` tag we check the equality\n * of the VNodes corresponding to the `
` tags and, since they are the\n * same tag in the same position, we'd be able to avoid completely\n * re-rendering the subtree under them with a new DOM element and would just\n * call out to `patch` to handle reconciling their children and so on.\n *\n * 3. Check, for both windows, to see if the element at the beginning of the\n * window corresponds to the element at the end of the other window. This is\n * a heuristic which will let us identify _some_ situations in which\n * elements have changed position, for instance it _should_ detect that the\n * children nodes themselves have not changed but merely moved in the\n * following example:\n *\n * oldVNode: `
`\n * newVNode: `
`\n *\n * If we find cases like this then we also need to move the concrete DOM\n * elements corresponding to the moved children to write the re-order to the\n * DOM.\n *\n * 4. Finally, if VNodes have the `key` attribute set on them we check for any\n * nodes in the old children which have the same key as the first element in\n * our window on the new children. If we find such a node we handle calling\n * out to `patch`, moving relevant DOM nodes, and so on, in accordance with\n * what we find.\n *\n * Finally, once we've narrowed our 'windows' to the point that either of them\n * collapse (i.e. they have length 0) we then handle any remaining VNode\n * insertion or deletion that needs to happen to get a DOM state that correctly\n * reflects the new child VNodes. If, for instance, after our window on the old\n * children has collapsed we still have more nodes on the new children that\n * we haven't dealt with yet then we need to add them, or if the new children\n * collapse but we still have unhandled _old_ children then we need to make\n * sure the corresponding DOM nodes are removed.\n *\n * @param parentElm the node into which the parent VNode is rendered\n * @param oldCh the old children of the parent node\n * @param newVNode the new VNode which will replace the parent\n * @param newCh the new children of the parent node\n */\nconst updateChildren = (parentElm, oldCh, newVNode, newCh) => {\n let oldStartIdx = 0;\n let newStartIdx = 0;\n let oldEndIdx = oldCh.length - 1;\n let oldStartVnode = oldCh[0];\n let oldEndVnode = oldCh[oldEndIdx];\n let newEndIdx = newCh.length - 1;\n let newStartVnode = newCh[0];\n let newEndVnode = newCh[newEndIdx];\n let node;\n while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {\n if (oldStartVnode == null) {\n // VNode might have been moved left\n oldStartVnode = oldCh[++oldStartIdx];\n }\n else if (oldEndVnode == null) {\n oldEndVnode = oldCh[--oldEndIdx];\n }\n else if (newStartVnode == null) {\n newStartVnode = newCh[++newStartIdx];\n }\n else if (newEndVnode == null) {\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newStartVnode)) {\n // if the start nodes are the same then we should patch the new VNode\n // onto the old one, and increment our `newStartIdx` and `oldStartIdx`\n // indices to reflect that. We don't need to move any DOM Nodes around\n // since things are matched up in order.\n patch(oldStartVnode, newStartVnode);\n oldStartVnode = oldCh[++oldStartIdx];\n newStartVnode = newCh[++newStartIdx];\n }\n else if (isSameVnode(oldEndVnode, newEndVnode)) {\n // likewise, if the end nodes are the same we patch new onto old and\n // decrement our end indices, and also likewise in this case we don't\n // need to move any DOM Nodes.\n patch(oldEndVnode, newEndVnode);\n oldEndVnode = oldCh[--oldEndIdx];\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newEndVnode)) {\n patch(oldStartVnode, newEndVnode);\n // We need to move the element for `oldStartVnode` into a position which\n // will be appropriate for `newEndVnode`. For this we can use\n // `.insertBefore` and `oldEndVnode.$elm$.nextSibling`. If there is a\n // sibling for `oldEndVnode.$elm$` then we want to move the DOM node for\n // `oldStartVnode` between `oldEndVnode` and it's sibling, like so:\n //\n //
\n //
\n //
\n // \n //
\n // \n // ```\n // In this case if we do not unshadow here and use the value of the shadowing property, attributeChangedCallback\n // will be called with `newValue = \"some-value\"` and will set the shadowed property (this.someAttribute = \"another-value\")\n // to the value that was set inline i.e. \"some-value\" from above example. When\n // the connectedCallback attempts to unshadow it will use \"some-value\" as the initial value rather than \"another-value\"\n //\n // The case where the attribute was NOT set inline but was not set programmatically shall be handled/unshadowed\n // by connectedCallback as this attributeChangedCallback will not fire.\n //\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n //\n // TODO(STENCIL-16) we should think about whether or not we actually want to be reflecting the attributes to\n // properties here given that this goes against best practices outlined here\n // https://developers.google.com/web/fundamentals/web-components/best-practices#avoid-reentrancy\n if (this.hasOwnProperty(propName)) {\n newValue = this[propName];\n delete this[propName];\n }\n else if (prototype.hasOwnProperty(propName) &&\n typeof this[propName] === 'number' &&\n this[propName] == newValue) {\n // if the propName exists on the prototype of `Cstr`, this update may be a result of Stencil using native\n // APIs to reflect props as attributes. Calls to `setAttribute(someElement, propName)` will result in\n // `propName` to be converted to a `DOMString`, which may not be what we want for other primitive props.\n return;\n }\n this[propName] = newValue === null && typeof this[propName] === 'boolean' ? false : newValue;\n });\n };\n // create an array of attributes to observe\n // and also create a map of html attribute name to js property name\n Cstr.observedAttributes = members\n .filter(([_, m]) => m[0] & 15 /* MEMBER_FLAGS.HasAttribute */) // filter to only keep props that should match attributes\n .map(([propName, m]) => {\n const attrName = m[1] || propName;\n attrNameToPropName.set(attrName, propName);\n return attrName;\n });\n }\n }\n return Cstr;\n};\nconst initializeComponent = async (elm, hostRef, cmpMeta, hmrVersionId, Cstr) => {\n // initializeComponent\n if ((hostRef.$flags$ & 32 /* HOST_FLAGS.hasInitializedComponent */) === 0) {\n // Let the runtime know that the component has been initialized\n hostRef.$flags$ |= 32 /* HOST_FLAGS.hasInitializedComponent */;\n {\n // lazy loaded components\n // request the component's implementation to be\n // wired up with the host element\n Cstr = loadModule(cmpMeta);\n if (Cstr.then) {\n // Await creates a micro-task avoid if possible\n const endLoad = uniqueTime();\n Cstr = await Cstr;\n endLoad();\n }\n if (!Cstr.isProxied) {\n proxyComponent(Cstr, cmpMeta, 2 /* PROXY_FLAGS.proxyState */);\n Cstr.isProxied = true;\n }\n const endNewInstance = createTime('createInstance', cmpMeta.$tagName$);\n // ok, time to construct the instance\n // but let's keep track of when we start and stop\n // so that the getters/setters don't incorrectly step on data\n {\n hostRef.$flags$ |= 8 /* HOST_FLAGS.isConstructingInstance */;\n }\n // construct the lazy-loaded component implementation\n // passing the hostRef is very important during\n // construction in order to directly wire together the\n // host element and the lazy-loaded instance\n try {\n new Cstr(hostRef);\n }\n catch (e) {\n consoleError(e);\n }\n {\n hostRef.$flags$ &= ~8 /* HOST_FLAGS.isConstructingInstance */;\n }\n endNewInstance();\n }\n if (Cstr.style) {\n // this component has styles but we haven't registered them yet\n let style = Cstr.style;\n const scopeId = getScopeId(cmpMeta);\n if (!styles.has(scopeId)) {\n const endRegisterStyles = createTime('registerStyles', cmpMeta.$tagName$);\n registerStyle(scopeId, style, !!(cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */));\n endRegisterStyles();\n }\n }\n }\n // we've successfully created a lazy instance\n const ancestorComponent = hostRef.$ancestorComponent$;\n const schedule = () => scheduleUpdate(hostRef, true);\n if (ancestorComponent && ancestorComponent['s-rc']) {\n // this is the initial load and this component it has an ancestor component\n // but the ancestor component has NOT fired its will update lifecycle yet\n // so let's just cool our jets and wait for the ancestor to continue first\n // this will get fired off when the ancestor component\n // finally gets around to rendering its lazy self\n // fire off the initial update\n ancestorComponent['s-rc'].push(schedule);\n }\n else {\n schedule();\n }\n};\nconst connectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const cmpMeta = hostRef.$cmpMeta$;\n const endConnected = createTime('connectedCallback', cmpMeta.$tagName$);\n if (!(hostRef.$flags$ & 1 /* HOST_FLAGS.hasConnected */)) {\n // first time this component has connected\n hostRef.$flags$ |= 1 /* HOST_FLAGS.hasConnected */;\n {\n // find the first ancestor component (if there is one) and register\n // this component as one of the actively loading child components for its ancestor\n let ancestorComponent = elm;\n while ((ancestorComponent = ancestorComponent.parentNode || ancestorComponent.host)) {\n // climb up the ancestors looking for the first\n // component that hasn't finished its lifecycle update yet\n if (ancestorComponent['s-p']) {\n // we found this components first ancestor component\n // keep a reference to this component's ancestor component\n attachToAncestor(hostRef, (hostRef.$ancestorComponent$ = ancestorComponent));\n break;\n }\n }\n }\n // Lazy properties\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n if (cmpMeta.$members$) {\n Object.entries(cmpMeta.$members$).map(([memberName, [memberFlags]]) => {\n if (memberFlags & 31 /* MEMBER_FLAGS.Prop */ && elm.hasOwnProperty(memberName)) {\n const value = elm[memberName];\n delete elm[memberName];\n elm[memberName] = value;\n }\n });\n }\n {\n initializeComponent(elm, hostRef, cmpMeta);\n }\n }\n else {\n // not the first time this has connected\n // reattach any event listeners to the host\n // since they would have been removed when disconnected\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n }\n endConnected();\n }\n};\nconst disconnectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const instance = hostRef.$lazyInstance$ ;\n {\n if (hostRef.$rmListeners$) {\n hostRef.$rmListeners$.map((rmListener) => rmListener());\n hostRef.$rmListeners$ = undefined;\n }\n }\n {\n safeCall(instance, 'disconnectedCallback');\n }\n }\n};\nconst bootstrapLazy = (lazyBundles, options = {}) => {\n var _a;\n const endBootstrap = createTime();\n const cmpTags = [];\n const exclude = options.exclude || [];\n const customElements = win.customElements;\n const head = doc.head;\n const metaCharset = /*@__PURE__*/ head.querySelector('meta[charset]');\n const visibilityStyle = /*@__PURE__*/ doc.createElement('style');\n const deferredConnectedCallbacks = [];\n let appLoadFallback;\n let isBootstrapping = true;\n Object.assign(plt, options);\n plt.$resourcesUrl$ = new URL(options.resourcesUrl || './', doc.baseURI).href;\n lazyBundles.map((lazyBundle) => {\n lazyBundle[1].map((compactMeta) => {\n const cmpMeta = {\n $flags$: compactMeta[0],\n $tagName$: compactMeta[1],\n $members$: compactMeta[2],\n $listeners$: compactMeta[3],\n };\n {\n cmpMeta.$members$ = compactMeta[2];\n }\n {\n cmpMeta.$listeners$ = compactMeta[3];\n }\n const tagName = cmpMeta.$tagName$;\n const HostElement = class extends HTMLElement {\n // StencilLazyHost\n constructor(self) {\n // @ts-ignore\n super(self);\n self = this;\n registerHost(self, cmpMeta);\n if (cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */) {\n // this component is using shadow dom\n // and this browser supports shadow dom\n // add the read-only property \"shadowRoot\" to the host element\n // adding the shadow root build conditionals to minimize runtime\n {\n {\n self.attachShadow({ mode: 'open' });\n }\n }\n }\n }\n connectedCallback() {\n if (appLoadFallback) {\n clearTimeout(appLoadFallback);\n appLoadFallback = null;\n }\n if (isBootstrapping) {\n // connectedCallback will be processed once all components have been registered\n deferredConnectedCallbacks.push(this);\n }\n else {\n plt.jmp(() => connectedCallback(this));\n }\n }\n disconnectedCallback() {\n plt.jmp(() => disconnectedCallback(this));\n }\n componentOnReady() {\n return getHostRef(this).$onReadyPromise$;\n }\n };\n cmpMeta.$lazyBundleId$ = lazyBundle[0];\n if (!exclude.includes(tagName) && !customElements.get(tagName)) {\n cmpTags.push(tagName);\n customElements.define(tagName, proxyComponent(HostElement, cmpMeta, 1 /* PROXY_FLAGS.isElementConstructor */));\n }\n });\n });\n {\n visibilityStyle.innerHTML = cmpTags + HYDRATED_CSS;\n visibilityStyle.setAttribute('data-styles', '');\n // Apply CSP nonce to the style tag if it exists\n const nonce = (_a = plt.$nonce$) !== null && _a !== void 0 ? _a : queryNonceMetaTagContent(doc);\n if (nonce != null) {\n visibilityStyle.setAttribute('nonce', nonce);\n }\n head.insertBefore(visibilityStyle, metaCharset ? metaCharset.nextSibling : head.firstChild);\n }\n // Process deferred connectedCallbacks now all components have been registered\n isBootstrapping = false;\n if (deferredConnectedCallbacks.length) {\n deferredConnectedCallbacks.map((host) => host.connectedCallback());\n }\n else {\n {\n plt.jmp(() => (appLoadFallback = setTimeout(appDidLoad, 30)));\n }\n }\n // Fallback appLoad event\n endBootstrap();\n};\nconst addHostEventListeners = (elm, hostRef, listeners, attachParentListeners) => {\n if (listeners) {\n listeners.map(([flags, name, method]) => {\n const target = getHostListenerTarget(elm, flags) ;\n const handler = hostListenerProxy(hostRef, method);\n const opts = hostListenerOpts(flags);\n plt.ael(target, name, handler, opts);\n (hostRef.$rmListeners$ = hostRef.$rmListeners$ || []).push(() => plt.rel(target, name, handler, opts));\n });\n }\n};\nconst hostListenerProxy = (hostRef, methodName) => (ev) => {\n try {\n {\n if (hostRef.$flags$ & 256 /* HOST_FLAGS.isListenReady */) {\n // instance is ready, let's call it's member method for this event\n hostRef.$lazyInstance$[methodName](ev);\n }\n else {\n (hostRef.$queuedListeners$ = hostRef.$queuedListeners$ || []).push([methodName, ev]);\n }\n }\n }\n catch (e) {\n consoleError(e);\n }\n};\nconst getHostListenerTarget = (elm, flags) => {\n if (flags & 16 /* LISTENER_FLAGS.TargetBody */)\n return doc.body;\n return elm;\n};\n// prettier-ignore\nconst hostListenerOpts = (flags) => (flags & 2 /* LISTENER_FLAGS.Capture */) !== 0;\n/**\n * Assigns the given value to the nonce property on the runtime platform object.\n * During runtime, this value is used to set the nonce attribute on all dynamically created script and style tags.\n * @param nonce The value to be assigned to the platform nonce property.\n * @returns void\n */\nconst setNonce = (nonce) => (plt.$nonce$ = nonce);\nconst hostRefs = /*@__PURE__*/ new WeakMap();\nconst getHostRef = (ref) => hostRefs.get(ref);\nconst registerInstance = (lazyInstance, hostRef) => hostRefs.set((hostRef.$lazyInstance$ = lazyInstance), hostRef);\nconst registerHost = (elm, cmpMeta) => {\n const hostRef = {\n $flags$: 0,\n $hostElement$: elm,\n $cmpMeta$: cmpMeta,\n $instanceValues$: new Map(),\n };\n {\n hostRef.$onInstancePromise$ = new Promise((r) => (hostRef.$onInstanceResolve$ = r));\n }\n {\n hostRef.$onReadyPromise$ = new Promise((r) => (hostRef.$onReadyResolve$ = r));\n elm['s-p'] = [];\n elm['s-rc'] = [];\n }\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n return hostRefs.set(elm, hostRef);\n};\nconst isMemberInElement = (elm, memberName) => memberName in elm;\nconst consoleError = (e, el) => (0, console.error)(e, el);\nconst cmpModules = /*@__PURE__*/ new Map();\nconst loadModule = (cmpMeta, hostRef, hmrVersionId) => {\n // loadModuleImport\n const exportName = cmpMeta.$tagName$.replace(/-/g, '_');\n const bundleId = cmpMeta.$lazyBundleId$;\n const module = cmpModules.get(bundleId) ;\n if (module) {\n return module[exportName];\n }\n \n if (!hmrVersionId || !BUILD.hotModuleReplacement) {\n const processMod = importedModule => {\n cmpModules.set(bundleId, importedModule);\n return importedModule[exportName];\n }\n switch(bundleId) {\n \n case 'pwa-action-sheet':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-action-sheet.entry.js').then(processMod, consoleError);\n case 'pwa-camera-modal':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera-modal.entry.js').then(processMod, consoleError);\n case 'pwa-toast':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-toast.entry.js').then(processMod, consoleError);\n case 'pwa-camera-modal-instance':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera-modal-instance.entry.js').then(processMod, consoleError);\n case 'pwa-camera':\n return import(\n /* webpackMode: \"lazy\" */\n './pwa-camera.entry.js').then(processMod, consoleError);\n }\n }\n return import(\n /* @vite-ignore */\n /* webpackInclude: /\\.entry\\.js$/ */\n /* webpackExclude: /\\.system\\.entry\\.js$/ */\n /* webpackMode: \"lazy\" */\n `./${bundleId}.entry.js${''}`).then((importedModule) => {\n {\n cmpModules.set(bundleId, importedModule);\n }\n return importedModule[exportName];\n }, consoleError);\n};\nconst styles = /*@__PURE__*/ new Map();\nconst win = typeof window !== 'undefined' ? window : {};\nconst doc = win.document || { head: {} };\nconst plt = {\n $flags$: 0,\n $resourcesUrl$: '',\n jmp: (h) => h(),\n raf: (h) => requestAnimationFrame(h),\n ael: (el, eventName, listener, opts) => el.addEventListener(eventName, listener, opts),\n rel: (el, eventName, listener, opts) => el.removeEventListener(eventName, listener, opts),\n ce: (eventName, opts) => new CustomEvent(eventName, opts),\n};\nconst promiseResolve = (v) => Promise.resolve(v);\nconst supportsConstructableStylesheets = /*@__PURE__*/ (() => {\n try {\n new CSSStyleSheet();\n return typeof new CSSStyleSheet().replaceSync === 'function';\n }\n catch (e) { }\n return false;\n })()\n ;\nconst queueDomReads = [];\nconst queueDomWrites = [];\nconst queueTask = (queue, write) => (cb) => {\n queue.push(cb);\n if (!queuePending) {\n queuePending = true;\n if (write && plt.$flags$ & 4 /* PLATFORM_FLAGS.queueSync */) {\n nextTick(flush);\n }\n else {\n plt.raf(flush);\n }\n }\n};\nconst consume = (queue) => {\n for (let i = 0; i < queue.length; i++) {\n try {\n queue[i](performance.now());\n }\n catch (e) {\n consoleError(e);\n }\n }\n queue.length = 0;\n};\nconst flush = () => {\n // always force a bunch of medium callbacks to run, but still have\n // a throttle on how many can run in a certain time\n // DOM READS!!!\n consume(queueDomReads);\n // DOM WRITES!!!\n {\n consume(queueDomWrites);\n if ((queuePending = queueDomReads.length > 0)) {\n // still more to do yet, but we've run out of time\n // let's let this thing cool off and try again in the next tick\n plt.raf(flush);\n }\n }\n};\nconst nextTick = /*@__PURE__*/ (cb) => promiseResolve().then(cb);\nconst writeTask = /*@__PURE__*/ queueTask(queueDomWrites, true);\n\nexport { Host as H, bootstrapLazy as b, createEvent as c, forceUpdate as f, getElement as g, h, promiseResolve as p, registerInstance as r, setNonce as s };\n","import { mergeAll } from '../operators/mergeAll';\nimport { innerFrom } from './innerFrom';\nimport { EMPTY } from './empty';\nimport { popNumber, popScheduler } from '../util/args';\nimport { from } from './from';\nexport function merge(...args) {\n const scheduler = popScheduler(args);\n const concurrent = popNumber(args, Infinity);\n const sources = args;\n return !sources.length\n ?\n EMPTY\n : sources.length === 1\n ?\n innerFrom(sources[0])\n :\n mergeAll(concurrent)(from(sources, scheduler));\n}\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = startOfUTCISOWeek;\nvar _index = _interopRequireDefault(require(\"../../toDate/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"../requiredArgs/index.js\"));\nfunction startOfUTCISOWeek(dirtyDate) {\n (0, _index2.default)(1, arguments);\n var weekStartsOn = 1;\n var date = (0, _index.default)(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}\nmodule.exports = exports.default;","import { createErrorClass } from './createErrorClass';\nexport const EmptyError = createErrorClass((_super) => function EmptyErrorImpl() {\n _super(this);\n this.name = 'EmptyError';\n this.message = 'no elements in sequence';\n});\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function defaultIfEmpty(defaultValue) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => {\n if (!hasValue) {\n subscriber.next(defaultValue);\n }\n subscriber.complete();\n }));\n });\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => (hasValue ? subscriber.complete() : subscriber.error(errorFactory()))));\n });\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { EMPTY } from '../observable/empty';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function takeLast(count) {\n return count <= 0\n ? () => EMPTY\n : operate((source, subscriber) => {\n let buffer = [];\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n buffer.push(value);\n count < buffer.length && buffer.shift();\n }, () => {\n for (const value of buffer) {\n subscriber.next(value);\n }\n subscriber.complete();\n }, undefined, () => {\n buffer = null;\n }));\n });\n}\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { ɵisPromise, ɵRuntimeError, Injectable, createEnvironmentInjector, ɵisNgModule, isStandalone, InjectionToken, EventEmitter, input, inject, ViewContainerRef, ChangeDetectorRef, Directive, Input, Output, reflectComponentType, ɵisInjectable, runInInjectionContext, Component, Compiler, NgModuleFactory, NgZone, afterNextRender, EnvironmentInjector, DestroyRef, ɵConsole, ɵPendingTasksInternal, ɵɵsanitizeUrlOrResourceUrl, booleanAttribute, Attribute, HostBinding, HostListener, Optional, ContentChildren, makeEnvironmentProviders, APP_BOOTSTRAP_LISTENER, ENVIRONMENT_INITIALIZER, Injector, ApplicationRef, InjectFlags, APP_INITIALIZER, SkipSelf, NgModule, Version, ɵpublishExternalGlobalUtil } from '@angular/core';\nimport { isObservable, from, of, BehaviorSubject, combineLatest, EmptyError, concat, defer, pipe, throwError, EMPTY, ConnectableObservable, Subject, Subscription } from 'rxjs';\nimport * as i3 from '@angular/common';\nimport { DOCUMENT, Location, ViewportScroller, LOCATION_INITIALIZED, LocationStrategy, HashLocationStrategy, PathLocationStrategy } from '@angular/common';\nimport { map, switchMap, take, startWith, filter, mergeMap, first, concatMap, tap, catchError, scan, defaultIfEmpty, last as last$1, takeLast, finalize, refCount, takeUntil, mergeAll } from 'rxjs/operators';\nimport * as i1 from '@angular/platform-browser';\n\n/**\n * The primary routing outlet.\n *\n * @publicApi\n */\nconst PRIMARY_OUTLET = 'primary';\n/**\n * A private symbol used to store the value of `Route.title` inside the `Route.data` if it is a\n * static string or `Route.resolve` if anything else. This allows us to reuse the existing route\n * data/resolvers to support the title feature without new instrumentation in the `Router` pipeline.\n */\nconst RouteTitleKey = /* @__PURE__ */ Symbol('RouteTitle');\nclass ParamsAsMap {\n params;\n constructor(params) {\n this.params = params || {};\n }\n has(name) {\n return Object.prototype.hasOwnProperty.call(this.params, name);\n }\n get(name) {\n if (this.has(name)) {\n const v = this.params[name];\n return Array.isArray(v) ? v[0] : v;\n }\n return null;\n }\n getAll(name) {\n if (this.has(name)) {\n const v = this.params[name];\n return Array.isArray(v) ? v : [v];\n }\n return [];\n }\n get keys() {\n return Object.keys(this.params);\n }\n}\n/**\n * Converts a `Params` instance to a `ParamMap`.\n * @param params The instance to convert.\n * @returns The new map instance.\n *\n * @publicApi\n */\nfunction convertToParamMap(params) {\n return new ParamsAsMap(params);\n}\n/**\n * Matches the route configuration (`route`) against the actual URL (`segments`).\n *\n * When no matcher is defined on a `Route`, this is the matcher used by the Router by default.\n *\n * @param segments The remaining unmatched segments in the current navigation\n * @param segmentGroup The current segment group being matched\n * @param route The `Route` to match against.\n *\n * @see {@link UrlMatchResult}\n * @see {@link Route}\n *\n * @returns The resulting match information or `null` if the `route` should not match.\n * @publicApi\n */\nfunction defaultUrlMatcher(segments, segmentGroup, route) {\n const parts = route.path.split('/');\n if (parts.length > segments.length) {\n // The actual URL is shorter than the config, no match\n return null;\n }\n if (route.pathMatch === 'full' &&\n (segmentGroup.hasChildren() || parts.length < segments.length)) {\n // The config is longer than the actual URL but we are looking for a full match, return null\n return null;\n }\n const posParams = {};\n // Check each config part against the actual URL\n for (let index = 0; index < parts.length; index++) {\n const part = parts[index];\n const segment = segments[index];\n const isParameter = part[0] === ':';\n if (isParameter) {\n posParams[part.substring(1)] = segment;\n }\n else if (part !== segment.path) {\n // The actual URL part does not match the config, no match\n return null;\n }\n }\n return { consumed: segments.slice(0, parts.length), posParams };\n}\n\nfunction shallowEqualArrays(a, b) {\n if (a.length !== b.length)\n return false;\n for (let i = 0; i < a.length; ++i) {\n if (!shallowEqual(a[i], b[i]))\n return false;\n }\n return true;\n}\nfunction shallowEqual(a, b) {\n // While `undefined` should never be possible, it would sometimes be the case in IE 11\n // and pre-chromium Edge. The check below accounts for this edge case.\n const k1 = a ? getDataKeys(a) : undefined;\n const k2 = b ? getDataKeys(b) : undefined;\n if (!k1 || !k2 || k1.length != k2.length) {\n return false;\n }\n let key;\n for (let i = 0; i < k1.length; i++) {\n key = k1[i];\n if (!equalArraysOrString(a[key], b[key])) {\n return false;\n }\n }\n return true;\n}\n/**\n * Gets the keys of an object, including `symbol` keys.\n */\nfunction getDataKeys(obj) {\n return [...Object.keys(obj), ...Object.getOwnPropertySymbols(obj)];\n}\n/**\n * Test equality for arrays of strings or a string.\n */\nfunction equalArraysOrString(a, b) {\n if (Array.isArray(a) && Array.isArray(b)) {\n if (a.length !== b.length)\n return false;\n const aSorted = [...a].sort();\n const bSorted = [...b].sort();\n return aSorted.every((val, index) => bSorted[index] === val);\n }\n else {\n return a === b;\n }\n}\n/**\n * Return the last element of an array.\n */\nfunction last(a) {\n return a.length > 0 ? a[a.length - 1] : null;\n}\nfunction wrapIntoObservable(value) {\n if (isObservable(value)) {\n return value;\n }\n if (ɵisPromise(value)) {\n // Use `Promise.resolve()` to wrap promise-like instances.\n // Required ie when a Resolver returns a AngularJS `$q` promise to correctly trigger the\n // change detection.\n return from(Promise.resolve(value));\n }\n return of(value);\n}\n\nconst pathCompareMap = {\n 'exact': equalSegmentGroups,\n 'subset': containsSegmentGroup,\n};\nconst paramCompareMap = {\n 'exact': equalParams,\n 'subset': containsParams,\n 'ignored': () => true,\n};\nfunction containsTree(container, containee, options) {\n return (pathCompareMap[options.paths](container.root, containee.root, options.matrixParams) &&\n paramCompareMap[options.queryParams](container.queryParams, containee.queryParams) &&\n !(options.fragment === 'exact' && container.fragment !== containee.fragment));\n}\nfunction equalParams(container, containee) {\n // TODO: This does not handle array params correctly.\n return shallowEqual(container, containee);\n}\nfunction equalSegmentGroups(container, containee, matrixParams) {\n if (!equalPath(container.segments, containee.segments))\n return false;\n if (!matrixParamsMatch(container.segments, containee.segments, matrixParams)) {\n return false;\n }\n if (container.numberOfChildren !== containee.numberOfChildren)\n return false;\n for (const c in containee.children) {\n if (!container.children[c])\n return false;\n if (!equalSegmentGroups(container.children[c], containee.children[c], matrixParams))\n return false;\n }\n return true;\n}\nfunction containsParams(container, containee) {\n return (Object.keys(containee).length <= Object.keys(container).length &&\n Object.keys(containee).every((key) => equalArraysOrString(container[key], containee[key])));\n}\nfunction containsSegmentGroup(container, containee, matrixParams) {\n return containsSegmentGroupHelper(container, containee, containee.segments, matrixParams);\n}\nfunction containsSegmentGroupHelper(container, containee, containeePaths, matrixParams) {\n if (container.segments.length > containeePaths.length) {\n const current = container.segments.slice(0, containeePaths.length);\n if (!equalPath(current, containeePaths))\n return false;\n if (containee.hasChildren())\n return false;\n if (!matrixParamsMatch(current, containeePaths, matrixParams))\n return false;\n return true;\n }\n else if (container.segments.length === containeePaths.length) {\n if (!equalPath(container.segments, containeePaths))\n return false;\n if (!matrixParamsMatch(container.segments, containeePaths, matrixParams))\n return false;\n for (const c in containee.children) {\n if (!container.children[c])\n return false;\n if (!containsSegmentGroup(container.children[c], containee.children[c], matrixParams)) {\n return false;\n }\n }\n return true;\n }\n else {\n const current = containeePaths.slice(0, container.segments.length);\n const next = containeePaths.slice(container.segments.length);\n if (!equalPath(container.segments, current))\n return false;\n if (!matrixParamsMatch(container.segments, current, matrixParams))\n return false;\n if (!container.children[PRIMARY_OUTLET])\n return false;\n return containsSegmentGroupHelper(container.children[PRIMARY_OUTLET], containee, next, matrixParams);\n }\n}\nfunction matrixParamsMatch(containerPaths, containeePaths, options) {\n return containeePaths.every((containeeSegment, i) => {\n return paramCompareMap[options](containerPaths[i].parameters, containeeSegment.parameters);\n });\n}\n/**\n * @description\n *\n * Represents the parsed URL.\n *\n * Since a router state is a tree, and the URL is nothing but a serialized state, the URL is a\n * serialized tree.\n * UrlTree is a data structure that provides a lot of affordances in dealing with URLs\n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const tree: UrlTree =\n * router.parseUrl('/team/33/(user/victor//support:help)?debug=true#fragment');\n * const f = tree.fragment; // return 'fragment'\n * const q = tree.queryParams; // returns {debug: 'true'}\n * const g: UrlSegmentGroup = tree.root.children[PRIMARY_OUTLET];\n * const s: UrlSegment[] = g.segments; // returns 2 segments 'team' and '33'\n * g.children[PRIMARY_OUTLET].segments; // returns 2 segments 'user' and 'victor'\n * g.children['support'].segments; // return 1 segment 'help'\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass UrlTree {\n root;\n queryParams;\n fragment;\n /** @internal */\n _queryParamMap;\n constructor(\n /** The root segment group of the URL tree */\n root = new UrlSegmentGroup([], {}), \n /** The query params of the URL */\n queryParams = {}, \n /** The fragment of the URL */\n fragment = null) {\n this.root = root;\n this.queryParams = queryParams;\n this.fragment = fragment;\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (root.segments.length > 0) {\n throw new ɵRuntimeError(4015 /* RuntimeErrorCode.INVALID_ROOT_URL_SEGMENT */, 'The root `UrlSegmentGroup` should not contain `segments`. ' +\n 'Instead, these segments belong in the `children` so they can be associated with a named outlet.');\n }\n }\n }\n get queryParamMap() {\n this._queryParamMap ??= convertToParamMap(this.queryParams);\n return this._queryParamMap;\n }\n /** @docsNotRequired */\n toString() {\n return DEFAULT_SERIALIZER.serialize(this);\n }\n}\n/**\n * @description\n *\n * Represents the parsed URL segment group.\n *\n * See `UrlTree` for more information.\n *\n * @publicApi\n */\nclass UrlSegmentGroup {\n segments;\n children;\n /** The parent node in the url tree */\n parent = null;\n constructor(\n /** The URL segments of this group. See `UrlSegment` for more information */\n segments, \n /** The list of children of this group */\n children) {\n this.segments = segments;\n this.children = children;\n Object.values(children).forEach((v) => (v.parent = this));\n }\n /** Whether the segment has child segments */\n hasChildren() {\n return this.numberOfChildren > 0;\n }\n /** Number of child segments */\n get numberOfChildren() {\n return Object.keys(this.children).length;\n }\n /** @docsNotRequired */\n toString() {\n return serializePaths(this);\n }\n}\n/**\n * @description\n *\n * Represents a single URL segment.\n *\n * A UrlSegment is a part of a URL between the two slashes. It contains a path and the matrix\n * parameters associated with the segment.\n *\n * @usageNotes\n * ### Example\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const tree: UrlTree = router.parseUrl('/team;id=33');\n * const g: UrlSegmentGroup = tree.root.children[PRIMARY_OUTLET];\n * const s: UrlSegment[] = g.segments;\n * s[0].path; // returns 'team'\n * s[0].parameters; // returns {id: 33}\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass UrlSegment {\n path;\n parameters;\n /** @internal */\n _parameterMap;\n constructor(\n /** The path part of a URL segment */\n path, \n /** The matrix parameters associated with a segment */\n parameters) {\n this.path = path;\n this.parameters = parameters;\n }\n get parameterMap() {\n this._parameterMap ??= convertToParamMap(this.parameters);\n return this._parameterMap;\n }\n /** @docsNotRequired */\n toString() {\n return serializePath(this);\n }\n}\nfunction equalSegments(as, bs) {\n return equalPath(as, bs) && as.every((a, i) => shallowEqual(a.parameters, bs[i].parameters));\n}\nfunction equalPath(as, bs) {\n if (as.length !