhase, arr, i) {\n const isInitHook = arr[i] < 0;\n const hook = arr[i + 1];\n const directiveIndex = isInitHook ? -arr[i] : arr[i];\n const directive = currentView[directiveIndex];\n if (isInitHook) {\n const indexWithintInitPhase = currentView[FLAGS] >> 14 /* LViewFlags.IndexWithinInitPhaseShift */;\n // The init phase state must be always checked here as it may have been recursively updated.\n if (indexWithintInitPhase <\n currentView[PREORDER_HOOK_FLAGS] >> 16 /* PreOrderHookFlags.NumberOfInitHooksCalledShift */ &&\n (currentView[FLAGS] & 3 /* LViewFlags.InitPhaseStateMask */) === initPhase) {\n currentView[FLAGS] += 16384 /* LViewFlags.IndexWithinInitPhaseIncrementer */;\n callHookInternal(directive, hook);\n }\n }\n else {\n callHookInternal(directive, hook);\n }\n}\n\nconst NO_PARENT_INJECTOR = -1;\n/**\n * Each injector is saved in 9 contiguous slots in `LView` and 9 contiguous slots in\n * `TView.data`. This allows us to store information about the current node's tokens (which\n * can be shared in `TView`) as well as the tokens of its ancestor nodes (which cannot be\n * shared, so they live in `LView`).\n *\n * Each of these slots (aside from the last slot) contains a bloom filter. This bloom filter\n * determines whether a directive is available on the associated node or not. This prevents us\n * from searching the directives array at this level unless it's probable the directive is in it.\n *\n * See: https://en.wikipedia.org/wiki/Bloom_filter for more about bloom filters.\n *\n * Because all injectors have been flattened into `LView` and `TViewData`, they cannot typed\n * using interfaces as they were previously. The start index of each `LInjector` and `TInjector`\n * will differ based on where it is flattened into the main array, so it's not possible to know\n * the indices ahead of time and save their types here. The interfaces are still included here\n * for documentation purposes.\n *\n * export interface LInjector extends Array {\n *\n * // Cumulative bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Cumulative bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Cumulative bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Cumulative bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Cumulative bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Cumulative bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Cumulative bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Cumulative bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // We need to store a reference to the injector's parent so DI can keep looking up\n * // the injector tree until it finds the dependency it's looking for.\n * [PARENT_INJECTOR]: number;\n * }\n *\n * export interface TInjector extends Array {\n *\n * // Shared node bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Shared node bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Shared node bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Shared node bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Shared node bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Shared node bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Shared node bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Shared node bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // Necessary to find directive indices for a particular node.\n * [TNODE]: TElementNode|TElementContainerNode|TContainerNode;\n * }\n */\n/**\n * Factory for creating instances of injectors in the NodeInjector.\n *\n * This factory is complicated by the fact that it can resolve `multi` factories as well.\n *\n * NOTE: Some of the fields are optional which means that this class has two hidden classes.\n * - One without `multi` support (most common)\n * - One with `multi` values, (rare).\n *\n * Since VMs can cache up to 4 inline hidden classes this is OK.\n *\n * - Single factory: Only `resolving` and `factory` is defined.\n * - `providers` factory: `componentProviders` is a number and `index = -1`.\n * - `viewProviders` factory: `componentProviders` is a number and `index` points to `providers`.\n */\nclass NodeInjectorFactory {\n factory;\n /**\n * The inject implementation to be activated when using the factory.\n */\n injectImpl;\n /**\n * Marker set to true during factory invocation to see if we get into recursive loop.\n * Recursive loop causes an error to be displayed.\n */\n resolving = false;\n /**\n * Marks that the token can see other Tokens declared in `viewProviders` on the same node.\n */\n canSeeViewProviders;\n /**\n * An array of factories to use in case of `multi` provider.\n */\n multi;\n /**\n * Number of `multi`-providers which belong to the component.\n *\n * This is needed because when multiple components and directives declare the `multi` provider\n * they have to be concatenated in the correct order.\n *\n * Example:\n *\n * If we have a component and directive active an a single element as declared here\n * ```ts\n * component:\n * providers: [ {provide: String, useValue: 'component', multi: true} ],\n * viewProviders: [ {provide: String, useValue: 'componentView', multi: true} ],\n *\n * directive:\n * providers: [ {provide: String, useValue: 'directive', multi: true} ],\n * ```\n *\n * Then the expected results are:\n *\n * ```ts\n * providers: ['component', 'directive']\n * viewProviders: ['component', 'componentView', 'directive']\n * ```\n *\n * The way to think about it is that the `viewProviders` have been inserted after the component\n * but before the directives, which is why we need to know how many `multi`s have been declared by\n * the component.\n */\n componentProviders;\n /**\n * Current index of the Factory in the `data`. Needed for `viewProviders` and `providers` merging.\n * See `providerFactory`.\n */\n index;\n /**\n * Because the same `multi` provider can be declared in `providers` and `viewProviders` it is\n * possible for `viewProviders` to shadow the `providers`. For this reason we store the\n * `provideFactory` of the `providers` so that `providers` can be extended with `viewProviders`.\n *\n * Example:\n *\n * Given:\n * ```ts\n * providers: [ {provide: String, useValue: 'all', multi: true} ],\n * viewProviders: [ {provide: String, useValue: 'viewOnly', multi: true} ],\n * ```\n *\n * We have to return `['all']` in case of content injection, but `['all', 'viewOnly']` in case\n * of view injection. We further have to make sure that the shared instances (in our case\n * `all`) are the exact same instance in both the content as well as the view injection. (We\n * have to make sure that we don't double instantiate.) For this reason the `viewProviders`\n * `Factory` has a pointer to the shadowed `providers` factory so that it can instantiate the\n * `providers` (`['all']`) and then extend it with `viewProviders` (`['all'] + ['viewOnly'] =\n * ['all', 'viewOnly']`).\n */\n providerFactory;\n constructor(\n /**\n * Factory to invoke in order to create a new instance.\n */\n factory, \n /**\n * Set to `true` if the token is declared in `viewProviders` (or if it is component).\n */\n isViewProvider, injectImplementation) {\n this.factory = factory;\n ngDevMode && assertDefined(factory, 'Factory not specified');\n ngDevMode && assertEqual(typeof factory, 'function', 'Expected factory function.');\n this.canSeeViewProviders = isViewProvider;\n this.injectImpl = injectImplementation;\n }\n}\n\n/**\n * Converts `TNodeType` into human readable text.\n * Make sure this matches with `TNodeType`\n */\nfunction toTNodeTypeAsString(tNodeType) {\n let text = '';\n tNodeType & 1 /* TNodeType.Text */ && (text += '|Text');\n tNodeType & 2 /* TNodeType.Element */ && (text += '|Element');\n tNodeType & 4 /* TNodeType.Container */ && (text += '|Container');\n tNodeType & 8 /* TNodeType.ElementContainer */ && (text += '|ElementContainer');\n tNodeType & 16 /* TNodeType.Projection */ && (text += '|Projection');\n tNodeType & 32 /* TNodeType.Icu */ && (text += '|IcuContainer');\n tNodeType & 64 /* TNodeType.Placeholder */ && (text += '|Placeholder');\n tNodeType & 128 /* TNodeType.LetDeclaration */ && (text += '|LetDeclaration');\n return text.length > 0 ? text.substring(1) : text;\n}\n/**\n * Helper function to detect if a given value matches a `TNode` shape.\n *\n * The logic uses the `insertBeforeIndex` and its possible values as\n * a way to differentiate a TNode shape from other types of objects\n * within the `TView.data`. This is not a perfect check, but it can\n * be a reasonable differentiator, since we control the shapes of objects\n * within `TView.data`.\n */\nfunction isTNodeShape(value) {\n return (value != null &&\n typeof value === 'object' &&\n (value.insertBeforeIndex === null ||\n typeof value.insertBeforeIndex === 'number' ||\n Array.isArray(value.insertBeforeIndex)));\n}\nfunction isLetDeclaration(tNode) {\n return !!(tNode.type & 128 /* TNodeType.LetDeclaration */);\n}\n/**\n * Returns `true` if the `TNode` has a directive which has `@Input()` for `class` binding.\n *\n * ```html\n *
\n * ```\n * and\n * ```ts\n * @Directive({\n * })\n * class MyDirective {\n * @Input()\n * class: string;\n * }\n * ```\n *\n * In the above case it is necessary to write the reconciled styling information into the\n * directive's input.\n *\n * @param tNode\n */\nfunction hasClassInput(tNode) {\n return (tNode.flags & 8 /* TNodeFlags.hasClassInput */) !== 0;\n}\n/**\n * Returns `true` if the `TNode` has a directive which has `@Input()` for `style` binding.\n *\n * ```html\n *
\n * ```\n * and\n * ```ts\n * @Directive({\n * })\n * class MyDirective {\n * @Input()\n * class: string;\n * }\n * ```\n *\n * In the above case it is necessary to write the reconciled styling information into the\n * directive's input.\n *\n * @param tNode\n */\nfunction hasStyleInput(tNode) {\n return (tNode.flags & 16 /* TNodeFlags.hasStyleInput */) !== 0;\n}\n\nfunction assertTNodeType(tNode, expectedTypes, message) {\n assertDefined(tNode, 'should be called with a TNode');\n if ((tNode.type & expectedTypes) === 0) {\n throwError(message ||\n `Expected [${toTNodeTypeAsString(expectedTypes)}] but got ${toTNodeTypeAsString(tNode.type)}.`);\n }\n}\nfunction assertPureTNodeType(type) {\n if (!(type === 2 /* TNodeType.Element */ ||\n type === 1 /* TNodeType.Text */ ||\n type === 4 /* TNodeType.Container */ ||\n type === 8 /* TNodeType.ElementContainer */ ||\n type === 32 /* TNodeType.Icu */ ||\n type === 16 /* TNodeType.Projection */ ||\n type === 64 /* TNodeType.Placeholder */ ||\n type === 128 /* TNodeType.LetDeclaration */)) {\n throwError(`Expected TNodeType to have only a single type selected, but got ${toTNodeTypeAsString(type)}.`);\n }\n}\n\n/**\n * Assigns all attribute values to the provided element via the inferred renderer.\n *\n * This function accepts two forms of attribute entries:\n *\n * default: (key, value):\n * attrs = [key1, value1, key2, value2]\n *\n * namespaced: (NAMESPACE_MARKER, uri, name, value)\n * attrs = [NAMESPACE_MARKER, uri, name, value, NAMESPACE_MARKER, uri, name, value]\n *\n * The `attrs` array can contain a mix of both the default and namespaced entries.\n * The \"default\" values are set without a marker, but if the function comes across\n * a marker value then it will attempt to set a namespaced value. If the marker is\n * not of a namespaced value then the function will quit and return the index value\n * where it stopped during the iteration of the attrs array.\n *\n * See [AttributeMarker] to understand what the namespace marker value is.\n *\n * Note that this instruction does not support assigning style and class values to\n * an element. See `elementStart` and `elementHostAttrs` to learn how styling values\n * are applied to an element.\n * @param renderer The renderer to be used\n * @param native The element that the attributes will be assigned to\n * @param attrs The attribute array of values that will be assigned to the element\n * @returns the index value that was last accessed in the attributes array\n */\nfunction setUpAttributes(renderer, native, attrs) {\n let i = 0;\n while (i < attrs.length) {\n const value = attrs[i];\n if (typeof value === 'number') {\n // only namespaces are supported. Other value types (such as style/class\n // entries) are not supported in this function.\n if (value !== 0 /* AttributeMarker.NamespaceURI */) {\n break;\n }\n // we just landed on the marker value ... therefore\n // we should skip to the next entry\n i++;\n const namespaceURI = attrs[i++];\n const attrName = attrs[i++];\n const attrVal = attrs[i++];\n ngDevMode && ngDevMode.rendererSetAttribute++;\n renderer.setAttribute(native, attrName, attrVal, namespaceURI);\n }\n else {\n // attrName is string;\n const attrName = value;\n const attrVal = attrs[++i];\n // Standard attributes\n ngDevMode && ngDevMode.rendererSetAttribute++;\n if (isAnimationProp(attrName)) {\n renderer.setProperty(native, attrName, attrVal);\n }\n else {\n renderer.setAttribute(native, attrName, attrVal);\n }\n i++;\n }\n }\n // another piece of code may iterate over the same attributes array. Therefore\n // it may be helpful to return the exact spot where the attributes array exited\n // whether by running into an unsupported marker or if all the static values were\n // iterated over.\n return i;\n}\n/**\n * Test whether the given value is a marker that indicates that the following\n * attribute values in a `TAttributes` array are only the names of attributes,\n * and not name-value pairs.\n * @param marker The attribute marker to test.\n * @returns true if the marker is a \"name-only\" marker (e.g. `Bindings`, `Template` or `I18n`).\n */\nfunction isNameOnlyAttributeMarker(marker) {\n return (marker === 3 /* AttributeMarker.Bindings */ ||\n marker === 4 /* AttributeMarker.Template */ ||\n marker === 6 /* AttributeMarker.I18n */);\n}\nfunction isAnimationProp(name) {\n // Perf note: accessing charCodeAt to check for the first character of a string is faster as\n // compared to accessing a character at index 0 (ex. name[0]). The main reason for this is that\n // charCodeAt doesn't allocate memory to return a substring.\n return name.charCodeAt(0) === 64 /* CharCode.AT_SIGN */;\n}\n/**\n * Merges `src` `TAttributes` into `dst` `TAttributes` removing any duplicates in the process.\n *\n * This merge function keeps the order of attrs same.\n *\n * @param dst Location of where the merged `TAttributes` should end up.\n * @param src `TAttributes` which should be appended to `dst`\n */\nfunction mergeHostAttrs(dst, src) {\n if (src === null || src.length === 0) {\n // do nothing\n }\n else if (dst === null || dst.length === 0) {\n // We have source, but dst is empty, just make a copy.\n dst = src.slice();\n }\n else {\n let srcMarker = -1 /* AttributeMarker.ImplicitAttributes */;\n for (let i = 0; i < src.length; i++) {\n const item = src[i];\n if (typeof item === 'number') {\n srcMarker = item;\n }\n else {\n if (srcMarker === 0 /* AttributeMarker.NamespaceURI */) {\n // Case where we need to consume `key1`, `key2`, `value` items.\n }\n else if (srcMarker === -1 /* AttributeMarker.ImplicitAttributes */ ||\n srcMarker === 2 /* AttributeMarker.Styles */) {\n // Case where we have to consume `key1` and `value` only.\n mergeHostAttribute(dst, srcMarker, item, null, src[++i]);\n }\n else {\n // Case where we have to consume `key1` only.\n mergeHostAttribute(dst, srcMarker, item, null, null);\n }\n }\n }\n }\n return dst;\n}\n/**\n * Append `key`/`value` to existing `TAttributes` taking region marker and duplicates into account.\n *\n * @param dst `TAttributes` to append to.\n * @param marker Region where the `key`/`value` should be added.\n * @param key1 Key to add to `TAttributes`\n * @param key2 Key to add to `TAttributes` (in case of `AttributeMarker.NamespaceURI`)\n * @param value Value to add or to overwrite to `TAttributes` Only used if `marker` is not Class.\n */\nfunction mergeHostAttribute(dst, marker, key1, key2, value) {\n let i = 0;\n // Assume that new markers will be inserted at the end.\n let markerInsertPosition = dst.length;\n // scan until correct type.\n if (marker === -1 /* AttributeMarker.ImplicitAttributes */) {\n markerInsertPosition = -1;\n }\n else {\n while (i < dst.length) {\n const dstValue = dst[i++];\n if (typeof dstValue === 'number') {\n if (dstValue === marker) {\n markerInsertPosition = -1;\n break;\n }\n else if (dstValue > marker) {\n // We need to save this as we want the markers to be inserted in specific order.\n markerInsertPosition = i - 1;\n break;\n }\n }\n }\n }\n // search until you find place of insertion\n while (i < dst.length) {\n const item = dst[i];\n if (typeof item === 'number') {\n // since `i` started as the index after the marker, we did not find it if we are at the next\n // marker\n break;\n }\n else if (item === key1) {\n // We already have same token\n if (key2 === null) {\n if (value !== null) {\n dst[i + 1] = value;\n }\n return;\n }\n else if (key2 === dst[i + 1]) {\n dst[i + 2] = value;\n return;\n }\n }\n // Increment counter.\n i++;\n if (key2 !== null)\n i++;\n if (value !== null)\n i++;\n }\n // insert at location.\n if (markerInsertPosition !== -1) {\n dst.splice(markerInsertPosition, 0, marker);\n i = markerInsertPosition + 1;\n }\n dst.splice(i++, 0, key1);\n if (key2 !== null) {\n dst.splice(i++, 0, key2);\n }\n if (value !== null) {\n dst.splice(i++, 0, value);\n }\n}\n\n// This default value is when checking the hierarchy for a token.\n//\n// It means both:\n// - the token is not provided by the current injector,\n// - only the element injectors should be checked (ie do not check module injectors\n//\n// mod1\n// /\n// el1 mod2\n// \\ /\n// el2\n//\n// When requesting el2.injector.get(token), we should check in the following order and return the\n// first found value:\n// - el2.injector.get(token, default)\n// - el1.injector.get(token, NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR) -> do not check the module\n// - mod2.injector.get(token, default)\nconst NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR = {};\n\n/**\n * Injector that looks up a value using a specific injector, before falling back to the module\n * injector. Used primarily when creating components or embedded views dynamically.\n */\nclass ChainedInjector {\n injector;\n parentInjector;\n constructor(injector, parentInjector) {\n this.injector = injector;\n this.parentInjector = parentInjector;\n }\n get(token, notFoundValue, flags) {\n flags = convertToBitFlags(flags);\n const value = this.injector.get(token, NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR, flags);\n if (value !== NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR ||\n notFoundValue === NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR) {\n // Return the value from the root element injector when\n // - it provides it\n // (value !== NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR)\n // - the module injector should not be checked\n // (notFoundValue === NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR)\n return value;\n }\n return this.parentInjector.get(token, notFoundValue, flags);\n }\n}\n\n/// Parent Injector Utils ///////////////////////////////////////////////////////////////\nfunction hasParentInjector(parentLocation) {\n return parentLocation !== NO_PARENT_INJECTOR;\n}\nfunction getParentInjectorIndex(parentLocation) {\n if (ngDevMode) {\n assertNumber(parentLocation, 'Number expected');\n assertNotEqual(parentLocation, -1, 'Not a valid state.');\n const parentInjectorIndex = parentLocation & 32767 /* RelativeInjectorLocationFlags.InjectorIndexMask */;\n assertGreaterThan(parentInjectorIndex, HEADER_OFFSET, 'Parent injector must be pointing past HEADER_OFFSET.');\n }\n return parentLocation & 32767 /* RelativeInjectorLocationFlags.InjectorIndexMask */;\n}\nfunction getParentInjectorViewOffset(parentLocation) {\n return parentLocation >> 16 /* RelativeInjectorLocationFlags.ViewOffsetShift */;\n}\n/**\n * Unwraps a parent injector location number to find the view offset from the current injector,\n * then walks up the declaration view tree until the view is found that contains the parent\n * injector.\n *\n * @param location The location of the parent injector, which contains the view offset\n * @param startView The LView instance from which to start walking up the view tree\n * @returns The LView instance that contains the parent injector\n */\nfunction getParentInjectorView(location, startView) {\n let viewOffset = getParentInjectorViewOffset(location);\n let parentView = startView;\n // For most cases, the parent injector can be found on the host node (e.g. for component\n // or container), but we must keep the loop here to support the rarer case of deeply nested\n // tags or inline views, where the parent injector might live many views\n // above the child injector.\n while (viewOffset > 0) {\n parentView = parentView[DECLARATION_VIEW];\n viewOffset--;\n }\n return parentView;\n}\n/**\n * Detects whether an injector is an instance of a `ChainedInjector`,\n * created based on the `OutletInjector`.\n */\nfunction isRouterOutletInjector(currentInjector) {\n return (currentInjector instanceof ChainedInjector &&\n typeof currentInjector.injector.__ngOutletInjector === 'function');\n}\n\n/**\n * Defines if the call to `inject` should include `viewProviders` in its resolution.\n *\n * This is set to true when we try to instantiate a component. This value is reset in\n * `getNodeInjectable` to a value which matches the declaration location of the token about to be\n * instantiated. This is done so that if we are injecting a token which was declared outside of\n * `viewProviders` we don't accidentally pull `viewProviders` in.\n *\n * Example:\n *\n * ```ts\n * @Injectable()\n * class MyService {\n * constructor(public value: String) {}\n * }\n *\n * @Component({\n * providers: [\n * MyService,\n * {provide: String, value: 'providers' }\n * ]\n * viewProviders: [\n * {provide: String, value: 'viewProviders'}\n * ]\n * })\n * class MyComponent {\n * constructor(myService: MyService, value: String) {\n * // We expect that Component can see into `viewProviders`.\n * expect(value).toEqual('viewProviders');\n * // `MyService` was not declared in `viewProviders` hence it can't see it.\n * expect(myService.value).toEqual('providers');\n * }\n * }\n *\n * ```\n */\nlet includeViewProviders = true;\nfunction setIncludeViewProviders(v) {\n const oldValue = includeViewProviders;\n includeViewProviders = v;\n return oldValue;\n}\n/**\n * The number of slots in each bloom filter (used by DI). The larger this number, the fewer\n * directives that will share slots, and thus, the fewer false positives when checking for\n * the existence of a directive.\n */\nconst BLOOM_SIZE = 256;\nconst BLOOM_MASK = BLOOM_SIZE - 1;\n/**\n * The number of bits that is represented by a single bloom bucket. JS bit operations are 32 bits,\n * so each bucket represents 32 distinct tokens which accounts for log2(32) = 5 bits of a bloom hash\n * number.\n */\nconst BLOOM_BUCKET_BITS = 5;\n/** Counter used to generate unique IDs for directives. */\nlet nextNgElementId = 0;\n/** Value used when something wasn't found by an injector. */\nconst NOT_FOUND = {};\n/**\n * Registers this directive as present in its node's injector by flipping the directive's\n * corresponding bit in the injector's bloom filter.\n *\n * @param injectorIndex The index of the node injector where this token should be registered\n * @param tView The TView for the injector's bloom filters\n * @param type The directive token to register\n */\nfunction bloomAdd(injectorIndex, tView, type) {\n ngDevMode && assertEqual(tView.firstCreatePass, true, 'expected firstCreatePass to be true');\n let id;\n if (typeof type === 'string') {\n id = type.charCodeAt(0) || 0;\n }\n else if (type.hasOwnProperty(NG_ELEMENT_ID)) {\n id = type[NG_ELEMENT_ID];\n }\n // Set a unique ID on the directive type, so if something tries to inject the directive,\n // we can easily retrieve the ID and hash it into the bloom bit that should be checked.\n if (id == null) {\n id = type[NG_ELEMENT_ID] = nextNgElementId++;\n }\n // We only have BLOOM_SIZE (256) slots in our bloom filter (8 buckets * 32 bits each),\n // so all unique IDs must be modulo-ed into a number from 0 - 255 to fit into the filter.\n const bloomHash = id & BLOOM_MASK;\n // Create a mask that targets the specific bit associated with the directive.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomHash;\n // Each bloom bucket in `tData` represents `BLOOM_BUCKET_BITS` number of bits of `bloomHash`.\n // Any bits in `bloomHash` beyond `BLOOM_BUCKET_BITS` indicate the bucket offset that the mask\n // should be written to.\n tView.data[injectorIndex + (bloomHash >> BLOOM_BUCKET_BITS)] |= mask;\n}\n/**\n * Creates (or gets an existing) injector for a given element or container.\n *\n * @param tNode for which an injector should be retrieved / created.\n * @param lView View where the node is stored\n * @returns Node injector\n */\nfunction getOrCreateNodeInjectorForNode(tNode, lView) {\n const existingInjectorIndex = getInjectorIndex(tNode, lView);\n if (existingInjectorIndex !== -1) {\n return existingInjectorIndex;\n }\n const tView = lView[TVIEW];\n if (tView.firstCreatePass) {\n tNode.injectorIndex = lView.length;\n insertBloom(tView.data, tNode); // foundation for node bloom\n insertBloom(lView, null); // foundation for cumulative bloom\n insertBloom(tView.blueprint, null);\n }\n const parentLoc = getParentInjectorLocation(tNode, lView);\n const injectorIndex = tNode.injectorIndex;\n // If a parent injector can't be found, its location is set to -1.\n // In that case, we don't need to set up a cumulative bloom\n if (hasParentInjector(parentLoc)) {\n const parentIndex = getParentInjectorIndex(parentLoc);\n const parentLView = getParentInjectorView(parentLoc, lView);\n const parentData = parentLView[TVIEW].data;\n // Creates a cumulative bloom filter that merges the parent's bloom filter\n // and its own cumulative bloom (which contains tokens for all ancestors)\n for (let i = 0; i < 8 /* NodeInjectorOffset.BLOOM_SIZE */; i++) {\n lView[injectorIndex + i] = parentLView[parentIndex + i] | parentData[parentIndex + i];\n }\n }\n lView[injectorIndex + 8 /* NodeInjectorOffset.PARENT */] = parentLoc;\n return injectorIndex;\n}\nfunction insertBloom(arr, footer) {\n arr.push(0, 0, 0, 0, 0, 0, 0, 0, footer);\n}\nfunction getInjectorIndex(tNode, lView) {\n if (tNode.injectorIndex === -1 ||\n // If the injector index is the same as its parent's injector index, then the index has been\n // copied down from the parent node. No injector has been created yet on this node.\n (tNode.parent && tNode.parent.injectorIndex === tNode.injectorIndex) ||\n // After the first template pass, the injector index might exist but the parent values\n // might not have been calculated yet for this instance\n lView[tNode.injectorIndex + 8 /* NodeInjectorOffset.PARENT */] === null) {\n return -1;\n }\n else {\n ngDevMode && assertIndexInRange(lView, tNode.injectorIndex);\n return tNode.injectorIndex;\n }\n}\n/**\n * Finds the index of the parent injector, with a view offset if applicable. Used to set the\n * parent injector initially.\n *\n * @returns Returns a number that is the combination of the number of LViews that we have to go up\n * to find the LView containing the parent inject AND the index of the injector within that LView.\n */\nfunction getParentInjectorLocation(tNode, lView) {\n if (tNode.parent && tNode.parent.injectorIndex !== -1) {\n // If we have a parent `TNode` and there is an injector associated with it we are done, because\n // the parent injector is within the current `LView`.\n return tNode.parent.injectorIndex; // ViewOffset is 0\n }\n // When parent injector location is computed it may be outside of the current view. (ie it could\n // be pointing to a declared parent location). This variable stores number of declaration parents\n // we need to walk up in order to find the parent injector location.\n let declarationViewOffset = 0;\n let parentTNode = null;\n let lViewCursor = lView;\n // The parent injector is not in the current `LView`. We will have to walk the declared parent\n // `LView` hierarchy and look for it. If we walk of the top, that means that there is no parent\n // `NodeInjector`.\n while (lViewCursor !== null) {\n parentTNode = getTNodeFromLView(lViewCursor);\n if (parentTNode === null) {\n // If we have no parent, than we are done.\n return NO_PARENT_INJECTOR;\n }\n ngDevMode && parentTNode && assertTNodeForLView(parentTNode, lViewCursor[DECLARATION_VIEW]);\n // Every iteration of the loop requires that we go to the declared parent.\n declarationViewOffset++;\n lViewCursor = lViewCursor[DECLARATION_VIEW];\n if (parentTNode.injectorIndex !== -1) {\n // We found a NodeInjector which points to something.\n return (parentTNode.injectorIndex |\n (declarationViewOffset <<\n 16 /* RelativeInjectorLocationFlags.ViewOffsetShift */));\n }\n }\n return NO_PARENT_INJECTOR;\n}\n/**\n * Makes a type or an injection token public to the DI system by adding it to an\n * injector's bloom filter.\n *\n * @param di The node injector in which a directive will be added\n * @param token The type or the injection token to be made public\n */\nfunction diPublicInInjector(injectorIndex, tView, token) {\n bloomAdd(injectorIndex, tView, token);\n}\n/**\n * Inject static attribute value into directive constructor.\n *\n * This method is used with `factory` functions which are generated as part of\n * `defineDirective` or `defineComponent`. The method retrieves the static value\n * of an attribute. (Dynamic attributes are not supported since they are not resolved\n * at the time of injection and can change over time.)\n *\n * # Example\n * Given:\n * ```ts\n * @Component(...)\n * class MyComponent {\n * constructor(@Attribute('title') title: string) { ... }\n * }\n * ```\n * When instantiated with\n * ```html\n * \n * ```\n *\n * Then factory method generated is:\n * ```ts\n * MyComponent.ɵcmp = defineComponent({\n * factory: () => new MyComponent(injectAttribute('title'))\n * ...\n * })\n * ```\n *\n * @publicApi\n */\nfunction injectAttributeImpl(tNode, attrNameToInject) {\n ngDevMode && assertTNodeType(tNode, 12 /* TNodeType.AnyContainer */ | 3 /* TNodeType.AnyRNode */);\n ngDevMode && assertDefined(tNode, 'expecting tNode');\n if (attrNameToInject === 'class') {\n return tNode.classes;\n }\n if (attrNameToInject === 'style') {\n return tNode.styles;\n }\n const attrs = tNode.attrs;\n if (attrs) {\n const attrsLength = attrs.length;\n let i = 0;\n while (i < attrsLength) {\n const value = attrs[i];\n // If we hit a `Bindings` or `Template` marker then we are done.\n if (isNameOnlyAttributeMarker(value))\n break;\n // Skip namespaced attributes\n if (value === 0 /* AttributeMarker.NamespaceURI */) {\n // we skip the next two values\n // as namespaced attributes looks like\n // [..., AttributeMarker.NamespaceURI, 'http://someuri.com/test', 'test:exist',\n // 'existValue', ...]\n i = i + 2;\n }\n else if (typeof value === 'number') {\n // Skip to the first value of the marked attribute.\n i++;\n while (i < attrsLength && typeof attrs[i] === 'string') {\n i++;\n }\n }\n else if (value === attrNameToInject) {\n return attrs[i + 1];\n }\n else {\n i = i + 2;\n }\n }\n }\n return null;\n}\nfunction notFoundValueOrThrow(notFoundValue, token, flags) {\n if (flags & InjectFlags.Optional || notFoundValue !== undefined) {\n return notFoundValue;\n }\n else {\n throwProviderNotFoundError(token, 'NodeInjector');\n }\n}\n/**\n * Returns the value associated to the given token from the ModuleInjector or throws exception\n *\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector or throws an exception\n */\nfunction lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue) {\n if (flags & InjectFlags.Optional && notFoundValue === undefined) {\n // This must be set or the NullInjector will throw for optional deps\n notFoundValue = null;\n }\n if ((flags & (InjectFlags.Self | InjectFlags.Host)) === 0) {\n const moduleInjector = lView[INJECTOR];\n // switch to `injectInjectorOnly` implementation for module injector, since module injector\n // should not have access to Component/Directive DI scope (that may happen through\n // `directiveInject` implementation)\n const previousInjectImplementation = setInjectImplementation(undefined);\n try {\n if (moduleInjector) {\n return moduleInjector.get(token, notFoundValue, flags & InjectFlags.Optional);\n }\n else {\n return injectRootLimpMode(token, notFoundValue, flags & InjectFlags.Optional);\n }\n }\n finally {\n setInjectImplementation(previousInjectImplementation);\n }\n }\n return notFoundValueOrThrow(notFoundValue, token, flags);\n}\n/**\n * Returns the value associated to the given token from the NodeInjectors => ModuleInjector.\n *\n * Look for the injector providing the token by walking up the node injector tree and then\n * the module injector tree.\n *\n * This function patches `token` with `__NG_ELEMENT_ID__` which contains the id for the bloom\n * filter. `-1` is reserved for injecting `Injector` (implemented by `NodeInjector`)\n *\n * @param tNode The Node where the search for the injector should start\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector, `null` when not found, or `notFoundValue` if provided\n */\nfunction getOrCreateInjectable(tNode, lView, token, flags = InjectFlags.Default, notFoundValue) {\n if (tNode !== null) {\n // If the view or any of its ancestors have an embedded\n // view injector, we have to look it up there first.\n if (lView[FLAGS] & 2048 /* LViewFlags.HasEmbeddedViewInjector */ &&\n // The token must be present on the current node injector when the `Self`\n // flag is set, so the lookup on embedded view injector(s) can be skipped.\n !(flags & InjectFlags.Self)) {\n const embeddedInjectorValue = lookupTokenUsingEmbeddedInjector(tNode, lView, token, flags, NOT_FOUND);\n if (embeddedInjectorValue !== NOT_FOUND) {\n return embeddedInjectorValue;\n }\n }\n // Otherwise try the node injector.\n const value = lookupTokenUsingNodeInjector(tNode, lView, token, flags, NOT_FOUND);\n if (value !== NOT_FOUND) {\n return value;\n }\n }\n // Finally, fall back to the module injector.\n return lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue);\n}\n/**\n * Returns the value associated to the given token from the node injector.\n *\n * @param tNode The Node where the search for the injector should start\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector, `null` when not found, or `notFoundValue` if provided\n */\nfunction lookupTokenUsingNodeInjector(tNode, lView, token, flags, notFoundValue) {\n const bloomHash = bloomHashBitOrFactory(token);\n // If the ID stored here is a function, this is a special object like ElementRef or TemplateRef\n // so just call the factory function to create it.\n if (typeof bloomHash === 'function') {\n if (!enterDI(lView, tNode, flags)) {\n // Failed to enter DI, try module injector instead. If a token is injected with the @Host\n // flag, the module injector is not searched for that token in Ivy.\n return flags & InjectFlags.Host\n ? notFoundValueOrThrow(notFoundValue, token, flags)\n : lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue);\n }\n try {\n let value;\n if (ngDevMode) {\n runInInjectorProfilerContext(new NodeInjector(getCurrentTNode(), getLView()), token, () => {\n value = bloomHash(flags);\n if (value != null) {\n emitInstanceCreatedByInjectorEvent(value);\n }\n });\n }\n else {\n value = bloomHash(flags);\n }\n if (value == null && !(flags & InjectFlags.Optional)) {\n throwProviderNotFoundError(token);\n }\n else {\n return value;\n }\n }\n finally {\n leaveDI();\n }\n }\n else if (typeof bloomHash === 'number') {\n // A reference to the previous injector TView that was found while climbing the element\n // injector tree. This is used to know if viewProviders can be accessed on the current\n // injector.\n let previousTView = null;\n let injectorIndex = getInjectorIndex(tNode, lView);\n let parentLocation = NO_PARENT_INJECTOR;\n let hostTElementNode = flags & InjectFlags.Host ? lView[DECLARATION_COMPONENT_VIEW][T_HOST] : null;\n // If we should skip this injector, or if there is no injector on this node, start by\n // searching the parent injector.\n if (injectorIndex === -1 || flags & InjectFlags.SkipSelf) {\n parentLocation =\n injectorIndex === -1\n ? getParentInjectorLocation(tNode, lView)\n : lView[injectorIndex + 8 /* NodeInjectorOffset.PARENT */];\n if (parentLocation === NO_PARENT_INJECTOR || !shouldSearchParent(flags, false)) {\n injectorIndex = -1;\n }\n else {\n previousTView = lView[TVIEW];\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n }\n // Traverse up the injector tree until we find a potential match or until we know there\n // *isn't* a match.\n while (injectorIndex !== -1) {\n ngDevMode && assertNodeInjector(lView, injectorIndex);\n // Check the current injector. If it matches, see if it contains token.\n const tView = lView[TVIEW];\n ngDevMode &&\n assertTNodeForLView(tView.data[injectorIndex + 8 /* NodeInjectorOffset.TNODE */], lView);\n if (bloomHasToken(bloomHash, injectorIndex, tView.data)) {\n // At this point, we have an injector which *may* contain the token, so we step through\n // the providers and directives associated with the injector's corresponding node to get\n // the instance.