== bs.length)\n return false;\n return as.every((a, i) => a.path === bs[i].path);\n}\nfunction mapChildrenIntoArray(segment, fn) {\n let res = [];\n Object.entries(segment.children).forEach(([childOutlet, child]) => {\n if (childOutlet === PRIMARY_OUTLET) {\n res = res.concat(fn(child, childOutlet));\n }\n });\n Object.entries(segment.children).forEach(([childOutlet, child]) => {\n if (childOutlet !== PRIMARY_OUTLET) {\n res = res.concat(fn(child, childOutlet));\n }\n });\n return res;\n}\n/**\n * @description\n *\n * Serializes and deserializes a URL string into a URL tree.\n *\n * The url serialization strategy is customizable. You can\n * make all URLs case insensitive by providing a custom UrlSerializer.\n *\n * See `DefaultUrlSerializer` for an example of a URL serializer.\n *\n * @publicApi\n */\nclass UrlSerializer {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, providedIn: 'root', useFactory: () => new DefaultUrlSerializer() });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: UrlSerializer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => new DefaultUrlSerializer() }]\n }] });\n/**\n * @description\n *\n * A default implementation of the `UrlSerializer`.\n *\n * Example URLs:\n *\n * ```\n * /inbox/33(popup:compose)\n * /inbox/33;open=true/messages/44\n * ```\n *\n * DefaultUrlSerializer uses parentheses to serialize secondary segments (e.g., popup:compose), the\n * colon syntax to specify the outlet, and the ';parameter=value' syntax (e.g., open=true) to\n * specify route specific parameters.\n *\n * @publicApi\n */\nclass DefaultUrlSerializer {\n /** Parses a url into a `UrlTree` */\n parse(url) {\n const p = new UrlParser(url);\n return new UrlTree(p.parseRootSegment(), p.parseQueryParams(), p.parseFragment());\n }\n /** Converts a `UrlTree` into a url */\n serialize(tree) {\n const segment = `/${serializeSegment(tree.root, true)}`;\n const query = serializeQueryParams(tree.queryParams);\n const fragment = typeof tree.fragment === `string` ? `#${encodeUriFragment(tree.fragment)}` : '';\n return `${segment}${query}${fragment}`;\n }\n}\nconst DEFAULT_SERIALIZER = new DefaultUrlSerializer();\nfunction serializePaths(segment) {\n return segment.segments.map((p) => serializePath(p)).join('/');\n}\nfunction serializeSegment(segment, root) {\n if (!segment.hasChildren()) {\n return serializePaths(segment);\n }\n if (root) {\n const primary = segment.children[PRIMARY_OUTLET]\n ? serializeSegment(segment.children[PRIMARY_OUTLET], false)\n : '';\n const children = [];\n Object.entries(segment.children).forEach(([k, v]) => {\n if (k !== PRIMARY_OUTLET) {\n children.push(`${k}:${serializeSegment(v, false)}`);\n }\n });\n return children.length > 0 ? `${primary}(${children.join('//')})` : primary;\n }\n else {\n const children = mapChildrenIntoArray(segment, (v, k) => {\n if (k === PRIMARY_OUTLET) {\n return [serializeSegment(segment.children[PRIMARY_OUTLET], false)];\n }\n return [`${k}:${serializeSegment(v, false)}`];\n });\n // use no parenthesis if the only child is a primary outlet route\n if (Object.keys(segment.children).length === 1 && segment.children[PRIMARY_OUTLET] != null) {\n return `${serializePaths(segment)}/${children[0]}`;\n }\n return `${serializePaths(segment)}/(${children.join('//')})`;\n }\n}\n/**\n * Encodes a URI string with the default encoding. This function will only ever be called from\n * `encodeUriQuery` or `encodeUriSegment` as it's the base set of encodings to be used. We need\n * a custom encoding because encodeURIComponent is too aggressive and encodes stuff that doesn't\n * have to be encoded per https://url.spec.whatwg.org.\n */\nfunction encodeUriString(s) {\n return encodeURIComponent(s)\n .replace(/%40/g, '@')\n .replace(/%3A/gi, ':')\n .replace(/%24/g, '$')\n .replace(/%2C/gi, ',');\n}\n/**\n * This function should be used to encode both keys and values in a query string key/value. In\n * the following URL, you need to call encodeUriQuery on \"k\" and \"v\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriQuery(s) {\n return encodeUriString(s).replace(/%3B/gi, ';');\n}\n/**\n * This function should be used to encode a URL fragment. In the following URL, you need to call\n * encodeUriFragment on \"f\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriFragment(s) {\n return encodeURI(s);\n}\n/**\n * This function should be run on any URI segment as well as the key and value in a key/value\n * pair for matrix params. In the following URL, you need to call encodeUriSegment on \"html\",\n * \"mk\", and \"mv\":\n *\n * http://www.site.org/html;mk=mv?k=v#f\n */\nfunction encodeUriSegment(s) {\n return encodeUriString(s).replace(/\\(/g, '%28').replace(/\\)/g, '%29').replace(/%26/gi, '&');\n}\nfunction decode(s) {\n return decodeURIComponent(s);\n}\n// Query keys/values should have the \"+\" replaced first, as \"+\" in a query string is \" \".\n// decodeURIComponent function will not decode \"+\" as a space.\nfunction decodeQuery(s) {\n return decode(s.replace(/\\+/g, '%20'));\n}\nfunction serializePath(path) {\n return `${encodeUriSegment(path.path)}${serializeMatrixParams(path.parameters)}`;\n}\nfunction serializeMatrixParams(params) {\n return Object.entries(params)\n .map(([key, value]) => `;${encodeUriSegment(key)}=${encodeUriSegment(value)}`)\n .join('');\n}\nfunction serializeQueryParams(params) {\n const strParams = Object.entries(params)\n .map(([name, value]) => {\n return Array.isArray(value)\n ? value.map((v) => `${encodeUriQuery(name)}=${encodeUriQuery(v)}`).join('&')\n : `${encodeUriQuery(name)}=${encodeUriQuery(value)}`;\n })\n .filter((s) => s);\n return strParams.length ? `?${strParams.join('&')}` : '';\n}\nconst SEGMENT_RE = /^[^\\/()?;#]+/;\nfunction matchSegments(str) {\n const match = str.match(SEGMENT_RE);\n return match ? match[0] : '';\n}\nconst MATRIX_PARAM_SEGMENT_RE = /^[^\\/()?;=#]+/;\nfunction matchMatrixKeySegments(str) {\n const match = str.match(MATRIX_PARAM_SEGMENT_RE);\n return match ? match[0] : '';\n}\nconst QUERY_PARAM_RE = /^[^=?&#]+/;\n// Return the name of the query param at the start of the string or an empty string\nfunction matchQueryParams(str) {\n const match = str.match(QUERY_PARAM_RE);\n return match ? match[0] : '';\n}\nconst QUERY_PARAM_VALUE_RE = /^[^&#]+/;\n// Return the value of the query param at the start of the string or an empty string\nfunction matchUrlQueryParamValue(str) {\n const match = str.match(QUERY_PARAM_VALUE_RE);\n return match ? match[0] : '';\n}\nclass UrlParser {\n url;\n remaining;\n constructor(url) {\n this.url = url;\n this.remaining = url;\n }\n parseRootSegment() {\n this.consumeOptional('/');\n if (this.remaining === '' || this.peekStartsWith('?') || this.peekStartsWith('#')) {\n return new UrlSegmentGroup([], {});\n }\n // The root segment group never has segments\n return new UrlSegmentGroup([], this.parseChildren());\n }\n parseQueryParams() {\n const params = {};\n if (this.consumeOptional('?')) {\n do {\n this.parseQueryParam(params);\n } while (this.consumeOptional('&'));\n }\n return params;\n }\n parseFragment() {\n return this.consumeOptional('#') ? decodeURIComponent(this.remaining) : null;\n }\n parseChildren() {\n if (this.remaining === '') {\n return {};\n }\n this.consumeOptional('/');\n const segments = [];\n if (!this.peekStartsWith('(')) {\n segments.push(this.parseSegment());\n }\n while (this.peekStartsWith('/') && !this.peekStartsWith('//') && !this.peekStartsWith('/(')) {\n this.capture('/');\n segments.push(this.parseSegment());\n }\n let children = {};\n if (this.peekStartsWith('/(')) {\n this.capture('/');\n children = this.parseParens(true);\n }\n let res = {};\n if (this.peekStartsWith('(')) {\n res = this.parseParens(false);\n }\n if (segments.length > 0 || Object.keys(children).length > 0) {\n res[PRIMARY_OUTLET] = new UrlSegmentGroup(segments, children);\n }\n return res;\n }\n // parse a segment with its matrix parameters\n // ie `name;k1=v1;k2`\n parseSegment() {\n const path = matchSegments(this.remaining);\n if (path === '' && this.peekStartsWith(';')) {\n throw new ɵRuntimeError(4009 /* RuntimeErrorCode.EMPTY_PATH_WITH_PARAMS */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Empty path url segment cannot have parameters: '${this.remaining}'.`);\n }\n this.capture(path);\n return new UrlSegment(decode(path), this.parseMatrixParams());\n }\n parseMatrixParams() {\n const params = {};\n while (this.consumeOptional(';')) {\n this.parseParam(params);\n }\n return params;\n }\n parseParam(params) {\n const key = matchMatrixKeySegments(this.remaining);\n if (!key) {\n return;\n }\n this.capture(key);\n let value = '';\n if (this.consumeOptional('=')) {\n const valueMatch = matchSegments(this.remaining);\n if (valueMatch) {\n value = valueMatch;\n this.capture(value);\n }\n }\n params[decode(key)] = decode(value);\n }\n // Parse a single query parameter `name[=value]`\n parseQueryParam(params) {\n const key = matchQueryParams(this.remaining);\n if (!key) {\n return;\n }\n this.capture(key);\n let value = '';\n if (this.consumeOptional('=')) {\n const valueMatch = matchUrlQueryParamValue(this.remaining);\n if (valueMatch) {\n value = valueMatch;\n this.capture(value);\n }\n }\n const decodedKey = decodeQuery(key);\n const decodedVal = decodeQuery(value);\n if (params.hasOwnProperty(decodedKey)) {\n // Append to existing values\n let currentVal = params[decodedKey];\n if (!Array.isArray(currentVal)) {\n currentVal = [currentVal];\n params[decodedKey] = currentVal;\n }\n currentVal.push(decodedVal);\n }\n else {\n // Create a new value\n params[decodedKey] = decodedVal;\n }\n }\n // parse `(a/b//outlet_name:c/d)`\n parseParens(allowPrimary) {\n const segments = {};\n this.capture('(');\n while (!this.consumeOptional(')') && this.remaining.length > 0) {\n const path = matchSegments(this.remaining);\n const next = this.remaining[path.length];\n // if is is not one of these characters, then the segment was unescaped\n // or the group was not closed\n if (next !== '/' && next !== ')' && next !== ';') {\n throw new ɵRuntimeError(4010 /* RuntimeErrorCode.UNPARSABLE_URL */, (typeof ngDevMode === 'undefined' || ngDevMode) && `Cannot parse url '${this.url}'`);\n }\n let outletName = undefined;\n if (path.indexOf(':') > -1) {\n outletName = path.slice(0, path.indexOf(':'));\n this.capture(outletName);\n this.capture(':');\n }\n else if (allowPrimary) {\n outletName = PRIMARY_OUTLET;\n }\n const children = this.parseChildren();\n segments[outletName] =\n Object.keys(children).length === 1\n ? children[PRIMARY_OUTLET]\n : new UrlSegmentGroup([], children);\n this.consumeOptional('//');\n }\n return segments;\n }\n peekStartsWith(str) {\n return this.remaining.startsWith(str);\n }\n // Consumes the prefix when it is present and returns whether it has been consumed\n consumeOptional(str) {\n if (this.peekStartsWith(str)) {\n this.remaining = this.remaining.substring(str.length);\n return true;\n }\n return false;\n }\n capture(str) {\n if (!this.consumeOptional(str)) {\n throw new ɵRuntimeError(4011 /* RuntimeErrorCode.UNEXPECTED_VALUE_IN_URL */, (typeof ngDevMode === 'undefined' || ngDevMode) && `Expected \"${str}\".`);\n }\n }\n}\nfunction createRoot(rootCandidate) {\n return rootCandidate.segments.length > 0\n ? new UrlSegmentGroup([], { [PRIMARY_OUTLET]: rootCandidate })\n : rootCandidate;\n}\n/**\n * Recursively\n * - merges primary segment children into their parents\n * - drops empty children (those which have no segments and no children themselves). This latter\n * prevents serializing a group into something like `/a(aux:)`, where `aux` is an empty child\n * segment.\n * - merges named outlets without a primary segment sibling into the children. This prevents\n * serializing a URL like `//(a:a)(b:b) instead of `/(a:a//b:b)` when the aux b route lives on the\n * root but the `a` route lives under an empty path primary route.\n */\nfunction squashSegmentGroup(segmentGroup) {\n const newChildren = {};\n for (const [childOutlet, child] of Object.entries(segmentGroup.children)) {\n const childCandidate = squashSegmentGroup(child);\n // moves named children in an empty path primary child into this group\n if (childOutlet === PRIMARY_OUTLET &&\n childCandidate.segments.length === 0 &&\n childCandidate.hasChildren()) {\n for (const [grandChildOutlet, grandChild] of Object.entries(childCandidate.children)) {\n newChildren[grandChildOutlet] = grandChild;\n }\n } // don't add empty children\n else if (childCandidate.segments.length > 0 || childCandidate.hasChildren()) {\n newChildren[childOutlet] = childCandidate;\n }\n }\n const s = new UrlSegmentGroup(segmentGroup.segments, newChildren);\n return mergeTrivialChildren(s);\n}\n/**\n * When possible, merges the primary outlet child into the parent `UrlSegmentGroup`.\n *\n * When a segment group has only one child which is a primary outlet, merges that child into the\n * parent. That is, the child segment group's segments are merged into the `s` and the child's\n * children become the children of `s`. Think of this like a 'squash', merging the child segment\n * group into the parent.\n */\nfunction mergeTrivialChildren(s) {\n if (s.numberOfChildren === 1 && s.children[PRIMARY_OUTLET]) {\n const c = s.children[PRIMARY_OUTLET];\n return new UrlSegmentGroup(s.segments.concat(c.segments), c.children);\n }\n return s;\n}\nfunction isUrlTree(v) {\n return v instanceof UrlTree;\n}\n\n/**\n * Creates a `UrlTree` relative to an `ActivatedRouteSnapshot`.\n *\n * @publicApi\n *\n *\n * @param relativeTo The `ActivatedRouteSnapshot` to apply the commands to\n * @param commands An array of URL fragments with which to construct the new URL tree.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the one provided in the `relativeTo` parameter.\n * @param queryParams The query parameters for the `UrlTree`. `null` if the `UrlTree` does not have\n * any query parameters.\n * @param fragment The fragment for the `UrlTree`. `null` if the `UrlTree` does not have a fragment.\n *\n * @usageNotes\n *\n * ```ts\n * // create /team/33/user/11\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, 'user', 11]);\n *\n * // create /team/33;expand=true/user/11\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {expand: true}, 'user', 11]);\n *\n * // you can collapse static segments like this (this works only with the first passed-in value):\n * createUrlTreeFromSnapshot(snapshot, ['/team/33/user', userId]);\n *\n * // If the first segment can contain slashes, and you do not want the router to split it,\n * // you can do the following:\n * createUrlTreeFromSnapshot(snapshot, [{segmentPath: '/one/two'}]);\n *\n * // create /team/33/(user/11//right:chat)\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {outlets: {primary: 'user/11', right:\n * 'chat'}}], null, null);\n *\n * // remove the right secondary node\n * createUrlTreeFromSnapshot(snapshot, ['/team', 33, {outlets: {primary: 'user/11', right: null}}]);\n *\n * // For the examples below, assume the current URL is for the `/team/33/user/11` and the\n * `ActivatedRouteSnapshot` points to `user/11`:\n *\n * // navigate to /team/33/user/11/details\n * createUrlTreeFromSnapshot(snapshot, ['details']);\n *\n * // navigate to /team/33/user/22\n * createUrlTreeFromSnapshot(snapshot, ['../22']);\n *\n * // navigate to /team/44/user/22\n * createUrlTreeFromSnapshot(snapshot, ['../../team/44/user/22']);\n * ```\n */\nfunction createUrlTreeFromSnapshot(relativeTo, commands, queryParams = null, fragment = null) {\n const relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeTo);\n return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, queryParams, fragment);\n}\nfunction createSegmentGroupFromRoute(route) {\n let targetGroup;\n function createSegmentGroupFromRouteRecursive(currentRoute) {\n const childOutlets = {};\n for (const childSnapshot of currentRoute.children) {\n const root = createSegmentGroupFromRouteRecursive(childSnapshot);\n childOutlets[childSnapshot.outlet] = root;\n }\n const segmentGroup = new UrlSegmentGroup(currentRoute.url, childOutlets);\n if (currentRoute === route) {\n targetGroup = segmentGroup;\n }\n return segmentGroup;\n }\n const rootCandidate = createSegmentGroupFromRouteRecursive(route.root);\n const rootSegmentGroup = createRoot(rootCandidate);\n return targetGroup ?? rootSegmentGroup;\n}\nfunction createUrlTreeFromSegmentGroup(relativeTo, commands, queryParams, fragment) {\n let root = relativeTo;\n while (root.parent) {\n root = root.parent;\n }\n // There are no commands so the `UrlTree` goes to the same path as the one created from the\n // `UrlSegmentGroup`. All we need to do is update the `queryParams` and `fragment` without\n // applying any other logic.\n if (commands.length === 0) {\n return tree(root, root, root, queryParams, fragment);\n }\n const nav = computeNavigation(commands);\n if (nav.toRoot()) {\n return tree(root, root, new UrlSegmentGroup([], {}), queryParams, fragment);\n }\n const position = findStartingPositionForTargetGroup(nav, root, relativeTo);\n const newSegmentGroup = position.processChildren\n ? updateSegmentGroupChildren(position.segmentGroup, position.index, nav.commands)\n : updateSegmentGroup(position.segmentGroup, position.index, nav.commands);\n return tree(root, position.segmentGroup, newSegmentGroup, queryParams, fragment);\n}\nfunction isMatrixParams(command) {\n return typeof command === 'object' && command != null && !command.outlets && !command.segmentPath;\n}\n/**\n * Determines if a given command has an `outlets` map. When we encounter a command\n * with an outlets k/v map, we need to apply each outlet individually to the existing segment.\n */\nfunction isCommandWithOutlets(command) {\n return typeof command === 'object' && command != null && command.outlets;\n}\nfunction tree(oldRoot, oldSegmentGroup, newSegmentGroup, queryParams, fragment) {\n let qp = {};\n if (queryParams) {\n Object.entries(queryParams).forEach(([name, value]) => {\n qp[name] = Array.isArray(value) ? value.map((v) => `${v}`) : `${value}`;\n });\n }\n let rootCandidate;\n if (oldRoot === oldSegmentGroup) {\n rootCandidate = newSegmentGroup;\n }\n else {\n rootCandidate = replaceSegment(oldRoot, oldSegmentGroup, newSegmentGroup);\n }\n const newRoot = createRoot(squashSegmentGroup(rootCandidate));\n return new UrlTree(newRoot, qp, fragment);\n}\n/**\n * Replaces the `oldSegment` which is located in some child of the `current` with the `newSegment`.\n * This also has the effect of creating new `UrlSegmentGroup` copies to update references. This\n * shouldn't be necessary but the fallback logic for an invalid ActivatedRoute in the creation uses\n * the Router's current url tree. If we don't create new segment groups, we end up modifying that\n * value.\n */\nfunction replaceSegment(current, oldSegment, newSegment) {\n const children = {};\n Object.entries(current.children).forEach(([outletName, c]) => {\n if (c === oldSegment) {\n children[outletName] = newSegment;\n }\n else {\n children[outletName] = replaceSegment(c, oldSegment, newSegment);\n }\n });\n return new UrlSegmentGroup(current.segments, children);\n}\nclass Navigation {\n isAbsolute;\n numberOfDoubleDots;\n commands;\n constructor(isAbsolute, numberOfDoubleDots, commands) {\n this.isAbsolute = isAbsolute;\n this.numberOfDoubleDots = numberOfDoubleDots;\n this.commands = commands;\n if (isAbsolute && commands.length > 0 && isMatrixParams(commands[0])) {\n throw new ɵRuntimeError(4003 /* RuntimeErrorCode.ROOT_SEGMENT_MATRIX_PARAMS */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n 'Root segment cannot have matrix parameters');\n }\n const cmdWithOutlet = commands.find(isCommandWithOutlets);\n if (cmdWithOutlet && cmdWithOutlet !== last(commands)) {\n throw new ɵRuntimeError(4004 /* RuntimeErrorCode.MISPLACED_OUTLETS_COMMAND */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n '{outlets:{}} has to be the last command');\n }\n }\n toRoot() {\n return this.isAbsolute && this.commands.length === 1 && this.commands[0] == '/';\n }\n}\n/** Transforms commands to a normalized `Navigation` */\nfunction computeNavigation(commands) {\n if (typeof commands[0] === 'string' && commands.length === 1 && commands[0] === '/') {\n return new Navigation(true, 0, commands);\n }\n let numberOfDoubleDots = 0;\n let isAbsolute = false;\n const res = commands.reduce((res, cmd, cmdIdx) => {\n if (typeof cmd === 'object' && cmd != null) {\n if (cmd.outlets) {\n const outlets = {};\n Object.entries(cmd.outlets).forEach(([name, commands]) => {\n outlets[name] = typeof commands === 'string' ? commands.split('/') : commands;\n });\n return [...res, { outlets }];\n }\n if (cmd.segmentPath) {\n return [...res, cmd.segmentPath];\n }\n }\n if (!(typeof cmd === 'string')) {\n return [...res, cmd];\n }\n if (cmdIdx === 0) {\n cmd.split('/').forEach((urlPart, partIndex) => {\n if (partIndex == 0 && urlPart === '.') {\n // skip './a'\n }\n else if (partIndex == 0 && urlPart === '') {\n // '/a'\n isAbsolute = true;\n }\n else if (urlPart === '..') {\n // '../a'\n numberOfDoubleDots++;\n }\n else if (urlPart != '') {\n res.push(urlPart);\n }\n });\n return res;\n }\n return [...res, cmd];\n }, []);\n return new Navigation(isAbsolute, numberOfDoubleDots, res);\n}\nclass Position {\n segmentGroup;\n processChildren;\n index;\n constructor(segmentGroup, processChildren, index) {\n this.segmentGroup = segmentGroup;\n this.processChildren = processChildren;\n this.index = index;\n }\n}\nfunction findStartingPositionForTargetGroup(nav, root, target) {\n if (nav.isAbsolute) {\n return new Position(root, true, 0);\n }\n if (!target) {\n // `NaN` is used only to maintain backwards compatibility with incorrectly mocked\n // `ActivatedRouteSnapshot` in tests. In prior versions of this code, the position here was\n // determined based on an internal property that was rarely mocked, resulting in `NaN`. In\n // reality, this code path should _never_ be touched since `target` is not allowed to be falsey.\n return new Position(root, false, NaN);\n }\n if (target.parent === null) {\n return new Position(target, true, 0);\n }\n const modifier = isMatrixParams(nav.commands[0]) ? 0 : 1;\n const index = target.segments.length - 1 + modifier;\n return createPositionApplyingDoubleDots(target, index, nav.numberOfDoubleDots);\n}\nfunction createPositionApplyingDoubleDots(group, index, numberOfDoubleDots) {\n let g = group;\n let ci = index;\n let dd = numberOfDoubleDots;\n while (dd > ci) {\n dd -= ci;\n g = g.parent;\n if (!g) {\n throw new ɵRuntimeError(4005 /* RuntimeErrorCode.INVALID_DOUBLE_DOTS */, (typeof ngDevMode === 'undefined' || ngDevMode) && \"Invalid number of '../'\");\n }\n ci = g.segments.length;\n }\n return new Position(g, false, ci - dd);\n}\nfunction getOutlets(commands) {\n if (isCommandWithOutlets(commands[0])) {\n return commands[0].outlets;\n }\n return { [PRIMARY_OUTLET]: commands };\n}\nfunction updateSegmentGroup(segmentGroup, startIndex, commands) {\n segmentGroup ??= new UrlSegmentGroup([], {});\n if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {\n return updateSegmentGroupChildren(segmentGroup, startIndex, commands);\n }\n const m = prefixedWith(segmentGroup, startIndex, commands);\n const slicedCommands = commands.slice(m.commandIndex);\n if (m.match && m.pathIndex < segmentGroup.segments.length) {\n const g = new UrlSegmentGroup(segmentGroup.segments.slice(0, m.pathIndex), {});\n g.children[PRIMARY_OUTLET] = new UrlSegmentGroup(segmentGroup.segments.slice(m.pathIndex), segmentGroup.children);\n return updateSegmentGroupChildren(g, 0, slicedCommands);\n }\n else if (m.match && slicedCommands.length === 0) {\n return new UrlSegmentGroup(segmentGroup.segments, {});\n }\n else if (m.match && !segmentGroup.hasChildren()) {\n return createNewSegmentGroup(segmentGroup, startIndex, commands);\n }\n else if (m.match) {\n return updateSegmentGroupChildren(segmentGroup, 0, slicedCommands);\n }\n else {\n return createNewSegmentGroup(segmentGroup, startIndex, commands);\n }\n}\nfunction updateSegmentGroupChildren(segmentGroup, startIndex, commands) {\n if (commands.length === 0) {\n return new UrlSegmentGroup(segmentGroup.segments, {});\n }\n else {\n const outlets = getOutlets(commands);\n const children = {};\n // If the set of commands applies to anything other than the primary outlet and the child\n // segment is an empty path primary segment on its own, we want to apply the commands to the\n // empty child path rather than here. The outcome is that the empty primary child is effectively\n // removed from the final output UrlTree. Imagine the following config:\n //\n // {path: '', children: [{path: '**', outlet: 'popup'}]}.\n //\n // Navigation to /(popup:a) will activate the child outlet correctly Given a follow-up\n // navigation with commands\n // ['/', {outlets: {'popup': 'b'}}], we _would not_ want to apply the outlet commands to the\n // root segment because that would result in\n // //(popup:a)(popup:b) since the outlet command got applied one level above where it appears in\n // the `ActivatedRoute` rather than updating the existing one.\n //\n // Because empty paths do not appear in the URL segments and the fact that the segments used in\n // the output `UrlTree` are squashed to eliminate these empty paths where possible\n // https://github.com/angular/angular/blob/13f10de40e25c6900ca55bd83b36bd533dacfa9e/packages/router/src/url_tree.ts#L755\n // it can be hard to determine what is the right thing to do when applying commands to a\n // `UrlSegmentGroup` that is created from an \"unsquashed\"/expanded `ActivatedRoute` tree.\n // This code effectively \"squashes\" empty path primary routes when they have no siblings on\n // the same level of the tree.\n if (Object.keys(outlets).some((o) => o !== PRIMARY_OUTLET) &&\n segmentGroup.children[PRIMARY_OUTLET] &&\n segmentGroup.numberOfChildren === 1 &&\n segmentGroup.children[PRIMARY_OUTLET].segments.length === 0) {\n const childrenOfEmptyChild = updateSegmentGroupChildren(segmentGroup.children[PRIMARY_OUTLET], startIndex, commands);\n return new UrlSegmentGroup(segmentGroup.segments, childrenOfEmptyChild.children);\n }\n Object.entries(outlets).forEach(([outlet, commands]) => {\n if (typeof commands === 'string') {\n commands = [commands];\n }\n if (commands !== null) {\n children[outlet] = updateSegmentGroup(segmentGroup.children[outlet], startIndex, commands);\n }\n });\n Object.entries(segmentGroup.children).forEach(([childOutlet, child]) => {\n if (outlets[childOutlet] === undefined) {\n children[childOutlet] = child;\n }\n });\n return new UrlSegmentGroup(segmentGroup.segments, children);\n }\n}\nfunction prefixedWith(segmentGroup, startIndex, commands) {\n let currentCommandIndex = 0;\n let currentPathIndex = startIndex;\n const noMatch = { match: false, pathIndex: 0, commandIndex: 0 };\n while (currentPathIndex < segmentGroup.segments.length) {\n if (currentCommandIndex >= commands.length)\n return noMatch;\n const path = segmentGroup.segments[currentPathIndex];\n const command = commands[currentCommandIndex];\n // Do not try to consume command as part of the prefixing if it has outlets because it can\n // contain outlets other than the one being processed. Consuming the outlets command would\n // result in other outlets being ignored.\n if (isCommandWithOutlets(command)) {\n break;\n }\n const curr = `${command}`;\n const next = currentCommandIndex < commands.length - 1 ? commands[currentCommandIndex + 1] : null;\n if (currentPathIndex > 0 && curr === undefined)\n break;\n if (curr && next && typeof next === 'object' && next.outlets === undefined) {\n if (!compare(curr, next, path))\n return noMatch;\n currentCommandIndex += 2;\n }\n else {\n if (!compare(curr, {}, path))\n return noMatch;\n currentCommandIndex++;\n }\n currentPathIndex++;\n }\n return { match: true, pathIndex: currentPathIndex, commandIndex: currentCommandIndex };\n}\nfunction createNewSegmentGroup(segmentGroup, startIndex, commands) {\n const paths = segmentGroup.segments.slice(0, startIndex);\n let i = 0;\n while (i < commands.length) {\n const command = commands[i];\n if (isCommandWithOutlets(command)) {\n const children = createNewSegmentChildren(command.outlets);\n return new UrlSegmentGroup(paths, children);\n }\n // if we start with an object literal, we need to reuse the path part from the segment\n if (i === 0 && isMatrixParams(commands[0])) {\n const p = segmentGroup.segments[startIndex];\n paths.push(new UrlSegment(p.path, stringify(commands[0])));\n i++;\n continue;\n }\n const curr = isCommandWithOutlets(command) ? command.outlets[PRIMARY_OUTLET] : `${command}`;\n const next = i < commands.length - 1 ? commands[i + 1] : null;\n if (curr && next && isMatrixParams(next)) {\n paths.push(new UrlSegment(curr, stringify(next)));\n i += 2;\n }\n else {\n paths.push(new UrlSegment(curr, {}));\n i++;\n }\n }\n return new UrlSegmentGroup(paths, {});\n}\nfunction createNewSegmentChildren(outlets) {\n const children = {};\n Object.entries(outlets).forEach(([outlet, commands]) => {\n if (typeof commands === 'string') {\n commands = [commands];\n }\n if (commands !== null) {\n children[outlet] = createNewSegmentGroup(new UrlSegmentGroup([], {}), 0, commands);\n }\n });\n return children;\n}\nfunction stringify(params) {\n const res = {};\n Object.entries(params).forEach(([k, v]) => (res[k] = `${v}`));\n return res;\n}\nfunction compare(path, params, segment) {\n return path == segment.path && shallowEqual(params, segment.parameters);\n}\n\nconst IMPERATIVE_NAVIGATION = 'imperative';\n/**\n * Identifies the type of a router event.\n *\n * @publicApi\n */\nvar EventType;\n(function (EventType) {\n EventType[EventType[\"NavigationStart\"] = 0] = \"NavigationStart\";\n EventType[EventType[\"NavigationEnd\"] = 1] = \"NavigationEnd\";\n EventType[EventType[\"NavigationCancel\"] = 2] = \"NavigationCancel\";\n EventType[EventType[\"NavigationError\"] = 3] = \"NavigationError\";\n EventType[EventType[\"RoutesRecognized\"] = 4] = \"RoutesRecognized\";\n EventType[EventType[\"ResolveStart\"] = 5] = \"ResolveStart\";\n EventType[EventType[\"ResolveEnd\"] = 6] = \"ResolveEnd\";\n EventType[EventType[\"GuardsCheckStart\"] = 7] = \"GuardsCheckStart\";\n EventType[EventType[\"GuardsCheckEnd\"] = 8] = \"GuardsCheckEnd\";\n EventType[EventType[\"RouteConfigLoadStart\"] = 9] = \"RouteConfigLoadStart\";\n EventType[EventType[\"RouteConfigLoadEnd\"] = 10] = \"RouteConfigLoadEnd\";\n EventType[EventType[\"ChildActivationStart\"] = 11] = \"ChildActivationStart\";\n EventType[EventType[\"ChildActivationEnd\"] = 12] = \"ChildActivationEnd\";\n EventType[EventType[\"ActivationStart\"] = 13] = \"ActivationStart\";\n EventType[EventType[\"ActivationEnd\"] = 14] = \"ActivationEnd\";\n EventType[EventType[\"Scroll\"] = 15] = \"Scroll\";\n EventType[EventType[\"NavigationSkipped\"] = 16] = \"NavigationSkipped\";\n})(EventType || (EventType = {}));\n/**\n * Base for events the router goes through, as opposed to events tied to a specific\n * route. Fired one time for any given navigation.\n *\n * The following code shows how a class subscribes to router events.\n *\n * ```ts\n * import {Event, RouterEvent, Router} from '@angular/router';\n *\n * class MyService {\n * constructor(public router: Router) {\n * router.events.pipe(\n * filter((e: Event | RouterEvent): e is RouterEvent => e instanceof RouterEvent)\n * ).subscribe((e: RouterEvent) => {\n * // Do something\n * });\n * }\n * }\n * ```\n *\n * @see {@link Event}\n * @see [Router events summary](guide/routing/router-reference#router-events)\n * @publicApi\n */\nclass RouterEvent {\n id;\n url;\n constructor(\n /** A unique ID that the router assigns to every router navigation. */\n id, \n /** The URL that is the destination for this navigation. */\n url) {\n this.id = id;\n this.url = url;\n }\n}\n/**\n * An event triggered when a navigation starts.\n *\n * @publicApi\n */\nclass NavigationStart extends RouterEvent {\n type = EventType.NavigationStart;\n /**\n * Identifies the call or event that triggered the navigation.\n * An `imperative` trigger is a call to `router.navigateByUrl()` or `router.navigate()`.\n *\n * @see {@link NavigationEnd}\n * @see {@link NavigationCancel}\n * @see {@link NavigationError}\n */\n navigationTrigger;\n /**\n * The navigation state that was previously supplied to the `pushState` call,\n * when the navigation is triggered by a `popstate` event. Otherwise null.\n *\n * The state object is defined by `NavigationExtras`, and contains any\n * developer-defined state value, as well as a unique ID that\n * the router assigns to every router transition/navigation.\n *\n * From the perspective of the router, the router never \"goes back\".\n * When the user clicks on the back button in the browser,\n * a new navigation ID is created.\n *\n * Use the ID in this previous-state object to differentiate between a newly created\n * state and one returned to by a `popstate` event, so that you can restore some\n * remembered state, such as scroll position.\n *\n */\n restoredState;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n navigationTrigger = 'imperative', \n /** @docsNotRequired */\n restoredState = null) {\n super(id, url);\n this.navigationTrigger = navigationTrigger;\n this.restoredState = restoredState;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationStart(id: ${this.id}, url: '${this.url}')`;\n }\n}\n/**\n * An event triggered when a navigation ends successfully.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationCancel}\n * @see {@link NavigationError}\n *\n * @publicApi\n */\nclass NavigationEnd extends RouterEvent {\n urlAfterRedirects;\n type = EventType.NavigationEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}')`;\n }\n}\n/**\n * A code for the `NavigationCancel` event of the `Router` to indicate the\n * reason a navigation failed.\n *\n * @publicApi\n */\nvar NavigationCancellationCode;\n(function (NavigationCancellationCode) {\n /**\n * A navigation failed because a guard returned a `UrlTree` to redirect.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"Redirect\"] = 0] = \"Redirect\";\n /**\n * A navigation failed because a more recent navigation started.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"SupersededByNewNavigation\"] = 1] = \"SupersededByNewNavigation\";\n /**\n * A navigation failed because one of the resolvers completed without emitting a value.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"NoDataFromResolver\"] = 2] = \"NoDataFromResolver\";\n /**\n * A navigation failed because a guard returned `false`.