\n const instance = searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode);\n if (instance !== NOT_FOUND) {\n return instance;\n }\n }\n parentLocation = lView[injectorIndex + 8 /* NodeInjectorOffset.PARENT */];\n if (parentLocation !== NO_PARENT_INJECTOR &&\n shouldSearchParent(flags, lView[TVIEW].data[injectorIndex + 8 /* NodeInjectorOffset.TNODE */] === hostTElementNode) &&\n bloomHasToken(bloomHash, injectorIndex, lView)) {\n // The def wasn't found anywhere on this node, so it was a false positive.\n // Traverse up the tree and continue searching.\n previousTView = tView;\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n else {\n // If we should not search parent OR If the ancestor bloom filter value does not have the\n // bit corresponding to the directive we can give up on traversing up to find the specific\n // injector.\n injectorIndex = -1;\n }\n }\n }\n return notFoundValue;\n}\nfunction searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode) {\n const currentTView = lView[TVIEW];\n const tNode = currentTView.data[injectorIndex + 8 /* NodeInjectorOffset.TNODE */];\n // First, we need to determine if view providers can be accessed by the starting element.\n // There are two possibilities\n const canAccessViewProviders = previousTView == null\n ? // 1) This is the first invocation `previousTView == null` which means that we are at the\n // `TNode` of where injector is starting to look. In such a case the only time we are allowed\n // to look into the ViewProviders is if:\n // - we are on a component\n // - AND the injector set `includeViewProviders` to true (implying that the token can see\n // ViewProviders because it is the Component or a Service which itself was declared in\n // ViewProviders)\n isComponentHost(tNode) && includeViewProviders\n : // 2) `previousTView != null` which means that we are now walking across the parent nodes.\n // In such a case we are only allowed to look into the ViewProviders if:\n // - We just crossed from child View to Parent View `previousTView != currentTView`\n // - AND the parent TNode is an Element.\n // This means that we just came from the Component's View and therefore are allowed to see\n // into the ViewProviders.\n previousTView != currentTView && (tNode.type & 3 /* TNodeType.AnyRNode */) !== 0;\n // This special case happens when there is a @host on the inject and when we are searching\n // on the host element node.\n const isHostSpecialCase = flags & InjectFlags.Host && hostTElementNode === tNode;\n const injectableIdx = locateDirectiveOrProvider(tNode, currentTView, token, canAccessViewProviders, isHostSpecialCase);\n if (injectableIdx !== null) {\n return getNodeInjectable(lView, currentTView, injectableIdx, tNode);\n }\n else {\n return NOT_FOUND;\n }\n}\n/**\n * Searches for the given token among the node's directives and providers.\n *\n * @param tNode TNode on which directives are present.\n * @param tView The tView we are currently processing\n * @param token Provider token or type of a directive to look for.\n * @param canAccessViewProviders Whether view providers should be considered.\n * @param isHostSpecialCase Whether the host special case applies.\n * @returns Index of a found directive or provider, or null when none found.\n */\nfunction locateDirectiveOrProvider(tNode, tView, token, canAccessViewProviders, isHostSpecialCase) {\n const nodeProviderIndexes = tNode.providerIndexes;\n const tInjectables = tView.data;\n const injectablesStart = nodeProviderIndexes & 1048575 /* TNodeProviderIndexes.ProvidersStartIndexMask */;\n const directivesStart = tNode.directiveStart;\n const directiveEnd = tNode.directiveEnd;\n const cptViewProvidersCount = nodeProviderIndexes >> 20 /* TNodeProviderIndexes.CptViewProvidersCountShift */;\n const startingIndex = canAccessViewProviders\n ? injectablesStart\n : injectablesStart + cptViewProvidersCount;\n // When the host special case applies, only the viewProviders and the component are visible\n const endIndex = isHostSpecialCase ? injectablesStart + cptViewProvidersCount : directiveEnd;\n for (let i = startingIndex; i < endIndex; i++) {\n const providerTokenOrDef = tInjectables[i];\n if ((i < directivesStart && token === providerTokenOrDef) ||\n (i >= directivesStart && providerTokenOrDef.type === token)) {\n return i;\n }\n }\n if (isHostSpecialCase) {\n const dirDef = tInjectables[directivesStart];\n if (dirDef && isComponentDef(dirDef) && dirDef.type === token) {\n return directivesStart;\n }\n }\n return null;\n}\n/**\n * Retrieve or instantiate the injectable from the `LView` at particular `index`.\n *\n * This function checks to see if the value has already been instantiated and if so returns the\n * cached `injectable`. Otherwise if it detects that the value is still a factory it\n * instantiates the `injectable` and caches the value.\n */\nfunction getNodeInjectable(lView, tView, index, tNode) {\n let value = lView[index];\n const tData = tView.data;\n if (value instanceof NodeInjectorFactory) {\n const factory = value;\n if (factory.resolving) {\n throwCyclicDependencyError(stringifyForError(tData[index]));\n }\n const previousIncludeViewProviders = setIncludeViewProviders(factory.canSeeViewProviders);\n factory.resolving = true;\n let prevInjectContext;\n if (ngDevMode) {\n // tData indexes mirror the concrete instances in its corresponding LView.\n // lView[index] here is either the injectable instace itself or a factory,\n // therefore tData[index] is the constructor of that injectable or a\n // definition object that contains the constructor in a `.type` field.\n const token = tData[index].type || tData[index];\n const injector = new NodeInjector(tNode, lView);\n prevInjectContext = setInjectorProfilerContext({ injector, token });\n }\n const previousInjectImplementation = factory.injectImpl\n ? setInjectImplementation(factory.injectImpl)\n : null;\n const success = enterDI(lView, tNode, InjectFlags.Default);\n ngDevMode &&\n assertEqual(success, true, \"Because flags do not contain `SkipSelf' we expect this to always succeed.\");\n try {\n value = lView[index] = factory.factory(undefined, tData, lView, tNode);\n ngDevMode && emitInstanceCreatedByInjectorEvent(value);\n // This code path is hit for both directives and providers.\n // For perf reasons, we want to avoid searching for hooks on providers.\n // It does no harm to try (the hooks just won't exist), but the extra\n // checks are unnecessary and this is a hot path. So we check to see\n // if the index of the dependency is in the directive range for this\n // tNode. If it's not, we know it's a provider and skip hook registration.\n if (tView.firstCreatePass && index >= tNode.directiveStart) {\n ngDevMode && assertDirectiveDef(tData[index]);\n registerPreOrderHooks(index, tData[index], tView);\n }\n }\n finally {\n ngDevMode && setInjectorProfilerContext(prevInjectContext);\n previousInjectImplementation !== null &&\n setInjectImplementation(previousInjectImplementation);\n setIncludeViewProviders(previousIncludeViewProviders);\n factory.resolving = false;\n leaveDI();\n }\n }\n return value;\n}\n/**\n * Returns the bit in an injector's bloom filter that should be used to determine whether or not\n * the directive might be provided by the injector.\n *\n * When a directive is public, it is added to the bloom filter and given a unique ID that can be\n * retrieved on the Type. When the directive isn't public or the token is not a directive `null`\n * is returned as the node injector can not possibly provide that token.\n *\n * @param token the injection token\n * @returns the matching bit to check in the bloom filter or `null` if the token is not known.\n * When the returned value is negative then it represents special values such as `Injector`.\n */\nfunction bloomHashBitOrFactory(token) {\n ngDevMode && assertDefined(token, 'token must be defined');\n if (typeof token === 'string') {\n return token.charCodeAt(0) || 0;\n }\n const tokenId = \n // First check with `hasOwnProperty` so we don't get an inherited ID.\n token.hasOwnProperty(NG_ELEMENT_ID) ? token[NG_ELEMENT_ID] : undefined;\n // Negative token IDs are used for special objects such as `Injector`\n if (typeof tokenId === 'number') {\n if (tokenId >= 0) {\n return tokenId & BLOOM_MASK;\n }\n else {\n ngDevMode &&\n assertEqual(tokenId, -1 /* InjectorMarkers.Injector */, 'Expecting to get Special Injector Id');\n return createNodeInjector;\n }\n }\n else {\n return tokenId;\n }\n}\nfunction bloomHasToken(bloomHash, injectorIndex, injectorView) {\n // Create a mask that targets the specific bit associated with the directive we're looking for.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomHash;\n // Each bloom bucket in `injectorView` represents `BLOOM_BUCKET_BITS` number of bits of\n // `bloomHash`. Any bits in `bloomHash` beyond `BLOOM_BUCKET_BITS` indicate the bucket offset\n // that should be used.\n const value = injectorView[injectorIndex + (bloomHash >> BLOOM_BUCKET_BITS)];\n // If the bloom filter value has the bit corresponding to the directive's bloomBit flipped on,\n // this injector is a potential match.\n return !!(value & mask);\n}\n/** Returns true if flags prevent parent injector from being searched for tokens */\nfunction shouldSearchParent(flags, isFirstHostTNode) {\n return !(flags & InjectFlags.Self) && !(flags & InjectFlags.Host && isFirstHostTNode);\n}\nfunction getNodeInjectorLView(nodeInjector) {\n return nodeInjector._lView;\n}\nfunction getNodeInjectorTNode(nodeInjector) {\n return nodeInjector._tNode;\n}\nclass NodeInjector {\n _tNode;\n _lView;\n constructor(_tNode, _lView) {\n this._tNode = _tNode;\n this._lView = _lView;\n }\n get(token, notFoundValue, flags) {\n return getOrCreateInjectable(this._tNode, this._lView, token, convertToBitFlags(flags), notFoundValue);\n }\n}\n/** Creates a `NodeInjector` for the current node. */\nfunction createNodeInjector() {\n return new NodeInjector(getCurrentTNode(), getLView());\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵgetInheritedFactory(type) {\n return noSideEffects(() => {\n const ownConstructor = type.prototype.constructor;\n const ownFactory = ownConstructor[NG_FACTORY_DEF] || getFactoryOf(ownConstructor);\n const objectPrototype = Object.prototype;\n let parent = Object.getPrototypeOf(type.prototype).constructor;\n // Go up the prototype until we hit `Object`.\n while (parent && parent !== objectPrototype) {\n const factory = parent[NG_FACTORY_DEF] || getFactoryOf(parent);\n // If we hit something that has a factory and the factory isn't the same as the type,\n // we've found the inherited factory. Note the check that the factory isn't the type's\n // own factory is redundant in most cases, but if the user has custom decorators on the\n // class, this lookup will start one level down in the prototype chain, causing us to\n // find the own factory first and potentially triggering an infinite loop downstream.\n if (factory && factory !== ownFactory) {\n return factory;\n }\n parent = Object.getPrototypeOf(parent);\n }\n // There is no factory defined. Either this was improper usage of inheritance\n // (no Angular decorator on the superclass) or there is no constructor at all\n // in the inheritance chain. Since the two cases cannot be distinguished, the\n // latter has to be assumed.\n return (t) => new t();\n });\n}\nfunction getFactoryOf(type) {\n if (isForwardRef(type)) {\n return () => {\n const factory = getFactoryOf(resolveForwardRef(type));\n return factory && factory();\n };\n }\n return getFactoryDef(type);\n}\n/**\n * Returns a value from the closest embedded or node injector.\n *\n * @param tNode The Node where the search for the injector should start\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector, `null` when not found, or `notFoundValue` if provided\n */\nfunction lookupTokenUsingEmbeddedInjector(tNode, lView, token, flags, notFoundValue) {\n let currentTNode = tNode;\n let currentLView = lView;\n // When an LView with an embedded view injector is inserted, it'll likely be interlaced with\n // nodes who may have injectors (e.g. node injector -> embedded view injector -> node injector).\n // Since the bloom filters for the node injectors have already been constructed and we don't\n // have a way of extracting the records from an injector, the only way to maintain the correct\n // hierarchy when resolving the value is to walk it node-by-node while attempting to resolve\n // the token at each level.\n while (currentTNode !== null &&\n currentLView !== null &&\n currentLView[FLAGS] & 2048 /* LViewFlags.HasEmbeddedViewInjector */ &&\n !isRootView(currentLView)) {\n ngDevMode && assertTNodeForLView(currentTNode, currentLView);\n // Note that this lookup on the node injector is using the `Self` flag, because\n // we don't want the node injector to look at any parent injectors since we\n // may hit the embedded view injector first.\n const nodeInjectorValue = lookupTokenUsingNodeInjector(currentTNode, currentLView, token, flags | InjectFlags.Self, NOT_FOUND);\n if (nodeInjectorValue !== NOT_FOUND) {\n return nodeInjectorValue;\n }\n // Has an explicit type due to a TS bug: https://github.com/microsoft/TypeScript/issues/33191\n let parentTNode = currentTNode.parent;\n // `TNode.parent` includes the parent within the current view only. If it doesn't exist,\n // it means that we've hit the view boundary and we need to go up to the next view.\n if (!parentTNode) {\n // Before we go to the next LView, check if the token exists on the current embedded injector.\n const embeddedViewInjector = currentLView[EMBEDDED_VIEW_INJECTOR];\n if (embeddedViewInjector) {\n const embeddedViewInjectorValue = embeddedViewInjector.get(token, NOT_FOUND, flags);\n if (embeddedViewInjectorValue !== NOT_FOUND) {\n return embeddedViewInjectorValue;\n }\n }\n // Otherwise keep going up the tree.\n parentTNode = getTNodeFromLView(currentLView);\n currentLView = currentLView[DECLARATION_VIEW];\n }\n currentTNode = parentTNode;\n }\n return notFoundValue;\n}\n/** Gets the TNode associated with an LView inside of the declaration view. */\nfunction getTNodeFromLView(lView) {\n const tView = lView[TVIEW];\n const tViewType = tView.type;\n // The parent pointer differs based on `TView.type`.\n if (tViewType === 2 /* TViewType.Embedded */) {\n ngDevMode && assertDefined(tView.declTNode, 'Embedded TNodes should have declaration parents.');\n return tView.declTNode;\n }\n else if (tViewType === 1 /* TViewType.Component */) {\n // Components don't have `TView.declTNode` because each instance of component could be\n // inserted in different location, hence `TView.declTNode` is meaningless.\n return lView[T_HOST];\n }\n return null;\n}\n\n/**\n * Facade for the attribute injection from DI.\n *\n * @codeGenApi\n */\nfunction ɵɵinjectAttribute(attrNameToInject) {\n return injectAttributeImpl(getCurrentTNode(), attrNameToInject);\n}\n\n/**\n * Attribute decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Attribute = makeParamDecorator('Attribute', (attributeName) => ({\n attributeName,\n __NG_ELEMENT_ID__: () => ɵɵinjectAttribute(attributeName),\n}));\n\nlet _reflect = null;\nfunction getReflect() {\n return (_reflect = _reflect || new ReflectionCapabilities());\n}\nfunction reflectDependencies(type) {\n return convertDependencies(getReflect().parameters(type));\n}\nfunction convertDependencies(deps) {\n return deps.map((dep) => reflectDependency(dep));\n}\nfunction reflectDependency(dep) {\n const meta = {\n token: null,\n attribute: null,\n host: false,\n optional: false,\n self: false,\n skipSelf: false,\n };\n if (Array.isArray(dep) && dep.length > 0) {\n for (let j = 0; j < dep.length; j++) {\n const param = dep[j];\n if (param === undefined) {\n // param may be undefined if type of dep is not set by ngtsc\n continue;\n }\n const proto = Object.getPrototypeOf(param);\n if (param instanceof Optional || proto.ngMetadataName === 'Optional') {\n meta.optional = true;\n }\n else if (param instanceof SkipSelf || proto.ngMetadataName === 'SkipSelf') {\n meta.skipSelf = true;\n }\n else if (param instanceof Self || proto.ngMetadataName === 'Self') {\n meta.self = true;\n }\n else if (param instanceof Host || proto.ngMetadataName === 'Host') {\n meta.host = true;\n }\n else if (param instanceof Inject) {\n meta.token = param.token;\n }\n else if (param instanceof Attribute) {\n if (param.attributeName === undefined) {\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode && `Attribute name must be defined.`);\n }\n meta.attribute = param.attributeName;\n }\n else {\n meta.token = param;\n }\n }\n }\n else if (dep === undefined || (Array.isArray(dep) && dep.length === 0)) {\n meta.token = null;\n }\n else {\n meta.token = dep;\n }\n return meta;\n}\n\n/**\n * Compile an Angular injectable according to its `Injectable` metadata, and patch the resulting\n * injectable def (`ɵprov`) onto the injectable type.\n */\nfunction compileInjectable(type, meta) {\n let ngInjectableDef = null;\n let ngFactoryDef = null;\n // if NG_PROV_DEF is already defined on this class then don't overwrite it\n if (!type.hasOwnProperty(NG_PROV_DEF)) {\n Object.defineProperty(type, NG_PROV_DEF, {\n get: () => {\n if (ngInjectableDef === null) {\n const compiler = getCompilerFacade({\n usage: 0 /* JitCompilerUsage.Decorator */,\n kind: 'injectable',\n type,\n });\n ngInjectableDef = compiler.compileInjectable(angularCoreDiEnv, `ng:///${type.name}/ɵprov.js`, getInjectableMetadata(type, meta));\n }\n return ngInjectableDef;\n },\n });\n }\n // if NG_FACTORY_DEF is already defined on this class then don't overwrite it\n if (!type.hasOwnProperty(NG_FACTORY_DEF)) {\n Object.defineProperty(type, NG_FACTORY_DEF, {\n get: () => {\n if (ngFactoryDef === null) {\n const compiler = getCompilerFacade({\n usage: 0 /* JitCompilerUsage.Decorator */,\n kind: 'injectable',\n type,\n });\n ngFactoryDef = compiler.compileFactory(angularCoreDiEnv, `ng:///${type.name}/ɵfac.js`, {\n name: type.name,\n type,\n typeArgumentCount: 0, // In JIT mode types are not available nor used.\n deps: reflectDependencies(type),\n target: compiler.FactoryTarget.Injectable,\n });\n }\n return ngFactoryDef;\n },\n // Leave this configurable so that the factories from directives or pipes can take precedence.\n configurable: true,\n });\n }\n}\nconst USE_VALUE = getClosureSafeProperty({\n provide: String,\n useValue: getClosureSafeProperty,\n});\nfunction isUseClassProvider(meta) {\n return meta.useClass !== undefined;\n}\nfunction isUseValueProvider(meta) {\n return USE_VALUE in meta;\n}\nfunction isUseFactoryProvider(meta) {\n return meta.useFactory !== undefined;\n}\nfunction isUseExistingProvider(meta) {\n return meta.useExisting !== undefined;\n}\nfunction getInjectableMetadata(type, srcMeta) {\n // Allow the compilation of a class with a `@Injectable()` decorator without parameters\n const meta = srcMeta || { providedIn: null };\n const compilerMeta = {\n name: type.name,\n type: type,\n typeArgumentCount: 0,\n providedIn: meta.providedIn,\n };\n if ((isUseClassProvider(meta) || isUseFactoryProvider(meta)) && meta.deps !== undefined) {\n compilerMeta.deps = convertDependencies(meta.deps);\n }\n // Check to see if the user explicitly provided a `useXxxx` property.\n if (isUseClassProvider(meta)) {\n compilerMeta.useClass = meta.useClass;\n }\n else if (isUseValueProvider(meta)) {\n compilerMeta.useValue = meta.useValue;\n }\n else if (isUseFactoryProvider(meta)) {\n compilerMeta.useFactory = meta.useFactory;\n }\n else if (isUseExistingProvider(meta)) {\n compilerMeta.useExisting = meta.useExisting;\n }\n return compilerMeta;\n}\n\n/**\n * Injectable decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Injectable = makeDecorator('Injectable', undefined, undefined, undefined, (type, meta) => compileInjectable(type, meta));\n\n/**\n * Create a new `Injector` which is configured using a `defType` of `InjectorType`s.\n */\nfunction createInjector(defType, parent = null, additionalProviders = null, name) {\n const injector = createInjectorWithoutInjectorInstances(defType, parent, additionalProviders, name);\n injector.resolveInjectorInitializers();\n return injector;\n}\n/**\n * Creates a new injector without eagerly resolving its injector types. Can be used in places\n * where resolving the injector types immediately can lead to an infinite loop. The injector types\n * should be resolved at a later point by calling `_resolveInjectorDefTypes`.\n */\nfunction createInjectorWithoutInjectorInstances(defType, parent = null, additionalProviders = null, name, scopes = new Set()) {\n const providers = [additionalProviders || EMPTY_ARRAY, importProvidersFrom(defType)];\n name = name || (typeof defType === 'object' ? undefined : stringify(defType));\n return new R3Injector(providers, parent || getNullInjector(), name || null, scopes);\n}\n\n/**\n * Concrete injectors implement this interface. Injectors are configured\n * with [providers](guide/di/dependency-injection-providers) that associate\n * dependencies of various types with [injection tokens](guide/di/dependency-injection-providers).\n *\n * @see [DI Providers](guide/di/dependency-injection-providers).\n * @see {@link StaticProvider}\n *\n * @usageNotes\n *\n * The following example creates a service injector instance.\n *\n * {@example core/di/ts/provider_spec.ts region='ConstructorProvider'}\n *\n * ### Usage example\n *\n * {@example core/di/ts/injector_spec.ts region='Injector'}\n *\n * `Injector` returns itself when given `Injector` as a token:\n *\n * {@example core/di/ts/injector_spec.ts region='injectInjector'}\n *\n * @publicApi\n */\nclass Injector {\n static THROW_IF_NOT_FOUND = THROW_IF_NOT_FOUND;\n static NULL = new NullInjector();\n static create(options, parent) {\n if (Array.isArray(options)) {\n return createInjector({ name: '' }, parent, options, '');\n }\n else {\n const name = options.name ?? '';\n return createInjector({ name }, options.parent, options.providers, name);\n }\n }\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: Injector,\n providedIn: 'any',\n factory: () => ɵɵinject(INJECTOR$1),\n });\n /**\n * @internal\n * @nocollapse\n */\n static __NG_ELEMENT_ID__ = -1 /* InjectorMarkers.Injector */;\n}\n\n/*!\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.dev/license\n */\n/**\n * Creates a token that can be used to inject static attributes of the host node.\n *\n * @usageNotes\n * ### Injecting an attribute that is known to exist\n * ```ts\n * @Directive()\n * class MyDir {\n * attr: string = inject(new HostAttributeToken('some-attr'));\n * }\n * ```\n *\n * ### Optionally injecting an attribute\n * ```ts\n * @Directive()\n * class MyDir {\n * attr: string | null = inject(new HostAttributeToken('some-attr'), {optional: true});\n * }\n * ```\n * @publicApi\n */\nclass HostAttributeToken {\n attributeName;\n constructor(attributeName) {\n this.attributeName = attributeName;\n }\n /** @internal */\n __NG_ELEMENT_ID__ = () => ɵɵinjectAttribute(this.attributeName);\n toString() {\n return `HostAttributeToken ${this.attributeName}`;\n }\n}\n\n/**\n * A token that can be used to inject the tag name of the host node.\n *\n * @usageNotes\n * ### Injecting a tag name that is known to exist\n * ```ts\n * @Directive()\n * class MyDir {\n * tagName: string = inject(HOST_TAG_NAME);\n * }\n * ```\n *\n * ### Optionally injecting a tag name\n * ```ts\n * @Directive()\n * class MyDir {\n * tagName: string | null = inject(HOST_TAG_NAME, {optional: true});\n * }\n * ```\n * @publicApi\n */\nconst HOST_TAG_NAME = new InjectionToken(ngDevMode ? 'HOST_TAG_NAME' : '');\n// HOST_TAG_NAME should be resolved at the current node, similar to e.g. ElementRef,\n// so we manually specify __NG_ELEMENT_ID__ here, instead of using a factory.\n// tslint:disable-next-line:no-toplevel-property-access\nHOST_TAG_NAME.__NG_ELEMENT_ID__ = (flags) => {\n const tNode = getCurrentTNode();\n if (tNode === null) {\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode &&\n 'HOST_TAG_NAME can only be injected in directives and components ' +\n 'during construction time (in a class constructor or as a class field initializer)');\n }\n if (tNode.type & 2 /* TNodeType.Element */) {\n return tNode.value;\n }\n if (flags & InjectFlags.Optional) {\n return null;\n }\n throw new RuntimeError(204 /* RuntimeErrorCode.INVALID_INJECTION_TOKEN */, ngDevMode &&\n `HOST_TAG_NAME was used on ${getDevModeNodeName(tNode)} which doesn't have an underlying element in the DOM. ` +\n `This is invalid, and so the dependency should be marked as optional.`);\n};\nfunction getDevModeNodeName(tNode) {\n if (tNode.type & 8 /* TNodeType.ElementContainer */) {\n return 'an ';\n }\n else if (tNode.type & 4 /* TNodeType.Container */) {\n return 'an ';\n }\n else if (tNode.type & 128 /* TNodeType.LetDeclaration */) {\n return 'an @let declaration';\n }\n else {\n return 'a node';\n }\n}\n\n/**\n * @module\n * @description\n * The `di` module provides dependency injection container services.\n */\n\n/**\n * This file should not be necessary because node resolution should just default to `./di/index`!\n *\n * However it does not seem to work and it breaks:\n * - //packages/animations/browser/test:test_web_chromium-local\n * - //packages/compiler-cli/test:extract_i18n\n * - //packages/compiler-cli/test:ngc\n * - //packages/compiler-cli/test:perform_watch\n * - //packages/compiler-cli/test/diagnostics:check_types\n * - //packages/compiler-cli/test/transformers:test\n * - //packages/compiler/test:test\n * - //tools/public_api_guard:core_api\n *\n * Remove this file once the above is solved or wait until `ngc` is deleted and then it should be\n * safe to delete this file.\n */\n\nconst SCHEDULE_IN_ROOT_ZONE_DEFAULT = false;\n\n/**\n * `DestroyRef` lets you set callbacks to run for any cleanup or destruction behavior.\n * The scope of this destruction depends on where `DestroyRef` is injected. If `DestroyRef`\n * is injected in a component or directive, the callbacks run when that component or\n * directive is destroyed. Otherwise the callbacks run when a corresponding injector is destroyed.\n *\n * @publicApi\n */\nclass DestroyRef {\n /**\n * @internal\n * @nocollapse\n */\n static __NG_ELEMENT_ID__ = injectDestroyRef;\n /**\n * @internal\n * @nocollapse\n */\n static __NG_ENV_ID__ = (injector) => injector;\n}\nclass NodeInjectorDestroyRef extends DestroyRef {\n _lView;\n constructor(_lView) {\n super();\n this._lView = _lView;\n }\n onDestroy(callback) {\n storeLViewOnDestroy(this._lView, callback);\n return () => removeLViewOnDestroy(this._lView, callback);\n }\n}\nfunction injectDestroyRef() {\n return new NodeInjectorDestroyRef(getLView());\n}\n\n/**\n * Injectable that is notified when an `LView` is made aware of changes to application state.\n */\nclass ChangeDetectionScheduler {\n}\n/** Token used to indicate if zoneless was enabled via provideZonelessChangeDetection(). */\nconst ZONELESS_ENABLED = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'Zoneless enabled' : '', { providedIn: 'root', factory: () => false });\n/** Token used to indicate `provideExperimentalZonelessChangeDetection` was used. */\nconst PROVIDED_ZONELESS = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'Zoneless provided' : '', { providedIn: 'root', factory: () => false });\nconst ZONELESS_SCHEDULER_DISABLED = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'scheduler disabled' : '');\n// TODO(atscott): Remove in v19. Scheduler should be done with runOutsideAngular.\nconst SCHEDULE_IN_ROOT_ZONE = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'run changes outside zone in root' : '');\n\n/**\n * Internal implementation of the pending tasks service.\n */\nclass PendingTasksInternal {\n taskId = 0;\n pendingTasks = new Set();\n get _hasPendingTasks() {\n return this.hasPendingTasks.value;\n }\n hasPendingTasks = new BehaviorSubject(false);\n add() {\n if (!this._hasPendingTasks) {\n this.hasPendingTasks.next(true);\n }\n const taskId = this.taskId++;\n this.pendingTasks.add(taskId);\n return taskId;\n }\n has(taskId) {\n return this.pendingTasks.has(taskId);\n }\n remove(taskId) {\n this.pendingTasks.delete(taskId);\n if (this.pendingTasks.size === 0 && this._hasPendingTasks) {\n this.hasPendingTasks.next(false);\n }\n }\n ngOnDestroy() {\n this.pendingTasks.clear();\n if (this._hasPendingTasks) {\n this.hasPendingTasks.next(false);\n }\n }\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: PendingTasksInternal,\n providedIn: 'root',\n factory: () => new PendingTasksInternal(),\n });\n}\n/**\n * Service that keeps track of pending tasks contributing to the stableness of Angular\n * application. While several existing Angular services (ex.: `HttpClient`) will internally manage\n * tasks influencing stability, this API gives control over stability to library and application\n * developers for specific cases not covered by Angular internals.\n *\n * The concept of stability comes into play in several important scenarios:\n * - SSR process needs to wait for the application stability before serializing and sending rendered\n * HTML;\n * - tests might want to delay assertions until the application becomes stable;\n *\n * @usageNotes\n * ```ts\n * const pendingTasks = inject(PendingTasks);\n * const taskCleanup = pendingTasks.add();\n * // do work that should block application's stability and then:\n * taskCleanup();\n * ```\n *\n * @publicApi\n * @developerPreview\n */\nclass PendingTasks {\n internalPendingTasks = inject(PendingTasksInternal);\n scheduler = inject(ChangeDetectionScheduler);\n /**\n * Adds a new task that should block application's stability.\n * @returns A cleanup function that removes a task when called.\n */\n add() {\n const taskId = this.internalPendingTasks.add();\n return () => {\n if (!this.internalPendingTasks.has(taskId)) {\n // This pending task has already been cleared.\n return;\n }\n // Notifying the scheduler will hold application stability open until the next tick.\n this.scheduler.notify(11 /* NotificationSource.PendingTaskRemoved */);\n this.internalPendingTasks.remove(taskId);\n };\n }\n /**\n * Runs an asynchronous function and blocks the application's stability until the function completes.\n *\n * ```ts\n * pendingTasks.run(async () => {\n * const userData = await fetch('/api/user');\n * this.userData.set(userData);\n * });\n * ```\n *\n * Application stability is at least delayed until the next tick after the `run` method resolves\n * so it is safe to make additional updates to application state that would require UI synchronization:\n *\n * ```ts\n * const userData = await pendingTasks.run(() => fetch('/api/user'));\n * this.userData.set(userData);\n * ```\n *\n * @param fn The asynchronous function to execute\n */\n async run(fn) {\n const removeTask = this.add();\n try {\n return await fn();\n }\n finally {\n removeTask();\n }\n }\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: PendingTasks,\n providedIn: 'root',\n factory: () => new PendingTasks(),\n });\n}\n\nclass EventEmitter_ extends Subject {\n // tslint:disable-next-line:require-internal-with-underscore\n __isAsync;\n destroyRef = undefined;\n pendingTasks = undefined;\n constructor(isAsync = false) {\n super();\n this.__isAsync = isAsync;\n // Attempt to retrieve a `DestroyRef` and `PendingTasks` optionally.\n // For backwards compatibility reasons, this cannot be required.\n if (isInInjectionContext()) {\n // `DestroyRef` is optional because it is not available in all contexts.\n // But it is useful to properly complete the `EventEmitter` if used with `outputToObservable`\n // when the component/directive is destroyed. (See `outputToObservable` for more details.)\n this.destroyRef = inject(DestroyRef, { optional: true }) ?? undefined;\n this.pendingTasks = inject(PendingTasksInternal, { optional: true }) ?? undefined;\n }\n }\n emit(value) {\n const prevConsumer = setActiveConsumer$1(null);\n try {\n super.next(value);\n }\n finally {\n setActiveConsumer$1(prevConsumer);\n }\n }\n subscribe(observerOrNext, error, complete) {\n let nextFn = observerOrNext;\n let errorFn = error || (() => null);\n let completeFn = complete;\n if (observerOrNext && typeof observerOrNext === 'object') {\n const observer = observerOrNext;\n nextFn = observer.next?.bind(observer);\n errorFn = observer.error?.bind(observer);\n completeFn = observer.complete?.bind(observer);\n }\n if (this.__isAsync) {\n errorFn = this.wrapInTimeout(errorFn);\n if (nextFn) {\n nextFn = this.wrapInTimeout(nextFn);\n }\n if (completeFn) {\n completeFn = this.wrapInTimeout(completeFn);\n }\n }\n const sink = super.subscribe({ next: nextFn, error: errorFn, complete: completeFn });\n if (observerOrNext instanceof Subscription) {\n observerOrNext.add(sink);\n }\n return sink;\n }\n wrapInTimeout(fn) {\n return (value) => {\n const taskId = this.pendingTasks?.add();\n setTimeout(() => {\n fn(value);\n if (taskId !== undefined) {\n this.pendingTasks?.remove(taskId);\n }\n });\n };\n }\n}\n/**\n * @publicApi\n */\nconst EventEmitter = EventEmitter_;\n\nfunction noop(...args) {\n // Do nothing.\n}\n\n/**\n * Gets a scheduling function that runs the callback after the first of setTimeout and\n * requestAnimationFrame resolves.\n *\n * - `requestAnimationFrame` ensures that change detection runs ahead of a browser repaint.\n * This ensures that the create and update passes of a change detection always happen\n * in the same frame.\n * - When the browser is resource-starved, `rAF` can execute _before_ a `setTimeout` because\n * rendering is a very high priority process. This means that `setTimeout` cannot guarantee\n * same-frame create and update pass, when `setTimeout` is used to schedule the update phase.\n * - While `rAF` gives us the desirable same-frame updates, it has two limitations that\n * prevent it from being used alone. First, it does not run in background tabs, which would\n * prevent Angular from initializing an application when opened in a new tab (for example).\n * Second, repeated calls to requestAnimationFrame will execute at the refresh rate of the\n * hardware (~16ms for a 60Hz display). This would cause significant slowdown of tests that\n * are written with several updates and asserts in the form of \"update; await stable; assert;\".\n * - Both `setTimeout` and `rAF` are able to \"coalesce\" several events from a single user\n * interaction into a single change detection. Importantly, this reduces view tree traversals when\n * compared to an alternative timing mechanism like `queueMicrotask`, where change detection would\n * then be interleaves between each event.\n *\n * By running change detection after the first of `setTimeout` and `rAF` to execute, we get the\n * best of both worlds.\n *\n * @returns a function to cancel the scheduled callback\n */\nfunction scheduleCallbackWithRafRace(callback) {\n let timeoutId;\n let animationFrameId;\n function cleanup() {\n callback = noop;\n try {\n if (animationFrameId !== undefined && typeof cancelAnimationFrame === 'function') {\n cancelAnimationFrame(animationFrameId);\n }\n if (timeoutId !== undefined) {\n clearTimeout(timeoutId);\n }\n }\n catch {\n // Clearing/canceling can fail in tests due to the timing of functions being patched and unpatched\n // Just ignore the errors - we protect ourselves from this issue by also making the callback a no-op.\n }\n }\n timeoutId = setTimeout(() => {\n callback();\n cleanup();\n });\n if (typeof requestAnimationFrame === 'function') {\n animationFrameId = requestAnimationFrame(() => {\n callback();\n cleanup();\n });\n }\n return () => cleanup();\n}\nfunction scheduleCallbackWithMicrotask(callback) {\n queueMicrotask(() => callback());\n return () => {\n callback = noop;\n };\n}\n\nclass AsyncStackTaggingZoneSpec {\n createTask;\n constructor(namePrefix, consoleAsyncStackTaggingImpl = console) {\n this.name = 'asyncStackTagging for ' + namePrefix;\n this.createTask = consoleAsyncStackTaggingImpl?.createTask ?? (() => null);\n }\n // ZoneSpec implementation below.\n name;\n onScheduleTask(delegate, _current, target, task) {\n task.consoleTask = this.createTask(`Zone - ${task.source || task.type}`);\n return delegate.scheduleTask(target, task);\n }\n onInvokeTask(delegate, _currentZone, targetZone, task, applyThis, applyArgs) {\n let ret;\n if (task.consoleTask) {\n ret = task.consoleTask.run(() => delegate.invokeTask(targetZone, task, applyThis, applyArgs));\n }\n else {\n ret = delegate.invokeTask(targetZone, task, applyThis, applyArgs);\n }\n return ret;\n }\n}\n\nconst isAngularZoneProperty = 'isAngularZone';\nconst angularZoneInstanceIdProperty = isAngularZoneProperty + '_ID';\nlet ngZoneInstanceId = 0;\n/**\n * An injectable service for executing work inside or outside of the Angular zone.\n *\n * The most common use of this service is to optimize performance when starting a work consisting of\n * one or more asynchronous tasks that don't require UI updates or error handling to be handled by\n * Angular. Such tasks can be kicked off via {@link #runOutsideAngular} and if needed, these tasks\n * can reenter the Angular zone via {@link #run}.\n *\n * \n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * import {Component, NgZone} from '@angular/core';\n * import {NgIf} from '@angular/common';\n *\n * @Component({\n * selector: 'ng-zone-demo',\n * template: `\n * Demo: NgZone \n *\n * Progress: {{progress}}%
\n * = 100\">Done processing {{label}} of Angular zone!