\n */\n NavigationCancellationCode[NavigationCancellationCode[\"GuardRejected\"] = 3] = \"GuardRejected\";\n})(NavigationCancellationCode || (NavigationCancellationCode = {}));\n/**\n * A code for the `NavigationSkipped` event of the `Router` to indicate the\n * reason a navigation was skipped.\n *\n * @publicApi\n */\nvar NavigationSkippedCode;\n(function (NavigationSkippedCode) {\n /**\n * A navigation was skipped because the navigation URL was the same as the current Router URL.\n */\n NavigationSkippedCode[NavigationSkippedCode[\"IgnoredSameUrlNavigation\"] = 0] = \"IgnoredSameUrlNavigation\";\n /**\n * A navigation was skipped because the configured `UrlHandlingStrategy` return `false` for both\n * the current Router URL and the target of the navigation.\n *\n * @see {@link UrlHandlingStrategy}\n */\n NavigationSkippedCode[NavigationSkippedCode[\"IgnoredByUrlHandlingStrategy\"] = 1] = \"IgnoredByUrlHandlingStrategy\";\n})(NavigationSkippedCode || (NavigationSkippedCode = {}));\n/**\n * An event triggered when a navigation is canceled, directly or indirectly.\n * This can happen for several reasons including when a route guard\n * returns `false` or initiates a redirect by returning a `UrlTree`.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationEnd}\n * @see {@link NavigationError}\n *\n * @publicApi\n */\nclass NavigationCancel extends RouterEvent {\n reason;\n code;\n type = EventType.NavigationCancel;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /**\n * A description of why the navigation was cancelled. For debug purposes only. Use `code`\n * instead for a stable cancellation reason that can be used in production.\n */\n reason, \n /**\n * A code to indicate why the navigation was canceled. This cancellation code is stable for\n * the reason and can be relied on whereas the `reason` string could change and should not be\n * used in production.\n */\n code) {\n super(id, url);\n this.reason = reason;\n this.code = code;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationCancel(id: ${this.id}, url: '${this.url}')`;\n }\n}\n/**\n * An event triggered when a navigation is skipped.\n * This can happen for a couple reasons including onSameUrlHandling\n * is set to `ignore` and the navigation URL is not different than the\n * current state.\n *\n * @publicApi\n */\nclass NavigationSkipped extends RouterEvent {\n reason;\n code;\n type = EventType.NavigationSkipped;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /**\n * A description of why the navigation was skipped. For debug purposes only. Use `code`\n * instead for a stable skipped reason that can be used in production.\n */\n reason, \n /**\n * A code to indicate why the navigation was skipped. This code is stable for\n * the reason and can be relied on whereas the `reason` string could change and should not be\n * used in production.\n */\n code) {\n super(id, url);\n this.reason = reason;\n this.code = code;\n }\n}\n/**\n * An event triggered when a navigation fails due to an unexpected error.\n *\n * @see {@link NavigationStart}\n * @see {@link NavigationEnd}\n * @see {@link NavigationCancel}\n *\n * @publicApi\n */\nclass NavigationError extends RouterEvent {\n error;\n target;\n type = EventType.NavigationError;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n error, \n /**\n * The target of the navigation when the error occurred.\n *\n * Note that this can be `undefined` because an error could have occurred before the\n * `RouterStateSnapshot` was created for the navigation.\n */\n target) {\n super(id, url);\n this.error = error;\n this.target = target;\n }\n /** @docsNotRequired */\n toString() {\n return `NavigationError(id: ${this.id}, url: '${this.url}', error: ${this.error})`;\n }\n}\n/**\n * An event triggered when routes are recognized.\n *\n * @publicApi\n */\nclass RoutesRecognized extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.RoutesRecognized;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n /** @docsNotRequired */\n toString() {\n return `RoutesRecognized(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the start of the Guard phase of routing.\n *\n * @see {@link GuardsCheckEnd}\n *\n * @publicApi\n */\nclass GuardsCheckStart extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.GuardsCheckStart;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `GuardsCheckStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the end of the Guard phase of routing.\n *\n * @see {@link GuardsCheckStart}\n *\n * @publicApi\n */\nclass GuardsCheckEnd extends RouterEvent {\n urlAfterRedirects;\n state;\n shouldActivate;\n type = EventType.GuardsCheckEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state, \n /** @docsNotRequired */\n shouldActivate) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n this.shouldActivate = shouldActivate;\n }\n toString() {\n return `GuardsCheckEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state}, shouldActivate: ${this.shouldActivate})`;\n }\n}\n/**\n * An event triggered at the start of the Resolve phase of routing.\n *\n * Runs in the \"resolve\" phase whether or not there is anything to resolve.\n * In future, may change to only run when there are things to be resolved.\n *\n * @see {@link ResolveEnd}\n *\n * @publicApi\n */\nclass ResolveStart extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.ResolveStart;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `ResolveStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered at the end of the Resolve phase of routing.\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ResolveEnd extends RouterEvent {\n urlAfterRedirects;\n state;\n type = EventType.ResolveEnd;\n constructor(\n /** @docsNotRequired */\n id, \n /** @docsNotRequired */\n url, \n /** @docsNotRequired */\n urlAfterRedirects, \n /** @docsNotRequired */\n state) {\n super(id, url);\n this.urlAfterRedirects = urlAfterRedirects;\n this.state = state;\n }\n toString() {\n return `ResolveEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;\n }\n}\n/**\n * An event triggered before lazy loading a route configuration.\n *\n * @see {@link RouteConfigLoadEnd}\n *\n * @publicApi\n */\nclass RouteConfigLoadStart {\n route;\n type = EventType.RouteConfigLoadStart;\n constructor(\n /** @docsNotRequired */\n route) {\n this.route = route;\n }\n toString() {\n return `RouteConfigLoadStart(path: ${this.route.path})`;\n }\n}\n/**\n * An event triggered when a route has been lazy loaded.\n *\n * @see {@link RouteConfigLoadStart}\n *\n * @publicApi\n */\nclass RouteConfigLoadEnd {\n route;\n type = EventType.RouteConfigLoadEnd;\n constructor(\n /** @docsNotRequired */\n route) {\n this.route = route;\n }\n toString() {\n return `RouteConfigLoadEnd(path: ${this.route.path})`;\n }\n}\n/**\n * An event triggered at the start of the child-activation\n * part of the Resolve phase of routing.\n * @see {@link ChildActivationEnd}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ChildActivationStart {\n snapshot;\n type = EventType.ChildActivationStart;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ChildActivationStart(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the end of the child-activation part\n * of the Resolve phase of routing.\n * @see {@link ChildActivationStart}\n * @see {@link ResolveStart}\n * @publicApi\n */\nclass ChildActivationEnd {\n snapshot;\n type = EventType.ChildActivationEnd;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ChildActivationEnd(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the start of the activation part\n * of the Resolve phase of routing.\n * @see {@link ActivationEnd}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ActivationStart {\n snapshot;\n type = EventType.ActivationStart;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ActivationStart(path: '${path}')`;\n }\n}\n/**\n * An event triggered at the end of the activation part\n * of the Resolve phase of routing.\n * @see {@link ActivationStart}\n * @see {@link ResolveStart}\n *\n * @publicApi\n */\nclass ActivationEnd {\n snapshot;\n type = EventType.ActivationEnd;\n constructor(\n /** @docsNotRequired */\n snapshot) {\n this.snapshot = snapshot;\n }\n toString() {\n const path = (this.snapshot.routeConfig && this.snapshot.routeConfig.path) || '';\n return `ActivationEnd(path: '${path}')`;\n }\n}\n/**\n * An event triggered by scrolling.\n *\n * @publicApi\n */\nclass Scroll {\n routerEvent;\n position;\n anchor;\n type = EventType.Scroll;\n constructor(\n /** @docsNotRequired */\n routerEvent, \n /** @docsNotRequired */\n position, \n /** @docsNotRequired */\n anchor) {\n this.routerEvent = routerEvent;\n this.position = position;\n this.anchor = anchor;\n }\n toString() {\n const pos = this.position ? `${this.position[0]}, ${this.position[1]}` : null;\n return `Scroll(anchor: '${this.anchor}', position: '${pos}')`;\n }\n}\nclass BeforeActivateRoutes {\n}\nclass RedirectRequest {\n url;\n navigationBehaviorOptions;\n constructor(url, navigationBehaviorOptions) {\n this.url = url;\n this.navigationBehaviorOptions = navigationBehaviorOptions;\n }\n}\nfunction stringifyEvent(routerEvent) {\n switch (routerEvent.type) {\n case EventType.ActivationEnd:\n return `ActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ActivationStart:\n return `ActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ChildActivationEnd:\n return `ChildActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.ChildActivationStart:\n return `ChildActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ''}')`;\n case EventType.GuardsCheckEnd:\n return `GuardsCheckEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state}, shouldActivate: ${routerEvent.shouldActivate})`;\n case EventType.GuardsCheckStart:\n return `GuardsCheckStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.NavigationCancel:\n return `NavigationCancel(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.NavigationSkipped:\n return `NavigationSkipped(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.NavigationEnd:\n return `NavigationEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}')`;\n case EventType.NavigationError:\n return `NavigationError(id: ${routerEvent.id}, url: '${routerEvent.url}', error: ${routerEvent.error})`;\n case EventType.NavigationStart:\n return `NavigationStart(id: ${routerEvent.id}, url: '${routerEvent.url}')`;\n case EventType.ResolveEnd:\n return `ResolveEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.ResolveStart:\n return `ResolveStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.RouteConfigLoadEnd:\n return `RouteConfigLoadEnd(path: ${routerEvent.route.path})`;\n case EventType.RouteConfigLoadStart:\n return `RouteConfigLoadStart(path: ${routerEvent.route.path})`;\n case EventType.RoutesRecognized:\n return `RoutesRecognized(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;\n case EventType.Scroll:\n const pos = routerEvent.position\n ? `${routerEvent.position[0]}, ${routerEvent.position[1]}`\n : null;\n return `Scroll(anchor: '${routerEvent.anchor}', position: '${pos}')`;\n }\n}\n\n/**\n * Creates an `EnvironmentInjector` if the `Route` has providers and one does not already exist\n * and returns the injector. Otherwise, if the `Route` does not have `providers`, returns the\n * `currentInjector`.\n *\n * @param route The route that might have providers\n * @param currentInjector The parent injector of the `Route`\n */\nfunction getOrCreateRouteInjectorIfNeeded(route, currentInjector) {\n if (route.providers && !route._injector) {\n route._injector = createEnvironmentInjector(route.providers, currentInjector, `Route: ${route.path}`);\n }\n return route._injector ?? currentInjector;\n}\nfunction getLoadedRoutes$1(route) {\n return route._loadedRoutes;\n}\nfunction getLoadedInjector(route) {\n return route._loadedInjector;\n}\nfunction getLoadedComponent(route) {\n return route._loadedComponent;\n}\nfunction getProvidersInjector(route) {\n return route._injector;\n}\nfunction validateConfig(config, parentPath = '', requireStandaloneComponents = false) {\n // forEach doesn't iterate undefined values\n for (let i = 0; i < config.length; i++) {\n const route = config[i];\n const fullPath = getFullPath(parentPath, route);\n validateNode(route, fullPath, requireStandaloneComponents);\n }\n}\nfunction assertStandalone(fullPath, component) {\n if (component && ɵisNgModule(component)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. You are using 'loadComponent' with a module, ` +\n `but it must be used with standalone components. Use 'loadChildren' instead.`);\n }\n else if (component && !isStandalone(component)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. The component must be standalone.`);\n }\n}\nfunction validateNode(route, fullPath, requireStandaloneComponents) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!route) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `\n Invalid configuration of route '${fullPath}': Encountered undefined route.\n The reason might be an extra comma.\n\n Example:\n const routes: Routes = [\n { path: '', redirectTo: '/dashboard', pathMatch: 'full' },\n { path: 'dashboard', component: DashboardComponent },, << two commas\n { path: 'detail/:id', component: HeroDetailComponent }\n ];\n `);\n }\n if (Array.isArray(route)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': Array cannot be specified`);\n }\n if (!route.redirectTo &&\n !route.component &&\n !route.loadComponent &&\n !route.children &&\n !route.loadChildren &&\n route.outlet &&\n route.outlet !== PRIMARY_OUTLET) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': a componentless route without children or loadChildren cannot have a named outlet set`);\n }\n if (route.redirectTo && route.children) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and children cannot be used together`);\n }\n if (route.redirectTo && route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and loadChildren cannot be used together`);\n }\n if (route.children && route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': children and loadChildren cannot be used together`);\n }\n if (route.redirectTo && (route.component || route.loadComponent)) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and component/loadComponent cannot be used together`);\n }\n if (route.component && route.loadComponent) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': component and loadComponent cannot be used together`);\n }\n if (route.redirectTo && route.canActivate) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': redirectTo and canActivate cannot be used together. Redirects happen before activation ` +\n `so canActivate will never be executed.`);\n }\n if (route.path && route.matcher) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': path and matcher cannot be used together`);\n }\n if (route.redirectTo === void 0 &&\n !route.component &&\n !route.loadComponent &&\n !route.children &&\n !route.loadChildren) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}'. One of the following must be provided: component, loadComponent, redirectTo, children or loadChildren`);\n }\n if (route.path === void 0 && route.matcher === void 0) {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': routes must have either a path or a matcher specified`);\n }\n if (typeof route.path === 'string' && route.path.charAt(0) === '/') {\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '${fullPath}': path cannot start with a slash`);\n }\n if (route.path === '' && route.redirectTo !== void 0 && route.pathMatch === void 0) {\n const exp = `The default value of 'pathMatch' is 'prefix', but often the intent is to use 'full'.`;\n throw new ɵRuntimeError(4014 /* RuntimeErrorCode.INVALID_ROUTE_CONFIG */, `Invalid configuration of route '{path: \"${fullPath}\", redirectTo: \"${route.redirectTo}\"}': please provide 'pathMatch'. ${exp}`);\n }\n if (requireStandaloneComponents) {\n assertStandalone(fullPath, route.component);\n }\n }\n if (route.children) {\n validateConfig(route.children, fullPath, requireStandaloneComponents);\n }\n}\nfunction getFullPath(parentPath, currentRoute) {\n if (!currentRoute) {\n return parentPath;\n }\n if (!parentPath && !currentRoute.path) {\n return '';\n }\n else if (parentPath && !currentRoute.path) {\n return `${parentPath}/`;\n }\n else if (!parentPath && currentRoute.path) {\n return currentRoute.path;\n }\n else {\n return `${parentPath}/${currentRoute.path}`;\n }\n}\n/** Returns the `route.outlet` or PRIMARY_OUTLET if none exists. */\nfunction getOutlet(route) {\n return route.outlet || PRIMARY_OUTLET;\n}\n/**\n * Sorts the `routes` such that the ones with an outlet matching `outletName` come first.\n * The order of the configs is otherwise preserved.\n */\nfunction sortByMatchingOutlets(routes, outletName) {\n const sortedConfig = routes.filter((r) => getOutlet(r) === outletName);\n sortedConfig.push(...routes.filter((r) => getOutlet(r) !== outletName));\n return sortedConfig;\n}\n/**\n * Gets the first injector in the snapshot's parent tree.\n *\n * If the `Route` has a static list of providers, the returned injector will be the one created from\n * those. If it does not exist, the returned injector may come from the parents, which may be from a\n * loaded config or their static providers.\n *\n * Returns `null` if there is neither this nor any parents have a stored injector.\n *\n * Generally used for retrieving the injector to use for getting tokens for guards/resolvers and\n * also used for getting the correct injector to use for creating components.\n */\nfunction getClosestRouteInjector(snapshot) {\n if (!snapshot)\n return null;\n // If the current route has its own injector, which is created from the static providers on the\n // route itself, we should use that. Otherwise, we start at the parent since we do not want to\n // include the lazy loaded injector from this route.\n if (snapshot.routeConfig?._injector) {\n return snapshot.routeConfig._injector;\n }\n for (let s = snapshot.parent; s; s = s.parent) {\n const route = s.routeConfig;\n // Note that the order here is important. `_loadedInjector` stored on the route with\n // `loadChildren: () => NgModule` so it applies to child routes with priority. The `_injector`\n // is created from the static providers on that parent route, so it applies to the children as\n // well, but only if there is no lazy loaded NgModuleRef injector.\n if (route?._loadedInjector)\n return route._loadedInjector;\n if (route?._injector)\n return route._injector;\n }\n return null;\n}\n\n/**\n * Store contextual information about a `RouterOutlet`\n *\n * @publicApi\n */\nclass OutletContext {\n rootInjector;\n outlet = null;\n route = null;\n children;\n attachRef = null;\n get injector() {\n return getClosestRouteInjector(this.route?.snapshot) ?? this.rootInjector;\n }\n constructor(rootInjector) {\n this.rootInjector = rootInjector;\n this.children = new ChildrenOutletContexts(this.rootInjector);\n }\n}\n/**\n * Store contextual information about the children (= nested) `RouterOutlet`\n *\n * @publicApi\n */\nclass ChildrenOutletContexts {\n rootInjector;\n // contexts for child outlets, by name.\n contexts = new Map();\n /** @nodoc */\n constructor(rootInjector) {\n this.rootInjector = rootInjector;\n }\n /** Called when a `RouterOutlet` directive is instantiated */\n onChildOutletCreated(childName, outlet) {\n const context = this.getOrCreateContext(childName);\n context.outlet = outlet;\n this.contexts.set(childName, context);\n }\n /**\n * Called when a `RouterOutlet` directive is destroyed.\n * We need to keep the context as the outlet could be destroyed inside a NgIf and might be\n * re-created later.\n */\n onChildOutletDestroyed(childName) {\n const context = this.getContext(childName);\n if (context) {\n context.outlet = null;\n context.attachRef = null;\n }\n }\n /**\n * Called when the corresponding route is deactivated during navigation.\n * Because the component get destroyed, all children outlet are destroyed.\n */\n onOutletDeactivated() {\n const contexts = this.contexts;\n this.contexts = new Map();\n return contexts;\n }\n onOutletReAttached(contexts) {\n this.contexts = contexts;\n }\n getOrCreateContext(childName) {\n let context = this.getContext(childName);\n if (!context) {\n context = new OutletContext(this.rootInjector);\n this.contexts.set(childName, context);\n }\n return context;\n }\n getContext(childName) {\n return this.contexts.get(childName) || null;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, deps: [{ token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ChildrenOutletContexts, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i0.EnvironmentInjector }] });\n\nclass Tree {\n /** @internal */\n _root;\n constructor(root) {\n this._root = root;\n }\n get root() {\n return this._root.value;\n }\n /**\n * @internal\n */\n parent(t) {\n const p = this.pathFromRoot(t);\n return p.length > 1 ? p[p.length - 2] : null;\n }\n /**\n * @internal\n */\n children(t) {\n const n = findNode(t, this._root);\n return n ? n.children.map((t) => t.value) : [];\n }\n /**\n * @internal\n */\n firstChild(t) {\n const n = findNode(t, this._root);\n return n && n.children.length > 0 ? n.children[0].value : null;\n }\n /**\n * @internal\n */\n siblings(t) {\n const p = findPath(t, this._root);\n if (p.length < 2)\n return [];\n const c = p[p.length - 2].children.map((c) => c.value);\n return c.filter((cc) => cc !== t);\n }\n /**\n * @internal\n */\n pathFromRoot(t) {\n return findPath(t, this._root).map((s) => s.value);\n }\n}\n// DFS for the node matching the value\nfunction findNode(value, node) {\n if (value === node.value)\n return node;\n for (const child of node.children) {\n const node = findNode(value, child);\n if (node)\n return node;\n }\n return null;\n}\n// Return the path to the node with the given value using DFS\nfunction findPath(value, node) {\n if (value === node.value)\n return [node];\n for (const child of node.children) {\n const path = findPath(value, child);\n if (path.length) {\n path.unshift(node);\n return path;\n }\n }\n return [];\n}\nclass TreeNode {\n value;\n children;\n constructor(value, children) {\n this.value = value;\n this.children = children;\n }\n toString() {\n return `TreeNode(${this.value})`;\n }\n}\n// Return the list of T indexed by outlet name\nfunction nodeChildrenAsMap(node) {\n const map = {};\n if (node) {\n node.children.forEach((child) => (map[child.value.outlet] = child));\n }\n return map;\n}\n\n/**\n * Represents the state of the router as a tree of activated routes.\n *\n * @usageNotes\n *\n * Every node in the route tree is an `ActivatedRoute` instance\n * that knows about the \"consumed\" URL segments, the extracted parameters,\n * and the resolved data.\n * Use the `ActivatedRoute` properties to traverse the tree from any node.\n *\n * The following fragment shows how a component gets the root node\n * of the current state to establish its own route tree:\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const state: RouterState = router.routerState;\n * const root: ActivatedRoute = state.root;\n * const child = root.firstChild;\n * const id: Observable
= child.params.map(p => p.id);\n * //...\n * }\n * }\n * ```\n *\n * @see {@link ActivatedRoute}\n * @see [Getting route information](guide/routing/common-router-tasks#getting-route-information)\n *\n * @publicApi\n */\nclass RouterState extends Tree {\n snapshot;\n /** @internal */\n constructor(root, \n /** The current snapshot of the router state */\n snapshot) {\n super(root);\n this.snapshot = snapshot;\n setRouterState(this, root);\n }\n toString() {\n return this.snapshot.toString();\n }\n}\nfunction createEmptyState(rootComponent) {\n const snapshot = createEmptyStateSnapshot(rootComponent);\n const emptyUrl = new BehaviorSubject([new UrlSegment('', {})]);\n const emptyParams = new BehaviorSubject({});\n const emptyData = new BehaviorSubject({});\n const emptyQueryParams = new BehaviorSubject({});\n const fragment = new BehaviorSubject('');\n const activated = new ActivatedRoute(emptyUrl, emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, snapshot.root);\n activated.snapshot = snapshot.root;\n return new RouterState(new TreeNode(activated, []), snapshot);\n}\nfunction createEmptyStateSnapshot(rootComponent) {\n const emptyParams = {};\n const emptyData = {};\n const emptyQueryParams = {};\n const fragment = '';\n const activated = new ActivatedRouteSnapshot([], emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, null, {});\n return new RouterStateSnapshot('', new TreeNode(activated, []));\n}\n/**\n * Provides access to information about a route associated with a component\n * that is loaded in an outlet.\n * Use to traverse the `RouterState` tree and extract information from nodes.\n *\n * The following example shows how to construct a component using information from a\n * currently activated route.\n *\n * Note: the observables in this class only emit when the current and previous values differ based\n * on shallow equality. For example, changing deeply nested properties in resolved `data` will not\n * cause the `ActivatedRoute.data` `Observable` to emit a new value.\n *\n * {@example router/activated-route/module.ts region=\"activated-route\"\n * header=\"activated-route.component.ts\"}\n *\n * @see [Getting route information](guide/routing/common-router-tasks#getting-route-information)\n *\n * @publicApi\n */\nclass ActivatedRoute {\n urlSubject;\n paramsSubject;\n queryParamsSubject;\n fragmentSubject;\n dataSubject;\n outlet;\n component;\n /** The current snapshot of this route */\n snapshot;\n /** @internal */\n _futureSnapshot;\n /** @internal */\n _routerState;\n /** @internal */\n _paramMap;\n /** @internal */\n _queryParamMap;\n /** An Observable of the resolved route title */\n title;\n /** An observable of the URL segments matched by this route. */\n url;\n /** An observable of the matrix parameters scoped to this route. */\n params;\n /** An observable of the query parameters shared by all the routes. */\n queryParams;\n /** An observable of the URL fragment shared by all the routes. */\n fragment;\n /** An observable of the static and resolved data of this route. */\n data;\n /** @internal */\n constructor(\n /** @internal */\n urlSubject, \n /** @internal */\n paramsSubject, \n /** @internal */\n queryParamsSubject, \n /** @internal */\n fragmentSubject, \n /** @internal */\n dataSubject, \n /** The outlet name of the route, a constant. */\n outlet, \n /** The component of the route, a constant. */\n component, futureSnapshot) {\n this.urlSubject = urlSubject;\n this.paramsSubject = paramsSubject;\n this.queryParamsSubject = queryParamsSubject;\n this.fragmentSubject = fragmentSubject;\n this.dataSubject = dataSubject;\n this.outlet = outlet;\n this.component = component;\n this._futureSnapshot = futureSnapshot;\n this.title = this.dataSubject?.pipe(map((d) => d[RouteTitleKey])) ?? of(undefined);\n // TODO(atscott): Verify that these can be changed to `.asObservable()` with TGP.\n this.url = urlSubject;\n this.params = paramsSubject;\n this.queryParams = queryParamsSubject;\n this.fragment = fragmentSubject;\n this.data = dataSubject;\n }\n /** The configuration used to match this route. */\n get routeConfig() {\n return this._futureSnapshot.routeConfig;\n }\n /** The root of the router state. */\n get root() {\n return this._routerState.root;\n }\n /** The parent of this route in the router state tree. */\n get parent() {\n return this._routerState.parent(this);\n }\n /** The first child of this route in the router state tree. */\n get firstChild() {\n return this._routerState.firstChild(this);\n }\n /** The children of this route in the router state tree. */\n get children() {\n return this._routerState.children(this);\n }\n /** The path from the root of the router state tree to this route. */\n get pathFromRoot() {\n return this._routerState.pathFromRoot(this);\n }\n /**\n * An Observable that contains a map of the required and optional parameters\n * specific to the route.\n * The map supports retrieving single and multiple values from the same parameter.\n */\n get paramMap() {\n this._paramMap ??= this.params.pipe(map((p) => convertToParamMap(p)));\n return this._paramMap;\n }\n /**\n * An Observable that contains a map of the query parameters available to all routes.\n * The map supports retrieving single and multiple values from the query parameter.\n */\n get queryParamMap() {\n this._queryParamMap ??= this.queryParams.pipe(map((p) => convertToParamMap(p)));\n return this._queryParamMap;\n }\n toString() {\n return this.snapshot ? this.snapshot.toString() : `Future(${this._futureSnapshot})`;\n }\n}\n/**\n * Returns the inherited params, data, and resolve for a given route.\n *\n * By default, we do not inherit parent data unless the current route is path-less or the parent\n * route is component-less.\n */\nfunction getInherited(route, parent, paramsInheritanceStrategy = 'emptyOnly') {\n let inherited;\n const { routeConfig } = route;\n if (parent !== null &&\n (paramsInheritanceStrategy === 'always' ||\n // inherit parent data if route is empty path\n routeConfig?.path === '' ||\n // inherit parent data if parent was componentless\n (!parent.component && !parent.routeConfig?.loadComponent))) {\n inherited = {\n params: { ...parent.params, ...route.params },\n data: { ...parent.data, ...route.data },\n resolve: {\n // Snapshots are created with data inherited from parent and guards (i.e. canActivate) can\n // change data because it's not frozen...\n // This first line could be deleted chose to break/disallow mutating the `data` object in\n // guards.\n // Note that data from parents still override this mutated data so anyone relying on this\n // might be surprised that it doesn't work if parent data is inherited but otherwise does.\n ...route.data,\n // Ensure inherited resolved data overrides inherited static data\n ...parent.data,\n // static data from the current route overrides any inherited data\n ...routeConfig?.data,\n // resolved data from current route overrides everything\n ...route._resolvedData,\n },\n };\n }\n else {\n inherited = {\n params: { ...route.params },\n data: { ...route.data },\n resolve: { ...route.data, ...(route._resolvedData ?? {}) },\n };\n }\n if (routeConfig && hasStaticTitle(routeConfig)) {\n inherited.resolve[RouteTitleKey] = routeConfig.title;\n }\n return inherited;\n}\n/**\n * @description\n *\n * Contains the information about a route associated with a component loaded in an\n * outlet at a particular moment in time. ActivatedRouteSnapshot can also be used to\n * traverse the router state tree.\n *\n * The following example initializes a component with route information extracted\n * from the snapshot of the root node at the time of creation.\n *\n * ```ts\n * @Component({templateUrl:'./my-component.html'})\n * class MyComponent {\n * constructor(route: ActivatedRoute) {\n * const id: string = route.snapshot.params.id;\n * const url: string = route.snapshot.url.join('');\n * const user = route.snapshot.data.user;\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass ActivatedRouteSnapshot {\n url;\n params;\n queryParams;\n fragment;\n data;\n outlet;\n component;\n /** The configuration used to match this route **/\n routeConfig;\n /** @internal */\n _resolve;\n /** @internal */\n _resolvedData;\n /** @internal */\n _routerState;\n /** @internal */\n _paramMap;\n /** @internal */\n _queryParamMap;\n /** The resolved route title */\n get title() {\n // Note: This _must_ be a getter because the data is mutated in the resolvers. Title will not be\n // available at the time of class instantiation.\n return this.data?.[RouteTitleKey];\n }\n /** @internal */\n constructor(\n /** The URL segments matched by this route */\n url, \n /**\n * The matrix parameters scoped to this route.\n *\n * You can compute all params (or data) in the router state or to get params outside\n * of an activated component by traversing the `RouterState` tree as in the following\n * example:\n * ```ts\n * collectRouteParams(router: Router) {\n * let params = {};\n * let stack: ActivatedRouteSnapshot[] = [router.routerState.snapshot.root];\n * while (stack.length > 0) {\n * const route = stack.pop()!;\n * params = {...params, ...route.params};\n * stack.push(...route.children);\n * }\n * return params;\n * }\n * ```\n */\n params, \n /** The query parameters shared by all the routes */\n queryParams, \n /** The URL fragment shared by all the routes */\n fragment, \n /** The static and resolved data of this route */\n data, \n /** The outlet name of the route */\n outlet, \n /** The component of the route */\n component, routeConfig, resolve) {\n this.url = url;\n this.params = params;\n this.queryParams = queryParams;\n this.fragment = fragment;\n this.data = data;\n this.outlet = outlet;\n this.component = component;\n this.routeConfig = routeConfig;\n this._resolve = resolve;\n }\n /** The root of the router state */\n get root() {\n return this._routerState.root;\n }\n /** The parent of this route in the router state tree */\n get parent() {\n return this._routerState.parent(this);\n }\n /** The first child of this route in the router state tree */\n get firstChild() {\n return this._routerState.firstChild(this);\n }\n /** The children of this route in the router state tree */\n get children() {\n return this._routerState.children(this);\n }\n /** The path from the root of the router state tree to this route */\n get pathFromRoot() {\n return this._routerState.pathFromRoot(this);\n }\n get paramMap() {\n this._paramMap ??= convertToParamMap(this.params);\n return this._paramMap;\n }\n get queryParamMap() {\n this._queryParamMap ??= convertToParamMap(this.queryParams);\n return this._queryParamMap;\n }\n toString() {\n const url = this.url.map((segment) => segment.toString()).join('/');\n const matched = this.routeConfig ? this.routeConfig.path : '';\n return `Route(url:'${url}', path:'${matched}')`;\n }\n}\n/**\n * @description\n *\n * Represents the state of the router at a moment in time.\n *\n * This is a tree of activated route snapshots. Every node in this tree knows about\n * the \"consumed\" URL segments, the extracted parameters, and the resolved data.\n *\n * The following example shows how a component is initialized with information\n * from the snapshot of the root node's state at the time of creation.\n *\n * ```ts\n * @Component({templateUrl:'template.html'})\n * class MyComponent {\n * constructor(router: Router) {\n * const state: RouterState = router.routerState;\n * const snapshot: RouterStateSnapshot = state.snapshot;\n * const root: ActivatedRouteSnapshot = snapshot.root;\n * const child = root.firstChild;\n * const id: Observable = child.params.map(p => p.id);\n * //...\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass RouterStateSnapshot extends Tree {\n url;\n /** @internal */\n constructor(\n /** The url from which this snapshot was created */\n url, root) {\n super(root);\n this.url = url;\n setRouterState(this, root);\n }\n toString() {\n return serializeNode(this._root);\n }\n}\nfunction setRouterState(state, node) {\n node.value._routerState = state;\n node.children.forEach((c) => setRouterState(state, c));\n}\nfunction serializeNode(node) {\n const c = node.children.length > 0 ? ` { ${node.children.map(serializeNode).join(', ')} } ` : '';\n return `${node.value}${c}`;\n}\n/**\n * The expectation is that the activate route is created with the right set of parameters.\n * So we push new values into the observables only when they are not the initial values.\n * And we detect that by checking if the snapshot field is set.\n */\nfunction advanceActivatedRoute(route) {\n if (route.snapshot) {\n const currentSnapshot = route.snapshot;\n const nextSnapshot = route._futureSnapshot;\n route.snapshot = nextSnapshot;\n if (!shallowEqual(currentSnapshot.queryParams, nextSnapshot.queryParams)) {\n route.queryParamsSubject.next(nextSnapshot.queryParams);\n }\n if (currentSnapshot.fragment !== nextSnapshot.fragment) {\n route.fragmentSubject.next(nextSnapshot.fragment);\n }\n if (!shallowEqual(currentSnapshot.params, nextSnapshot.params)) {\n route.paramsSubject.next(nextSnapshot.params);\n }\n if (!shallowEqualArrays(currentSnapshot.url, nextSnapshot.url)) {\n route.urlSubject.next(nextSnapshot.url);\n }\n if (!shallowEqual(currentSnapshot.data, nextSnapshot.data)) {\n route.dataSubject.next(nextSnapshot.data);\n }\n }\n else {\n route.snapshot = route._futureSnapshot;\n // this is for resolved data\n route.dataSubject.next(route._futureSnapshot.data);\n }\n}\nfunction equalParamsAndUrlSegments(a, b) {\n const equalUrlParams = shallowEqual(a.params, b.params) && equalSegments(a.url, b.url);\n const parentsMismatch = !a.parent !== !b.parent;\n return (equalUrlParams &&\n !parentsMismatch &&\n (!a.parent || equalParamsAndUrlSegments(a.parent, b.parent)));\n}\nfunction hasStaticTitle(config) {\n return typeof config.title === 'string' || config.title === null;\n}\n\n/**\n * An `InjectionToken` provided by the `RouterOutlet` and can be set using the `routerOutletData`\n * input.\n *\n * When unset, this value is `null` by default.\n *\n * @usageNotes\n *\n * To set the data from the template of the component with `router-outlet`:\n * ```html\n * , component: , outlet: }`\n *\n * Using named outlets and secondary routes, you can target multiple outlets in\n * the same `RouterLink` directive.\n *\n * The router keeps track of separate branches in a navigation tree for each named outlet and\n * generates a representation of that tree in the URL.\n * The URL for a secondary route uses the following syntax to specify both the primary and secondary\n * routes at the same time:\n *\n * `http://base-path/primary-route-path(outlet-name:route-path)`\n *\n * A router outlet emits an activate event when a new component is instantiated,\n * deactivate event when a component is destroyed.\n * An attached event emits when the `RouteReuseStrategy` instructs the outlet to reattach the\n * subtree, and the detached event emits when the `RouteReuseStrategy` instructs the outlet to\n * detach the subtree.\n *\n * ```html\n * \n * ```\n *\n * @see {@link RouterLink}\n * @see {@link Route}\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterOutlet {\n activated = null;\n /** @internal */\n get activatedComponentRef() {\n return this.activated;\n }\n _activatedRoute = null;\n /**\n * The name of the outlet\n *\n */\n name = PRIMARY_OUTLET;\n activateEvents = new EventEmitter();\n deactivateEvents = new EventEmitter();\n /**\n * Emits an attached component instance when the `RouteReuseStrategy` instructs to re-attach a\n * previously detached subtree.\n **/\n attachEvents = new EventEmitter();\n /**\n * Emits a detached component instance when the `RouteReuseStrategy` instructs to detach the\n * subtree.\n */\n detachEvents = new EventEmitter();\n /**\n * Data that will be provided to the child injector through the `ROUTER_OUTLET_DATA` token.\n *\n * When unset, the value of the token is `undefined` by default.\n */\n routerOutletData = input(undefined);\n parentContexts = inject(ChildrenOutletContexts);\n location = inject(ViewContainerRef);\n changeDetector = inject(ChangeDetectorRef);\n inputBinder = inject(INPUT_BINDER, { optional: true });\n /** @nodoc */\n supportsBindingToComponentInputs = true;\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['name']) {\n const { firstChange, previousValue } = changes['name'];\n if (firstChange) {\n // The first change is handled by ngOnInit. Because ngOnChanges doesn't get called when no\n // input is set at all, we need to centrally handle the first change there.\n return;\n }\n // unregister with the old name\n if (this.isTrackedInParentContexts(previousValue)) {\n this.deactivate();\n this.parentContexts.onChildOutletDestroyed(previousValue);\n }\n // register the new name\n this.initializeOutletWithName();\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n // Ensure that the registered outlet is this one before removing it on the context.\n if (this.isTrackedInParentContexts(this.name)) {\n this.parentContexts.onChildOutletDestroyed(this.name);\n }\n this.inputBinder?.unsubscribeFromRouteData(this);\n }\n isTrackedInParentContexts(outletName) {\n return this.parentContexts.getContext(outletName)?.outlet === this;\n }\n /** @nodoc */\n ngOnInit() {\n this.initializeOutletWithName();\n }\n initializeOutletWithName() {\n this.parentContexts.onChildOutletCreated(this.name, this);\n if (this.activated) {\n return;\n }\n // If the outlet was not instantiated at the time the route got activated we need to populate\n // the outlet when it is initialized (ie inside a NgIf)\n const context = this.parentContexts.getContext(this.name);\n if (context?.route) {\n if (context.attachRef) {\n // `attachRef` is populated when there is an existing component to mount\n this.attach(context.attachRef, context.route);\n }\n else {\n // otherwise the component defined in the configuration is created\n this.activateWith(context.route, context.injector);\n }\n }\n }\n get isActivated() {\n return !!this.activated;\n }\n /**\n * @returns The currently activated component instance.\n * @throws An error if the outlet is not activated.\n */\n get component() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n return this.activated.instance;\n }\n get activatedRoute() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n return this._activatedRoute;\n }\n get activatedRouteData() {\n if (this._activatedRoute) {\n return this._activatedRoute.snapshot.data;\n }\n return {};\n }\n /**\n * Called when the `RouteReuseStrategy` instructs to detach the subtree\n */\n detach() {\n if (!this.activated)\n throw new ɵRuntimeError(4012 /* RuntimeErrorCode.OUTLET_NOT_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) && 'Outlet is not activated');\n this.location.detach();\n const cmp = this.activated;\n this.activated = null;\n this._activatedRoute = null;\n this.detachEvents.emit(cmp.instance);\n return cmp;\n }\n /**\n * Called when the `RouteReuseStrategy` instructs to re-attach a previously detached subtree\n */\n attach(ref, activatedRoute) {\n this.activated = ref;\n this._activatedRoute = activatedRoute;\n this.location.insert(ref.hostView);\n this.inputBinder?.bindActivatedRouteToOutletComponent(this);\n this.attachEvents.emit(ref.instance);\n }\n deactivate() {\n if (this.activated) {\n const c = this.component;\n this.activated.destroy();\n this.activated = null;\n this._activatedRoute = null;\n this.deactivateEvents.emit(c);\n }\n }\n activateWith(activatedRoute, environmentInjector) {\n if (this.isActivated) {\n throw new ɵRuntimeError(4013 /* RuntimeErrorCode.OUTLET_ALREADY_ACTIVATED */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n 'Cannot activate an already activated outlet');\n }\n this._activatedRoute = activatedRoute;\n const location = this.location;\n const snapshot = activatedRoute.snapshot;\n const component = snapshot.component;\n const childContexts = this.parentContexts.getOrCreateContext(this.name).children;\n const injector = new OutletInjector(activatedRoute, childContexts, location.injector, this.routerOutletData);\n this.activated = location.createComponent(component, {\n index: location.length,\n injector,\n environmentInjector: environmentInjector,\n });\n // Calling `markForCheck` to make sure we will run the change detection when the\n // `RouterOutlet` is inside a `ChangeDetectionStrategy.OnPush` component.\n this.changeDetector.markForCheck();\n this.inputBinder?.bindActivatedRouteToOutletComponent(this);\n this.activateEvents.emit(this.activated.instance);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterOutlet, deps: [], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"17.1.0\", version: \"19.2.1\", type: RouterOutlet, isStandalone: true, selector: \"router-outlet\", inputs: { name: { classPropertyName: \"name\", publicName: \"name\", isSignal: false, isRequired: false, transformFunction: null }, routerOutletData: { classPropertyName: \"routerOutletData\", publicName: \"routerOutletData\", isSignal: true, isRequired: false, transformFunction: null } }, outputs: { activateEvents: \"activate\", deactivateEvents: \"deactivate\", attachEvents: \"attach\", detachEvents: \"detach\" }, exportAs: [\"outlet\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: 'router-outlet',\n exportAs: 'outlet',\n }]\n }], propDecorators: { name: [{\n type: Input\n }], activateEvents: [{\n type: Output,\n args: ['activate']\n }], deactivateEvents: [{\n type: Output,\n args: ['deactivate']\n }], attachEvents: [{\n type: Output,\n args: ['attach']\n }], detachEvents: [{\n type: Output,\n args: ['detach']\n }] } });\nclass OutletInjector {\n route;\n childContexts;\n parent;\n outletData;\n /**\n * This injector has a special handing for the `ActivatedRoute` and\n * `ChildrenOutletContexts` tokens: it returns corresponding values for those\n * tokens dynamically. This behavior is different from the regular injector logic,\n * when we initialize and store a value, which is later returned for all inject\n * requests.\n *\n * In some cases (e.g. when using `@defer`), this dynamic behavior requires special\n * handling. This function allows to identify an instance of the `OutletInjector` and\n * create an instance of it without referring to the class itself (so this logic can\n * be invoked from the `core` package). This helps to retain dynamic behavior for the\n * mentioned tokens.\n *\n * Note: it's a temporary solution and we should explore how to support this case better.\n */\n __ngOutletInjector(parentInjector) {\n return new OutletInjector(this.route, this.childContexts, parentInjector, this.outletData);\n }\n constructor(route, childContexts, parent, outletData) {\n this.route = route;\n this.childContexts = childContexts;\n this.parent = parent;\n this.outletData = outletData;\n }\n get(token, notFoundValue) {\n if (token === ActivatedRoute) {\n return this.route;\n }\n if (token === ChildrenOutletContexts) {\n return this.childContexts;\n }\n if (token === ROUTER_OUTLET_DATA) {\n return this.outletData;\n }\n return this.parent.get(token, notFoundValue);\n }\n}\nconst INPUT_BINDER = new InjectionToken('');\n/**\n * Injectable used as a tree-shakable provider for opting in to binding router data to component\n * inputs.\n *\n * The RouterOutlet registers itself with this service when an `ActivatedRoute` is attached or\n * activated. When this happens, the service subscribes to the `ActivatedRoute` observables (params,\n * queryParams, data) and sets the inputs of the component using `ComponentRef.setInput`.\n * Importantly, when an input does not have an item in the route data with a matching key, this\n * input is set to `undefined`. If it were not done this way, the previous information would be\n * retained if the data got removed from the route (i.e. if a query parameter is removed).\n *\n * The `RouterOutlet` should unregister itself when destroyed via `unsubscribeFromRouteData` so that\n * the subscriptions are cleaned up.\n */\nclass RoutedComponentInputBinder {\n outletDataSubscriptions = new Map();\n bindActivatedRouteToOutletComponent(outlet) {\n this.unsubscribeFromRouteData(outlet);\n this.subscribeToRouteData(outlet);\n }\n unsubscribeFromRouteData(outlet) {\n this.outletDataSubscriptions.get(outlet)?.unsubscribe();\n this.outletDataSubscriptions.delete(outlet);\n }\n subscribeToRouteData(outlet) {\n const { activatedRoute } = outlet;\n const dataSubscription = combineLatest([\n activatedRoute.queryParams,\n activatedRoute.params,\n activatedRoute.data,\n ])\n .pipe(switchMap(([queryParams, params, data], index) => {\n data = { ...queryParams, ...params, ...data };\n // Get the first result from the data subscription synchronously so it's available to\n // the component as soon as possible (and doesn't require a second change detection).\n if (index === 0) {\n return of(data);\n }\n // Promise.resolve is used to avoid synchronously writing the wrong data when\n // two of the Observables in the `combineLatest` stream emit one after\n // another.\n return Promise.resolve(data);\n }))\n .subscribe((data) => {\n // Outlet may have been deactivated or changed names to be associated with a different\n // route\n if (!outlet.isActivated ||\n !outlet.activatedComponentRef ||\n outlet.activatedRoute !== activatedRoute ||\n activatedRoute.component === null) {\n this.unsubscribeFromRouteData(outlet);\n return;\n }\n const mirror = reflectComponentType(activatedRoute.component);\n if (!mirror) {\n this.unsubscribeFromRouteData(outlet);\n return;\n }\n for (const { templateName } of mirror.inputs) {\n outlet.activatedComponentRef.setInput(templateName, data[templateName]);\n }\n });\n this.outletDataSubscriptions.set(outlet, dataSubscription);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RoutedComponentInputBinder, decorators: [{\n type: Injectable\n }] });\n\nfunction createRouterState(routeReuseStrategy, curr, prevState) {\n const root = createNode(routeReuseStrategy, curr._root, prevState ? prevState._root : undefined);\n return new RouterState(root, curr);\n}\nfunction createNode(routeReuseStrategy, curr, prevState) {\n // reuse an activated route that is currently displayed on the screen\n if (prevState && routeReuseStrategy.shouldReuseRoute(curr.value, prevState.value.snapshot)) {\n const value = prevState.value;\n value._futureSnapshot = curr.value;\n const children = createOrReuseChildren(routeReuseStrategy, curr, prevState);\n return new TreeNode(value, children);\n }\n else {\n if (routeReuseStrategy.shouldAttach(curr.value)) {\n // retrieve an activated route that is used to be displayed, but is not currently displayed\n const detachedRouteHandle = routeReuseStrategy.retrieve(curr.value);\n if (detachedRouteHandle !== null) {\n const tree = detachedRouteHandle.route;\n tree.value._futureSnapshot = curr.value;\n tree.children = curr.children.map((c) => createNode(routeReuseStrategy, c));\n return tree;\n }\n }\n const value = createActivatedRoute(curr.value);\n const children = curr.children.map((c) => createNode(routeReuseStrategy, c));\n return new TreeNode(value, children);\n }\n}\nfunction createOrReuseChildren(routeReuseStrategy, curr, prevState) {\n return curr.children.map((child) => {\n for (const p of prevState.children) {\n if (routeReuseStrategy.shouldReuseRoute(child.value, p.value.snapshot)) {\n return createNode(routeReuseStrategy, child, p);\n }\n }\n return createNode(routeReuseStrategy, child);\n });\n}\nfunction createActivatedRoute(c) {\n return new ActivatedRoute(new BehaviorSubject(c.url), new BehaviorSubject(c.params), new BehaviorSubject(c.queryParams), new BehaviorSubject(c.fragment), new BehaviorSubject(c.data), c.outlet, c.component, c);\n}\n\n/**\n * Can be returned by a `Router` guard to instruct the `Router` to redirect rather than continue\n * processing the path of the in-flight navigation. The `redirectTo` indicates _where_ the new\n * navigation should go to and the optional `navigationBehaviorOptions` can provide more information\n * about _how_ to perform the navigation.\n *\n * ```ts\n * const route: Route = {\n * path: \"user/:userId\",\n * component: User,\n * canActivate: [\n * () => {\n * const router = inject(Router);\n * const authService = inject(AuthenticationService);\n *\n * if (!authService.isLoggedIn()) {\n * const loginPath = router.parseUrl(\"/login\");\n * return new RedirectCommand(loginPath, {\n * skipLocationChange: \"true\",\n * });\n * }\n *\n * return true;\n * },\n * ],\n * };\n * ```\n * @see [Routing guide](guide/routing/common-router-tasks#preventing-unauthorized-access)\n *\n * @publicApi\n */\nclass RedirectCommand {\n redirectTo;\n navigationBehaviorOptions;\n constructor(redirectTo, navigationBehaviorOptions) {\n this.redirectTo = redirectTo;\n this.navigationBehaviorOptions = navigationBehaviorOptions;\n }\n}\n\nconst NAVIGATION_CANCELING_ERROR = 'ngNavigationCancelingError';\nfunction redirectingNavigationError(urlSerializer, redirect) {\n const { redirectTo, navigationBehaviorOptions } = isUrlTree(redirect)\n ? { redirectTo: redirect, navigationBehaviorOptions: undefined }\n : redirect;\n const error = navigationCancelingError(ngDevMode && `Redirecting to \"${urlSerializer.serialize(redirectTo)}\"`, NavigationCancellationCode.Redirect);\n error.url = redirectTo;\n error.navigationBehaviorOptions = navigationBehaviorOptions;\n return error;\n}\nfunction navigationCancelingError(message, code) {\n const error = new Error(`NavigationCancelingError: ${message || ''}`);\n error[NAVIGATION_CANCELING_ERROR] = true;\n error.cancellationCode = code;\n return error;\n}\nfunction isRedirectingNavigationCancelingError(error) {\n return (isNavigationCancelingError(error) &&\n isUrlTree(error.url));\n}\nfunction isNavigationCancelingError(error) {\n return !!error && error[NAVIGATION_CANCELING_ERROR];\n}\n\nlet warnedAboutUnsupportedInputBinding = false;\nconst activateRoutes = (rootContexts, routeReuseStrategy, forwardEvent, inputBindingEnabled) => map((t) => {\n new ActivateRoutes(routeReuseStrategy, t.targetRouterState, t.currentRouterState, forwardEvent, inputBindingEnabled).activate(rootContexts);\n return t;\n});\nclass ActivateRoutes {\n routeReuseStrategy;\n futureState;\n currState;\n forwardEvent;\n inputBindingEnabled;\n constructor(routeReuseStrategy, futureState, currState, forwardEvent, inputBindingEnabled) {\n this.routeReuseStrategy = routeReuseStrategy;\n this.futureState = futureState;\n this.currState = currState;\n this.forwardEvent = forwardEvent;\n this.inputBindingEnabled = inputBindingEnabled;\n }\n activate(parentContexts) {\n const futureRoot = this.futureState._root;\n const currRoot = this.currState ? this.currState._root : null;\n this.deactivateChildRoutes(futureRoot, currRoot, parentContexts);\n advanceActivatedRoute(this.futureState.root);\n this.activateChildRoutes(futureRoot, currRoot, parentContexts);\n }\n // De-activate the child route that are not re-used for the future state\n deactivateChildRoutes(futureNode, currNode, contexts) {\n const children = nodeChildrenAsMap(currNode);\n // Recurse on the routes active in the future state to de-activate deeper children\n futureNode.children.forEach((futureChild) => {\n const childOutletName = futureChild.value.outlet;\n this.deactivateRoutes(futureChild, children[childOutletName], contexts);\n delete children[childOutletName];\n });\n // De-activate the routes that will not be re-used\n Object.values(children).forEach((v) => {\n this.deactivateRouteAndItsChildren(v, contexts);\n });\n }\n deactivateRoutes(futureNode, currNode, parentContext) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n if (future === curr) {\n // Reusing the node, check to see if the children need to be de-activated\n if (future.component) {\n // If we have a normal route, we need to go through an outlet.\n const context = parentContext.getContext(future.outlet);\n if (context) {\n this.deactivateChildRoutes(futureNode, currNode, context.children);\n }\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.deactivateChildRoutes(futureNode, currNode, parentContext);\n }\n }\n else {\n if (curr) {\n // Deactivate the current route which will not be re-used\n this.deactivateRouteAndItsChildren(currNode, parentContext);\n }\n }\n }\n deactivateRouteAndItsChildren(route, parentContexts) {\n // If there is no component, the Route is never attached to an outlet (because there is no\n // component to attach).\n if (route.value.component && this.routeReuseStrategy.shouldDetach(route.value.snapshot)) {\n this.detachAndStoreRouteSubtree(route, parentContexts);\n }\n else {\n this.deactivateRouteAndOutlet(route, parentContexts);\n }\n }\n detachAndStoreRouteSubtree(route, parentContexts) {\n const context = parentContexts.getContext(route.value.outlet);\n const contexts = context && route.value.component ? context.children : parentContexts;\n const children = nodeChildrenAsMap(route);\n for (const treeNode of Object.values(children)) {\n this.deactivateRouteAndItsChildren(treeNode, contexts);\n }\n if (context && context.outlet) {\n const componentRef = context.outlet.detach();\n const contexts = context.children.onOutletDeactivated();\n this.routeReuseStrategy.store(route.value.snapshot, { componentRef, route, contexts });\n }\n }\n deactivateRouteAndOutlet(route, parentContexts) {\n const context = parentContexts.getContext(route.value.outlet);\n // The context could be `null` if we are on a componentless route but there may still be\n // children that need deactivating.\n const contexts = context && route.value.component ? context.children : parentContexts;\n const children = nodeChildrenAsMap(route);\n for (const treeNode of Object.values(children)) {\n this.deactivateRouteAndItsChildren(treeNode, contexts);\n }\n if (context) {\n if (context.outlet) {\n // Destroy the component\n context.outlet.deactivate();\n // Destroy the contexts for all the outlets that were in the component\n context.children.onOutletDeactivated();\n }\n // Clear the information about the attached component on the context but keep the reference to\n // the outlet. Clear even if outlet was not yet activated to avoid activating later with old\n // info\n context.attachRef = null;\n context.route = null;\n }\n }\n activateChildRoutes(futureNode, currNode, contexts) {\n const children = nodeChildrenAsMap(currNode);\n futureNode.children.forEach((c) => {\n this.activateRoutes(c, children[c.value.outlet], contexts);\n this.forwardEvent(new ActivationEnd(c.value.snapshot));\n });\n if (futureNode.children.length) {\n this.forwardEvent(new ChildActivationEnd(futureNode.value.snapshot));\n }\n }\n activateRoutes(futureNode, currNode, parentContexts) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n advanceActivatedRoute(future);\n // reusing the node\n if (future === curr) {\n if (future.component) {\n // If we have a normal route, we need to go through an outlet.\n const context = parentContexts.getOrCreateContext(future.outlet);\n this.activateChildRoutes(futureNode, currNode, context.children);\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.activateChildRoutes(futureNode, currNode, parentContexts);\n }\n }\n else {\n if (future.component) {\n // if we have a normal route, we need to place the component into the outlet and recurse.\n const context = parentContexts.getOrCreateContext(future.outlet);\n if (this.routeReuseStrategy.shouldAttach(future.snapshot)) {\n const stored = (this.routeReuseStrategy.retrieve(future.snapshot));\n this.routeReuseStrategy.store(future.snapshot, null);\n context.children.onOutletReAttached(stored.contexts);\n context.attachRef = stored.componentRef;\n context.route = stored.route.value;\n if (context.outlet) {\n // Attach right away when the outlet has already been instantiated\n // Otherwise attach from `RouterOutlet.ngOnInit` when it is instantiated\n context.outlet.attach(stored.componentRef, stored.route.value);\n }\n advanceActivatedRoute(stored.route.value);\n this.activateChildRoutes(futureNode, null, context.children);\n }\n else {\n context.attachRef = null;\n context.route = future;\n if (context.outlet) {\n // Activate the outlet when it has already been instantiated\n // Otherwise it will get activated from its `ngOnInit` when instantiated\n context.outlet.activateWith(future, context.injector);\n }\n this.activateChildRoutes(futureNode, null, context.children);\n }\n }\n else {\n // if we have a componentless route, we recurse but keep the same outlet map.\n this.activateChildRoutes(futureNode, null, parentContexts);\n }\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n const context = parentContexts.getOrCreateContext(future.outlet);\n const outlet = context.outlet;\n if (outlet &&\n this.inputBindingEnabled &&\n !outlet.supportsBindingToComponentInputs &&\n !warnedAboutUnsupportedInputBinding) {\n console.warn(`'withComponentInputBinding' feature is enabled but ` +\n `this application is using an outlet that may not support binding to component inputs.`);\n warnedAboutUnsupportedInputBinding = true;\n }\n }\n }\n}\n\nclass CanActivate {\n path;\n route;\n constructor(path) {\n this.path = path;\n this.route = this.path[this.path.length - 1];\n }\n}\nclass CanDeactivate {\n component;\n route;\n constructor(component, route) {\n this.component = component;\n this.route = route;\n }\n}\nfunction getAllRouteGuards(future, curr, parentContexts) {\n const futureRoot = future._root;\n const currRoot = curr ? curr._root : null;\n return getChildRouteGuards(futureRoot, currRoot, parentContexts, [futureRoot.value]);\n}\nfunction getCanActivateChild(p) {\n const canActivateChild = p.routeConfig ? p.routeConfig.canActivateChild : null;\n if (!canActivateChild || canActivateChild.length === 0)\n return null;\n return { node: p, guards: canActivateChild };\n}\nfunction getTokenOrFunctionIdentity(tokenOrFunction, injector) {\n const NOT_FOUND = Symbol();\n const result = injector.get(tokenOrFunction, NOT_FOUND);\n if (result === NOT_FOUND) {\n if (typeof tokenOrFunction === 'function' && !ɵisInjectable(tokenOrFunction)) {\n // We think the token is just a function so return it as-is\n return tokenOrFunction;\n }\n else {\n // This will throw the not found error\n return injector.get(tokenOrFunction);\n }\n }\n return result;\n}\nfunction getChildRouteGuards(futureNode, currNode, contexts, futurePath, checks = {\n canDeactivateChecks: [],\n canActivateChecks: [],\n}) {\n const prevChildren = nodeChildrenAsMap(currNode);\n // Process the children of the future route\n futureNode.children.forEach((c) => {\n getRouteGuards(c, prevChildren[c.value.outlet], contexts, futurePath.concat([c.value]), checks);\n delete prevChildren[c.value.outlet];\n });\n // Process any children left from the current route (not active for the future route)\n Object.entries(prevChildren).forEach(([k, v]) => deactivateRouteAndItsChildren(v, contexts.getContext(k), checks));\n return checks;\n}\nfunction getRouteGuards(futureNode, currNode, parentContexts, futurePath, checks = {\n canDeactivateChecks: [],\n canActivateChecks: [],\n}) {\n const future = futureNode.value;\n const curr = currNode ? currNode.value : null;\n const context = parentContexts ? parentContexts.getContext(futureNode.value.outlet) : null;\n // reusing the node\n if (curr && future.routeConfig === curr.routeConfig) {\n const shouldRun = shouldRunGuardsAndResolvers(curr, future, future.routeConfig.runGuardsAndResolvers);\n if (shouldRun) {\n checks.canActivateChecks.push(new CanActivate(futurePath));\n }\n else {\n // we need to set the data\n future.data = curr.data;\n future._resolvedData = curr._resolvedData;\n }\n // If we have a component, we need to go through an outlet.\n if (future.component) {\n getChildRouteGuards(futureNode, currNode, context ? context.children : null, futurePath, checks);\n // if we have a componentless route, we recurse but keep the same outlet map.\n }\n else {\n getChildRouteGuards(futureNode, currNode, parentContexts, futurePath, checks);\n }\n if (shouldRun && context && context.outlet && context.outlet.isActivated) {\n checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, curr));\n }\n }\n else {\n if (curr) {\n deactivateRouteAndItsChildren(currNode, context, checks);\n }\n checks.canActivateChecks.push(new CanActivate(futurePath));\n // If we have a component, we need to go through an outlet.\n if (future.component) {\n getChildRouteGuards(futureNode, null, context ? context.children : null, futurePath, checks);\n // if we have a componentless route, we recurse but keep the same outlet map.\n }\n else {\n getChildRouteGuards(futureNode, null, parentContexts, futurePath, checks);\n }\n }\n return checks;\n}\nfunction shouldRunGuardsAndResolvers(curr, future, mode) {\n if (typeof mode === 'function') {\n return mode(curr, future);\n }\n switch (mode) {\n case 'pathParamsChange':\n return !equalPath(curr.url, future.url);\n case 'pathParamsOrQueryParamsChange':\n return (!equalPath(curr.url, future.url) || !shallowEqual(curr.queryParams, future.queryParams));\n case 'always':\n return true;\n case 'paramsOrQueryParamsChange':\n return (!equalParamsAndUrlSegments(curr, future) ||\n !shallowEqual(curr.queryParams, future.queryParams));\n case 'paramsChange':\n default:\n return !equalParamsAndUrlSegments(curr, future);\n }\n}\nfunction deactivateRouteAndItsChildren(route, context, checks) {\n const children = nodeChildrenAsMap(route);\n const r = route.value;\n Object.entries(children).forEach(([childName, node]) => {\n if (!r.component) {\n deactivateRouteAndItsChildren(node, context, checks);\n }\n else if (context) {\n deactivateRouteAndItsChildren(node, context.children.getContext(childName), checks);\n }\n else {\n deactivateRouteAndItsChildren(node, null, checks);\n }\n });\n if (!r.component) {\n checks.canDeactivateChecks.push(new CanDeactivate(null, r));\n }\n else if (context && context.outlet && context.outlet.isActivated) {\n checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, r));\n }\n else {\n checks.canDeactivateChecks.push(new CanDeactivate(null, r));\n }\n}\n\n/**\n * Simple function check, but generic so type inference will flow. Example:\n *\n * function product(a: number, b: number) {\n * return a * b;\n * }\n *\n * if (isFunction(fn)) {\n * return fn(1, 2);\n * } else {\n * throw \"Must provide the `product` function\";\n * }\n */\nfunction isFunction(v) {\n return typeof v === 'function';\n}\nfunction isBoolean(v) {\n return typeof v === 'boolean';\n}\nfunction isCanLoad(guard) {\n return guard && isFunction(guard.canLoad);\n}\nfunction isCanActivate(guard) {\n return guard && isFunction(guard.canActivate);\n}\nfunction isCanActivateChild(guard) {\n return guard && isFunction(guard.canActivateChild);\n}\nfunction isCanDeactivate(guard) {\n return guard && isFunction(guard.canDeactivate);\n}\nfunction isCanMatch(guard) {\n return guard && isFunction(guard.canMatch);\n}\nfunction isEmptyError(e) {\n return e instanceof EmptyError || e?.name === 'EmptyError';\n}\n\nconst INITIAL_VALUE = /* @__PURE__ */ Symbol('INITIAL_VALUE');\nfunction prioritizedGuardValue() {\n return switchMap((obs) => {\n return combineLatest(obs.map((o) => o.pipe(take(1), startWith(INITIAL_VALUE)))).pipe(map((results) => {\n for (const result of results) {\n if (result === true) {\n // If result is true, check the next one\n continue;\n }\n else if (result === INITIAL_VALUE) {\n // If guard has not finished, we need to stop processing.\n return INITIAL_VALUE;\n }\n else if (result === false || isRedirect(result)) {\n // Result finished and was not true. Return the result.\n // Note that we only allow false/UrlTree/RedirectCommand. Other values are considered invalid and\n // ignored.\n return result;\n }\n }\n // Everything resolved to true. Return true.\n return true;\n }), filter((item) => item !== INITIAL_VALUE), take(1));\n });\n}\nfunction isRedirect(val) {\n return isUrlTree(val) || val instanceof RedirectCommand;\n}\n\nfunction checkGuards(injector, forwardEvent) {\n return mergeMap((t) => {\n const { targetSnapshot, currentSnapshot, guards: { canActivateChecks, canDeactivateChecks }, } = t;\n if (canDeactivateChecks.length === 0 && canActivateChecks.length === 0) {\n return of({ ...t, guardsResult: true });\n }\n return runCanDeactivateChecks(canDeactivateChecks, targetSnapshot, currentSnapshot, injector).pipe(mergeMap((canDeactivate) => {\n return canDeactivate && isBoolean(canDeactivate)\n ? runCanActivateChecks(targetSnapshot, canActivateChecks, injector, forwardEvent)\n : of(canDeactivate);\n }), map((guardsResult) => ({ ...t, guardsResult })));\n });\n}\nfunction runCanDeactivateChecks(checks, futureRSS, currRSS, injector) {\n return from(checks).pipe(mergeMap((check) => runCanDeactivate(check.component, check.route, currRSS, futureRSS, injector)), first((result) => {\n return result !== true;\n }, true));\n}\nfunction runCanActivateChecks(futureSnapshot, checks, injector, forwardEvent) {\n return from(checks).pipe(concatMap((check) => {\n return concat(fireChildActivationStart(check.route.parent, forwardEvent), fireActivationStart(check.route, forwardEvent), runCanActivateChild(futureSnapshot, check.path, injector), runCanActivate(futureSnapshot, check.route, injector));\n }), first((result) => {\n return result !== true;\n }, true));\n}\n/**\n * This should fire off `ActivationStart` events for each route being activated at this\n * level.