\n *\n * Process within Angular zone \n * Process outside of Angular zone \n * `,\n * })\n * export class NgZoneDemo {\n * progress: number = 0;\n * label: string;\n *\n * constructor(private _ngZone: NgZone) {}\n *\n * // Loop inside the Angular zone\n * // so the UI DOES refresh after each setTimeout cycle\n * processWithinAngularZone() {\n * this.label = 'inside';\n * this.progress = 0;\n * this._increaseProgress(() => console.log('Inside Done!'));\n * }\n *\n * // Loop outside of the Angular zone\n * // so the UI DOES NOT refresh after each setTimeout cycle\n * processOutsideOfAngularZone() {\n * this.label = 'outside';\n * this.progress = 0;\n * this._ngZone.runOutsideAngular(() => {\n * this._increaseProgress(() => {\n * // reenter the Angular zone and display done\n * this._ngZone.run(() => { console.log('Outside Done!'); });\n * });\n * });\n * }\n *\n * _increaseProgress(doneCallback: () => void) {\n * this.progress += 1;\n * console.log(`Current progress: ${this.progress}%`);\n *\n * if (this.progress < 100) {\n * window.setTimeout(() => this._increaseProgress(doneCallback), 10);\n * } else {\n * doneCallback();\n * }\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass NgZone {\n hasPendingMacrotasks = false;\n hasPendingMicrotasks = false;\n /**\n * Whether there are no outstanding microtasks or macrotasks.\n */\n isStable = true;\n /**\n * Notifies when code enters Angular Zone. This gets fired first on VM Turn.\n */\n onUnstable = new EventEmitter(false);\n /**\n * Notifies when there is no more microtasks enqueued in the current VM Turn.\n * This is a hint for Angular to do change detection, which may enqueue more microtasks.\n * For this reason this event can fire multiple times per VM Turn.\n */\n onMicrotaskEmpty = new EventEmitter(false);\n /**\n * Notifies when the last `onMicrotaskEmpty` has run and there are no more microtasks, which\n * implies we are about to relinquish VM turn.\n * This event gets called just once.\n */\n onStable = new EventEmitter(false);\n /**\n * Notifies that an error has been delivered.\n */\n onError = new EventEmitter(false);\n constructor(options) {\n const { enableLongStackTrace = false, shouldCoalesceEventChangeDetection = false, shouldCoalesceRunChangeDetection = false, scheduleInRootZone = SCHEDULE_IN_ROOT_ZONE_DEFAULT, } = options;\n if (typeof Zone == 'undefined') {\n throw new RuntimeError(908 /* RuntimeErrorCode.MISSING_ZONEJS */, ngDevMode && `In this configuration Angular requires Zone.js`);\n }\n Zone.assertZonePatched();\n const self = this;\n self._nesting = 0;\n self._outer = self._inner = Zone.current;\n // AsyncStackTaggingZoneSpec provides `linked stack traces` to show\n // where the async operation is scheduled. For more details, refer\n // to this article, https://developer.chrome.com/blog/devtools-better-angular-debugging/\n // And we only import this AsyncStackTaggingZoneSpec in development mode,\n // in the production mode, the AsyncStackTaggingZoneSpec will be tree shaken away.\n if (ngDevMode) {\n self._inner = self._inner.fork(new AsyncStackTaggingZoneSpec('Angular'));\n }\n if (Zone['TaskTrackingZoneSpec']) {\n self._inner = self._inner.fork(new Zone['TaskTrackingZoneSpec']());\n }\n if (enableLongStackTrace && Zone['longStackTraceZoneSpec']) {\n self._inner = self._inner.fork(Zone['longStackTraceZoneSpec']);\n }\n // if shouldCoalesceRunChangeDetection is true, all tasks including event tasks will be\n // coalesced, so shouldCoalesceEventChangeDetection option is not necessary and can be skipped.\n self.shouldCoalesceEventChangeDetection =\n !shouldCoalesceRunChangeDetection && shouldCoalesceEventChangeDetection;\n self.shouldCoalesceRunChangeDetection = shouldCoalesceRunChangeDetection;\n self.callbackScheduled = false;\n self.scheduleInRootZone = scheduleInRootZone;\n forkInnerZoneWithAngularBehavior(self);\n }\n /**\n This method checks whether the method call happens within an Angular Zone instance.\n */\n static isInAngularZone() {\n // Zone needs to be checked, because this method might be called even when NoopNgZone is used.\n return typeof Zone !== 'undefined' && Zone.current.get(isAngularZoneProperty) === true;\n }\n /**\n Assures that the method is called within the Angular Zone, otherwise throws an error.\n */\n static assertInAngularZone() {\n if (!NgZone.isInAngularZone()) {\n throw new RuntimeError(909 /* RuntimeErrorCode.UNEXPECTED_ZONE_STATE */, ngDevMode && 'Expected to be in Angular Zone, but it is not!');\n }\n }\n /**\n Assures that the method is called outside of the Angular Zone, otherwise throws an error.\n */\n static assertNotInAngularZone() {\n if (NgZone.isInAngularZone()) {\n throw new RuntimeError(909 /* RuntimeErrorCode.UNEXPECTED_ZONE_STATE */, ngDevMode && 'Expected to not be in Angular Zone, but it is!');\n }\n }\n /**\n * Executes the `fn` function synchronously within the Angular zone and returns value returned by\n * the function.\n *\n * Running functions via `run` allows you to reenter Angular zone from a task that was executed\n * outside of the Angular zone (typically started via {@link #runOutsideAngular}).\n *\n * Any future tasks or microtasks scheduled from within this function will continue executing from\n * within the Angular zone.\n *\n * If a synchronous error happens it will be rethrown and not reported via `onError`.\n */\n run(fn, applyThis, applyArgs) {\n return this._inner.run(fn, applyThis, applyArgs);\n }\n /**\n * Executes the `fn` function synchronously within the Angular zone as a task and returns value\n * returned by the function.\n *\n * Running functions via `runTask` allows you to reenter Angular zone from a task that was executed\n * outside of the Angular zone (typically started via {@link #runOutsideAngular}).\n *\n * Any future tasks or microtasks scheduled from within this function will continue executing from\n * within the Angular zone.\n *\n * If a synchronous error happens it will be rethrown and not reported via `onError`.\n */\n runTask(fn, applyThis, applyArgs, name) {\n const zone = this._inner;\n const task = zone.scheduleEventTask('NgZoneEvent: ' + name, fn, EMPTY_PAYLOAD, noop, noop);\n try {\n return zone.runTask(task, applyThis, applyArgs);\n }\n finally {\n zone.cancelTask(task);\n }\n }\n /**\n * Same as `run`, except that synchronous errors are caught and forwarded via `onError` and not\n * rethrown.\n */\n runGuarded(fn, applyThis, applyArgs) {\n return this._inner.runGuarded(fn, applyThis, applyArgs);\n }\n /**\n * Executes the `fn` function synchronously in Angular's parent zone and returns value returned by\n * the function.\n *\n * Running functions via {@link #runOutsideAngular} allows you to escape Angular's zone and do\n * work that\n * doesn't trigger Angular change-detection or is subject to Angular's error handling.\n *\n * Any future tasks or microtasks scheduled from within this function will continue executing from\n * outside of the Angular zone.\n *\n * Use {@link #run} to reenter the Angular zone and do work that updates the application model.\n */\n runOutsideAngular(fn) {\n return this._outer.run(fn);\n }\n}\nconst EMPTY_PAYLOAD = {};\nfunction checkStable(zone) {\n // TODO: @JiaLiPassion, should check zone.isCheckStableRunning to prevent\n // re-entry. The case is:\n //\n // @Component({...})\n // export class AppComponent {\n // constructor(private ngZone: NgZone) {\n // this.ngZone.onStable.subscribe(() => {\n // this.ngZone.run(() => console.log('stable'););\n // });\n // }\n //\n // The onStable subscriber run another function inside ngZone\n // which causes `checkStable()` re-entry.\n // But this fix causes some issues in g3, so this fix will be\n // launched in another PR.\n if (zone._nesting == 0 && !zone.hasPendingMicrotasks && !zone.isStable) {\n try {\n zone._nesting++;\n zone.onMicrotaskEmpty.emit(null);\n }\n finally {\n zone._nesting--;\n if (!zone.hasPendingMicrotasks) {\n try {\n zone.runOutsideAngular(() => zone.onStable.emit(null));\n }\n finally {\n zone.isStable = true;\n }\n }\n }\n }\n}\nfunction delayChangeDetectionForEvents(zone) {\n /**\n * We also need to check _nesting here\n * Consider the following case with shouldCoalesceRunChangeDetection = true\n *\n * ngZone.run(() => {});\n * ngZone.run(() => {});\n *\n * We want the two `ngZone.run()` only trigger one change detection\n * when shouldCoalesceRunChangeDetection is true.\n * And because in this case, change detection run in async way(requestAnimationFrame),\n * so we also need to check the _nesting here to prevent multiple\n * change detections.\n */\n if (zone.isCheckStableRunning || zone.callbackScheduled) {\n return;\n }\n zone.callbackScheduled = true;\n function scheduleCheckStable() {\n scheduleCallbackWithRafRace(() => {\n zone.callbackScheduled = false;\n updateMicroTaskStatus(zone);\n zone.isCheckStableRunning = true;\n checkStable(zone);\n zone.isCheckStableRunning = false;\n });\n }\n if (zone.scheduleInRootZone) {\n Zone.root.run(() => {\n scheduleCheckStable();\n });\n }\n else {\n zone._outer.run(() => {\n scheduleCheckStable();\n });\n }\n updateMicroTaskStatus(zone);\n}\nfunction forkInnerZoneWithAngularBehavior(zone) {\n const delayChangeDetectionForEventsDelegate = () => {\n delayChangeDetectionForEvents(zone);\n };\n const instanceId = ngZoneInstanceId++;\n zone._inner = zone._inner.fork({\n name: 'angular',\n properties: {\n [isAngularZoneProperty]: true,\n [angularZoneInstanceIdProperty]: instanceId,\n [angularZoneInstanceIdProperty + instanceId]: true,\n },\n onInvokeTask: (delegate, current, target, task, applyThis, applyArgs) => {\n // Prevent triggering change detection when the flag is detected.\n if (shouldBeIgnoredByZone(applyArgs)) {\n return delegate.invokeTask(target, task, applyThis, applyArgs);\n }\n try {\n onEnter(zone);\n return delegate.invokeTask(target, task, applyThis, applyArgs);\n }\n finally {\n if ((zone.shouldCoalesceEventChangeDetection && task.type === 'eventTask') ||\n zone.shouldCoalesceRunChangeDetection) {\n delayChangeDetectionForEventsDelegate();\n }\n onLeave(zone);\n }\n },\n onInvoke: (delegate, current, target, callback, applyThis, applyArgs, source) => {\n try {\n onEnter(zone);\n return delegate.invoke(target, callback, applyThis, applyArgs, source);\n }\n finally {\n if (zone.shouldCoalesceRunChangeDetection &&\n // Do not delay change detection when the task is the scheduler's tick.\n // We need to synchronously trigger the stability logic so that the\n // zone-based scheduler can prevent a duplicate ApplicationRef.tick\n // by first checking if the scheduler tick is running. This does seem a bit roundabout,\n // but we _do_ still want to trigger all the correct events when we exit the zone.run\n // (`onMicrotaskEmpty` and `onStable` _should_ emit; developers can have code which\n // relies on these events happening after change detection runs).\n // Note: `zone.callbackScheduled` is already in delayChangeDetectionForEventsDelegate\n // but is added here as well to prevent reads of applyArgs when not necessary\n !zone.callbackScheduled &&\n !isSchedulerTick(applyArgs)) {\n delayChangeDetectionForEventsDelegate();\n }\n onLeave(zone);\n }\n },\n onHasTask: (delegate, current, target, hasTaskState) => {\n delegate.hasTask(target, hasTaskState);\n if (current === target) {\n // We are only interested in hasTask events which originate from our zone\n // (A child hasTask event is not interesting to us)\n if (hasTaskState.change == 'microTask') {\n zone._hasPendingMicrotasks = hasTaskState.microTask;\n updateMicroTaskStatus(zone);\n checkStable(zone);\n }\n else if (hasTaskState.change == 'macroTask') {\n zone.hasPendingMacrotasks = hasTaskState.macroTask;\n }\n }\n },\n onHandleError: (delegate, current, target, error) => {\n delegate.handleError(target, error);\n zone.runOutsideAngular(() => zone.onError.emit(error));\n return false;\n },\n });\n}\nfunction updateMicroTaskStatus(zone) {\n if (zone._hasPendingMicrotasks ||\n ((zone.shouldCoalesceEventChangeDetection || zone.shouldCoalesceRunChangeDetection) &&\n zone.callbackScheduled === true)) {\n zone.hasPendingMicrotasks = true;\n }\n else {\n zone.hasPendingMicrotasks = false;\n }\n}\nfunction onEnter(zone) {\n zone._nesting++;\n if (zone.isStable) {\n zone.isStable = false;\n zone.onUnstable.emit(null);\n }\n}\nfunction onLeave(zone) {\n zone._nesting--;\n checkStable(zone);\n}\n/**\n * Provides a noop implementation of `NgZone` which does nothing. This zone requires explicit calls\n * to framework to perform rendering.\n */\nclass NoopNgZone {\n hasPendingMicrotasks = false;\n hasPendingMacrotasks = false;\n isStable = true;\n onUnstable = new EventEmitter();\n onMicrotaskEmpty = new EventEmitter();\n onStable = new EventEmitter();\n onError = new EventEmitter();\n run(fn, applyThis, applyArgs) {\n return fn.apply(applyThis, applyArgs);\n }\n runGuarded(fn, applyThis, applyArgs) {\n return fn.apply(applyThis, applyArgs);\n }\n runOutsideAngular(fn) {\n return fn();\n }\n runTask(fn, applyThis, applyArgs, name) {\n return fn.apply(applyThis, applyArgs);\n }\n}\nfunction shouldBeIgnoredByZone(applyArgs) {\n return hasApplyArgsData(applyArgs, '__ignore_ng_zone__');\n}\nfunction isSchedulerTick(applyArgs) {\n return hasApplyArgsData(applyArgs, '__scheduler_tick__');\n}\nfunction hasApplyArgsData(applyArgs, key) {\n if (!Array.isArray(applyArgs)) {\n return false;\n }\n // We should only ever get 1 arg passed through to invokeTask.\n // Short circuit here incase that behavior changes.\n if (applyArgs.length !== 1) {\n return false;\n }\n return applyArgs[0]?.data?.[key] === true;\n}\nfunction getNgZone(ngZoneToUse = 'zone.js', options) {\n if (ngZoneToUse === 'noop') {\n return new NoopNgZone();\n }\n if (ngZoneToUse === 'zone.js') {\n return new NgZone(options);\n }\n return ngZoneToUse;\n}\n\n// Public API for Zone\n\n/**\n * Provides a hook for centralized exception handling.\n *\n * The default implementation of `ErrorHandler` prints error messages to the `console`. To\n * intercept error handling, write a custom exception handler that replaces this default as\n * appropriate for your app.\n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * class MyErrorHandler implements ErrorHandler {\n * handleError(error) {\n * // do something with the exception\n * }\n * }\n *\n * // Provide in standalone apps\n * bootstrapApplication(AppComponent, {\n * providers: [{provide: ErrorHandler, useClass: MyErrorHandler}]\n * })\n *\n * // Provide in module-based apps\n * @NgModule({\n * providers: [{provide: ErrorHandler, useClass: MyErrorHandler}]\n * })\n * class MyModule {}\n * ```\n *\n * @publicApi\n */\nclass ErrorHandler {\n /**\n * @internal\n */\n _console = console;\n handleError(error) {\n this._console.error('ERROR', error);\n }\n}\n/**\n * `InjectionToken` used to configure how to call the `ErrorHandler`.\n *\n * `NgZone` is provided by default today so the default (and only) implementation for this\n * is calling `ErrorHandler.handleError` outside of the Angular zone.\n */\nconst INTERNAL_APPLICATION_ERROR_HANDLER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'internal error handler' : '', {\n providedIn: 'root',\n factory: () => {\n const zone = inject(NgZone);\n const userErrorHandler = inject(ErrorHandler);\n return (e) => zone.runOutsideAngular(() => userErrorHandler.handleError(e));\n },\n});\n\n/**\n * An `OutputEmitterRef` is created by the `output()` function and can be\n * used to emit values to consumers of your directive or component.\n *\n * Consumers of your directive/component can bind to the output and\n * subscribe to changes via the bound event syntax. For example:\n *\n * ```html\n * \n * ```\n *\n * @publicAPI\n */\nclass OutputEmitterRef {\n destroyed = false;\n listeners = null;\n errorHandler = inject(ErrorHandler, { optional: true });\n /** @internal */\n destroyRef = inject(DestroyRef);\n constructor() {\n // Clean-up all listeners and mark as destroyed upon destroy.\n this.destroyRef.onDestroy(() => {\n this.destroyed = true;\n this.listeners = null;\n });\n }\n subscribe(callback) {\n if (this.destroyed) {\n throw new RuntimeError(953 /* RuntimeErrorCode.OUTPUT_REF_DESTROYED */, ngDevMode &&\n 'Unexpected subscription to destroyed `OutputRef`. ' +\n 'The owning directive/component is destroyed.');\n }\n (this.listeners ??= []).push(callback);\n return {\n unsubscribe: () => {\n const idx = this.listeners?.indexOf(callback);\n if (idx !== undefined && idx !== -1) {\n this.listeners?.splice(idx, 1);\n }\n },\n };\n }\n /** Emits a new value to the output. */\n emit(value) {\n if (this.destroyed) {\n throw new RuntimeError(953 /* RuntimeErrorCode.OUTPUT_REF_DESTROYED */, ngDevMode &&\n 'Unexpected emit for destroyed `OutputRef`. ' +\n 'The owning directive/component is destroyed.');\n }\n if (this.listeners === null) {\n return;\n }\n const previousConsumer = setActiveConsumer$1(null);\n try {\n for (const listenerFn of this.listeners) {\n try {\n listenerFn(value);\n }\n catch (err) {\n this.errorHandler?.handleError(err);\n }\n }\n }\n finally {\n setActiveConsumer$1(previousConsumer);\n }\n }\n}\n/** Gets the owning `DestroyRef` for the given output. */\nfunction getOutputDestroyRef(ref) {\n return ref.destroyRef;\n}\n\n/**\n * The `output` function allows declaration of Angular outputs in\n * directives and components.