\n * In other words, if you're activating `a` and `b` below, `path` will contain the\n * `ActivatedRouteSnapshot`s for both and we will fire `ActivationStart` for both. Always\n * return\n * `true` so checks continue to run.\n */\nfunction fireActivationStart(snapshot, forwardEvent) {\n if (snapshot !== null && forwardEvent) {\n forwardEvent(new ActivationStart(snapshot));\n }\n return of(true);\n}\n/**\n * This should fire off `ChildActivationStart` events for each route being activated at this\n * level.\n * In other words, if you're activating `a` and `b` below, `path` will contain the\n * `ActivatedRouteSnapshot`s for both and we will fire `ChildActivationStart` for both. Always\n * return\n * `true` so checks continue to run.\n */\nfunction fireChildActivationStart(snapshot, forwardEvent) {\n if (snapshot !== null && forwardEvent) {\n forwardEvent(new ChildActivationStart(snapshot));\n }\n return of(true);\n}\nfunction runCanActivate(futureRSS, futureARS, injector) {\n const canActivate = futureARS.routeConfig ? futureARS.routeConfig.canActivate : null;\n if (!canActivate || canActivate.length === 0)\n return of(true);\n const canActivateObservables = canActivate.map((canActivate) => {\n return defer(() => {\n const closestInjector = getClosestRouteInjector(futureARS) ?? injector;\n const guard = getTokenOrFunctionIdentity(canActivate, closestInjector);\n const guardVal = isCanActivate(guard)\n ? guard.canActivate(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n });\n return of(canActivateObservables).pipe(prioritizedGuardValue());\n}\nfunction runCanActivateChild(futureRSS, path, injector) {\n const futureARS = path[path.length - 1];\n const canActivateChildGuards = path\n .slice(0, path.length - 1)\n .reverse()\n .map((p) => getCanActivateChild(p))\n .filter((_) => _ !== null);\n const canActivateChildGuardsMapped = canActivateChildGuards.map((d) => {\n return defer(() => {\n const guardsMapped = d.guards.map((canActivateChild) => {\n const closestInjector = getClosestRouteInjector(d.node) ?? injector;\n const guard = getTokenOrFunctionIdentity(canActivateChild, closestInjector);\n const guardVal = isCanActivateChild(guard)\n ? guard.canActivateChild(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n return of(guardsMapped).pipe(prioritizedGuardValue());\n });\n });\n return of(canActivateChildGuardsMapped).pipe(prioritizedGuardValue());\n}\nfunction runCanDeactivate(component, currARS, currRSS, futureRSS, injector) {\n const canDeactivate = currARS && currARS.routeConfig ? currARS.routeConfig.canDeactivate : null;\n if (!canDeactivate || canDeactivate.length === 0)\n return of(true);\n const canDeactivateObservables = canDeactivate.map((c) => {\n const closestInjector = getClosestRouteInjector(currARS) ?? injector;\n const guard = getTokenOrFunctionIdentity(c, closestInjector);\n const guardVal = isCanDeactivate(guard)\n ? guard.canDeactivate(component, currARS, currRSS, futureRSS)\n : runInInjectionContext(closestInjector, () => guard(component, currARS, currRSS, futureRSS));\n return wrapIntoObservable(guardVal).pipe(first());\n });\n return of(canDeactivateObservables).pipe(prioritizedGuardValue());\n}\nfunction runCanLoadGuards(injector, route, segments, urlSerializer) {\n const canLoad = route.canLoad;\n if (canLoad === undefined || canLoad.length === 0) {\n return of(true);\n }\n const canLoadObservables = canLoad.map((injectionToken) => {\n const guard = getTokenOrFunctionIdentity(injectionToken, injector);\n const guardVal = isCanLoad(guard)\n ? guard.canLoad(route, segments)\n : runInInjectionContext(injector, () => guard(route, segments));\n return wrapIntoObservable(guardVal);\n });\n return of(canLoadObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));\n}\nfunction redirectIfUrlTree(urlSerializer) {\n return pipe(tap((result) => {\n if (typeof result === 'boolean')\n return;\n throw redirectingNavigationError(urlSerializer, result);\n }), map((result) => result === true));\n}\nfunction runCanMatchGuards(injector, route, segments, urlSerializer) {\n const canMatch = route.canMatch;\n if (!canMatch || canMatch.length === 0)\n return of(true);\n const canMatchObservables = canMatch.map((injectionToken) => {\n const guard = getTokenOrFunctionIdentity(injectionToken, injector);\n const guardVal = isCanMatch(guard)\n ? guard.canMatch(route, segments)\n : runInInjectionContext(injector, () => guard(route, segments));\n return wrapIntoObservable(guardVal);\n });\n return of(canMatchObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));\n}\n\nclass NoMatch {\n segmentGroup;\n constructor(segmentGroup) {\n this.segmentGroup = segmentGroup || null;\n }\n}\nclass AbsoluteRedirect extends Error {\n urlTree;\n constructor(urlTree) {\n super();\n this.urlTree = urlTree;\n }\n}\nfunction noMatch$1(segmentGroup) {\n return throwError(new NoMatch(segmentGroup));\n}\nfunction absoluteRedirect(newTree) {\n return throwError(new AbsoluteRedirect(newTree));\n}\nfunction namedOutletsRedirect(redirectTo) {\n return throwError(new ɵRuntimeError(4000 /* RuntimeErrorCode.NAMED_OUTLET_REDIRECT */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Only absolute redirects can have named outlets. redirectTo: '${redirectTo}'`));\n}\nfunction canLoadFails(route) {\n return throwError(navigationCancelingError((typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Cannot load children because the guard of the route \"path: '${route.path}'\" returned false`, NavigationCancellationCode.GuardRejected));\n}\nclass ApplyRedirects {\n urlSerializer;\n urlTree;\n constructor(urlSerializer, urlTree) {\n this.urlSerializer = urlSerializer;\n this.urlTree = urlTree;\n }\n lineralizeSegments(route, urlTree) {\n let res = [];\n let c = urlTree.root;\n while (true) {\n res = res.concat(c.segments);\n if (c.numberOfChildren === 0) {\n return of(res);\n }\n if (c.numberOfChildren > 1 || !c.children[PRIMARY_OUTLET]) {\n return namedOutletsRedirect(`${route.redirectTo}`);\n }\n c = c.children[PRIMARY_OUTLET];\n }\n }\n applyRedirectCommands(segments, redirectTo, posParams, currentSnapshot, injector) {\n if (typeof redirectTo !== 'string') {\n const redirectToFn = redirectTo;\n const { queryParams, fragment, routeConfig, url, outlet, params, data, title } = currentSnapshot;\n const newRedirect = runInInjectionContext(injector, () => redirectToFn({ params, data, queryParams, fragment, routeConfig, url, outlet, title }));\n if (newRedirect instanceof UrlTree) {\n throw new AbsoluteRedirect(newRedirect);\n }\n redirectTo = newRedirect;\n }\n const newTree = this.applyRedirectCreateUrlTree(redirectTo, this.urlSerializer.parse(redirectTo), segments, posParams);\n if (redirectTo[0] === '/') {\n throw new AbsoluteRedirect(newTree);\n }\n return newTree;\n }\n applyRedirectCreateUrlTree(redirectTo, urlTree, segments, posParams) {\n const newRoot = this.createSegmentGroup(redirectTo, urlTree.root, segments, posParams);\n return new UrlTree(newRoot, this.createQueryParams(urlTree.queryParams, this.urlTree.queryParams), urlTree.fragment);\n }\n createQueryParams(redirectToParams, actualParams) {\n const res = {};\n Object.entries(redirectToParams).forEach(([k, v]) => {\n const copySourceValue = typeof v === 'string' && v[0] === ':';\n if (copySourceValue) {\n const sourceName = v.substring(1);\n res[k] = actualParams[sourceName];\n }\n else {\n res[k] = v;\n }\n });\n return res;\n }\n createSegmentGroup(redirectTo, group, segments, posParams) {\n const updatedSegments = this.createSegments(redirectTo, group.segments, segments, posParams);\n let children = {};\n Object.entries(group.children).forEach(([name, child]) => {\n children[name] = this.createSegmentGroup(redirectTo, child, segments, posParams);\n });\n return new UrlSegmentGroup(updatedSegments, children);\n }\n createSegments(redirectTo, redirectToSegments, actualSegments, posParams) {\n return redirectToSegments.map((s) => s.path[0] === ':'\n ? this.findPosParam(redirectTo, s, posParams)\n : this.findOrReturn(s, actualSegments));\n }\n findPosParam(redirectTo, redirectToUrlSegment, posParams) {\n const pos = posParams[redirectToUrlSegment.path.substring(1)];\n if (!pos)\n throw new ɵRuntimeError(4001 /* RuntimeErrorCode.MISSING_REDIRECT */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Cannot redirect to '${redirectTo}'. Cannot find '${redirectToUrlSegment.path}'.`);\n return pos;\n }\n findOrReturn(redirectToUrlSegment, actualSegments) {\n let idx = 0;\n for (const s of actualSegments) {\n if (s.path === redirectToUrlSegment.path) {\n actualSegments.splice(idx);\n return s;\n }\n idx++;\n }\n return redirectToUrlSegment;\n }\n}\n\nconst noMatch = {\n matched: false,\n consumedSegments: [],\n remainingSegments: [],\n parameters: {},\n positionalParamSegments: {},\n};\nfunction matchWithChecks(segmentGroup, route, segments, injector, urlSerializer) {\n const result = match(segmentGroup, route, segments);\n if (!result.matched) {\n return of(result);\n }\n // Only create the Route's `EnvironmentInjector` if it matches the attempted\n // navigation\n injector = getOrCreateRouteInjectorIfNeeded(route, injector);\n return runCanMatchGuards(injector, route, segments, urlSerializer).pipe(map((v) => (v === true ? result : { ...noMatch })));\n}\nfunction match(segmentGroup, route, segments) {\n if (route.path === '**') {\n return createWildcardMatchResult(segments);\n }\n if (route.path === '') {\n if (route.pathMatch === 'full' && (segmentGroup.hasChildren() || segments.length > 0)) {\n return { ...noMatch };\n }\n return {\n matched: true,\n consumedSegments: [],\n remainingSegments: segments,\n parameters: {},\n positionalParamSegments: {},\n };\n }\n const matcher = route.matcher || defaultUrlMatcher;\n const res = matcher(segments, segmentGroup, route);\n if (!res)\n return { ...noMatch };\n const posParams = {};\n Object.entries(res.posParams ?? {}).forEach(([k, v]) => {\n posParams[k] = v.path;\n });\n const parameters = res.consumed.length > 0\n ? { ...posParams, ...res.consumed[res.consumed.length - 1].parameters }\n : posParams;\n return {\n matched: true,\n consumedSegments: res.consumed,\n remainingSegments: segments.slice(res.consumed.length),\n // TODO(atscott): investigate combining parameters and positionalParamSegments\n parameters,\n positionalParamSegments: res.posParams ?? {},\n };\n}\nfunction createWildcardMatchResult(segments) {\n return {\n matched: true,\n parameters: segments.length > 0 ? last(segments).parameters : {},\n consumedSegments: segments,\n remainingSegments: [],\n positionalParamSegments: {},\n };\n}\nfunction split(segmentGroup, consumedSegments, slicedSegments, config) {\n if (slicedSegments.length > 0 &&\n containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, config)) {\n const s = new UrlSegmentGroup(consumedSegments, createChildrenForEmptyPaths(config, new UrlSegmentGroup(slicedSegments, segmentGroup.children)));\n return { segmentGroup: s, slicedSegments: [] };\n }\n if (slicedSegments.length === 0 &&\n containsEmptyPathMatches(segmentGroup, slicedSegments, config)) {\n const s = new UrlSegmentGroup(segmentGroup.segments, addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, config, segmentGroup.children));\n return { segmentGroup: s, slicedSegments };\n }\n const s = new UrlSegmentGroup(segmentGroup.segments, segmentGroup.children);\n return { segmentGroup: s, slicedSegments };\n}\nfunction addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, routes, children) {\n const res = {};\n for (const r of routes) {\n if (emptyPathMatch(segmentGroup, slicedSegments, r) && !children[getOutlet(r)]) {\n const s = new UrlSegmentGroup([], {});\n res[getOutlet(r)] = s;\n }\n }\n return { ...children, ...res };\n}\nfunction createChildrenForEmptyPaths(routes, primarySegment) {\n const res = {};\n res[PRIMARY_OUTLET] = primarySegment;\n for (const r of routes) {\n if (r.path === '' && getOutlet(r) !== PRIMARY_OUTLET) {\n const s = new UrlSegmentGroup([], {});\n res[getOutlet(r)] = s;\n }\n }\n return res;\n}\nfunction containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, routes) {\n return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r) && getOutlet(r) !== PRIMARY_OUTLET);\n}\nfunction containsEmptyPathMatches(segmentGroup, slicedSegments, routes) {\n return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r));\n}\nfunction emptyPathMatch(segmentGroup, slicedSegments, r) {\n if ((segmentGroup.hasChildren() || slicedSegments.length > 0) && r.pathMatch === 'full') {\n return false;\n }\n return r.path === '';\n}\nfunction noLeftoversInUrl(segmentGroup, segments, outlet) {\n return segments.length === 0 && !segmentGroup.children[outlet];\n}\n\n/**\n * Class used to indicate there were no additional route config matches but that all segments of\n * the URL were consumed during matching so the route was URL matched. When this happens, we still\n * try to match child configs in case there are empty path children.\n */\nclass NoLeftoversInUrl {\n}\nfunction recognize$1(injector, configLoader, rootComponentType, config, urlTree, urlSerializer, paramsInheritanceStrategy = 'emptyOnly') {\n return new Recognizer(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer).recognize();\n}\nconst MAX_ALLOWED_REDIRECTS = 31;\nclass Recognizer {\n injector;\n configLoader;\n rootComponentType;\n config;\n urlTree;\n paramsInheritanceStrategy;\n urlSerializer;\n applyRedirects;\n absoluteRedirectCount = 0;\n allowRedirects = true;\n constructor(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer) {\n this.injector = injector;\n this.configLoader = configLoader;\n this.rootComponentType = rootComponentType;\n this.config = config;\n this.urlTree = urlTree;\n this.paramsInheritanceStrategy = paramsInheritanceStrategy;\n this.urlSerializer = urlSerializer;\n this.applyRedirects = new ApplyRedirects(this.urlSerializer, this.urlTree);\n }\n noMatchError(e) {\n return new ɵRuntimeError(4002 /* RuntimeErrorCode.NO_MATCH */, typeof ngDevMode === 'undefined' || ngDevMode\n ? `Cannot match any routes. URL Segment: '${e.segmentGroup}'`\n : `'${e.segmentGroup}'`);\n }\n recognize() {\n const rootSegmentGroup = split(this.urlTree.root, [], [], this.config).segmentGroup;\n return this.match(rootSegmentGroup).pipe(map(({ children, rootSnapshot }) => {\n const rootNode = new TreeNode(rootSnapshot, children);\n const routeState = new RouterStateSnapshot('', rootNode);\n const tree = createUrlTreeFromSnapshot(rootSnapshot, [], this.urlTree.queryParams, this.urlTree.fragment);\n // https://github.com/angular/angular/issues/47307\n // Creating the tree stringifies the query params\n // We don't want to do this here so reassign them to the original.\n tree.queryParams = this.urlTree.queryParams;\n routeState.url = this.urlSerializer.serialize(tree);\n return { state: routeState, tree };\n }));\n }\n match(rootSegmentGroup) {\n // Use Object.freeze to prevent readers of the Router state from modifying it outside\n // of a navigation, resulting in the router being out of sync with the browser.\n const rootSnapshot = new ActivatedRouteSnapshot([], Object.freeze({}), Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, Object.freeze({}), PRIMARY_OUTLET, this.rootComponentType, null, {});\n return this.processSegmentGroup(this.injector, this.config, rootSegmentGroup, PRIMARY_OUTLET, rootSnapshot).pipe(map((children) => {\n return { children, rootSnapshot };\n }), catchError((e) => {\n if (e instanceof AbsoluteRedirect) {\n this.urlTree = e.urlTree;\n return this.match(e.urlTree.root);\n }\n if (e instanceof NoMatch) {\n throw this.noMatchError(e);\n }\n throw e;\n }));\n }\n processSegmentGroup(injector, config, segmentGroup, outlet, parentRoute) {\n if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {\n return this.processChildren(injector, config, segmentGroup, parentRoute);\n }\n return this.processSegment(injector, config, segmentGroup, segmentGroup.segments, outlet, true, parentRoute).pipe(map((child) => (child instanceof TreeNode ? [child] : [])));\n }\n /**\n * Matches every child outlet in the `segmentGroup` to a `Route` in the config. Returns `null` if\n * we cannot find a match for _any_ of the children.\n *\n * @param config - The `Routes` to match against\n * @param segmentGroup - The `UrlSegmentGroup` whose children need to be matched against the\n * config.\n */\n processChildren(injector, config, segmentGroup, parentRoute) {\n // Expand outlets one at a time, starting with the primary outlet. We need to do it this way\n // because an absolute redirect from the primary outlet takes precedence.\n const childOutlets = [];\n for (const child of Object.keys(segmentGroup.children)) {\n if (child === 'primary') {\n childOutlets.unshift(child);\n }\n else {\n childOutlets.push(child);\n }\n }\n return from(childOutlets).pipe(concatMap((childOutlet) => {\n const child = segmentGroup.children[childOutlet];\n // Sort the config so that routes with outlets that match the one being activated\n // appear first, followed by routes for other outlets, which might match if they have\n // an empty path.\n const sortedConfig = sortByMatchingOutlets(config, childOutlet);\n return this.processSegmentGroup(injector, sortedConfig, child, childOutlet, parentRoute);\n }), scan((children, outletChildren) => {\n children.push(...outletChildren);\n return children;\n }), defaultIfEmpty(null), last$1(), mergeMap((children) => {\n if (children === null)\n return noMatch$1(segmentGroup);\n // Because we may have matched two outlets to the same empty path segment, we can have\n // multiple activated results for the same outlet. We should merge the children of\n // these results so the final return value is only one `TreeNode` per outlet.\n const mergedChildren = mergeEmptyPathMatches(children);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n // This should really never happen - we are only taking the first match for each\n // outlet and merge the empty path matches.\n checkOutletNameUniqueness(mergedChildren);\n }\n sortActivatedRouteSnapshots(mergedChildren);\n return of(mergedChildren);\n }));\n }\n processSegment(injector, routes, segmentGroup, segments, outlet, allowRedirects, parentRoute) {\n return from(routes).pipe(concatMap((r) => {\n return this.processSegmentAgainstRoute(r._injector ?? injector, routes, r, segmentGroup, segments, outlet, allowRedirects, parentRoute).pipe(catchError((e) => {\n if (e instanceof NoMatch) {\n return of(null);\n }\n throw e;\n }));\n }), first((x) => !!x), catchError((e) => {\n if (isEmptyError(e)) {\n if (noLeftoversInUrl(segmentGroup, segments, outlet)) {\n return of(new NoLeftoversInUrl());\n }\n return noMatch$1(segmentGroup);\n }\n throw e;\n }));\n }\n processSegmentAgainstRoute(injector, routes, route, rawSegment, segments, outlet, allowRedirects, parentRoute) {\n // We allow matches to empty paths when the outlets differ so we can match a url like `/(b:b)` to\n // a config like\n // * `{path: '', children: [{path: 'b', outlet: 'b'}]}`\n // or even\n // * `{path: '', outlet: 'a', children: [{path: 'b', outlet: 'b'}]`\n //\n // The exception here is when the segment outlet is for the primary outlet. This would\n // result in a match inside the named outlet because all children there are written as primary\n // outlets. So we need to prevent child named outlet matches in a url like `/b` in a config like\n // * `{path: '', outlet: 'x' children: [{path: 'b'}]}`\n // This should only match if the url is `/(x:b)`.\n if (getOutlet(route) !== outlet &&\n (outlet === PRIMARY_OUTLET || !emptyPathMatch(rawSegment, segments, route))) {\n return noMatch$1(rawSegment);\n }\n if (route.redirectTo === undefined) {\n return this.matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute);\n }\n if (this.allowRedirects && allowRedirects) {\n return this.expandSegmentAgainstRouteUsingRedirect(injector, rawSegment, routes, route, segments, outlet, parentRoute);\n }\n return noMatch$1(rawSegment);\n }\n expandSegmentAgainstRouteUsingRedirect(injector, segmentGroup, routes, route, segments, outlet, parentRoute) {\n const { matched, parameters, consumedSegments, positionalParamSegments, remainingSegments } = match(segmentGroup, route, segments);\n if (!matched)\n return noMatch$1(segmentGroup);\n // TODO(atscott): Move all of this under an if(ngDevMode) as a breaking change and allow stack\n // size exceeded in production\n if (typeof route.redirectTo === 'string' && route.redirectTo[0] === '/') {\n this.absoluteRedirectCount++;\n if (this.absoluteRedirectCount > MAX_ALLOWED_REDIRECTS) {\n if (ngDevMode) {\n throw new ɵRuntimeError(4016 /* RuntimeErrorCode.INFINITE_REDIRECT */, `Detected possible infinite redirect when redirecting from '${this.urlTree}' to '${route.redirectTo}'.\\n` +\n `This is currently a dev mode only error but will become a` +\n ` call stack size exceeded error in production in a future major version.`);\n }\n this.allowRedirects = false;\n }\n }\n const currentSnapshot = new ActivatedRouteSnapshot(segments, parameters, Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));\n const inherited = getInherited(currentSnapshot, parentRoute, this.paramsInheritanceStrategy);\n currentSnapshot.params = Object.freeze(inherited.params);\n currentSnapshot.data = Object.freeze(inherited.data);\n const newTree = this.applyRedirects.applyRedirectCommands(consumedSegments, route.redirectTo, positionalParamSegments, currentSnapshot, injector);\n return this.applyRedirects.lineralizeSegments(route, newTree).pipe(mergeMap((newSegments) => {\n return this.processSegment(injector, routes, segmentGroup, newSegments.concat(remainingSegments), outlet, false, parentRoute);\n }));\n }\n matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute) {\n const matchResult = matchWithChecks(rawSegment, route, segments, injector, this.urlSerializer);\n if (route.path === '**') {\n // Prior versions of the route matching algorithm would stop matching at the wildcard route.\n // We should investigate a better strategy for any existing children. Otherwise, these\n // child segments are silently dropped from the navigation.\n // https://github.com/angular/angular/issues/40089\n rawSegment.children = {};\n }\n return matchResult.pipe(switchMap((result) => {\n if (!result.matched) {\n return noMatch$1(rawSegment);\n }\n // If the route has an injector created from providers, we should start using that.\n injector = route._injector ?? injector;\n return this.getChildConfig(injector, route, segments).pipe(switchMap(({ routes: childConfig }) => {\n const childInjector = route._loadedInjector ?? injector;\n const { parameters, consumedSegments, remainingSegments } = result;\n const snapshot = new ActivatedRouteSnapshot(consumedSegments, parameters, Object.freeze({ ...this.urlTree.queryParams }), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));\n const inherited = getInherited(snapshot, parentRoute, this.paramsInheritanceStrategy);\n snapshot.params = Object.freeze(inherited.params);\n snapshot.data = Object.freeze(inherited.data);\n const { segmentGroup, slicedSegments } = split(rawSegment, consumedSegments, remainingSegments, childConfig);\n if (slicedSegments.length === 0 && segmentGroup.hasChildren()) {\n return this.processChildren(childInjector, childConfig, segmentGroup, snapshot).pipe(map((children) => {\n return new TreeNode(snapshot, children);\n }));\n }\n if (childConfig.length === 0 && slicedSegments.length === 0) {\n return of(new TreeNode(snapshot, []));\n }\n const matchedOnOutlet = getOutlet(route) === outlet;\n // If we matched a config due to empty path match on a different outlet, we need to\n // continue passing the current outlet for the segment rather than switch to PRIMARY.\n // Note that we switch to primary when we have a match because outlet configs look like\n // this: {path: 'a', outlet: 'a', children: [\n // {path: 'b', component: B},\n // {path: 'c', component: C},\n // ]}\n // Notice that the children of the named outlet are configured with the primary outlet\n return this.processSegment(childInjector, childConfig, segmentGroup, slicedSegments, matchedOnOutlet ? PRIMARY_OUTLET : outlet, true, snapshot).pipe(map((child) => {\n return new TreeNode(snapshot, child instanceof TreeNode ? [child] : []);\n }));\n }));\n }));\n }\n getChildConfig(injector, route, segments) {\n if (route.children) {\n // The children belong to the same module\n return of({ routes: route.children, injector });\n }\n if (route.loadChildren) {\n // lazy children belong to the loaded module\n if (route._loadedRoutes !== undefined) {\n return of({ routes: route._loadedRoutes, injector: route._loadedInjector });\n }\n return runCanLoadGuards(injector, route, segments, this.urlSerializer).pipe(mergeMap((shouldLoadResult) => {\n if (shouldLoadResult) {\n return this.configLoader.loadChildren(injector, route).pipe(tap((cfg) => {\n route._loadedRoutes = cfg.routes;\n route._loadedInjector = cfg.injector;\n }));\n }\n return canLoadFails(route);\n }));\n }\n return of({ routes: [], injector });\n }\n}\nfunction sortActivatedRouteSnapshots(nodes) {\n nodes.sort((a, b) => {\n if (a.value.outlet === PRIMARY_OUTLET)\n return -1;\n if (b.value.outlet === PRIMARY_OUTLET)\n return 1;\n return a.value.outlet.localeCompare(b.value.outlet);\n });\n}\nfunction hasEmptyPathConfig(node) {\n const config = node.value.routeConfig;\n return config && config.path === '';\n}\n/**\n * Finds `TreeNode`s with matching empty path route configs and merges them into `TreeNode` with\n * the children from each duplicate. This is necessary because different outlets can match a\n * single empty path route config and the results need to then be merged.\n */\nfunction mergeEmptyPathMatches(nodes) {\n const result = [];\n // The set of nodes which contain children that were merged from two duplicate empty path nodes.\n const mergedNodes = new Set();\n for (const node of nodes) {\n if (!hasEmptyPathConfig(node)) {\n result.push(node);\n continue;\n }\n const duplicateEmptyPathNode = result.find((resultNode) => node.value.routeConfig === resultNode.value.routeConfig);\n if (duplicateEmptyPathNode !== undefined) {\n duplicateEmptyPathNode.children.push(...node.children);\n mergedNodes.add(duplicateEmptyPathNode);\n }\n else {\n result.push(node);\n }\n }\n // For each node which has children from multiple sources, we need to recompute a new `TreeNode`\n // by also merging those children. This is necessary when there are multiple empty path configs\n // in a row. Put another way: whenever we combine children of two nodes, we need to also check\n // if any of those children can be combined into a single node as well.\n for (const mergedNode of mergedNodes) {\n const mergedChildren = mergeEmptyPathMatches(mergedNode.children);\n result.push(new TreeNode(mergedNode.value, mergedChildren));\n }\n return result.filter((n) => !mergedNodes.has(n));\n}\nfunction checkOutletNameUniqueness(nodes) {\n const names = {};\n nodes.forEach((n) => {\n const routeWithSameOutletName = names[n.value.outlet];\n if (routeWithSameOutletName) {\n const p = routeWithSameOutletName.url.map((s) => s.toString()).join('/');\n const c = n.value.url.map((s) => s.toString()).join('/');\n throw new ɵRuntimeError(4006 /* RuntimeErrorCode.TWO_SEGMENTS_WITH_SAME_OUTLET */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `Two segments cannot have the same outlet name: '${p}' and '${c}'.`);\n }\n names[n.value.outlet] = n.value;\n });\n}\nfunction getData(route) {\n return route.data || {};\n}\nfunction getResolve(route) {\n return route.resolve || {};\n}\n\nfunction recognize(injector, configLoader, rootComponentType, config, serializer, paramsInheritanceStrategy) {\n return mergeMap((t) => recognize$1(injector, configLoader, rootComponentType, config, t.extractedUrl, serializer, paramsInheritanceStrategy).pipe(map(({ state: targetSnapshot, tree: urlAfterRedirects }) => {\n return { ...t, targetSnapshot, urlAfterRedirects };\n })));\n}\n\nfunction resolveData(paramsInheritanceStrategy, injector) {\n return mergeMap((t) => {\n const { targetSnapshot, guards: { canActivateChecks }, } = t;\n if (!canActivateChecks.length) {\n return of(t);\n }\n // Iterating a Set in javascript happens in insertion order so it is safe to use a `Set` to\n // preserve the correct order that the resolvers should run in.\n // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Set#description\n const routesWithResolversToRun = new Set(canActivateChecks.map((check) => check.route));\n const routesNeedingDataUpdates = new Set();\n for (const route of routesWithResolversToRun) {\n if (routesNeedingDataUpdates.has(route)) {\n continue;\n }\n // All children under the route with a resolver to run need to recompute inherited data.\n for (const newRoute of flattenRouteTree(route)) {\n routesNeedingDataUpdates.add(newRoute);\n }\n }\n let routesProcessed = 0;\n return from(routesNeedingDataUpdates).pipe(concatMap((route) => {\n if (routesWithResolversToRun.has(route)) {\n return runResolve(route, targetSnapshot, paramsInheritanceStrategy, injector);\n }\n else {\n route.data = getInherited(route, route.parent, paramsInheritanceStrategy).resolve;\n return of(void 0);\n }\n }), tap(() => routesProcessed++), takeLast(1), mergeMap((_) => (routesProcessed === routesNeedingDataUpdates.size ? of(t) : EMPTY)));\n });\n}\n/**\n * Returns the `ActivatedRouteSnapshot` tree as an array, using DFS to traverse the route tree.\n */\nfunction flattenRouteTree(route) {\n const descendants = route.children.map((child) => flattenRouteTree(child)).flat();\n return [route, ...descendants];\n}\nfunction runResolve(futureARS, futureRSS, paramsInheritanceStrategy, injector) {\n const config = futureARS.routeConfig;\n const resolve = futureARS._resolve;\n if (config?.title !== undefined && !hasStaticTitle(config)) {\n resolve[RouteTitleKey] = config.title;\n }\n return resolveNode(resolve, futureARS, futureRSS, injector).pipe(map((resolvedData) => {\n futureARS._resolvedData = resolvedData;\n futureARS.data = getInherited(futureARS, futureARS.parent, paramsInheritanceStrategy).resolve;\n return null;\n }));\n}\nfunction resolveNode(resolve, futureARS, futureRSS, injector) {\n const keys = getDataKeys(resolve);\n if (keys.length === 0) {\n return of({});\n }\n const data = {};\n return from(keys).pipe(mergeMap((key) => getResolver(resolve[key], futureARS, futureRSS, injector).pipe(first(), tap((value) => {\n if (value instanceof RedirectCommand) {\n throw redirectingNavigationError(new DefaultUrlSerializer(), value);\n }\n data[key] = value;\n }))), takeLast(1), map(() => data), catchError((e) => (isEmptyError(e) ? EMPTY : throwError(e))));\n}\nfunction getResolver(injectionToken, futureARS, futureRSS, injector) {\n const closestInjector = getClosestRouteInjector(futureARS) ?? injector;\n const resolver = getTokenOrFunctionIdentity(injectionToken, closestInjector);\n const resolverValue = resolver.resolve\n ? resolver.resolve(futureARS, futureRSS)\n : runInInjectionContext(closestInjector, () => resolver(futureARS, futureRSS));\n return wrapIntoObservable(resolverValue);\n}\n\n/**\n * Perform a side effect through a switchMap for every emission on the source Observable,\n * but return an Observable that is identical to the source. It's essentially the same as\n * the `tap` operator, but if the side effectful `next` function returns an ObservableInput,\n * it will wait before continuing with the original value.\n */\nfunction switchTap(next) {\n return switchMap((v) => {\n const nextResult = next(v);\n if (nextResult) {\n return from(nextResult).pipe(map(() => v));\n }\n return of(v);\n });\n}\n\n/**\n * Provides a strategy for setting the page title after a router navigation.\n *\n * The built-in implementation traverses the router state snapshot and finds the deepest primary\n * outlet with `title` property. Given the `Routes` below, navigating to\n * `/base/child(popup:aux)` would result in the document title being set to \"child\".\n * ```ts\n * [\n * {path: 'base', title: 'base', children: [\n * {path: 'child', title: 'child'},\n * ],\n * {path: 'aux', outlet: 'popup', title: 'popupTitle'}\n * ]\n * ```\n *\n * This class can be used as a base class for custom title strategies. That is, you can create your\n * own class that extends the `TitleStrategy`. Note that in the above example, the `title`\n * from the named outlet is never used. However, a custom strategy might be implemented to\n * incorporate titles in named outlets.\n *\n * @publicApi\n * @see [Page title guide](guide/routing/common-router-tasks#setting-the-page-title)\n */\nclass TitleStrategy {\n /**\n * @returns The `title` of the deepest primary route.\n */\n buildTitle(snapshot) {\n let pageTitle;\n let route = snapshot.root;\n while (route !== undefined) {\n pageTitle = this.getResolvedTitleForRoute(route) ?? pageTitle;\n route = route.children.find((child) => child.outlet === PRIMARY_OUTLET);\n }\n return pageTitle;\n }\n /**\n * Given an `ActivatedRouteSnapshot`, returns the final value of the\n * `Route.title` property, which can either be a static string or a resolved value.\n */\n getResolvedTitleForRoute(snapshot) {\n return snapshot.data[RouteTitleKey];\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, providedIn: 'root', useFactory: () => inject(DefaultTitleStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: TitleStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(DefaultTitleStrategy) }]\n }] });\n/**\n * The default `TitleStrategy` used by the router that updates the title using the `Title` service.\n */\nclass DefaultTitleStrategy extends TitleStrategy {\n title;\n constructor(title) {\n super();\n this.title = title;\n }\n /**\n * Sets the title of the browser to the given value.\n *\n * @param title The `pageTitle` from the deepest primary route.\n */\n updateTitle(snapshot) {\n const title = this.buildTitle(snapshot);\n if (title !== undefined) {\n this.title.setTitle(title);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, deps: [{ token: i1.Title }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: DefaultTitleStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Title }] });\n\n/**\n * A DI token for the router service.\n *\n * @publicApi\n */\nconst ROUTER_CONFIGURATION = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router config' : '', {\n providedIn: 'root',\n factory: () => ({}),\n});\n\n/**\n * This component is used internally within the router to be a placeholder when an empty\n * router-outlet is needed. For example, with a config such as:\n *\n * `{path: 'parent', outlet: 'nav', children: [...]