\n *\n * You can use outputs to emit values to parent directives and component.\n * Parents can subscribe to changes via:\n *\n * - template event bindings. For example, `(myOutput)=\"doSomething($event)\"`\n * - programmatic subscription by using `OutputRef#subscribe`.\n *\n * @usageNotes\n *\n * To use `output()`, import the function from `@angular/core`.\n *\n * ```ts\n * import {output} from '@angular/core';\n * ```\n *\n * Inside your component, introduce a new class member and initialize\n * it with a call to `output`.\n *\n * ```ts\n * @Directive({\n * ...\n * })\n * export class MyDir {\n * nameChange = output(); // OutputEmitterRef\n * onClick = output(); // OutputEmitterRef\n * }\n * ```\n *\n * You can emit values to consumers of your directive, by using\n * the `emit` method from `OutputEmitterRef`.\n *\n * ```ts\n * updateName(newName: string): void {\n * this.nameChange.emit(newName);\n * }\n * ```\n * @initializerApiFunction {\"showTypesInSignaturePreview\": true}\n * @publicAPI\n */\nfunction output(opts) {\n ngDevMode && assertInInjectionContext(output);\n return new OutputEmitterRef();\n}\n\nfunction inputFunction(initialValue, opts) {\n ngDevMode && assertInInjectionContext(input);\n return createInputSignal(initialValue, opts);\n}\nfunction inputRequiredFunction(opts) {\n ngDevMode && assertInInjectionContext(input);\n return createInputSignal(REQUIRED_UNSET_VALUE, opts);\n}\n/**\n * The `input` function allows declaration of Angular inputs in directives\n * and components.\n *\n * There are two variants of inputs that can be declared:\n *\n * 1. **Optional inputs** with an initial value.\n * 2. **Required inputs** that consumers need to set.\n *\n * By default, the `input` function will declare optional inputs that\n * always have an initial value. Required inputs can be declared\n * using the `input.required()` function.\n *\n * Inputs are signals. The values of an input are exposed as a `Signal`.\n * The signal always holds the latest value of the input that is bound\n * from the parent.\n *\n * @usageNotes\n * To use signal-based inputs, import `input` from `@angular/core`.\n *\n * ```ts\n * import {input} from '@angular/core`;\n * ```\n *\n * Inside your component, introduce a new class member and initialize\n * it with a call to `input` or `input.required`.\n *\n * ```ts\n * @Component({\n * ...\n * })\n * export class UserProfileComponent {\n * firstName = input(); // Signal\n * lastName = input.required(); // Signal\n * age = input(0) // Signal\n * }\n * ```\n *\n * Inside your component template, you can display values of the inputs\n * by calling the signal.\n *\n * ```html\n * {{firstName()}} \n * ```\n *\n * @publicAPI\n * @initializerApiFunction\n */\nconst input = (() => {\n // Note: This may be considered a side-effect, but nothing will depend on\n // this assignment, unless this `input` constant export is accessed. It's a\n // self-contained side effect that is local to the user facing`input` export.\n inputFunction.required = inputRequiredFunction;\n return inputFunction;\n})();\n\n/**\n * Creates an ElementRef from the most recent node.\n *\n * @returns The ElementRef instance to use\n */\nfunction injectElementRef() {\n return createElementRef(getCurrentTNode(), getLView());\n}\n/**\n * Creates an ElementRef given a node.\n *\n * @param tNode The node for which you'd like an ElementRef\n * @param lView The view to which the node belongs\n * @returns The ElementRef instance to use\n */\nfunction createElementRef(tNode, lView) {\n return new ElementRef(getNativeByTNode(tNode, lView));\n}\n/**\n * A wrapper around a native element inside of a View.\n *\n * An `ElementRef` is backed by a render-specific element. In the browser, this is usually a DOM\n * element.\n *\n * @security Permitting direct access to the DOM can make your application more vulnerable to\n * XSS attacks. Carefully review any use of `ElementRef` in your code. For more detail, see the\n * [Security Guide](https://g.co/ng/security).\n *\n * @publicApi\n */\n// Note: We don't expose things like `Injector`, `ViewContainer`, ... here,\n// i.e. users have to ask for what they need. With that, we can build better analysis tools\n// and could do better codegen in the future.\nclass ElementRef {\n /**\n * \n *
\n *
\n * Use this API as the last resort when direct access to DOM is needed. Use templating and\n * data-binding provided by Angular instead. Alternatively you can take a look at\n * {@link Renderer2} which provides an API that can be safely used.\n *
\n *
\n */\n nativeElement;\n constructor(nativeElement) {\n this.nativeElement = nativeElement;\n }\n /**\n * @internal\n * @nocollapse\n */\n static __NG_ELEMENT_ID__ = injectElementRef;\n}\n/**\n * Unwraps `ElementRef` and return the `nativeElement`.\n *\n * @param value value to unwrap\n * @returns `nativeElement` if `ElementRef` otherwise returns value as is.\n */\nfunction unwrapElementRef(value) {\n return value instanceof ElementRef ? value.nativeElement : value;\n}\n\n/**\n * Checks if the given `value` is a reactive `Signal`.\n */\nfunction isSignal(value) {\n return typeof value === 'function' && value[SIGNAL$1] !== undefined;\n}\n\n/** Symbol used distinguish `WritableSignal` from other non-writable signals and functions. */\nconst ɵWRITABLE_SIGNAL = /* @__PURE__ */ Symbol('WRITABLE_SIGNAL');\n/**\n * Utility function used during template type checking to extract the value from a `WritableSignal`.\n * @codeGenApi\n */\nfunction ɵunwrapWritableSignal(value) {\n // Note: the function uses `WRITABLE_SIGNAL` as a brand instead of `WritableSignal`,\n // because the latter incorrectly unwraps non-signal getter functions.\n return null;\n}\n/**\n * Create a `Signal` that can be set or updated directly.\n */\nfunction signal(initialValue, options) {\n const signalFn = createSignal$1(initialValue);\n const node = signalFn[SIGNAL$1];\n if (options?.equal) {\n node.equal = options.equal;\n }\n signalFn.set = (newValue) => signalSetFn$1(node, newValue);\n signalFn.update = (updateFn) => signalUpdateFn$1(node, updateFn);\n signalFn.asReadonly = signalAsReadonlyFn.bind(signalFn);\n if (ngDevMode) {\n signalFn.toString = () => `[Signal: ${signalFn()}]`;\n node.debugName = options?.debugName;\n }\n return signalFn;\n}\nfunction signalAsReadonlyFn() {\n const node = this[SIGNAL$1];\n if (node.readonlyFn === undefined) {\n const readonlyFn = () => this();\n readonlyFn[SIGNAL$1] = node;\n node.readonlyFn = readonlyFn;\n }\n return node.readonlyFn;\n}\n/**\n * Checks if the given `value` is a writeable signal.\n */\nfunction isWritableSignal(value) {\n return isSignal(value) && typeof value.set === 'function';\n}\n\nfunction symbolIterator() {\n // @ts-expect-error accessing a private member\n return this._results[Symbol.iterator]();\n}\n/**\n * An unmodifiable list of items that Angular keeps up to date when the state\n * of the application changes.\n *\n * The type of object that {@link ViewChildren}, {@link ContentChildren}, and {@link QueryList}\n * provide.\n *\n * Implements an iterable interface, therefore it can be used in both ES6\n * javascript `for (var i of items)` loops as well as in Angular templates with\n * `*ngFor=\"let i of myList\"`.\n *\n * Changes can be observed by subscribing to the changes `Observable`.\n *\n * NOTE: In the future this class will implement an `Observable` interface.\n *\n * @usageNotes\n * ### Example\n * ```ts\n * @Component({...})\n * class Container {\n * @ViewChildren(Item) items:QueryList- ;\n * }\n * ```\n *\n * @publicApi\n */\nclass QueryList {\n _emitDistinctChangesOnly;\n dirty = true;\n _onDirty = undefined;\n _results = [];\n _changesDetected = false;\n _changes = undefined;\n length = 0;\n first = undefined;\n last = undefined;\n /**\n * Returns `Observable` of `QueryList` notifying the subscriber of changes.\n */\n get changes() {\n return (this._changes ??= new Subject());\n }\n /**\n * @param emitDistinctChangesOnly Whether `QueryList.changes` should fire only when actual change\n * has occurred. Or if it should fire when query is recomputed. (recomputing could resolve in\n * the same result)\n */\n constructor(_emitDistinctChangesOnly = false) {\n this._emitDistinctChangesOnly = _emitDistinctChangesOnly;\n }\n /**\n * Returns the QueryList entry at `index`.\n */\n get(index) {\n return this._results[index];\n }\n /**\n * See\n * [Array.map](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/map)\n */\n map(fn) {\n return this._results.map(fn);\n }\n filter(fn) {\n return this._results.filter(fn);\n }\n /**\n * See\n * [Array.find](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/find)\n */\n find(fn) {\n return this._results.find(fn);\n }\n /**\n * See\n * [Array.reduce](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/reduce)\n */\n reduce(fn, init) {\n return this._results.reduce(fn, init);\n }\n /**\n * See\n * [Array.forEach](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/forEach)\n */\n forEach(fn) {\n this._results.forEach(fn);\n }\n /**\n * See\n * [Array.some](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/some)\n */\n some(fn) {\n return this._results.some(fn);\n }\n /**\n * Returns a copy of the internal results list as an Array.\n */\n toArray() {\n return this._results.slice();\n }\n toString() {\n return this._results.toString();\n }\n /**\n * Updates the stored data of the query list, and resets the `dirty` flag to `false`, so that\n * on change detection, it will not notify of changes to the queries, unless a new change\n * occurs.\n *\n * @param resultsTree The query results to store\n * @param identityAccessor Optional function for extracting stable object identity from a value\n * in the array. This function is executed for each element of the query result list while\n * comparing current query list with the new one (provided as a first argument of the `reset`\n * function) to detect if the lists are different. If the function is not provided, elements\n * are compared as is (without any pre-processing).\n */\n reset(resultsTree, identityAccessor) {\n this.dirty = false;\n const newResultFlat = flatten(resultsTree);\n if ((this._changesDetected = !arrayEquals(this._results, newResultFlat, identityAccessor))) {\n this._results = newResultFlat;\n this.length = newResultFlat.length;\n this.last = newResultFlat[this.length - 1];\n this.first = newResultFlat[0];\n }\n }\n /**\n * Triggers a change event by emitting on the `changes` {@link EventEmitter}.\n */\n notifyOnChanges() {\n if (this._changes !== undefined && (this._changesDetected || !this._emitDistinctChangesOnly))\n this._changes.next(this);\n }\n /** @internal */\n onDirty(cb) {\n this._onDirty = cb;\n }\n /** internal */\n setDirty() {\n this.dirty = true;\n this._onDirty?.();\n }\n /** internal */\n destroy() {\n if (this._changes !== undefined) {\n this._changes.complete();\n this._changes.unsubscribe();\n }\n }\n [Symbol.iterator] = (() => symbolIterator)();\n}\n\n/**\n * The name of an attribute that can be added to the hydration boundary node\n * (component host node) to disable hydration for the content within that boundary.\n */\nconst SKIP_HYDRATION_ATTR_NAME = 'ngSkipHydration';\n/** Lowercase name of the `ngSkipHydration` attribute used for case-insensitive comparisons. */\nconst SKIP_HYDRATION_ATTR_NAME_LOWER_CASE = 'ngskiphydration';\n/**\n * Helper function to check if a given TNode has the 'ngSkipHydration' attribute.\n */\nfunction hasSkipHydrationAttrOnTNode(tNode) {\n const attrs = tNode.mergedAttrs;\n if (attrs === null)\n return false;\n // only ever look at the attribute name and skip the values\n for (let i = 0; i < attrs.length; i += 2) {\n const value = attrs[i];\n // This is a marker, which means that the static attributes section is over,\n // so we can exit early.\n if (typeof value === 'number')\n return false;\n if (typeof value === 'string' && value.toLowerCase() === SKIP_HYDRATION_ATTR_NAME_LOWER_CASE) {\n return true;\n }\n }\n return false;\n}\n/**\n * Helper function to check if a given RElement has the 'ngSkipHydration' attribute.\n */\nfunction hasSkipHydrationAttrOnRElement(rNode) {\n return rNode.hasAttribute(SKIP_HYDRATION_ATTR_NAME);\n}\n/**\n * Checks whether a TNode has a flag to indicate that it's a part of\n * a skip hydration block.\n */\nfunction hasInSkipHydrationBlockFlag(tNode) {\n return (tNode.flags & 128 /* TNodeFlags.inSkipHydrationBlock */) === 128 /* TNodeFlags.inSkipHydrationBlock */;\n}\n/**\n * Helper function that determines if a given node is within a skip hydration block\n * by navigating up the TNode tree to see if any parent nodes have skip hydration\n * attribute.\n */\nfunction isInSkipHydrationBlock(tNode) {\n if (hasInSkipHydrationBlockFlag(tNode)) {\n return true;\n }\n let currentTNode = tNode.parent;\n while (currentTNode) {\n if (hasInSkipHydrationBlockFlag(tNode) || hasSkipHydrationAttrOnTNode(currentTNode)) {\n return true;\n }\n currentTNode = currentTNode.parent;\n }\n return false;\n}\n/**\n * Check if an i18n block is in a skip hydration section by looking at a parent TNode\n * to determine if this TNode is in a skip hydration section or the TNode has\n * the `ngSkipHydration` attribute.\n */\nfunction isI18nInSkipHydrationBlock(parentTNode) {\n return (hasInSkipHydrationBlockFlag(parentTNode) ||\n hasSkipHydrationAttrOnTNode(parentTNode) ||\n isInSkipHydrationBlock(parentTNode));\n}\n\n/**\n * The strategy that the default change detector uses to detect changes.\n * When set, takes effect the next time change detection is triggered.\n *\n * @see {@link /api/core/ChangeDetectorRef?tab=usage-notes Change detection usage}\n * @see {@link /best-practices/skipping-subtrees Skipping component subtrees}\n *\n * @publicApi\n */\nvar ChangeDetectionStrategy;\n(function (ChangeDetectionStrategy) {\n /**\n * Use the `CheckOnce` strategy, meaning that automatic change detection is deactivated\n * until reactivated by setting the strategy to `Default` (`CheckAlways`).\n * Change detection can still be explicitly invoked.\n * This strategy applies to all child directives and cannot be overridden.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"OnPush\"] = 0] = \"OnPush\";\n /**\n * Use the default `CheckAlways` strategy, in which change detection is automatic until\n * explicitly deactivated.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"Default\"] = 1] = \"Default\";\n})(ChangeDetectionStrategy || (ChangeDetectionStrategy = {}));\n\n// Keeps track of the currently-active LViews.\nconst TRACKED_LVIEWS = new Map();\n// Used for generating unique IDs for LViews.\nlet uniqueIdCounter = 0;\n/** Gets a unique ID that can be assigned to an LView. */\nfunction getUniqueLViewId() {\n return uniqueIdCounter++;\n}\n/** Starts tracking an LView. */\nfunction registerLView(lView) {\n ngDevMode && assertNumber(lView[ID], 'LView must have an ID in order to be registered');\n TRACKED_LVIEWS.set(lView[ID], lView);\n}\n/** Gets an LView by its unique ID. */\nfunction getLViewById(id) {\n ngDevMode && assertNumber(id, 'ID used for LView lookup must be a number');\n return TRACKED_LVIEWS.get(id) || null;\n}\n/** Stops tracking an LView. */\nfunction unregisterLView(lView) {\n ngDevMode && assertNumber(lView[ID], 'Cannot stop tracking an LView that does not have an ID');\n TRACKED_LVIEWS.delete(lView[ID]);\n}\n/** Gets the currently-tracked views. */\nfunction getTrackedLViews() {\n return TRACKED_LVIEWS;\n}\n\n/**\n * The internal view context which is specific to a given DOM element, directive or\n * component instance. Each value in here (besides the LView and element node details)\n * can be present, null or undefined. If undefined then it implies the value has not been\n * looked up yet, otherwise, if null, then a lookup was executed and nothing was found.\n *\n * Each value will get filled when the respective value is examined within the getContext\n * function. The component, element and each directive instance will share the same instance\n * of the context.\n */\nclass LContext {\n lViewId;\n nodeIndex;\n native;\n /**\n * The instance of the Component node.\n */\n component;\n /**\n * The list of active directives that exist on this element.\n */\n directives;\n /**\n * The map of local references (local reference name => element or directive instance) that\n * exist on this element.\n */\n localRefs;\n /** Component's parent view data. */\n get lView() {\n return getLViewById(this.lViewId);\n }\n constructor(\n /**\n * ID of the component's parent view data.\n */\n lViewId, \n /**\n * The index instance of the node.\n */\n nodeIndex, \n /**\n * The instance of the DOM node that is attached to the lNode.\n */\n native) {\n this.lViewId = lViewId;\n this.nodeIndex = nodeIndex;\n this.native = native;\n }\n}\n\n/**\n * Returns the matching `LContext` data for a given DOM node, directive or component instance.\n *\n * This function will examine the provided DOM element, component, or directive instance\\'s\n * monkey-patched property to derive the `LContext` data. Once called then the monkey-patched\n * value will be that of the newly created `LContext`.