}`\n *\n * In order to render, there needs to be a component on this config, which will default\n * to this `EmptyOutletComponent`.\n */\nclass ɵEmptyOutletComponent {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: ɵEmptyOutletComponent, deps: [], target: i0.ɵɵFactoryTarget.Component });\n static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"19.2.1\", type: ɵEmptyOutletComponent, isStandalone: true, selector: \"ng-component\", exportAs: [\"emptyRouterOutlet\"], ngImport: i0, template: `).next(...)`. This isn't\n // allowed/supported but we still have to fix these or file bugs against the teams before making\n // the change.\n return this._events;\n }\n /**\n * The current state of routing in this NgModule.\n */\n get routerState() {\n return this.stateManager.getRouterState();\n }\n /**\n * True if at least one navigation event has occurred,\n * false otherwise.\n */\n navigated = false;\n /**\n * A strategy for re-using routes.\n *\n * @deprecated Configure using `providers` instead:\n * `{provide: RouteReuseStrategy, useClass: MyStrategy}`.\n */\n routeReuseStrategy = inject(RouteReuseStrategy);\n /**\n * How to handle a navigation request to the current URL.\n *\n *\n * @deprecated Configure this through `provideRouter` or `RouterModule.forRoot` instead.\n * @see {@link withRouterConfig}\n * @see {@link provideRouter}\n * @see {@link RouterModule}\n */\n onSameUrlNavigation = this.options.onSameUrlNavigation || 'ignore';\n config = inject(ROUTES, { optional: true })?.flat() ?? [];\n /**\n * Indicates whether the application has opted in to binding Router data to component inputs.\n *\n * This option is enabled by the `withComponentInputBinding` feature of `provideRouter` or\n * `bindToComponentInputs` in the `ExtraOptions` of `RouterModule.forRoot`.\n */\n componentInputBindingEnabled = !!inject(INPUT_BINDER, { optional: true });\n constructor() {\n this.resetConfig(this.config);\n this.navigationTransitions\n .setupNavigations(this, this.currentUrlTree, this.routerState)\n .subscribe({\n error: (e) => {\n this.console.warn(ngDevMode ? `Unhandled Navigation Error: ${e}` : e);\n },\n });\n this.subscribeToNavigationEvents();\n }\n eventsSubscription = new Subscription();\n subscribeToNavigationEvents() {\n const subscription = this.navigationTransitions.events.subscribe((e) => {\n try {\n const currentTransition = this.navigationTransitions.currentTransition;\n const currentNavigation = this.navigationTransitions.currentNavigation;\n if (currentTransition !== null && currentNavigation !== null) {\n this.stateManager.handleRouterEvent(e, currentNavigation);\n if (e instanceof NavigationCancel &&\n e.code !== NavigationCancellationCode.Redirect &&\n e.code !== NavigationCancellationCode.SupersededByNewNavigation) {\n // It seems weird that `navigated` is set to `true` when the navigation is rejected,\n // however it's how things were written initially. Investigation would need to be done\n // to determine if this can be removed.\n this.navigated = true;\n }\n else if (e instanceof NavigationEnd) {\n this.navigated = true;\n }\n else if (e instanceof RedirectRequest) {\n const opts = e.navigationBehaviorOptions;\n const mergedTree = this.urlHandlingStrategy.merge(e.url, currentTransition.currentRawUrl);\n const extras = {\n browserUrl: currentTransition.extras.browserUrl,\n info: currentTransition.extras.info,\n skipLocationChange: currentTransition.extras.skipLocationChange,\n // The URL is already updated at this point if we have 'eager' URL\n // updates or if the navigation was triggered by the browser (back\n // button, URL bar, etc). We want to replace that item in history\n // if the navigation is rejected.\n replaceUrl: currentTransition.extras.replaceUrl ||\n this.urlUpdateStrategy === 'eager' ||\n isBrowserTriggeredNavigation(currentTransition.source),\n // allow developer to override default options with RedirectCommand\n ...opts,\n };\n this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras, {\n resolve: currentTransition.resolve,\n reject: currentTransition.reject,\n promise: currentTransition.promise,\n });\n }\n }\n // Note that it's important to have the Router process the events _before_ the event is\n // pushed through the public observable. This ensures the correct router state is in place\n // before applications observe the events.\n if (isPublicRouterEvent(e)) {\n this._events.next(e);\n }\n }\n catch (e) {\n this.navigationTransitions.transitionAbortSubject.next(e);\n }\n });\n this.eventsSubscription.add(subscription);\n }\n /** @internal */\n resetRootComponentType(rootComponentType) {\n // TODO: vsavkin router 4.0 should make the root component set to null\n // this will simplify the lifecycle of the router.\n this.routerState.root.component = rootComponentType;\n this.navigationTransitions.rootComponentType = rootComponentType;\n }\n /**\n * Sets up the location change listener and performs the initial navigation.\n */\n initialNavigation() {\n this.setUpLocationChangeListener();\n if (!this.navigationTransitions.hasRequestedNavigation) {\n this.navigateToSyncWithBrowser(this.location.path(true), IMPERATIVE_NAVIGATION, this.stateManager.restoredState());\n }\n }\n /**\n * Sets up the location change listener. This listener detects navigations triggered from outside\n * the Router (the browser back/forward buttons, for example) and schedules a corresponding Router\n * navigation so that the correct events, guards, etc. are triggered.\n */\n setUpLocationChangeListener() {\n // Don't need to use Zone.wrap any more, because zone.js\n // already patch onPopState, so location change callback will\n // run into ngZone\n this.nonRouterCurrentEntryChangeSubscription ??=\n this.stateManager.registerNonRouterCurrentEntryChangeListener((url, state) => {\n // The `setTimeout` was added in #12160 and is likely to support Angular/AngularJS\n // hybrid apps.\n setTimeout(() => {\n this.navigateToSyncWithBrowser(url, 'popstate', state);\n }, 0);\n });\n }\n /**\n * Schedules a router navigation to synchronize Router state with the browser state.\n *\n * This is done as a response to a popstate event and the initial navigation. These\n * two scenarios represent times when the browser URL/state has been updated and\n * the Router needs to respond to ensure its internal state matches.\n */\n navigateToSyncWithBrowser(url, source, state) {\n const extras = { replaceUrl: true };\n // TODO: restoredState should always include the entire state, regardless\n // of navigationId. This requires a breaking change to update the type on\n // NavigationStart’s restoredState, which currently requires navigationId\n // to always be present. The Router used to only restore history state if\n // a navigationId was present.\n // The stored navigationId is used by the RouterScroller to retrieve the scroll\n // position for the page.\n const restoredState = state?.navigationId ? state : null;\n // Separate to NavigationStart.restoredState, we must also restore the state to\n // history.state and generate a new navigationId, since it will be overwritten\n if (state) {\n const stateCopy = { ...state };\n delete stateCopy.navigationId;\n delete stateCopy.ɵrouterPageId;\n if (Object.keys(stateCopy).length !== 0) {\n extras.state = stateCopy;\n }\n }\n const urlTree = this.parseUrl(url);\n this.scheduleNavigation(urlTree, source, restoredState, extras);\n }\n /** The current URL. */\n get url() {\n return this.serializeUrl(this.currentUrlTree);\n }\n /**\n * Returns the current `Navigation` object when the router is navigating,\n * and `null` when idle.\n */\n getCurrentNavigation() {\n return this.navigationTransitions.currentNavigation;\n }\n /**\n * The `Navigation` object of the most recent navigation to succeed and `null` if there\n * has not been a successful navigation yet.\n */\n get lastSuccessfulNavigation() {\n return this.navigationTransitions.lastSuccessfulNavigation;\n }\n /**\n * Resets the route configuration used for navigation and generating links.\n *\n * @param config The route array for the new configuration.\n *\n * @usageNotes\n *\n * ```ts\n * router.resetConfig([\n * { path: 'team/:id', component: TeamCmp, children: [\n * { path: 'simple', component: SimpleCmp },\n * { path: 'user/:name', component: UserCmp }\n * ]}\n * ]);\n * ```\n */\n resetConfig(config) {\n (typeof ngDevMode === 'undefined' || ngDevMode) && validateConfig(config);\n this.config = config.map(standardizeConfig);\n this.navigated = false;\n }\n /** @nodoc */\n ngOnDestroy() {\n this.dispose();\n }\n /** Disposes of the router. */\n dispose() {\n // We call `unsubscribe()` to release observers, as users may forget to\n // unsubscribe manually when subscribing to `router.events`. We do not call\n // `complete()` because it is unsafe; if someone subscribes using the `first`\n // operator and the observable completes before emitting a value,\n // RxJS will throw an error.\n this._events.unsubscribe();\n this.navigationTransitions.complete();\n if (this.nonRouterCurrentEntryChangeSubscription) {\n this.nonRouterCurrentEntryChangeSubscription.unsubscribe();\n this.nonRouterCurrentEntryChangeSubscription = undefined;\n }\n this.disposed = true;\n this.eventsSubscription.unsubscribe();\n }\n /**\n * Appends URL segments to the current URL tree to create a new URL tree.\n *\n * @param commands An array of URL fragments with which to construct the new URL tree.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the current URL tree or the one provided in the `relativeTo`\n * property of the options object, if supplied.\n * @param navigationExtras Options that control the navigation strategy.\n * @returns The new URL tree.\n *\n * @usageNotes\n *\n * ```\n * // create /team/33/user/11\n * router.createUrlTree(['/team', 33, 'user', 11]);\n *\n * // create /team/33;expand=true/user/11\n * router.createUrlTree(['/team', 33, {expand: true}, 'user', 11]);\n *\n * // you can collapse static segments like this (this works only with the first passed-in value):\n * router.createUrlTree(['/team/33/user', userId]);\n *\n * // If the first segment can contain slashes, and you do not want the router to split it,\n * // you can do the following:\n * router.createUrlTree([{segmentPath: '/one/two'}]);\n *\n * // create /team/33/(user/11//right:chat)\n * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: 'chat'}}]);\n *\n * // remove the right secondary node\n * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: null}}]);\n *\n * // assuming the current url is `/team/33/user/11` and the route points to `user/11`\n *\n * // navigate to /team/33/user/11/details\n * router.createUrlTree(['details'], {relativeTo: route});\n *\n * // navigate to /team/33/user/22\n * router.createUrlTree(['../22'], {relativeTo: route});\n *\n * // navigate to /team/44/user/22\n * router.createUrlTree(['../../team/44/user/22'], {relativeTo: route});\n *\n * Note that a value of `null` or `undefined` for `relativeTo` indicates that the\n * tree should be created relative to the root.\n * ```\n */\n createUrlTree(commands, navigationExtras = {}) {\n const { relativeTo, queryParams, fragment, queryParamsHandling, preserveFragment } = navigationExtras;\n const f = preserveFragment ? this.currentUrlTree.fragment : fragment;\n let q = null;\n switch (queryParamsHandling ?? this.options.defaultQueryParamsHandling) {\n case 'merge':\n q = { ...this.currentUrlTree.queryParams, ...queryParams };\n break;\n case 'preserve':\n q = this.currentUrlTree.queryParams;\n break;\n default:\n q = queryParams || null;\n }\n if (q !== null) {\n q = this.removeEmptyProps(q);\n }\n let relativeToUrlSegmentGroup;\n try {\n const relativeToSnapshot = relativeTo ? relativeTo.snapshot : this.routerState.snapshot.root;\n relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeToSnapshot);\n }\n catch (e) {\n // This is strictly for backwards compatibility with tests that create\n // invalid `ActivatedRoute` mocks.\n // Note: the difference between having this fallback for invalid `ActivatedRoute` setups and\n // just throwing is ~500 test failures. Fixing all of those tests by hand is not feasible at\n // the moment.\n if (typeof commands[0] !== 'string' || commands[0][0] !== '/') {\n // Navigations that were absolute in the old way of creating UrlTrees\n // would still work because they wouldn't attempt to match the\n // segments in the `ActivatedRoute` to the `currentUrlTree` but\n // instead just replace the root segment with the navigation result.\n // Non-absolute navigations would fail to apply the commands because\n // the logic could not find the segment to replace (so they'd act like there were no\n // commands).\n commands = [];\n }\n relativeToUrlSegmentGroup = this.currentUrlTree.root;\n }\n return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, q, f ?? null);\n }\n /**\n * Navigates to a view using an absolute route path.\n *\n * @param url An absolute path for a defined route. The function does not apply any delta to the\n * current URL.\n * @param extras An object containing properties that modify the navigation strategy.\n *\n * @returns A Promise that resolves to 'true' when navigation succeeds,\n * to 'false' when navigation fails, or is rejected on error.\n *\n * @usageNotes\n *\n * The following calls request navigation to an absolute path.\n *\n * ```ts\n * router.navigateByUrl(\"/team/33/user/11\");\n *\n * // Navigate without updating the URL\n * router.navigateByUrl(\"/team/33/user/11\", { skipLocationChange: true });\n * ```\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks)\n *\n */\n navigateByUrl(url, extras = {\n skipLocationChange: false,\n }) {\n const urlTree = isUrlTree(url) ? url : this.parseUrl(url);\n const mergedTree = this.urlHandlingStrategy.merge(urlTree, this.rawUrlTree);\n return this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras);\n }\n /**\n * Navigate based on the provided array of commands and a starting point.\n * If no starting route is provided, the navigation is absolute.\n *\n * @param commands An array of URL fragments with which to construct the target URL.\n * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path\n * segments, followed by the parameters for each segment.\n * The fragments are applied to the current URL or the one provided in the `relativeTo` property\n * of the options object, if supplied.\n * @param extras An options object that determines how the URL should be constructed or\n * interpreted.\n *\n * @returns A Promise that resolves to `true` when navigation succeeds, or `false` when navigation\n * fails. The Promise is rejected when an error occurs if `resolveNavigationPromiseOnError` is\n * not `true`.\n *\n * @usageNotes\n *\n * The following calls request navigation to a dynamic route path relative to the current URL.\n *\n * ```ts\n * router.navigate(['team', 33, 'user', 11], {relativeTo: route});\n *\n * // Navigate without updating the URL, overriding the default behavior\n * router.navigate(['team', 33, 'user', 11], {relativeTo: route, skipLocationChange: true});\n * ```\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks)\n *\n */\n navigate(commands, extras = { skipLocationChange: false }) {\n validateCommands(commands);\n return this.navigateByUrl(this.createUrlTree(commands, extras), extras);\n }\n /** Serializes a `UrlTree` into a string */\n serializeUrl(url) {\n return this.urlSerializer.serialize(url);\n }\n /** Parses a string into a `UrlTree` */\n parseUrl(url) {\n try {\n return this.urlSerializer.parse(url);\n }\n catch {\n return this.urlSerializer.parse('/');\n }\n }\n isActive(url, matchOptions) {\n let options;\n if (matchOptions === true) {\n options = { ...exactMatchOptions };\n }\n else if (matchOptions === false) {\n options = { ...subsetMatchOptions };\n }\n else {\n options = matchOptions;\n }\n if (isUrlTree(url)) {\n return containsTree(this.currentUrlTree, url, options);\n }\n const urlTree = this.parseUrl(url);\n return containsTree(this.currentUrlTree, urlTree, options);\n }\n removeEmptyProps(params) {\n return Object.entries(params).reduce((result, [key, value]) => {\n if (value !== null && value !== undefined) {\n result[key] = value;\n }\n return result;\n }, {});\n }\n scheduleNavigation(rawUrl, source, restoredState, extras, priorPromise) {\n if (this.disposed) {\n return Promise.resolve(false);\n }\n let resolve;\n let reject;\n let promise;\n if (priorPromise) {\n resolve = priorPromise.resolve;\n reject = priorPromise.reject;\n promise = priorPromise.promise;\n }\n else {\n promise = new Promise((res, rej) => {\n resolve = res;\n reject = rej;\n });\n }\n // Indicate that the navigation is happening.\n const taskId = this.pendingTasks.add();\n afterNextNavigation(this, () => {\n // Remove pending task in a microtask to allow for cancelled\n // initial navigations and redirects within the same task.\n queueMicrotask(() => this.pendingTasks.remove(taskId));\n });\n this.navigationTransitions.handleNavigationRequest({\n source,\n restoredState,\n currentUrlTree: this.currentUrlTree,\n currentRawUrl: this.currentUrlTree,\n rawUrl,\n extras,\n resolve: resolve,\n reject: reject,\n promise,\n currentSnapshot: this.routerState.snapshot,\n currentRouterState: this.routerState,\n });\n // Make sure that the error is propagated even though `processNavigations` catch\n // handler does not rethrow\n return promise.catch((e) => {\n return Promise.reject(e);\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: Router, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\nfunction validateCommands(commands) {\n for (let i = 0; i < commands.length; i++) {\n const cmd = commands[i];\n if (cmd == null) {\n throw new ɵRuntimeError(4008 /* RuntimeErrorCode.NULLISH_COMMAND */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n `The requested path contains ${cmd} segment at index ${i}`);\n }\n }\n}\nfunction isPublicRouterEvent(e) {\n return !(e instanceof BeforeActivateRoutes) && !(e instanceof RedirectRequest);\n}\n\n/**\n * @description\n *\n * When applied to an element in a template, makes that element a link\n * that initiates navigation to a route. Navigation opens one or more routed components\n * in one or more `` locations on the page.\n *\n * Given a route configuration `[{ path: 'user/:name', component: UserCmp }]`,\n * the following creates a static link to the route:\n * `link to user component `\n *\n * You can use dynamic values to generate the link.\n * For a dynamic link, pass an array of path segments,\n * followed by the params for each segment.\n * For example, `['/team', teamId, 'user', userName, {details: true}]`\n * generates a link to `/team/11/user/bob;details=true`.\n *\n * Multiple static segments can be merged into one term and combined with dynamic segments.\n * For example, `['/team/11/user', userName, {details: true}]`\n *\n * The input that you provide to the link is treated as a delta to the current URL.\n * For instance, suppose the current URL is `/user/(box//aux:team)`.\n * The link `Jim ` creates the URL\n * `/user/(jim//aux:team)`.\n * See {@link Router#createUrlTree} for more information.\n *\n * @usageNotes\n *\n * You can use absolute or relative paths in a link, set query parameters,\n * control how parameters are handled, and keep a history of navigation states.\n *\n * ### Relative link paths\n *\n * The first segment name can be prepended with `/`, `./`, or `../`.\n * * If the first segment begins with `/`, the router looks up the route from the root of the\n * app.\n * * If the first segment begins with `./`, or doesn't begin with a slash, the router\n * looks in the children of the current activated route.\n * * If the first segment begins with `../`, the router goes up one level in the route tree.\n *\n * ### Setting and handling query params and fragments\n *\n * The following link adds a query parameter and a fragment to the generated URL:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n * By default, the directive constructs the new URL using the given query parameters.\n * The example generates the link: `/user/bob?debug=true#education`.\n *\n * You can instruct the directive to handle query parameters differently\n * by specifying the `queryParamsHandling` option in the link.\n * Allowed values are:\n *\n * - `'merge'`: Merge the given `queryParams` into the current query params.\n * - `'preserve'`: Preserve the current query params.\n *\n * For example:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n *\n * `queryParams`, `fragment`, `queryParamsHandling`, `preserveFragment`, and `relativeTo`\n * cannot be used when the `routerLink` input is a `UrlTree`.\n *\n * See {@link UrlCreationOptions#queryParamsHandling}.\n *\n * ### Preserving navigation history\n *\n * You can provide a `state` value to be persisted to the browser's\n * [`History.state` property](https://developer.mozilla.org/en-US/docs/Web/API/History#Properties).\n * For example:\n *\n * ```html\n * \n * link to user component\n * \n * ```\n *\n * Use {@link Router#getCurrentNavigation} to retrieve a saved\n * navigation-state value. For example, to capture the `tracingId` during the `NavigationStart`\n * event:\n *\n * ```ts\n * // Get NavigationStart events\n * router.events.pipe(filter(e => e instanceof NavigationStart)).subscribe(e => {\n * const navigation = router.getCurrentNavigation();\n * tracingService.trace({id: navigation.extras.state.tracingId});\n * });\n * ```\n *\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterLink {\n router;\n route;\n tabIndexAttribute;\n renderer;\n el;\n locationStrategy;\n /**\n * Represents an `href` attribute value applied to a host element,\n * when a host element is ``. For other tags, the value is `null`.\n */\n href = null;\n /**\n * Represents the `target` attribute on a host element.\n * This is only used when the host element is an ` ` tag.\n */\n target;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#queryParams}\n * @see {@link Router#createUrlTree}\n */\n queryParams;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#fragment}\n * @see {@link Router#createUrlTree}\n */\n fragment;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#queryParamsHandling}\n * @see {@link Router#createUrlTree}\n */\n queryParamsHandling;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#state}\n * @see {@link Router#navigateByUrl}\n */\n state;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#info}\n * @see {@link Router#navigateByUrl}\n */\n info;\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * Specify a value here when you do not want to use the default value\n * for `routerLink`, which is the current activated route.\n * Note that a value of `undefined` here will use the `routerLink` default.\n * @see {@link UrlCreationOptions#relativeTo}\n * @see {@link Router#createUrlTree}\n */\n relativeTo;\n /** Whether a host element is an ` ` tag. */\n isAnchorElement;\n subscription;\n /** @internal */\n onChanges = new Subject();\n constructor(router, route, tabIndexAttribute, renderer, el, locationStrategy) {\n this.router = router;\n this.route = route;\n this.tabIndexAttribute = tabIndexAttribute;\n this.renderer = renderer;\n this.el = el;\n this.locationStrategy = locationStrategy;\n const tagName = el.nativeElement.tagName?.toLowerCase();\n this.isAnchorElement = tagName === 'a' || tagName === 'area';\n if (this.isAnchorElement) {\n this.subscription = router.events.subscribe((s) => {\n if (s instanceof NavigationEnd) {\n this.updateHref();\n }\n });\n }\n else {\n this.setTabIndexIfNotOnNativeEl('0');\n }\n }\n /**\n * Passed to {@link Router#createUrlTree} as part of the\n * `UrlCreationOptions`.\n * @see {@link UrlCreationOptions#preserveFragment}\n * @see {@link Router#createUrlTree}\n */\n preserveFragment = false;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#skipLocationChange}\n * @see {@link Router#navigateByUrl}\n */\n skipLocationChange = false;\n /**\n * Passed to {@link Router#navigateByUrl} as part of the\n * `NavigationBehaviorOptions`.\n * @see {@link NavigationBehaviorOptions#replaceUrl}\n * @see {@link Router#navigateByUrl}\n */\n replaceUrl = false;\n /**\n * Modifies the tab index if there was not a tabindex attribute on the element during\n * instantiation.\n */\n setTabIndexIfNotOnNativeEl(newTabIndex) {\n if (this.tabIndexAttribute != null /* both `null` and `undefined` */ || this.isAnchorElement) {\n return;\n }\n this.applyAttributeValue('tabindex', newTabIndex);\n }\n /** @nodoc */\n // TODO(atscott): Remove changes parameter in major version as a breaking change.\n ngOnChanges(changes) {\n if (ngDevMode &&\n isUrlTree(this.routerLinkInput) &&\n (this.fragment !== undefined ||\n this.queryParams ||\n this.queryParamsHandling ||\n this.preserveFragment ||\n this.relativeTo)) {\n throw new ɵRuntimeError(4016 /* RuntimeErrorCode.INVALID_ROUTER_LINK_INPUTS */, 'Cannot configure queryParams or fragment when using a UrlTree as the routerLink input value.');\n }\n if (this.isAnchorElement) {\n this.updateHref();\n }\n // This is subscribed to by `RouterLinkActive` so that it knows to update when there are changes\n // to the RouterLinks it's tracking.\n this.onChanges.next(this);\n }\n routerLinkInput = null;\n /**\n * Commands to pass to {@link Router#createUrlTree} or a `UrlTree`.\n * - **array**: commands to pass to {@link Router#createUrlTree}.\n * - **string**: shorthand for array of commands with just the string, i.e. `['/route']`\n * - **UrlTree**: a `UrlTree` for this link rather than creating one from the commands\n * and other inputs that correspond to properties of `UrlCreationOptions`.\n * - **null|undefined**: effectively disables the `routerLink`\n * @see {@link Router#createUrlTree}\n */\n set routerLink(commandsOrUrlTree) {\n if (commandsOrUrlTree == null) {\n this.routerLinkInput = null;\n this.setTabIndexIfNotOnNativeEl(null);\n }\n else {\n if (isUrlTree(commandsOrUrlTree)) {\n this.routerLinkInput = commandsOrUrlTree;\n }\n else {\n this.routerLinkInput = Array.isArray(commandsOrUrlTree)\n ? commandsOrUrlTree\n : [commandsOrUrlTree];\n }\n this.setTabIndexIfNotOnNativeEl('0');\n }\n }\n /** @nodoc */\n onClick(button, ctrlKey, shiftKey, altKey, metaKey) {\n const urlTree = this.urlTree;\n if (urlTree === null) {\n return true;\n }\n if (this.isAnchorElement) {\n if (button !== 0 || ctrlKey || shiftKey || altKey || metaKey) {\n return true;\n }\n if (typeof this.target === 'string' && this.target != '_self') {\n return true;\n }\n }\n const extras = {\n skipLocationChange: this.skipLocationChange,\n replaceUrl: this.replaceUrl,\n state: this.state,\n info: this.info,\n };\n this.router.navigateByUrl(urlTree, extras);\n // Return `false` for ` ` elements to prevent default action\n // and cancel the native behavior, since the navigation is handled\n // by the Router.\n return !this.isAnchorElement;\n }\n /** @nodoc */\n ngOnDestroy() {\n this.subscription?.unsubscribe();\n }\n updateHref() {\n const urlTree = this.urlTree;\n this.href =\n urlTree !== null && this.locationStrategy\n ? this.locationStrategy?.prepareExternalUrl(this.router.serializeUrl(urlTree))\n : null;\n const sanitizedValue = this.href === null\n ? null\n : // This class represents a directive that can be added to both ` ` elements,\n // as well as other elements. As a result, we can't define security context at\n // compile time. So the security context is deferred to runtime.\n // The `ɵɵsanitizeUrlOrResourceUrl` selects the necessary sanitizer function\n // based on the tag and property names. The logic mimics the one from\n // `packages/compiler/src/schema/dom_security_schema.ts`, which is used at compile time.\n //\n // Note: we should investigate whether we can switch to using `@HostBinding('attr.href')`\n // instead of applying a value via a renderer, after a final merge of the\n // `RouterLinkWithHref` directive.\n ɵɵsanitizeUrlOrResourceUrl(this.href, this.el.nativeElement.tagName.toLowerCase(), 'href');\n this.applyAttributeValue('href', sanitizedValue);\n }\n applyAttributeValue(attrName, attrValue) {\n const renderer = this.renderer;\n const nativeElement = this.el.nativeElement;\n if (attrValue !== null) {\n renderer.setAttribute(nativeElement, attrName, attrValue);\n }\n else {\n renderer.removeAttribute(nativeElement, attrName);\n }\n }\n get urlTree() {\n if (this.routerLinkInput === null) {\n return null;\n }\n else if (isUrlTree(this.routerLinkInput)) {\n return this.routerLinkInput;\n }\n return this.router.createUrlTree(this.routerLinkInput, {\n // If the `relativeTo` input is not defined, we want to use `this.route` by default.\n // Otherwise, we should use the value provided by the user in the input.\n relativeTo: this.relativeTo !== undefined ? this.relativeTo : this.route,\n queryParams: this.queryParams,\n fragment: this.fragment,\n queryParamsHandling: this.queryParamsHandling,\n preserveFragment: this.preserveFragment,\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLink, deps: [{ token: Router }, { token: ActivatedRoute }, { token: 'tabindex', attribute: true }, { token: i0.Renderer2 }, { token: i0.ElementRef }, { token: i3.LocationStrategy }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"19.2.1\", type: RouterLink, isStandalone: true, selector: \"[routerLink]\", inputs: { target: \"target\", queryParams: \"queryParams\", fragment: \"fragment\", queryParamsHandling: \"queryParamsHandling\", state: \"state\", info: \"info\", relativeTo: \"relativeTo\", preserveFragment: [\"preserveFragment\", \"preserveFragment\", booleanAttribute], skipLocationChange: [\"skipLocationChange\", \"skipLocationChange\", booleanAttribute], replaceUrl: [\"replaceUrl\", \"replaceUrl\", booleanAttribute], routerLink: \"routerLink\" }, host: { listeners: { \"click\": \"onClick($event.button,$event.ctrlKey,$event.shiftKey,$event.altKey,$event.metaKey)\" }, properties: { \"attr.target\": \"this.target\" } }, usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLink, decorators: [{\n type: Directive,\n args: [{\n selector: '[routerLink]',\n }]\n }], ctorParameters: () => [{ type: Router }, { type: ActivatedRoute }, { type: undefined, decorators: [{\n type: Attribute,\n args: ['tabindex']\n }] }, { type: i0.Renderer2 }, { type: i0.ElementRef }, { type: i3.LocationStrategy }], propDecorators: { target: [{\n type: HostBinding,\n args: ['attr.target']\n }, {\n type: Input\n }], queryParams: [{\n type: Input\n }], fragment: [{\n type: Input\n }], queryParamsHandling: [{\n type: Input\n }], state: [{\n type: Input\n }], info: [{\n type: Input\n }], relativeTo: [{\n type: Input\n }], preserveFragment: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], skipLocationChange: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], replaceUrl: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], routerLink: [{\n type: Input\n }], onClick: [{\n type: HostListener,\n args: ['click', [\n '$event.button',\n '$event.ctrlKey',\n '$event.shiftKey',\n '$event.altKey',\n '$event.metaKey',\n ]]\n }] } });\n\n/**\n *\n * @description\n *\n * Tracks whether the linked route of an element is currently active, and allows you\n * to specify one or more CSS classes to add to the element when the linked route\n * is active.\n *\n * Use this directive to create a visual distinction for elements associated with an active route.\n * For example, the following code highlights the word \"Bob\" when the router\n * activates the associated route:\n *\n * ```html\n * Bob \n * ```\n *\n * Whenever the URL is either '/user' or '/user/bob', the \"active-link\" class is\n * added to the anchor tag. If the URL changes, the class is removed.\n *\n * You can set more than one class using a space-separated string or an array.\n * For example:\n *\n * ```html\n * Bob \n * Bob \n * ```\n *\n * To add the classes only when the URL matches the link exactly, add the option `exact: true`:\n *\n * ```html\n * Bob \n * ```\n *\n * To directly check the `isActive` status of the link, assign the `RouterLinkActive`\n * instance to a template variable.\n * For example, the following checks the status without assigning any CSS classes:\n *\n * ```html\n * \n * Bob {{ rla.isActive ? '(already open)' : ''}}\n * \n * ```\n *\n * You can apply the `RouterLinkActive` directive to an ancestor of linked elements.\n * For example, the following sets the active-link class on the `` parent tag\n * when the URL is either '/user/jim' or '/user/bob'.\n *\n * ```html\n *
\n * ```\n *\n * The `RouterLinkActive` directive can also be used to set the aria-current attribute\n * to provide an alternative distinction for active elements to visually impaired users.\n *\n * For example, the following code adds the 'active' class to the Home Page link when it is\n * indeed active and in such case also sets its aria-current attribute to 'page':\n *\n * ```html\n *
Home Page \n * ```\n *\n * @ngModule RouterModule\n *\n * @publicApi\n */\nclass RouterLinkActive {\n router;\n element;\n renderer;\n cdr;\n link;\n links;\n classes = [];\n routerEventsSubscription;\n linkInputChangesSubscription;\n _isActive = false;\n get isActive() {\n return this._isActive;\n }\n /**\n * Options to configure how to determine if the router link is active.\n *\n * These options are passed to the `Router.isActive()` function.\n *\n * @see {@link Router#isActive}\n */\n routerLinkActiveOptions = { exact: false };\n /**\n * Aria-current attribute to apply when the router link is active.\n *\n * Possible values: `'page'` | `'step'` | `'location'` | `'date'` | `'time'` | `true` | `false`.\n *\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/Attributes/aria-current}\n */\n ariaCurrentWhenActive;\n /**\n *\n * You can use the output `isActiveChange` to get notified each time the link becomes\n * active or inactive.\n *\n * Emits:\n * true -> Route is active\n * false -> Route is inactive\n *\n * ```html\n *