\n *\n * If the monkey-patched value is the `LView` instance then the context value for that\n * target will be created and the monkey-patch reference will be updated. Therefore when this\n * function is called it may mutate the provided element\\'s, component\\'s or any of the associated\n * directive\\'s monkey-patch values.\n *\n * If the monkey-patch value is not detected then the code will walk up the DOM until an element\n * is found which contains a monkey-patch reference. When that occurs then the provided element\n * will be updated with a new context (which is then returned). If the monkey-patch value is not\n * detected for a component/directive instance then it will throw an error (all components and\n * directives should be automatically monkey-patched by ivy).\n *\n * @param target Component, Directive or DOM Node.\n */\nfunction getLContext(target) {\n let mpValue = readPatchedData(target);\n if (mpValue) {\n // only when it's an array is it considered an LView instance\n // ... otherwise it's an already constructed LContext instance\n if (isLView(mpValue)) {\n const lView = mpValue;\n let nodeIndex;\n let component = undefined;\n let directives = undefined;\n if (isComponentInstance(target)) {\n nodeIndex = findViaComponent(lView, target);\n if (nodeIndex == -1) {\n throw new Error('The provided component was not found in the application');\n }\n component = target;\n }\n else if (isDirectiveInstance(target)) {\n nodeIndex = findViaDirective(lView, target);\n if (nodeIndex == -1) {\n throw new Error('The provided directive was not found in the application');\n }\n directives = getDirectivesAtNodeIndex(nodeIndex, lView);\n }\n else {\n nodeIndex = findViaNativeElement(lView, target);\n if (nodeIndex == -1) {\n return null;\n }\n }\n // the goal is not to fill the entire context full of data because the lookups\n // are expensive. Instead, only the target data (the element, component, container, ICU\n // expression or directive details) are filled into the context. If called multiple times\n // with different target values then the missing target data will be filled in.\n const native = unwrapRNode(lView[nodeIndex]);\n const existingCtx = readPatchedData(native);\n const context = existingCtx && !Array.isArray(existingCtx)\n ? existingCtx\n : createLContext(lView, nodeIndex, native);\n // only when the component has been discovered then update the monkey-patch\n if (component && context.component === undefined) {\n context.component = component;\n attachPatchData(context.component, context);\n }\n // only when the directives have been discovered then update the monkey-patch\n if (directives && context.directives === undefined) {\n context.directives = directives;\n for (let i = 0; i < directives.length; i++) {\n attachPatchData(directives[i], context);\n }\n }\n attachPatchData(context.native, context);\n mpValue = context;\n }\n }\n else {\n const rElement = target;\n ngDevMode && assertDomNode(rElement);\n // if the context is not found then we need to traverse upwards up the DOM\n // to find the nearest element that has already been monkey patched with data\n let parent = rElement;\n while ((parent = parent.parentNode)) {\n const parentContext = readPatchedData(parent);\n if (parentContext) {\n const lView = Array.isArray(parentContext) ? parentContext : parentContext.lView;\n // the edge of the app was also reached here through another means\n // (maybe because the DOM was changed manually).\n if (!lView) {\n return null;\n }\n const index = findViaNativeElement(lView, rElement);\n if (index >= 0) {\n const native = unwrapRNode(lView[index]);\n const context = createLContext(lView, index, native);\n attachPatchData(native, context);\n mpValue = context;\n break;\n }\n }\n }\n }\n return mpValue || null;\n}\n/**\n * Creates an empty instance of a `LContext` context\n */\nfunction createLContext(lView, nodeIndex, native) {\n return new LContext(lView[ID], nodeIndex, native);\n}\n/**\n * Takes a component instance and returns the view for that component.\n *\n * @param componentInstance\n * @returns The component's view\n */\nfunction getComponentViewByInstance(componentInstance) {\n let patchedData = readPatchedData(componentInstance);\n let lView;\n if (isLView(patchedData)) {\n const contextLView = patchedData;\n const nodeIndex = findViaComponent(contextLView, componentInstance);\n lView = getComponentLViewByIndex(nodeIndex, contextLView);\n const context = createLContext(contextLView, nodeIndex, lView[HOST]);\n context.component = componentInstance;\n attachPatchData(componentInstance, context);\n attachPatchData(context.native, context);\n }\n else {\n const context = patchedData;\n const contextLView = context.lView;\n ngDevMode && assertLView(contextLView);\n lView = getComponentLViewByIndex(context.nodeIndex, contextLView);\n }\n return lView;\n}\n/**\n * This property will be monkey-patched on elements, components and directives.\n */\nconst MONKEY_PATCH_KEY_NAME = '__ngContext__';\nfunction attachLViewId(target, data) {\n target[MONKEY_PATCH_KEY_NAME] = data[ID];\n}\n/**\n * Returns the monkey-patch value data present on the target (which could be\n * a component, directive or a DOM node).\n */\nfunction readLView(target) {\n const data = readPatchedData(target);\n if (isLView(data)) {\n return data;\n }\n return data ? data.lView : null;\n}\n/**\n * Assigns the given data to the given target (which could be a component,\n * directive or DOM node instance) using monkey-patching.\n */\nfunction attachPatchData(target, data) {\n ngDevMode && assertDefined(target, 'Target expected');\n // Only attach the ID of the view in order to avoid memory leaks (see #41047). We only do this\n // for `LView`, because we have control over when an `LView` is created and destroyed, whereas\n // we can't know when to remove an `LContext`.\n if (isLView(data)) {\n target[MONKEY_PATCH_KEY_NAME] = data[ID];\n registerLView(data);\n }\n else {\n target[MONKEY_PATCH_KEY_NAME] = data;\n }\n}\n/**\n * Returns the monkey-patch value data present on the target (which could be\n * a component, directive or a DOM node).\n */\nfunction readPatchedData(target) {\n ngDevMode && assertDefined(target, 'Target expected');\n const data = target[MONKEY_PATCH_KEY_NAME];\n return typeof data === 'number' ? getLViewById(data) : data || null;\n}\nfunction readPatchedLView(target) {\n const value = readPatchedData(target);\n if (value) {\n return (isLView(value) ? value : value.lView);\n }\n return null;\n}\nfunction isComponentInstance(instance) {\n return instance && instance.constructor && instance.constructor.ɵcmp;\n}\nfunction isDirectiveInstance(instance) {\n return instance && instance.constructor && instance.constructor.ɵdir;\n}\n/**\n * Locates the element within the given LView and returns the matching index\n */\nfunction findViaNativeElement(lView, target) {\n const tView = lView[TVIEW];\n for (let i = HEADER_OFFSET; i < tView.bindingStartIndex; i++) {\n if (unwrapRNode(lView[i]) === target) {\n return i;\n }\n }\n return -1;\n}\n/**\n * Locates the next tNode (child, sibling or parent).\n */\nfunction traverseNextElement(tNode) {\n if (tNode.child) {\n return tNode.child;\n }\n else if (tNode.next) {\n return tNode.next;\n }\n else {\n // Let's take the following template:
text
\n // After checking the text node, we need to find the next parent that has a \"next\" TNode,\n // in this case the parent `div`, so that we can find the component.\n while (tNode.parent && !tNode.parent.next) {\n tNode = tNode.parent;\n }\n return tNode.parent && tNode.parent.next;\n }\n}\n/**\n * Locates the component within the given LView and returns the matching index\n */\nfunction findViaComponent(lView, componentInstance) {\n const componentIndices = lView[TVIEW].components;\n if (componentIndices) {\n for (let i = 0; i < componentIndices.length; i++) {\n const elementComponentIndex = componentIndices[i];\n const componentView = getComponentLViewByIndex(elementComponentIndex, lView);\n if (componentView[CONTEXT] === componentInstance) {\n return elementComponentIndex;\n }\n }\n }\n else {\n const rootComponentView = getComponentLViewByIndex(HEADER_OFFSET, lView);\n const rootComponent = rootComponentView[CONTEXT];\n if (rootComponent === componentInstance) {\n // we are dealing with the root element here therefore we know that the\n // element is the very first element after the HEADER data in the lView\n return HEADER_OFFSET;\n }\n }\n return -1;\n}\n/**\n * Locates the directive within the given LView and returns the matching index\n */\nfunction findViaDirective(lView, directiveInstance) {\n // if a directive is monkey patched then it will (by default)\n // have a reference to the LView of the current view. The\n // element bound to the directive being search lives somewhere\n // in the view data. We loop through the nodes and check their\n // list of directives for the instance.\n let tNode = lView[TVIEW].firstChild;\n while (tNode) {\n const directiveIndexStart = tNode.directiveStart;\n const directiveIndexEnd = tNode.directiveEnd;\n for (let i = directiveIndexStart; i < directiveIndexEnd; i++) {\n if (lView[i] === directiveInstance) {\n return tNode.index;\n }\n }\n tNode = traverseNextElement(tNode);\n }\n return -1;\n}\n/**\n * Returns a list of directives applied to a node at a specific index. The list includes\n * directives matched by selector and any host directives, but it excludes components.\n * Use `getComponentAtNodeIndex` to find the component applied to a node.\n *\n * @param nodeIndex The node index\n * @param lView The target view data\n */\nfunction getDirectivesAtNodeIndex(nodeIndex, lView) {\n const tNode = lView[TVIEW].data[nodeIndex];\n if (tNode.directiveStart === 0)\n return EMPTY_ARRAY;\n const results = [];\n for (let i = tNode.directiveStart; i < tNode.directiveEnd; i++) {\n const directiveInstance = lView[i];\n if (!isComponentInstance(directiveInstance)) {\n results.push(directiveInstance);\n }\n }\n return results;\n}\nfunction getComponentAtNodeIndex(nodeIndex, lView) {\n const tNode = lView[TVIEW].data[nodeIndex];\n return isComponentHost(tNode) ? lView[tNode.directiveStart + tNode.componentOffset] : null;\n}\n/**\n * Returns a map of local references (local reference name => element or directive instance) that\n * exist on a given element.\n */\nfunction discoverLocalRefs(lView, nodeIndex) {\n const tNode = lView[TVIEW].data[nodeIndex];\n if (tNode && tNode.localNames) {\n const result = {};\n let localIndex = tNode.index + 1;\n for (let i = 0; i < tNode.localNames.length; i += 2) {\n result[tNode.localNames[i]] = lView[localIndex];\n localIndex++;\n }\n return result;\n }\n return null;\n}\n\n/**\n * Retrieve the root view from any component or `LView` by walking the parent `LView` until\n * reaching the root `LView`.\n *\n * @param componentOrLView any component or `LView`\n */\nfunction getRootView(componentOrLView) {\n ngDevMode && assertDefined(componentOrLView, 'component');\n let lView = isLView(componentOrLView) ? componentOrLView : readPatchedLView(componentOrLView);\n while (lView && !isRootView(lView)) {\n lView = getLViewParent(lView);\n }\n ngDevMode && assertLView(lView);\n return lView;\n}\n/**\n * Returns the context information associated with the application where the target is situated. It\n * does this by walking the parent views until it gets to the root view, then getting the context\n * off of that.\n *\n * @param viewOrComponent the `LView` or component to get the root context for.\n */\nfunction getRootContext(viewOrComponent) {\n const rootView = getRootView(viewOrComponent);\n ngDevMode &&\n assertDefined(rootView[CONTEXT], 'Root view has no context. Perhaps it is disconnected?');\n return rootView[CONTEXT];\n}\n/**\n * Gets the first `LContainer` in the LView or `null` if none exists.\n */\nfunction getFirstLContainer(lView) {\n return getNearestLContainer(lView[CHILD_HEAD]);\n}\n/**\n * Gets the next `LContainer` that is a sibling of the given container.\n */\nfunction getNextLContainer(container) {\n return getNearestLContainer(container[NEXT]);\n}\nfunction getNearestLContainer(viewOrContainer) {\n while (viewOrContainer !== null && !isLContainer(viewOrContainer)) {\n viewOrContainer = viewOrContainer[NEXT];\n }\n return viewOrContainer;\n}\n\n/**\n * Retrieves the component instance associated with a given DOM element.\n *\n * @usageNotes\n * Given the following DOM structure:\n *\n * ```html\n * \n * \n * \n *
\n * \n * ```\n *\n * Calling `getComponent` on `` will return the instance of `ChildComponent`\n * associated with this DOM element.\n *\n * Calling the function on `` will return the `MyApp` instance.\n *\n *\n * @param element DOM element from which the component should be retrieved.\n * @returns Component instance associated with the element or `null` if there\n * is no component associated with it.\n *\n * @publicApi\n */\nfunction getComponent(element) {\n ngDevMode && assertDomElement(element);\n const context = getLContext(element);\n if (context === null)\n return null;\n if (context.component === undefined) {\n const lView = context.lView;\n if (lView === null) {\n return null;\n }\n context.component = getComponentAtNodeIndex(context.nodeIndex, lView);\n }\n return context.component;\n}\n/**\n * If inside an embedded view (e.g. `*ngIf` or `*ngFor`), retrieves the context of the embedded\n * view that the element is part of. Otherwise retrieves the instance of the component whose view\n * owns the element (in this case, the result is the same as calling `getOwningComponent`).\n *\n * @param element Element for which to get the surrounding component instance.\n * @returns Instance of the component that is around the element or null if the element isn't\n * inside any component.\n *\n * @publicApi\n */\nfunction getContext(element) {\n assertDomElement(element);\n const context = getLContext(element);\n const lView = context ? context.lView : null;\n return lView === null ? null : lView[CONTEXT];\n}\n/**\n * Retrieves the component instance whose view contains the DOM element.\n *\n * For example, if `` is used in the template of ``\n * (i.e. a `ViewChild` of ``), calling `getOwningComponent` on ``\n * would return ``.\n *\n * @param elementOrDir DOM element, component or directive instance\n * for which to retrieve the root components.\n * @returns Component instance whose view owns the DOM element or null if the element is not\n * part of a component view.\n *\n * @publicApi\n */\nfunction getOwningComponent(elementOrDir) {\n const context = getLContext(elementOrDir);\n let lView = context ? context.lView : null;\n if (lView === null)\n return null;\n let parent;\n while (lView[TVIEW].type === 2 /* TViewType.Embedded */ && (parent = getLViewParent(lView))) {\n lView = parent;\n }\n return isRootView(lView) ? null : lView[CONTEXT];\n}\n/**\n * Retrieves all root components associated with a DOM element, directive or component instance.\n * Root components are those which have been bootstrapped by Angular.\n *\n * @param elementOrDir DOM element, component or directive instance\n * for which to retrieve the root components.\n * @returns Root components associated with the target object.\n *\n * @publicApi\n */\nfunction getRootComponents(elementOrDir) {\n const lView = readPatchedLView(elementOrDir);\n return lView !== null ? [getRootContext(lView)] : [];\n}\n/**\n * Retrieves an `Injector` associated with an element, component or directive instance.\n *\n * @param elementOrDir DOM element, component or directive instance for which to\n * retrieve the injector.\n * @returns Injector associated with the element, component or directive instance.\n *\n * @publicApi\n */\nfunction getInjector(elementOrDir) {\n const context = getLContext(elementOrDir);\n const lView = context ? context.lView : null;\n if (lView === null)\n return Injector.NULL;\n const tNode = lView[TVIEW].data[context.nodeIndex];\n return new NodeInjector(tNode, lView);\n}\n/**\n * Retrieve a set of injection tokens at a given DOM node.\n *\n * @param element Element for which the injection tokens should be retrieved.\n */\nfunction getInjectionTokens(element) {\n const context = getLContext(element);\n const lView = context ? context.lView : null;\n if (lView === null)\n return [];\n const tView = lView[TVIEW];\n const tNode = tView.data[context.nodeIndex];\n const providerTokens = [];\n const startIndex = tNode.providerIndexes & 1048575 /* TNodeProviderIndexes.ProvidersStartIndexMask */;\n const endIndex = tNode.directiveEnd;\n for (let i = startIndex; i < endIndex; i++) {\n let value = tView.data[i];\n if (isDirectiveDefHack(value)) {\n // The fact that we sometimes store Type and sometimes DirectiveDef in this location is a\n // design flaw. We should always store same type so that we can be monomorphic. The issue\n // is that for Components/Directives we store the def instead the type. The correct behavior\n // is that we should always be storing injectable type in this location.\n value = value.type;\n }\n providerTokens.push(value);\n }\n return providerTokens;\n}\n/**\n * Retrieves directive instances associated with a given DOM node. Does not include\n * component instances.\n *\n * @usageNotes\n * Given the following DOM structure:\n *\n * ```html\n * \n * \n * \n * \n * ```\n *\n * Calling `getDirectives` on `` will return an array with an instance of the `MyButton`\n * directive that is associated with the DOM node.