Bob\n * ```\n */\n isActiveChange = new EventEmitter();\n constructor(router, element, renderer, cdr, link) {\n this.router = router;\n this.element = element;\n this.renderer = renderer;\n this.cdr = cdr;\n this.link = link;\n this.routerEventsSubscription = router.events.subscribe((s) => {\n if (s instanceof NavigationEnd) {\n this.update();\n }\n });\n }\n /** @nodoc */\n ngAfterContentInit() {\n // `of(null)` is used to force subscribe body to execute once immediately (like `startWith`).\n of(this.links.changes, of(null))\n .pipe(mergeAll())\n .subscribe((_) => {\n this.update();\n this.subscribeToEachLinkOnChanges();\n });\n }\n subscribeToEachLinkOnChanges() {\n this.linkInputChangesSubscription?.unsubscribe();\n const allLinkChanges = [...this.links.toArray(), this.link]\n .filter((link) => !!link)\n .map((link) => link.onChanges);\n this.linkInputChangesSubscription = from(allLinkChanges)\n .pipe(mergeAll())\n .subscribe((link) => {\n if (this._isActive !== this.isLinkActive(this.router)(link)) {\n this.update();\n }\n });\n }\n set routerLinkActive(data) {\n const classes = Array.isArray(data) ? data : data.split(' ');\n this.classes = classes.filter((c) => !!c);\n }\n /** @nodoc */\n ngOnChanges(changes) {\n this.update();\n }\n /** @nodoc */\n ngOnDestroy() {\n this.routerEventsSubscription.unsubscribe();\n this.linkInputChangesSubscription?.unsubscribe();\n }\n update() {\n if (!this.links || !this.router.navigated)\n return;\n queueMicrotask(() => {\n const hasActiveLinks = this.hasActiveLinks();\n this.classes.forEach((c) => {\n if (hasActiveLinks) {\n this.renderer.addClass(this.element.nativeElement, c);\n }\n else {\n this.renderer.removeClass(this.element.nativeElement, c);\n }\n });\n if (hasActiveLinks && this.ariaCurrentWhenActive !== undefined) {\n this.renderer.setAttribute(this.element.nativeElement, 'aria-current', this.ariaCurrentWhenActive.toString());\n }\n else {\n this.renderer.removeAttribute(this.element.nativeElement, 'aria-current');\n }\n // Only emit change if the active state changed.\n if (this._isActive !== hasActiveLinks) {\n this._isActive = hasActiveLinks;\n this.cdr.markForCheck();\n // Emit on isActiveChange after classes are updated\n this.isActiveChange.emit(hasActiveLinks);\n }\n });\n }\n isLinkActive(router) {\n const options = isActiveMatchOptions(this.routerLinkActiveOptions)\n ? this.routerLinkActiveOptions\n : // While the types should disallow `undefined` here, it's possible without strict inputs\n this.routerLinkActiveOptions.exact || false;\n return (link) => {\n const urlTree = link.urlTree;\n return urlTree ? router.isActive(urlTree, options) : false;\n };\n }\n hasActiveLinks() {\n const isActiveCheckFn = this.isLinkActive(this.router);\n return (this.link && isActiveCheckFn(this.link)) || this.links.some(isActiveCheckFn);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLinkActive, deps: [{ token: Router }, { token: i0.ElementRef }, { token: i0.Renderer2 }, { token: i0.ChangeDetectorRef }, { token: RouterLink, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: RouterLinkActive, isStandalone: true, selector: \"[routerLinkActive]\", inputs: { routerLinkActiveOptions: \"routerLinkActiveOptions\", ariaCurrentWhenActive: \"ariaCurrentWhenActive\", routerLinkActive: \"routerLinkActive\" }, outputs: { isActiveChange: \"isActiveChange\" }, queries: [{ propertyName: \"links\", predicate: RouterLink, descendants: true }], exportAs: [\"routerLinkActive\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterLinkActive, decorators: [{\n type: Directive,\n args: [{\n selector: '[routerLinkActive]',\n exportAs: 'routerLinkActive',\n }]\n }], ctorParameters: () => [{ type: Router }, { type: i0.ElementRef }, { type: i0.Renderer2 }, { type: i0.ChangeDetectorRef }, { type: RouterLink, decorators: [{\n type: Optional\n }] }], propDecorators: { links: [{\n type: ContentChildren,\n args: [RouterLink, { descendants: true }]\n }], routerLinkActiveOptions: [{\n type: Input\n }], ariaCurrentWhenActive: [{\n type: Input\n }], isActiveChange: [{\n type: Output\n }], routerLinkActive: [{\n type: Input\n }] } });\n/**\n * Use instead of `'paths' in options` to be compatible with property renaming\n */\nfunction isActiveMatchOptions(options) {\n return !!options.paths;\n}\n\n/**\n * @description\n *\n * Provides a preloading strategy.\n *\n * @publicApi\n */\nclass PreloadingStrategy {\n}\n/**\n * @description\n *\n * Provides a preloading strategy that preloads all modules as quickly as possible.\n *\n * ```ts\n * RouterModule.forRoot(ROUTES, {preloadingStrategy: PreloadAllModules})\n * ```\n *\n * @publicApi\n */\nclass PreloadAllModules {\n preload(route, fn) {\n return fn().pipe(catchError(() => of(null)));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PreloadAllModules, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/**\n * @description\n *\n * Provides a preloading strategy that does not preload any modules.\n *\n * This strategy is enabled by default.\n *\n * @publicApi\n */\nclass NoPreloading {\n preload(route, fn) {\n return of(null);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NoPreloading, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/**\n * The preloader optimistically loads all router configurations to\n * make navigations into lazily-loaded sections of the application faster.\n *\n * The preloader runs in the background. When the router bootstraps, the preloader\n * starts listening to all navigation events. After every such event, the preloader\n * will check if any configurations can be loaded lazily.\n *\n * If a route is protected by `canLoad` guards, the preloaded will not load it.\n *\n * @publicApi\n */\nclass RouterPreloader {\n router;\n injector;\n preloadingStrategy;\n loader;\n subscription;\n constructor(router, compiler, injector, preloadingStrategy, loader) {\n this.router = router;\n this.injector = injector;\n this.preloadingStrategy = preloadingStrategy;\n this.loader = loader;\n }\n setUpPreloading() {\n this.subscription = this.router.events\n .pipe(filter((e) => e instanceof NavigationEnd), concatMap(() => this.preload()))\n .subscribe(() => { });\n }\n preload() {\n return this.processRoutes(this.injector, this.router.config);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this.subscription) {\n this.subscription.unsubscribe();\n }\n }\n processRoutes(injector, routes) {\n const res = [];\n for (const route of routes) {\n if (route.providers && !route._injector) {\n route._injector = createEnvironmentInjector(route.providers, injector, `Route: ${route.path}`);\n }\n const injectorForCurrentRoute = route._injector ?? injector;\n const injectorForChildren = route._loadedInjector ?? injectorForCurrentRoute;\n // Note that `canLoad` is only checked as a condition that prevents `loadChildren` and not\n // `loadComponent`. `canLoad` guards only block loading of child routes by design. This\n // happens as a consequence of needing to descend into children for route matching immediately\n // while component loading is deferred until route activation. Because `canLoad` guards can\n // have side effects, we cannot execute them here so we instead skip preloading altogether\n // when present. Lastly, it remains to be decided whether `canLoad` should behave this way\n // at all. Code splitting and lazy loading is separate from client-side authorization checks\n // and should not be used as a security measure to prevent loading of code.\n if ((route.loadChildren && !route._loadedRoutes && route.canLoad === undefined) ||\n (route.loadComponent && !route._loadedComponent)) {\n res.push(this.preloadConfig(injectorForCurrentRoute, route));\n }\n if (route.children || route._loadedRoutes) {\n res.push(this.processRoutes(injectorForChildren, (route.children ?? route._loadedRoutes)));\n }\n }\n return from(res).pipe(mergeAll());\n }\n preloadConfig(injector, route) {\n return this.preloadingStrategy.preload(route, () => {\n let loadedChildren$;\n if (route.loadChildren && route.canLoad === undefined) {\n loadedChildren$ = this.loader.loadChildren(injector, route);\n }\n else {\n loadedChildren$ = of(null);\n }\n const recursiveLoadChildren$ = loadedChildren$.pipe(mergeMap((config) => {\n if (config === null) {\n return of(void 0);\n }\n route._loadedRoutes = config.routes;\n route._loadedInjector = config.injector;\n // If the loaded config was a module, use that as the module/module injector going\n // forward. Otherwise, continue using the current module/module injector.\n return this.processRoutes(config.injector ?? injector, config.routes);\n }));\n if (route.loadComponent && !route._loadedComponent) {\n const loadComponent$ = this.loader.loadComponent(route);\n return from([recursiveLoadChildren$, loadComponent$]).pipe(mergeAll());\n }\n else {\n return recursiveLoadChildren$;\n }\n });\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, deps: [{ token: Router }, { token: i0.Compiler }, { token: i0.EnvironmentInjector }, { token: PreloadingStrategy }, { token: RouterConfigLoader }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, providedIn: 'root' });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterPreloader, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: Router }, { type: i0.Compiler }, { type: i0.EnvironmentInjector }, { type: PreloadingStrategy }, { type: RouterConfigLoader }] });\n\nconst ROUTER_SCROLLER = new InjectionToken('');\nclass RouterScroller {\n urlSerializer;\n transitions;\n viewportScroller;\n zone;\n options;\n routerEventsSubscription;\n scrollEventsSubscription;\n lastId = 0;\n lastSource = 'imperative';\n restoredId = 0;\n store = {};\n /** @nodoc */\n constructor(urlSerializer, transitions, viewportScroller, zone, options = {}) {\n this.urlSerializer = urlSerializer;\n this.transitions = transitions;\n this.viewportScroller = viewportScroller;\n this.zone = zone;\n this.options = options;\n // Default both options to 'disabled'\n options.scrollPositionRestoration ||= 'disabled';\n options.anchorScrolling ||= 'disabled';\n }\n init() {\n // we want to disable the automatic scrolling because having two places\n // responsible for scrolling results race conditions, especially given\n // that browser don't implement this behavior consistently\n if (this.options.scrollPositionRestoration !== 'disabled') {\n this.viewportScroller.setHistoryScrollRestoration('manual');\n }\n this.routerEventsSubscription = this.createScrollEvents();\n this.scrollEventsSubscription = this.consumeScrollEvents();\n }\n createScrollEvents() {\n return this.transitions.events.subscribe((e) => {\n if (e instanceof NavigationStart) {\n // store the scroll position of the current stable navigations.\n this.store[this.lastId] = this.viewportScroller.getScrollPosition();\n this.lastSource = e.navigationTrigger;\n this.restoredId = e.restoredState ? e.restoredState.navigationId : 0;\n }\n else if (e instanceof NavigationEnd) {\n this.lastId = e.id;\n this.scheduleScrollEvent(e, this.urlSerializer.parse(e.urlAfterRedirects).fragment);\n }\n else if (e instanceof NavigationSkipped &&\n e.code === NavigationSkippedCode.IgnoredSameUrlNavigation) {\n this.lastSource = undefined;\n this.restoredId = 0;\n this.scheduleScrollEvent(e, this.urlSerializer.parse(e.url).fragment);\n }\n });\n }\n consumeScrollEvents() {\n return this.transitions.events.subscribe((e) => {\n if (!(e instanceof Scroll))\n return;\n // a popstate event. The pop state event will always ignore anchor scrolling.\n if (e.position) {\n if (this.options.scrollPositionRestoration === 'top') {\n this.viewportScroller.scrollToPosition([0, 0]);\n }\n else if (this.options.scrollPositionRestoration === 'enabled') {\n this.viewportScroller.scrollToPosition(e.position);\n }\n // imperative navigation \"forward\"\n }\n else {\n if (e.anchor && this.options.anchorScrolling === 'enabled') {\n this.viewportScroller.scrollToAnchor(e.anchor);\n }\n else if (this.options.scrollPositionRestoration !== 'disabled') {\n this.viewportScroller.scrollToPosition([0, 0]);\n }\n }\n });\n }\n scheduleScrollEvent(routerEvent, anchor) {\n this.zone.runOutsideAngular(() => {\n // The scroll event needs to be delayed until after change detection. Otherwise, we may\n // attempt to restore the scroll position before the router outlet has fully rendered the\n // component by executing its update block of the template function.\n setTimeout(() => {\n this.zone.run(() => {\n this.transitions.events.next(new Scroll(routerEvent, this.lastSource === 'popstate' ? this.store[this.restoredId] : null, anchor));\n });\n }, 0);\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this.routerEventsSubscription?.unsubscribe();\n this.scrollEventsSubscription?.unsubscribe();\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller, deps: \"invalid\", target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterScroller, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: UrlSerializer }, { type: NavigationTransitions }, { type: i3.ViewportScroller }, { type: i0.NgZone }, { type: undefined }] });\n\n/**\n * Sets up providers necessary to enable `Router` functionality for the application.\n * Allows to configure a set of routes as well as extra features that should be enabled.\n *\n * @usageNotes\n *\n * Basic example of how you can add a Router to your application:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent, {\n * providers: [provideRouter(appRoutes)]\n * });\n * ```\n *\n * You can also enable optional features in the Router by adding functions from the `RouterFeatures`\n * type:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes,\n * withDebugTracing(),\n * withRouterConfig({paramsInheritanceStrategy: 'always'}))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link RouterFeatures}\n *\n * @publicApi\n * @param routes A set of `Route`s to use for the application routing table.\n * @param features Optional features to configure additional router behaviors.\n * @returns A set of providers to setup a Router.\n */\nfunction provideRouter(routes, ...features) {\n return makeEnvironmentProviders([\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode\n ? { provide: ROUTER_IS_PROVIDED, useValue: true }\n : [],\n { provide: ActivatedRoute, useFactory: rootRoute, deps: [Router] },\n { provide: APP_BOOTSTRAP_LISTENER, multi: true, useFactory: getBootstrapListener },\n features.map((feature) => feature.ɵproviders),\n ]);\n}\nfunction rootRoute(router) {\n return router.routerState.root;\n}\n/**\n * Helper function to create an object that represents a Router feature.\n */\nfunction routerFeature(kind, providers) {\n return { ɵkind: kind, ɵproviders: providers };\n}\n/**\n * An Injection token used to indicate whether `provideRouter` or `RouterModule.forRoot` was ever\n * called.\n */\nconst ROUTER_IS_PROVIDED = new InjectionToken('', {\n providedIn: 'root',\n factory: () => false,\n});\nconst routerIsProvidedDevModeCheck = {\n provide: ENVIRONMENT_INITIALIZER,\n multi: true,\n useFactory() {\n return () => {\n if (!inject(ROUTER_IS_PROVIDED)) {\n console.warn('`provideRoutes` was called without `provideRouter` or `RouterModule.forRoot`. ' +\n 'This is likely a mistake.');\n }\n };\n },\n};\n/**\n * Registers a DI provider for a set of routes.\n * @param routes The route configuration to provide.\n *\n * @usageNotes\n *\n * ```ts\n * @NgModule({\n * providers: [provideRoutes(ROUTES)]\n * })\n * class LazyLoadedChildModule {}\n * ```\n *\n * @deprecated If necessary, provide routes using the `ROUTES` `InjectionToken`.\n * @see {@link ROUTES}\n * @publicApi\n */\nfunction provideRoutes(routes) {\n return [\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode ? routerIsProvidedDevModeCheck : [],\n ];\n}\n/**\n * Enables customizable scrolling behavior for router navigations.\n *\n * @usageNotes\n *\n * Basic example of how you can enable scrolling feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withInMemoryScrolling())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n * @see {@link ViewportScroller}\n *\n * @publicApi\n * @param options Set of configuration parameters to customize scrolling behavior, see\n * `InMemoryScrollingOptions` for additional information.\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withInMemoryScrolling(options = {}) {\n const providers = [\n {\n provide: ROUTER_SCROLLER,\n useFactory: () => {\n const viewportScroller = inject(ViewportScroller);\n const zone = inject(NgZone);\n const transitions = inject(NavigationTransitions);\n const urlSerializer = inject(UrlSerializer);\n return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, options);\n },\n },\n ];\n return routerFeature(4 /* RouterFeatureKind.InMemoryScrollingFeature */, providers);\n}\nfunction getBootstrapListener() {\n const injector = inject(Injector);\n return (bootstrappedComponentRef) => {\n const ref = injector.get(ApplicationRef);\n if (bootstrappedComponentRef !== ref.components[0]) {\n return;\n }\n const router = injector.get(Router);\n const bootstrapDone = injector.get(BOOTSTRAP_DONE);\n if (injector.get(INITIAL_NAVIGATION) === 1 /* InitialNavigation.EnabledNonBlocking */) {\n router.initialNavigation();\n }\n injector.get(ROUTER_PRELOADER, null, InjectFlags.Optional)?.setUpPreloading();\n injector.get(ROUTER_SCROLLER, null, InjectFlags.Optional)?.init();\n router.resetRootComponentType(ref.componentTypes[0]);\n if (!bootstrapDone.closed) {\n bootstrapDone.next();\n bootstrapDone.complete();\n bootstrapDone.unsubscribe();\n }\n };\n}\n/**\n * A subject used to indicate that the bootstrapping phase is done. When initial navigation is\n * `enabledBlocking`, the first navigation waits until bootstrapping is finished before continuing\n * to the activation phase.\n */\nconst BOOTSTRAP_DONE = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'bootstrap done indicator' : '', {\n factory: () => {\n return new Subject();\n },\n});\nconst INITIAL_NAVIGATION = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'initial navigation' : '', { providedIn: 'root', factory: () => 1 /* InitialNavigation.EnabledNonBlocking */ });\n/**\n * Configures initial navigation to start before the root component is created.\n *\n * The bootstrap is blocked until the initial navigation is complete. This should be set in case\n * you use [server-side rendering](guide/ssr), but do not enable [hydration](guide/hydration) for\n * your application.\n *\n * @usageNotes\n *\n * Basic example of how you can enable this navigation behavior:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withEnabledBlockingInitialNavigation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @publicApi\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withEnabledBlockingInitialNavigation() {\n const providers = [\n { provide: INITIAL_NAVIGATION, useValue: 0 /* InitialNavigation.EnabledBlocking */ },\n {\n provide: APP_INITIALIZER,\n multi: true,\n deps: [Injector],\n useFactory: (injector) => {\n const locationInitialized = injector.get(LOCATION_INITIALIZED, Promise.resolve());\n return () => {\n return locationInitialized.then(() => {\n return new Promise((resolve) => {\n const router = injector.get(Router);\n const bootstrapDone = injector.get(BOOTSTRAP_DONE);\n afterNextNavigation(router, () => {\n // Unblock APP_INITIALIZER in case the initial navigation was canceled or errored\n // without a redirect.\n resolve(true);\n });\n injector.get(NavigationTransitions).afterPreactivation = () => {\n // Unblock APP_INITIALIZER once we get to `afterPreactivation`. At this point, we\n // assume activation will complete successfully (even though this is not\n // guaranteed).\n resolve(true);\n return bootstrapDone.closed ? of(void 0) : bootstrapDone;\n };\n router.initialNavigation();\n });\n });\n };\n },\n },\n ];\n return routerFeature(2 /* RouterFeatureKind.EnabledBlockingInitialNavigationFeature */, providers);\n}\n/**\n * Disables initial navigation.\n *\n * Use if there is a reason to have more control over when the router starts its initial navigation\n * due to some complex initialization logic.\n *\n * @usageNotes\n *\n * Basic example of how you can disable initial navigation:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withDisabledInitialNavigation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withDisabledInitialNavigation() {\n const providers = [\n {\n provide: APP_INITIALIZER,\n multi: true,\n useFactory: () => {\n const router = inject(Router);\n return () => {\n router.setUpLocationChangeListener();\n };\n },\n },\n { provide: INITIAL_NAVIGATION, useValue: 2 /* InitialNavigation.Disabled */ },\n ];\n return routerFeature(3 /* RouterFeatureKind.DisabledInitialNavigationFeature */, providers);\n}\n/**\n * Enables logging of all internal navigation events to the console.\n * Extra logging might be useful for debugging purposes to inspect Router event sequence.\n *\n * @usageNotes\n *\n * Basic example of how you can enable debug tracing:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withDebugTracing())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withDebugTracing() {\n let providers = [];\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n providers = [\n {\n provide: ENVIRONMENT_INITIALIZER,\n multi: true,\n useFactory: () => {\n const router = inject(Router);\n return () => router.events.subscribe((e) => {\n // tslint:disable:no-console\n console.group?.(`Router Event: ${e.constructor.name}`);\n console.log(stringifyEvent(e));\n console.log(e);\n console.groupEnd?.();\n // tslint:enable:no-console\n });\n },\n },\n ];\n }\n else {\n providers = [];\n }\n return routerFeature(1 /* RouterFeatureKind.DebugTracingFeature */, providers);\n}\nconst ROUTER_PRELOADER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router preloader' : '');\n/**\n * Allows to configure a preloading strategy to use. The strategy is configured by providing a\n * reference to a class that implements a `PreloadingStrategy`.\n *\n * @usageNotes\n *\n * Basic example of how you can configure preloading:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withPreloading(PreloadAllModules))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @param preloadingStrategy A reference to a class that implements a `PreloadingStrategy` that\n * should be used.\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withPreloading(preloadingStrategy) {\n const providers = [\n { provide: ROUTER_PRELOADER, useExisting: RouterPreloader },\n { provide: PreloadingStrategy, useExisting: preloadingStrategy },\n ];\n return routerFeature(0 /* RouterFeatureKind.PreloadingFeature */, providers);\n}\n/**\n * Allows to provide extra parameters to configure Router.\n *\n * @usageNotes\n *\n * Basic example of how you can provide extra configuration options:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withRouterConfig({\n * onSameUrlNavigation: 'reload'\n * }))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n *\n * @param options A set of parameters to configure Router, see `RouterConfigOptions` for\n * additional information.\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withRouterConfig(options) {\n const providers = [{ provide: ROUTER_CONFIGURATION, useValue: options }];\n return routerFeature(5 /* RouterFeatureKind.RouterConfigurationFeature */, providers);\n}\n/**\n * Provides the location strategy that uses the URL fragment instead of the history API.\n *\n * @usageNotes\n *\n * Basic example of how you can use the hash location option:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withHashLocation())\n * ]\n * }\n * );\n * ```\n *\n * @see {@link provideRouter}\n * @see {@link /api/common/HashLocationStrategy HashLocationStrategy}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withHashLocation() {\n const providers = [{ provide: LocationStrategy, useClass: HashLocationStrategy }];\n return routerFeature(6 /* RouterFeatureKind.RouterHashLocationFeature */, providers);\n}\n/**\n * Provides a function which is called when a navigation error occurs.\n *\n * This function is run inside application's [injection context](guide/di/dependency-injection-context)\n * so you can use the [`inject`](api/core/inject) function.\n *\n * This function can return a `RedirectCommand` to convert the error to a redirect, similar to returning\n * a `UrlTree` or `RedirectCommand` from a guard. This will also prevent the `Router` from emitting\n * `NavigationError`; it will instead emit `NavigationCancel` with code NavigationCancellationCode.Redirect.\n * Return values other than `RedirectCommand` are ignored and do not change any behavior with respect to\n * how the `Router` handles the error.\n *\n * @usageNotes\n *\n * Basic example of how you can use the error handler option:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withNavigationErrorHandler((e: NavigationError) =>\n * inject(MyErrorTracker).trackError(e)))\n * ]\n * }\n * );\n * ```\n *\n * @see {@link NavigationError}\n * @see {@link /api/core/inject inject}\n * @see {@link runInInjectionContext}\n *\n * @returns A set of providers for use with `provideRouter`.\n *\n * @publicApi\n */\nfunction withNavigationErrorHandler(handler) {\n const providers = [\n {\n provide: NAVIGATION_ERROR_HANDLER,\n useValue: handler,\n },\n ];\n return routerFeature(7 /* RouterFeatureKind.NavigationErrorHandlerFeature */, providers);\n}\n/**\n * Enables binding information from the `Router` state directly to the inputs of the component in\n * `Route` configurations.\n *\n * @usageNotes\n *\n * Basic example of how you can enable the feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withComponentInputBinding())\n * ]\n * }\n * );\n * ```\n *\n * The router bindings information from any of the following sources:\n *\n * - query parameters\n * - path and matrix parameters\n * - static route data\n * - data from resolvers\n *\n * Duplicate keys are resolved in the same order from above, from least to greatest,\n * meaning that resolvers have the highest precedence and override any of the other information\n * from the route.\n *\n * Importantly, when an input does not have an item in the route data with a matching key, this\n * input is set to `undefined`. This prevents previous information from being\n * retained if the data got removed from the route (i.e. if a query parameter is removed).\n * Default values can be provided with a resolver on the route to ensure the value is always present\n * or an input and use an input transform in the component.\n *\n * @see {@link /guide/components/inputs#input-transforms Input Transforms}\n * @returns A set of providers for use with `provideRouter`.\n */\nfunction withComponentInputBinding() {\n const providers = [\n RoutedComponentInputBinder,\n { provide: INPUT_BINDER, useExisting: RoutedComponentInputBinder },\n ];\n return routerFeature(8 /* RouterFeatureKind.ComponentInputBindingFeature */, providers);\n}\n/**\n * Enables view transitions in the Router by running the route activation and deactivation inside of\n * `document.startViewTransition`.\n *\n * Note: The View Transitions API is not available in all browsers. If the browser does not support\n * view transitions, the Router will not attempt to start a view transition and continue processing\n * the navigation as usual.\n *\n * @usageNotes\n *\n * Basic example of how you can enable the feature:\n * ```ts\n * const appRoutes: Routes = [];\n * bootstrapApplication(AppComponent,\n * {\n * providers: [\n * provideRouter(appRoutes, withViewTransitions())\n * ]\n * }\n * );\n * ```\n *\n * @returns A set of providers for use with `provideRouter`.\n * @see https://developer.chrome.com/docs/web-platform/view-transitions/\n * @see https://developer.mozilla.org/en-US/docs/Web/API/View_Transitions_API\n * @developerPreview\n */\nfunction withViewTransitions(options) {\n const providers = [\n { provide: CREATE_VIEW_TRANSITION, useValue: createViewTransition },\n {\n provide: VIEW_TRANSITION_OPTIONS,\n useValue: { skipNextTransition: !!options?.skipInitialTransition, ...options },\n },\n ];\n return routerFeature(9 /* RouterFeatureKind.ViewTransitionsFeature */, providers);\n}\n\n/**\n * The directives defined in the `RouterModule`.\n */\nconst ROUTER_DIRECTIVES = [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent];\n/**\n * @docsNotRequired\n */\nconst ROUTER_FORROOT_GUARD = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'router duplicate forRoot guard' : '');\n// TODO(atscott): All of these except `ActivatedRoute` are `providedIn: 'root'`. They are only kept\n// here to avoid a breaking change whereby the provider order matters based on where the\n// `RouterModule`/`RouterTestingModule` is imported. These can/should be removed as a \"breaking\"\n// change in a major version.\nconst ROUTER_PROVIDERS = [\n Location,\n { provide: UrlSerializer, useClass: DefaultUrlSerializer },\n Router,\n ChildrenOutletContexts,\n { provide: ActivatedRoute, useFactory: rootRoute, deps: [Router] },\n RouterConfigLoader,\n // Only used to warn when `provideRoutes` is used without `RouterModule` or `provideRouter`. Can\n // be removed when `provideRoutes` is removed.\n typeof ngDevMode === 'undefined' || ngDevMode\n ? { provide: ROUTER_IS_PROVIDED, useValue: true }\n : [],\n];\n/**\n * @description\n *\n * Adds directives and providers for in-app navigation among views defined in an application.\n * Use the Angular `Router` service to declaratively specify application states and manage state\n * transitions.\n *\n * You can import this NgModule multiple times, once for each lazy-loaded bundle.\n * However, only one `Router` service can be active.\n * To ensure this, there are two ways to register routes when importing this module:\n *\n * * The `forRoot()` method creates an `NgModule` that contains all the directives, the given\n * routes, and the `Router` service itself.\n * * The `forChild()` method creates an `NgModule` that contains all the directives and the given\n * routes, but does not include the `Router` service.\n *\n * @see [Routing and Navigation guide](guide/routing/common-router-tasks) for an\n * overview of how the `Router` service should be used.\n *\n * @publicApi\n */\nclass RouterModule {\n constructor() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n inject(ROUTER_FORROOT_GUARD, { optional: true });\n }\n }\n /**\n * Creates and configures a module with all the router providers and directives.\n * Optionally sets up an application listener to perform an initial navigation.\n *\n * When registering the NgModule at the root, import as follows:\n *\n * ```ts\n * @NgModule({\n * imports: [RouterModule.forRoot(ROUTES)]\n * })\n * class MyNgModule {}\n * ```\n *\n * @param routes An array of `Route` objects that define the navigation paths for the application.\n * @param config An `ExtraOptions` configuration object that controls how navigation is performed.\n * @return The new `NgModule`.\n *\n */\n static forRoot(routes, config) {\n return {\n ngModule: RouterModule,\n providers: [\n ROUTER_PROVIDERS,\n typeof ngDevMode === 'undefined' || ngDevMode\n ? config?.enableTracing\n ? withDebugTracing().ɵproviders\n : []\n : [],\n { provide: ROUTES, multi: true, useValue: routes },\n typeof ngDevMode === 'undefined' || ngDevMode\n ? {\n provide: ROUTER_FORROOT_GUARD,\n useFactory: provideForRootGuard,\n deps: [[Router, new Optional(), new SkipSelf()]],\n }\n : [],\n config?.errorHandler\n ? {\n provide: NAVIGATION_ERROR_HANDLER,\n useValue: config.errorHandler,\n }\n : [],\n { provide: ROUTER_CONFIGURATION, useValue: config ? config : {} },\n config?.useHash ? provideHashLocationStrategy() : providePathLocationStrategy(),\n provideRouterScroller(),\n config?.preloadingStrategy ? withPreloading(config.preloadingStrategy).ɵproviders : [],\n config?.initialNavigation ? provideInitialNavigation(config) : [],\n config?.bindToComponentInputs ? withComponentInputBinding().ɵproviders : [],\n config?.enableViewTransitions ? withViewTransitions().ɵproviders : [],\n provideRouterInitializer(),\n ],\n };\n }\n /**\n * Creates a module with all the router directives and a provider registering routes,\n * without creating a new Router service.\n * When registering for submodules and lazy-loaded submodules, create the NgModule as follows:\n *\n * ```ts\n * @NgModule({\n * imports: [RouterModule.forChild(ROUTES)]\n * })\n * class MyNgModule {}\n * ```\n *\n * @param routes An array of `Route` objects that define the navigation paths for the submodule.\n * @return The new NgModule.\n *\n */\n static forChild(routes) {\n return {\n ngModule: RouterModule,\n providers: [{ provide: ROUTES, multi: true, useValue: routes }],\n };\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\n static ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, imports: [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent], exports: [RouterOutlet, RouterLink, RouterLinkActive, ɵEmptyOutletComponent] });\n static ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: RouterModule, decorators: [{\n type: NgModule,\n args: [{\n imports: ROUTER_DIRECTIVES,\n exports: ROUTER_DIRECTIVES,\n }]\n }], ctorParameters: () => [] });\n/**\n * For internal use by `RouterModule` only. Note that this differs from `withInMemoryRouterScroller`\n * because it reads from the `ExtraOptions` which should not be used in the standalone world.\n */\nfunction provideRouterScroller() {\n return {\n provide: ROUTER_SCROLLER,\n useFactory: () => {\n const viewportScroller = inject(ViewportScroller);\n const zone = inject(NgZone);\n const config = inject(ROUTER_CONFIGURATION);\n const transitions = inject(NavigationTransitions);\n const urlSerializer = inject(UrlSerializer);\n if (config.scrollOffset) {\n viewportScroller.setOffset(config.scrollOffset);\n }\n return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, config);\n },\n };\n}\n// Note: For internal use only with `RouterModule`. Standalone setup via `provideRouter` should\n// provide hash location directly via `{provide: LocationStrategy, useClass: HashLocationStrategy}`.\nfunction provideHashLocationStrategy() {\n return { provide: LocationStrategy, useClass: HashLocationStrategy };\n}\n// Note: For internal use only with `RouterModule`. Standalone setup via `provideRouter` does not\n// need this at all because `PathLocationStrategy` is the default factory for `LocationStrategy`.\nfunction providePathLocationStrategy() {\n return { provide: LocationStrategy, useClass: PathLocationStrategy };\n}\nfunction provideForRootGuard(router) {\n if (router) {\n throw new ɵRuntimeError(4007 /* RuntimeErrorCode.FOR_ROOT_CALLED_TWICE */, `The Router was provided more than once. This can happen if 'forRoot' is used outside of the root injector.