\n *\n * Calling `getDirectives` on `` will return an empty array.\n *\n * @param node DOM node for which to get the directives.\n * @returns Array of directives associated with the node.\n *\n * @publicApi\n */\nfunction getDirectives(node) {\n // Skip text nodes because we can't have directives associated with them.\n if (node instanceof Text) {\n return [];\n }\n const context = getLContext(node);\n const lView = context ? context.lView : null;\n if (lView === null) {\n return [];\n }\n const tView = lView[TVIEW];\n const nodeIndex = context.nodeIndex;\n if (!tView?.data[nodeIndex]) {\n return [];\n }\n if (context.directives === undefined) {\n context.directives = getDirectivesAtNodeIndex(nodeIndex, lView);\n }\n // The `directives` in this case are a named array called `LComponentView`. Clone the\n // result so we don't expose an internal data structure in the user's console.\n return context.directives === null ? [] : [...context.directives];\n}\n/**\n * Returns the debug (partial) metadata for a particular directive or component instance.\n * The function accepts an instance of a directive or component and returns the corresponding\n * metadata.\n *\n * @param directiveOrComponentInstance Instance of a directive or component\n * @returns metadata of the passed directive or component\n *\n * @publicApi\n */\nfunction getDirectiveMetadata$1(directiveOrComponentInstance) {\n const { constructor } = directiveOrComponentInstance;\n if (!constructor) {\n throw new Error('Unable to find the instance constructor');\n }\n // In case a component inherits from a directive, we may have component and directive metadata\n // To ensure we don't get the metadata of the directive, we want to call `getComponentDef` first.\n const componentDef = getComponentDef(constructor);\n if (componentDef) {\n const inputs = extractInputDebugMetadata(componentDef.inputs);\n return {\n inputs,\n outputs: componentDef.outputs,\n encapsulation: componentDef.encapsulation,\n changeDetection: componentDef.onPush\n ? ChangeDetectionStrategy.OnPush\n : ChangeDetectionStrategy.Default,\n };\n }\n const directiveDef = getDirectiveDef(constructor);\n if (directiveDef) {\n const inputs = extractInputDebugMetadata(directiveDef.inputs);\n return { inputs, outputs: directiveDef.outputs };\n }\n return null;\n}\n/**\n * Retrieve map of local references.\n *\n * The references are retrieved as a map of local reference name to element or directive instance.\n *\n * @param target DOM element, component or directive instance for which to retrieve\n * the local references.\n */\nfunction getLocalRefs(target) {\n const context = getLContext(target);\n if (context === null)\n return {};\n if (context.localRefs === undefined) {\n const lView = context.lView;\n if (lView === null) {\n return {};\n }\n context.localRefs = discoverLocalRefs(lView, context.nodeIndex);\n }\n return context.localRefs || {};\n}\n/**\n * Retrieves the host element of a component or directive instance.\n * The host element is the DOM element that matched the selector of the directive.\n *\n * @param componentOrDirective Component or directive instance for which the host\n * element should be retrieved.\n * @returns Host element of the target.\n *\n * @publicApi\n */\nfunction getHostElement(componentOrDirective) {\n return getLContext(componentOrDirective).native;\n}\n/**\n * Retrieves the rendered text for a given component.\n *\n * This function retrieves the host element of a component and\n * and then returns the `textContent` for that element. This implies\n * that the text returned will include re-projected content of\n * the component as well.\n *\n * @param component The component to return the content text for.\n */\nfunction getRenderedText(component) {\n const hostElement = getHostElement(component);\n return hostElement.textContent || '';\n}\n/**\n * Retrieves a list of event listeners associated with a DOM element. The list does include host\n * listeners, but it does not include event listeners defined outside of the Angular context\n * (e.g. through `addEventListener`).\n *\n * @usageNotes\n * Given the following DOM structure:\n *\n * ```html\n * \n *
\n * \n * ```\n *\n * Calling `getListeners` on `` will return an object that looks as follows:\n *\n * ```ts\n * {\n * name: 'click',\n * element:
,\n * callback: () => doSomething(),\n * useCapture: false\n * }\n * ```\n *\n * @param element Element for which the DOM listeners should be retrieved.\n * @returns Array of event listeners on the DOM element.\n *\n * @publicApi\n */\nfunction getListeners(element) {\n ngDevMode && assertDomElement(element);\n const lContext = getLContext(element);\n const lView = lContext === null ? null : lContext.lView;\n if (lView === null)\n return [];\n const tView = lView[TVIEW];\n const lCleanup = lView[CLEANUP];\n const tCleanup = tView.cleanup;\n const listeners = [];\n if (tCleanup && lCleanup) {\n for (let i = 0; i < tCleanup.length;) {\n const firstParam = tCleanup[i++];\n const secondParam = tCleanup[i++];\n if (typeof firstParam === 'string') {\n const name = firstParam;\n const listenerElement = unwrapRNode(lView[secondParam]);\n const callback = lCleanup[tCleanup[i++]];\n const useCaptureOrIndx = tCleanup[i++];\n // if useCaptureOrIndx is boolean then report it as is.\n // if useCaptureOrIndx is positive number then it in unsubscribe method\n // if useCaptureOrIndx is negative number then it is a Subscription\n const type = typeof useCaptureOrIndx === 'boolean' || useCaptureOrIndx >= 0 ? 'dom' : 'output';\n const useCapture = typeof useCaptureOrIndx === 'boolean' ? useCaptureOrIndx : false;\n if (element == listenerElement) {\n listeners.push({ element, name, callback, useCapture, type });\n }\n }\n }\n }\n listeners.sort(sortListeners);\n return listeners;\n}\nfunction sortListeners(a, b) {\n if (a.name == b.name)\n return 0;\n return a.name < b.name ? -1 : 1;\n}\n/**\n * This function should not exist because it is megamorphic and only mostly correct.\n *\n * See call site for more info.\n */\nfunction isDirectiveDefHack(obj) {\n return (obj.type !== undefined &&\n obj.declaredInputs !== undefined &&\n obj.findHostDirectiveDefs !== undefined);\n}\n/**\n * Retrieve the component `LView` from component/element.\n *\n * NOTE: `LView` is a private and should not be leaked outside.\n * Don't export this method to `ng.*` on window.\n *\n * @param target DOM element or component instance for which to retrieve the LView.\n */\nfunction getComponentLView(target) {\n const lContext = getLContext(target);\n const nodeIndx = lContext.nodeIndex;\n const lView = lContext.lView;\n ngDevMode && assertLView(lView);\n const componentLView = lView[nodeIndx];\n ngDevMode && assertLView(componentLView);\n return componentLView;\n}\n/** Asserts that a value is a DOM Element. */\nfunction assertDomElement(value) {\n if (typeof Element !== 'undefined' && !(value instanceof Element)) {\n throw new Error('Expecting instance of DOM Element');\n }\n}\n/**\n * A directive definition holds additional metadata using bitwise flags to indicate\n * for example whether it is signal based.\n *\n * This information needs to be separate from the `publicName -> minifiedName`\n * mappings for backwards compatibility.\n */\nfunction extractInputDebugMetadata(inputs) {\n const res = {};\n for (const key in inputs) {\n if (inputs.hasOwnProperty(key)) {\n const value = inputs[key];\n if (value !== undefined) {\n res[key] = value[0];\n }\n }\n }\n return res;\n}\n\n/**\n * Most of the use of `document` in Angular is from within the DI system so it is possible to simply\n * inject the `DOCUMENT` token and are done.\n *\n * Ivy is special because it does not rely upon the DI and must get hold of the document some other\n * way.\n *\n * The solution is to define `getDocument()` and `setDocument()` top-level functions for ivy.\n * Wherever ivy needs the global document, it calls `getDocument()` instead.\n *\n * When running ivy outside of a browser environment, it is necessary to call `setDocument()` to\n * tell ivy what the global `document` is.\n *\n * Angular does this for us in each of the standard platforms (`Browser` and `Server`)\n * by calling `setDocument()` when providing the `DOCUMENT` token.\n */\nlet DOCUMENT = undefined;\n/**\n * Tell ivy what the `document` is for this platform.\n *\n * It is only necessary to call this if the current platform is not a browser.\n *\n * @param document The object representing the global `document` in this environment.\n */\nfunction setDocument(document) {\n DOCUMENT = document;\n}\n/**\n * Access the object that represents the `document` for this platform.\n *\n * Ivy calls this whenever it needs to access the `document` object.\n * For example to create the renderer or to do sanitization.\n */\nfunction getDocument() {\n if (DOCUMENT !== undefined) {\n return DOCUMENT;\n }\n else if (typeof document !== 'undefined') {\n return document;\n }\n throw new RuntimeError(210 /* RuntimeErrorCode.MISSING_DOCUMENT */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `The document object is not available in this context. Make sure the DOCUMENT injection token is provided.`);\n // No \"document\" can be found. This should only happen if we are running ivy outside Angular and\n // the current platform is not a browser. Since this is not a supported scenario at the moment\n // this should not happen in Angular apps.\n // Once we support running ivy outside of Angular we will need to publish `setDocument()` as a\n // public API.\n}\n\n/**\n * A DI token representing a string ID, used\n * primarily for prefixing application attributes and CSS styles when\n * {@link ViewEncapsulation#Emulated} is being used.\n *\n * The token is needed in cases when multiple applications are bootstrapped on a page\n * (for example, using `bootstrapApplication` calls). In this case, ensure that those applications\n * have different `APP_ID` value setup. For example:\n *\n * ```ts\n * bootstrapApplication(ComponentA, {\n * providers: [\n * { provide: APP_ID, useValue: 'app-a' },\n * // ... other providers ...\n * ]\n * });\n *\n * bootstrapApplication(ComponentB, {\n * providers: [\n * { provide: APP_ID, useValue: 'app-b' },\n * // ... other providers ...\n * ]\n * });\n * ```\n *\n * By default, when there is only one application bootstrapped, you don't need to provide the\n * `APP_ID` token (the `ng` will be used as an app ID).\n *\n * @publicApi\n */\nconst APP_ID = new InjectionToken(ngDevMode ? 'AppId' : '', {\n providedIn: 'root',\n factory: () => DEFAULT_APP_ID,\n});\n/** Default value of the `APP_ID` token. */\nconst DEFAULT_APP_ID = 'ng';\n/**\n * A function that is executed when a platform is initialized.\n *\n * @deprecated from v19.0.0, use providePlatformInitializer instead\n *\n * @see {@link providePlatformInitializer}\n *\n * @publicApi\n */\nconst PLATFORM_INITIALIZER = new InjectionToken(ngDevMode ? 'Platform Initializer' : '');\n/**\n * A token that indicates an opaque platform ID.\n * @publicApi\n */\nconst PLATFORM_ID = new InjectionToken(ngDevMode ? 'Platform ID' : '', {\n providedIn: 'platform',\n factory: () => 'unknown', // set a default platform name, when none set explicitly\n});\n/**\n * A DI token that indicates the root directory of\n * the application\n * @publicApi\n * @deprecated\n */\nconst PACKAGE_ROOT_URL = new InjectionToken(ngDevMode ? 'Application Packages Root URL' : '');\n// We keep this token here, rather than the animations package, so that modules that only care\n// about which animations module is loaded (e.g. the CDK) can retrieve it without having to\n// include extra dependencies. See #44970 for more context.\n/**\n * A [DI token](api/core/InjectionToken) that indicates which animations\n * module has been loaded.\n * @publicApi\n */\nconst ANIMATION_MODULE_TYPE = new InjectionToken(ngDevMode ? 'AnimationModuleType' : '');\n// TODO(crisbeto): link to CSP guide here.\n/**\n * Token used to configure the [Content Security Policy](https://web.dev/strict-csp/) nonce that\n * Angular will apply when inserting inline styles. If not provided, Angular will look up its value\n * from the `ngCspNonce` attribute of the application root node.\n *\n * @publicApi\n */\nconst CSP_NONCE = new InjectionToken(ngDevMode ? 'CSP nonce' : '', {\n providedIn: 'root',\n factory: () => {\n // Ideally we wouldn't have to use `querySelector` here since we know that the nonce will be on\n // the root node, but because the token value is used in renderers, it has to be available\n // *very* early in the bootstrapping process. This should be a fairly shallow search, because\n // the app won't have been added to the DOM yet. Some approaches that were considered:\n // 1. Find the root node through `ApplicationRef.components[i].location` - normally this would\n // be enough for our purposes, but the token is injected very early so the `components` array\n // isn't populated yet.\n // 2. Find the root `LView` through the current `LView` - renderers are a prerequisite to\n // creating the `LView`. This means that no `LView` will have been entered when this factory is\n // invoked for the root component.\n // 3. Have the token factory return `() => string` which is invoked when a nonce is requested -\n // the slightly later execution does allow us to get an `LView` reference, but the fact that\n // it is a function means that it could be executed at *any* time (including immediately) which\n // may lead to weird bugs.\n // 4. Have the `ComponentFactory` read the attribute and provide it to the injector under the\n // hood - has the same problem as #1 and #2 in that the renderer is used to query for the root\n // node and the nonce value needs to be available when the renderer is created.\n return getDocument().body?.querySelector('[ngCspNonce]')?.getAttribute('ngCspNonce') || null;\n },\n});\nconst IMAGE_CONFIG_DEFAULTS = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n placeholderResolution: 30,\n disableImageSizeWarning: false,\n disableImageLazyLoadWarning: false,\n};\n/**\n * Injection token that configures the image optimized image functionality.\n * See {@link ImageConfig} for additional information about parameters that\n * can be used.\n *\n * @see {@link NgOptimizedImage}\n * @see {@link ImageConfig}\n * @publicApi\n */\nconst IMAGE_CONFIG = new InjectionToken(ngDevMode ? 'ImageConfig' : '', {\n providedIn: 'root',\n factory: () => IMAGE_CONFIG_DEFAULTS,\n});\n\n/**\n * Create a `StateKey` that can be used to store value of type T with `TransferState`.\n *\n * Example:\n *\n * ```ts\n * const COUNTER_KEY = makeStateKey('counter');\n * let value = 10;\n *\n * transferState.set(COUNTER_KEY, value);\n * ```\n *\n * @publicApi\n */\nfunction makeStateKey(key) {\n return key;\n}\nfunction initTransferState() {\n const transferState = new TransferState();\n if (inject(PLATFORM_ID) === 'browser') {\n transferState.store = retrieveTransferredState(getDocument(), inject(APP_ID));\n }\n return transferState;\n}\n/**\n * A key value store that is transferred from the application on the server side to the application\n * on the client side.\n *\n * The `TransferState` is available as an injectable token.\n * On the client, just inject this token using DI and use it, it will be lazily initialized.\n * On the server it's already included if `renderApplication` function is used. Otherwise, import\n * the `ServerTransferStateModule` module to make the `TransferState` available.\n *\n * The values in the store are serialized/deserialized using JSON.stringify/JSON.parse. So only\n * boolean, number, string, null and non-class objects will be serialized and deserialized in a\n * non-lossy manner.\n *\n * @publicApi\n */\nclass TransferState {\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: TransferState,\n providedIn: 'root',\n factory: initTransferState,\n });\n /** @internal */\n store = {};\n onSerializeCallbacks = {};\n /**\n * Get the value corresponding to a key. Return `defaultValue` if key is not found.\n */\n get(key, defaultValue) {\n return this.store[key] !== undefined ? this.store[key] : defaultValue;\n }\n /**\n * Set the value corresponding to a key.\n */\n set(key, value) {\n this.store[key] = value;\n }\n /**\n * Remove a key from the store.\n */\n remove(key) {\n delete this.store[key];\n }\n /**\n * Test whether a key exists in the store.\n */\n hasKey(key) {\n return this.store.hasOwnProperty(key);\n }\n /**\n * Indicates whether the state is empty.\n */\n get isEmpty() {\n return Object.keys(this.store).length === 0;\n }\n /**\n * Register a callback to provide the value for a key when `toJson` is called.\n */\n onSerialize(key, callback) {\n this.onSerializeCallbacks[key] = callback;\n }\n /**\n * Serialize the current state of the store to JSON.\n */\n toJson() {\n // Call the onSerialize callbacks and put those values into the store.\n for (const key in this.onSerializeCallbacks) {\n if (this.onSerializeCallbacks.hasOwnProperty(key)) {\n try {\n this.store[key] = this.onSerializeCallbacks[key]();\n }\n catch (e) {\n console.warn('Exception in onSerialize callback: ', e);\n }\n }\n }\n // Escape script tag to avoid break out of