` +\n ` Lazy loaded modules should use RouterModule.forChild() instead.`);\n }\n return 'guarded';\n}\n// Note: For internal use only with `RouterModule`. Standalone router setup with `provideRouter`\n// users call `withXInitialNavigation` directly.\nfunction provideInitialNavigation(config) {\n return [\n config.initialNavigation === 'disabled' ? withDisabledInitialNavigation().ɵproviders : [],\n config.initialNavigation === 'enabledBlocking'\n ? withEnabledBlockingInitialNavigation().ɵproviders\n : [],\n ];\n}\n// TODO(atscott): This should not be in the public API\n/**\n * A DI token for the router initializer that\n * is called after the app is bootstrapped.\n *\n * @publicApi\n */\nconst ROUTER_INITIALIZER = new InjectionToken(typeof ngDevMode === 'undefined' || ngDevMode ? 'Router Initializer' : '');\nfunction provideRouterInitializer() {\n return [\n // ROUTER_INITIALIZER token should be removed. It's public API but shouldn't be. We can just\n // have `getBootstrapListener` directly attached to APP_BOOTSTRAP_LISTENER.\n { provide: ROUTER_INITIALIZER, useFactory: getBootstrapListener },\n { provide: APP_BOOTSTRAP_LISTENER, multi: true, useExisting: ROUTER_INITIALIZER },\n ];\n}\n\n/**\n * Maps an array of injectable classes with canMatch functions to an array of equivalent\n * `CanMatchFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanMatch(providers) {\n return providers.map((provider) => (...params) => inject(provider).canMatch(...params));\n}\n/**\n * Maps an array of injectable classes with canActivate functions to an array of equivalent\n * `CanActivateFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanActivate(providers) {\n return providers.map((provider) => (...params) => inject(provider).canActivate(...params));\n}\n/**\n * Maps an array of injectable classes with canActivateChild functions to an array of equivalent\n * `CanActivateChildFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanActivateChild(providers) {\n return providers.map((provider) => (...params) => inject(provider).canActivateChild(...params));\n}\n/**\n * Maps an array of injectable classes with canDeactivate functions to an array of equivalent\n * `CanDeactivateFn` for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='CanActivate'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToCanDeactivate(providers) {\n return providers.map((provider) => (...params) => inject(provider).canDeactivate(...params));\n}\n/**\n * Maps an injectable class with a resolve function to an equivalent `ResolveFn`\n * for use in a `Route` definition.\n *\n * Usage {@example router/utils/functional_guards.ts region='Resolve'}\n *\n * @publicApi\n * @see {@link Route}\n */\nfunction mapToResolve(provider) {\n return (...params) => inject(provider).resolve(...params);\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the router package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('19.2.1');\n\nfunction getLoadedRoutes(route) {\n return route._loadedRoutes;\n}\nɵpublishExternalGlobalUtil('ɵgetLoadedRoutes', getLoadedRoutes);\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ActivatedRoute, ActivatedRouteSnapshot, ActivationEnd, ActivationStart, BaseRouteReuseStrategy, ChildActivationEnd, ChildActivationStart, ChildrenOutletContexts, DefaultTitleStrategy, DefaultUrlSerializer, EventType, GuardsCheckEnd, GuardsCheckStart, NavigationCancel, NavigationCancellationCode, NavigationEnd, NavigationError, NavigationSkipped, NavigationSkippedCode, NavigationStart, NoPreloading, OutletContext, PRIMARY_OUTLET, PreloadAllModules, PreloadingStrategy, ROUTER_CONFIGURATION, ROUTER_INITIALIZER, ROUTER_OUTLET_DATA, ROUTES, RedirectCommand, ResolveEnd, ResolveStart, RouteConfigLoadEnd, RouteConfigLoadStart, RouteReuseStrategy, Router, RouterEvent, RouterLink, RouterLinkActive, RouterLink as RouterLinkWithHref, RouterModule, RouterOutlet, RouterPreloader, RouterState, RouterStateSnapshot, RoutesRecognized, Scroll, TitleStrategy, UrlHandlingStrategy, UrlSegment, UrlSegmentGroup, UrlSerializer, UrlTree, VERSION, convertToParamMap, createUrlTreeFromSnapshot, defaultUrlMatcher, mapToCanActivate, mapToCanActivateChild, mapToCanDeactivate, mapToCanMatch, mapToResolve, provideRouter, provideRoutes, withComponentInputBinding, withDebugTracing, withDisabledInitialNavigation, withEnabledBlockingInitialNavigation, withHashLocation, withInMemoryScrolling, withNavigationErrorHandler, withPreloading, withRouterConfig, withViewTransitions, ɵEmptyOutletComponent, ROUTER_PROVIDERS as ɵROUTER_PROVIDERS, afterNextNavigation as ɵafterNextNavigation, loadChildren as ɵloadChildren };\n","import { operate } from '../util/lift';\nimport { scanInternals } from './scanInternals';\nexport function scan(accumulator, seed) {\n return operate(scanInternals(accumulator, seed, arguments.length >= 2, true));\n}\n","import { createOperatorSubscriber } from './OperatorSubscriber';\nexport function scanInternals(accumulator, seed, hasSeed, emitOnNext, emitBeforeComplete) {\n return (source, subscriber) => {\n let hasState = hasSeed;\n let state = seed;\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n const i = index++;\n state = hasState\n ?\n accumulator(state, value, i)\n :\n ((hasState = true), value);\n emitOnNext && subscriber.next(state);\n }, emitBeforeComplete &&\n (() => {\n hasState && subscriber.next(state);\n subscriber.complete();\n })));\n };\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","\n \n\n\n \n \n \n \n \n\n \n \n = null;\n protected questions: MongoStoredObject[] = [];\n protected isLoading = true;\n protected currentQuestionIndex = 0;\n protected answers: {\n question: string;\n result: IPsychologicalSurveyAnswerValue;\n }[] = [];\n\n public constructor(\n private readonly _psychologicalSurveyApiService: PsychologicalSurveyApiService,\n private readonly _toastSerivce: ToastService,\n private readonly _loadingCtrl: LoadingController,\n private readonly _userEntityService: UserEntityService,\n private readonly _modalCtrl: ModalController\n ) {\n super();\n\n this._psychologicalSurveyApiService\n .getCurrentPsychologicalSurvey()\n .subscribe((res) => {\n this.survey = res.survey;\n this.questions = res.questions;\n this.isLoading = false;\n });\n }\n\n protected get currentQuestion() {\n if (this.questions.length === 0) {\n return null;\n }\n\n const question = this.questions[this.currentQuestionIndex];\n const answer = question\n ? this.answers.find((a) => a.question === question._id)?.result\n : null;\n\n return {\n question,\n answer\n } as any;\n }\n\n protected async onQuestionComplete(event: {\n questionId: string;\n result: IPsychologicalSurveyAnswerValue;\n }) {\n this.answers.push({\n question: event.questionId,\n result: event.result\n });\n\n if (this.currentQuestionIndex === this.questions.length - 1) {\n const loading = await this._loadingCtrl.create({\n message: 'Please wait...'\n });\n loading.present();\n\n this._psychologicalSurveyApiService\n .answerToPsychologicalSurvey({\n path: { surveyId: this.survey._id },\n body: { questionAnswers: this.answers }\n })\n .subscribe({\n next: () => {\n loading.dismiss();\n this._toastSerivce.presentToast(\n 'Your answer has been submitted! Thank you!'\n );\n this._userEntityService.update();\n this.confirm();\n },\n error: () => {\n loading.dismiss();\n this._toastSerivce.presentToast('Unable to complete the survey');\n this.confirm();\n }\n });\n } else {\n this.currentQuestionIndex++;\n }\n }\n\n protected onStepBack() {\n if (this.currentQuestionIndex > 0) {\n this.currentQuestionIndex--;\n }\n }\n\n protected confirm(): void {\n this._modalCtrl.dismiss(null, 'confirm', this._modalName);\n }\n}\n","\n \n When are you off today? \n \n \n\n\n \n\n\n \n \n \n\n \n \n Submit\n \n
\n \n \n I don't work today\n \n
\n \n \n","import { Component } from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { ModalClass } from '@core/class/modal.class';\nimport { TodaysShiftApiService } from '@core/service/api/todaysShift.api.service';\nimport { ToastService } from '@core/service/toast.service';\nimport { LoadingController, ModalController } from '@ionic/angular';\nimport { add } from 'date-fns';\n\n@Component({\n selector: 'app-todays-shift-modal',\n templateUrl: './todays-shift-modal.component.html',\n standalone: false\n})\nexport class TodaysShiftModalComponent extends ModalClass {\n protected form = new FormGroup({\n start: new FormControl('00:00', Validators.required),\n end: new FormControl('00:00', Validators.required)\n });\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _loadingCtrl: LoadingController,\n private readonly _todaysShiftApiService: TodaysShiftApiService,\n private readonly _toastService: ToastService\n ) {\n super();\n\n const start = new Date();\n start.setMinutes(Math.floor(start.getMinutes() / 30) * 30);\n\n const end = add(start, { hours: 6 });\n\n this.form.reset({\n start: `${start.getHours()}:${start.getMinutes()}`,\n end: `${end.getHours()}:${end.getMinutes()}`\n });\n }\n\n protected async iDontWorkToday() {\n const loading = await this._loadingCtrl.create({\n message: 'Loading...'\n });\n loading.present();\n\n this._todaysShiftApiService.setShiftTime({ body: {} }).subscribe({\n next: (res) => {\n loading.dismiss();\n this._modalCtrl.dismiss(res, 'confirm', this._modalName);\n },\n error: () => {\n loading.dismiss();\n this._toastService.presentToast('Unable to set the shift time');\n }\n });\n }\n\n protected async onSubmitClick() {\n const loading = await this._loadingCtrl.create({\n message: 'Loading...'\n });\n loading.present();\n\n const formValue = this.form.value;\n\n this._todaysShiftApiService\n .setShiftTime({ body: { start: formValue.start, end: formValue.end } })\n .subscribe({\n next: (res) => {\n loading.dismiss();\n this._modalCtrl.dismiss(res, 'confirm', this._modalName);\n },\n error: () => {\n loading.dismiss();\n this._toastService.presentToast('Unable to set the shift time');\n }\n });\n }\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { PsychologicalSurveyModalComponent } from '@app/modals/psychological-survey-modal/psychological-survey-modal.component';\nimport { TodaysShiftModalComponent } from '@app/modals/todays-shift-modal/todays-shift-modal.component';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { showModal } from '@app/utils/modal';\nimport { EUserScheduleType } from '@backend/models/types/user';\nimport { IUserShiftTime } from '@backend/models/types/user-shift-time';\nimport {\n TSpecQueryGetUserLatestShiftTime,\n TSpecRoute_getUserLatestShiftTime\n} from '@backend/types/generated/Users/getUserLatestShiftTime';\nimport {\n TSpecBodySetShiftTime,\n TSpecRoute_setShiftTime\n} from '@backend/types/generated/Users/setShiftTime';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalController } from '@ionic/angular';\nimport { isSameDay, isWithinInterval, subMinutes } from 'date-fns';\nimport { Observable, take } from 'rxjs';\nimport { PsychologicalSurveyApiService } from './psychologicalSurvey.api.service';\n\n@Injectable()\nexport class TodaysShiftApiService {\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _authenticationService: AuthenticationService,\n private readonly _httpClient: HttpClient,\n private readonly _psychologicalSurveyApiService: PsychologicalSurveyApiService\n ) {}\n\n public async askTodaysShift(dailySurveyPNTime = 0) {\n const user = this._authenticationService.user;\n\n if (user && user.schedule) {\n this.getUserLatestShiftTime({ query: {} })\n .pipe(take(1))\n .subscribe(async (lastShift) => {\n if (\n user.schedule.scheduleType === EUserScheduleType.VARIABLE &&\n (!lastShift || !isSameDay(new Date(lastShift.date), new Date()))\n ) {\n await showModal(\n { component: TodaysShiftModalComponent },\n this._modalCtrl,\n {\n canDismiss: async (_, role) => role === 'confirm',\n useTopModalAsParent: true\n }\n );\n }\n\n if (dailySurveyPNTime) {\n let todaysShiftEnd: string | null = null;\n\n if (user.schedule.scheduleType === EUserScheduleType.FIXED) {\n const weekDayIndex = new Date().getDay();\n\n if (user.schedule.weekDays[weekDayIndex]) {\n todaysShiftEnd = user.schedule.weekTime[weekDayIndex].to;\n }\n } else if (\n user.schedule.scheduleType === EUserScheduleType.VARIABLE\n ) {\n if (\n lastShift &&\n isSameDay(new Date(lastShift.date), new Date()) &&\n lastShift.end\n ) {\n todaysShiftEnd = lastShift.end;\n }\n }\n\n if (todaysShiftEnd) {\n const splitted = todaysShiftEnd.split(':');\n\n const dateTo = new Date();\n const toHour = Number(splitted[0]);\n const toMinute = Number(splitted[1]);\n dateTo.setHours(toHour);\n dateTo.setMinutes(toMinute);\n\n const dateFrom = subMinutes(dateTo, dailySurveyPNTime);\n\n const showSurvey = isWithinInterval(new Date(), {\n start: dateFrom,\n end: dateTo\n });\n\n if (showSurvey) {\n this._psychologicalSurveyApiService\n .getUnansweredPsychologicalSurveys({\n query: { skipSurveyMode: true }\n })\n .pipe(take(1))\n .subscribe(({ items }) => {\n if (items.length) {\n showModal(\n {\n component: PsychologicalSurveyModalComponent\n },\n this._modalCtrl,\n {\n canDismiss: async (_, role) => role === 'confirm',\n useTopModalAsParent: true\n }\n );\n }\n });\n }\n }\n }\n });\n }\n }\n\n public getUserLatestShiftTime(params: {\n query: TSpecQueryGetUserLatestShiftTime;\n }): Observable | null> {\n return this._httpClient.get | null>(\n TSpecRoute_getUserLatestShiftTime(),\n { params: { ...params.query } }\n );\n }\n\n public setShiftTime(params: {\n body: TSpecBodySetShiftTime;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_setShiftTime(),\n params.body\n );\n }\n}\n","import addMinutes from \"../addMinutes/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\nimport toInteger from \"../_lib/toInteger/index.js\";\n/**\n * @name subMinutes\n * @category Minute Helpers\n * @summary Subtract the specified number of minutes from the given date.\n *\n * @description\n * Subtract the specified number of minutes from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of minutes to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the minutes subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 30 minutes from 10 July 2014 12:00:00:\n * const result = subMinutes(new Date(2014, 6, 10, 12, 0), 30)\n * //=> Thu Jul 10 2014 11:30:00\n */\nexport default function subMinutes(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var amount = toInteger(dirtyAmount);\n return addMinutes(dirtyDate, -amount);\n}","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getUserLatestShiftTime = () => \"/users/latest-shift-time\";\n\nexport type TSpecHandler_getUserLatestShiftTime = RequestHandler;\n\nexport interface TSpecPathGetUserLatestShiftTime { }\n\nexport interface TSpecBodyGetUserLatestShiftTime {}\n\nexport interface TSpecQueryGetUserLatestShiftTime {\n userId?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_setShiftTime = () => \"/user/shift-time\";\n\nexport type TSpecHandler_setShiftTime = RequestHandler;\n\nexport interface TSpecPathSetShiftTime { }\n\nexport interface TSpecBodySetShiftTime {\n start?: string;\n end?: string;\n}\n\nexport interface TSpecQuerySetShiftTime {\n AppVersion?: string;\n AppUser?: string;\n}\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = subMilliseconds;\nvar _index = _interopRequireDefault(require(\"../addMilliseconds/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\nvar _index3 = _interopRequireDefault(require(\"../_lib/toInteger/index.js\"));\n/**\n * @name subMilliseconds\n * @category Millisecond Helpers\n * @summary Subtract the specified number of milliseconds from the given date.\n *\n * @description\n * Subtract the specified number of milliseconds from the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of milliseconds to be subtracted. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the milliseconds subtracted\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Subtract 750 milliseconds from 10 July 2014 12:45:30.000:\n * const result = subMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)\n * //=> Thu Jul 10 2014 12:45:29.250\n */\nfunction subMilliseconds(dirtyDate, dirtyAmount) {\n (0, _index2.default)(2, arguments);\n var amount = (0, _index3.default)(dirtyAmount);\n return (0, _index.default)(dirtyDate, -amount);\n}\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar _index = _interopRequireDefault(require(\"../../../_lib/buildFormatLongFn/index.js\"));\nvar dateFormats = {\n full: 'EEEE, MMMM do, y',\n long: 'MMMM do, y',\n medium: 'MMM d, y',\n short: 'MM/dd/yyyy'\n};\nvar timeFormats = {\n full: 'h:mm:ss a zzzz',\n long: 'h:mm:ss a z',\n medium: 'h:mm:ss a',\n short: 'h:mm a'\n};\nvar dateTimeFormats = {\n full: \"{{date}} 'at' {{time}}\",\n long: \"{{date}} 'at' {{time}}\",\n medium: '{{date}}, {{time}}',\n short: '{{date}}, {{time}}'\n};\nvar formatLong = {\n date: (0, _index.default)({\n formats: dateFormats,\n defaultWidth: 'full'\n }),\n time: (0, _index.default)({\n formats: timeFormats,\n defaultWidth: 'full'\n }),\n dateTime: (0, _index.default)({\n formats: dateTimeFormats,\n defaultWidth: 'full'\n })\n};\nvar _default = formatLong;\nexports.default = _default;\nmodule.exports = exports.default;","import {\n AfterViewInit,\n ChangeDetectionStrategy,\n Component,\n HostBinding,\n Input\n} from '@angular/core';\n\n@Component({\n selector: 'app-full-height-container',\n templateUrl: './full-height-container.component.html',\n styleUrls: ['./full-height-container.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class FullHeightContainerComponent implements AfterViewInit {\n @Input()\n public readonly maxWidth: 'default' | 'modal' = 'default';\n\n @Input()\n public readonly isModal: boolean = false;\n\n @Input()\n public readonly isFullHeight: boolean = false;\n\n @Input()\n public readonly isVirtualScroll: boolean = false;\n\n @Input()\n public readonly withVerticalPadding: boolean = false;\n\n @HostBinding('class.full-height')\n public get fullHeight() {\n return this.isFullHeight || this.isVirtualScroll;\n }\n\n @HostBinding('class.is-modal')\n public get modal() {\n return this.isModal;\n }\n\n public ngAfterViewInit(): void {\n if (this.isVirtualScroll && this.isModal) {\n const scrollcontainer = document.querySelector(\n '.virtual-scroll-container'\n );\n\n if (scrollcontainer) {\n scrollcontainer.ontouchmove = function (e) {\n e.stopPropagation();\n };\n }\n }\n }\n}\n","\n \n \n","export const dateTimestampProvider = {\n now() {\n return (dateTimestampProvider.delegate || Date).now();\n },\n delegate: undefined,\n};\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { DirectivesModule } from '@app/modules/directives.module';\nimport { FormatTimeModule } from '@app/modules/format-time/format-time.module';\nimport { IonicModule } from '@ionic/angular';\nimport { TimeFormControlComponent } from './time-form-control.component';\n\n@NgModule({\n declarations: [TimeFormControlComponent],\n imports: [CommonModule, IonicModule, DirectivesModule, FormatTimeModule],\n exports: [TimeFormControlComponent]\n})\nexport class TimeFormControlModule {}\n","/**\n * @license Angular v19.2.1\n * (c) 2010-2025 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Optional, Inject, ɵɵinject, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, untracked, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, PLATFORM_ID, ɵIMAGE_CONFIG, Renderer2, ElementRef, Injector, DestroyRef, ɵperformanceMarkFeature, NgZone, ApplicationRef, ChangeDetectorRef, numberAttribute, booleanAttribute, ɵIMAGE_CONFIG_DEFAULTS, ɵunwrapSafeValue } from '@angular/core';\nexport { ɵIMAGE_CONFIG as IMAGE_CONFIG } from '@angular/core';\nimport { Subject } from 'rxjs';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n _DOM ??= adapter;\n}\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * This class wraps the platform Navigation API which allows server-specific and test\n * implementations.\n */\nclass PlatformNavigation {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, providedIn: 'platform', useFactory: () => window.navigation });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformNavigation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => window.navigation }]\n }] });\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken(ngDevMode ? 'DocumentToken' : '');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link /api/router/Router Router} in order to navigate between routes. Since all interactions between\n * {@link /api/router/Router Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }]\n }] });\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? 'Location Initialized' : '');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n _location;\n _history;\n _doc = inject(DOCUMENT);\n constructor() {\n super();\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n this._history.pushState(state, title, url);\n }\n replaceState(state, title, url) {\n this._history.replaceState(state, title, url);\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: () => new BrowserPlatformLocation() });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n useFactory: () => new BrowserPlatformLocation(),\n }]\n }], ctorParameters: () => [] });\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n // If `start` is an empty string, return `end` as the result.\n if (!start)\n return end;\n // If `end` is an empty string, return `start` as the result.\n if (!end)\n return start;\n // If `start` ends with a slash, remove the leading slash from `end`.\n if (start.endsWith('/')) {\n return end.startsWith('/') ? start + end.slice(1) : start + end;\n }\n // If `start` doesn't end with a slash, add one if `end` doesn't start with a slash.\n return end.startsWith('/') ? start + end : `${start}/${end}`;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n // Find the index of the first occurrence of `#`, `?`, or the end of the string.\n // This marks the start of the query string, fragment, or the end of the URL path.\n const pathEndIdx = url.search(/#|\\?|$/);\n // Check if the character before `pathEndIdx` is a trailing slash.\n // If it is, remove the trailing slash and return the modified URL.\n // Otherwise, return the URL as is.\n return url[pathEndIdx - 1] === '/' ? url.slice(0, pathEndIdx - 1) + url.slice(pathEndIdx) : url;\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? `?${params}` : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com/#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined DI token for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```ts\n * import {NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken(ngDevMode ? 'appBaseHref' : '');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see {@link NumberFormatStyle}\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.NumberFormat` determine the number format instead\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n *\n * @deprecated We recommend you create a map of locale to ISO 4217 currency codes.\n * Time relative currency data is provided by the CLDR project. See https://www.unicode.org/cldr/charts/44/supplemental/detailed_territory_currency_information.html\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.PluralRules` instead\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex.LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see {@link getLocaleExtraDayPeriods}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.DateTimeFormat` determine the day period instead.\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see {@link getLocaleExtraDayPeriodRules}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * To extract a day period use `Intl.DateTimeFormat` with the `dayPeriod` option instead.\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */],\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * For dates and numbers, let `Intl.DateTimeFormat()` and `Intl.NumberFormat()` determine the writing direction.\n * The `Intl` alternative [`getTextInfo`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Intl/Locale/getTextInfo).\n * has only partial support (Chromium M99 & Safari 17).\n * 3rd party alternatives like [`rtl-detect`](https://www.npmjs.com/package/rtl-detect) can work around this issue.\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * You can use `Intl.NumberFormat().formatToParts()` to extract the currency symbol.\n * For example: `Intl.NumberFormat('en', {style:'currency', currency: 'USD'}).formatToParts().find(part => part.type === 'currency').value`\n * returns `$` for USD currency code in the `en` locale.\n * Note: `US$` is a currency symbol for the `en-ca` locale but not the `en-us` locale.\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * This function should not be used anymore. Let `Intl.NumberFormat` determine the number of digits to display for the currency\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`).\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see {@link DatePipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach((value) => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter\n ? dateFormatter(date, locale, dateTimezoneOffset)\n : value === \"''\"\n ? \"'\"\n : value.replace(/(^'|'$)/g, '').replace(/''/g, \"'\");\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] ??= {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [\n shortTime,\n shortDate,\n ]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [\n mediumTime,\n mediumDate,\n ]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [\n longTime,\n longDate,\n ]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [\n fullTime,\n fullDate,\n ]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return opt_values != null && key in opt_values ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === 3 /* DateType.Hours */) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === 6 /* DateType.FractionalSeconds */) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case 0 /* DateType.FullYear */:\n return date.getFullYear();\n case 1 /* DateType.Month */:\n return date.getMonth();\n case 2 /* DateType.Date */:\n return date.getDate();\n case 3 /* DateType.Hours */:\n return date.getHours();\n case 4 /* DateType.Minutes */:\n return date.getMinutes();\n case 5 /* DateType.Seconds */:\n return date.getSeconds();\n case 6 /* DateType.FractionalSeconds */:\n return date.getMilliseconds();\n case 7 /* DateType.Day */:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case 2 /* TranslationType.Months */:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case 1 /* TranslationType.Days */:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case 0 /* TranslationType.DayPeriods */:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex((rule) => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = currentHours < to.hours || (currentHours === to.hours && currentMinutes < to.minutes);\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else {\n // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case 3 /* TranslationType.Eras */:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case 0 /* ZoneWidth.Short */:\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case 1 /* ZoneWidth.ShortGMT */:\n return 'GMT' + (zone >= 0 ? '+' : '') + padNumber(hours, 1, minusSign);\n case 2 /* ZoneWidth.Long */:\n return ('GMT' +\n (zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case 3 /* ZoneWidth.Extended */:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + (firstDayOfYear <= THURSDAY ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\n/**\n * ISO Week starts on day 1 (Monday) and ends with day 0 (Sunday)\n */\nfunction getThursdayThisIsoWeek(datetime) {\n // getDay returns 0-6 range with sunday as 0.\n const currentDay = datetime.getDay();\n // On a Sunday, read the previous Thursday since ISO weeks start on Monday.\n const deltaToThursday = currentDay === 0 ? -3 : THURSDAY - currentDay;\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + deltaToThursday);\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisIsoWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisIsoWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(3 /* TranslationType.Eras */, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(0 /* DateType.FullYear */, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(0 /* DateType.FullYear */, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(0 /* DateType.FullYear */, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(0 /* DateType.FullYear */, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(1 /* DateType.Month */, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(1 /* DateType.Month */, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter = dateStrGetter(2 /* TranslationType.Months */, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(2 /* DateType.Date */, 1);\n break;\n case 'dd':\n formatter = dateGetter(2 /* DateType.Date */, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(7 /* DateType.Day */, 1);\n break;\n case 'ccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(1 /* TranslationType.Days */, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(0 /* TranslationType.DayPeriods */, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(3 /* DateType.Hours */, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(3 /* DateType.Hours */, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(3 /* DateType.Hours */, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(3 /* DateType.Hours */, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(4 /* DateType.Minutes */, 1);\n break;\n case 'mm':\n formatter = dateGetter(4 /* DateType.Minutes */, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(5 /* DateType.Seconds */, 1);\n break;\n case 'ss':\n formatter = dateGetter(5 /* DateType.Seconds */, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 1);\n break;\n case 'SS':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 2);\n break;\n case 'SSS':\n formatter = dateGetter(6 /* DateType.FractionalSeconds */, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(0 /* ZoneWidth.Short */);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(3 /* ZoneWidth.Extended */);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(1 /* ZoneWidth.ShortGMT */);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(2 /* ZoneWidth.Long */);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if ((match = value.match(ISO8601_DATE_REGEX))) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every((d) => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return (res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim());\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0,\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1\n ? positive.split(DECIMAL_SEP)\n : [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1),\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = groups[2] || groups[1] ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) {\n /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, (roundAt = fractionSize + 1));\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n locale;\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\n static ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n/format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```html\n * ... \n *\n * ... \n * ```\n *\n * For more simple use cases you can use the [class bindings](/guide/templates/binding#css-class-and-style-property-bindings) directly.\n * It doesn't require importing a directive.\n *\n * ```html\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n * ```\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n *\n * @see [Class bindings](/guide/templates/binding#css-class-and-style-property-bindings)\n *\n * @publicApi\n */\nclass NgClass {\n _ngEl;\n _renderer;\n initialClasses = EMPTY_ARRAY;\n rawClass;\n stateMap = new Map();\n constructor(_ngEl, _renderer) {\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach((klass) => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgClass, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.Renderer2 }], propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link /api/core/Component Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInputs`: Optional component inputs object, which will be bind to the\n * component.\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```html\n * \n * \n * ```\n *\n * Customized injector/content\n * ```html\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```html\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n _viewContainerRef;\n // TODO(crisbeto): this should be `Type`, but doing so broke a few\n // targets in a TGP so we need to do it in a major version.\n /** Component that should be rendered in the outlet. */\n ngComponentOutlet = null;\n ngComponentOutletInputs;\n ngComponentOutletInjector;\n ngComponentOutletContent;\n ngComponentOutletNgModule;\n /**\n * @deprecated This input is deprecated, use `ngComponentOutletNgModule` instead.\n */\n ngComponentOutletNgModuleFactory;\n _componentRef;\n _moduleRef;\n /**\n * A helper data structure that allows us to track inputs that were part of the\n * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones\n * that are no longer referenced.\n */\n _inputsUsed = new Map();\n /**\n * Gets the instance of the currently-rendered component.\n * Will be null if no component has been rendered.\n */\n get componentInstance() {\n return this._componentRef?.instance ?? null;\n }\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n }\n _needToReCreateNgModuleInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutletNgModule'] !== undefined ||\n changes['ngComponentOutletNgModuleFactory'] !== undefined);\n }\n _needToReCreateComponentInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutlet'] !== undefined ||\n changes['ngComponentOutletContent'] !== undefined ||\n changes['ngComponentOutletInjector'] !== undefined ||\n this._needToReCreateNgModuleInstance(changes));\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (this._needToReCreateComponentInstance(changes)) {\n this._viewContainerRef.clear();\n this._inputsUsed.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (this._needToReCreateNgModuleInstance(changes)) {\n this._moduleRef?.destroy();\n if (this.ngComponentOutletNgModule) {\n this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));\n }\n else if (this.ngComponentOutletNgModuleFactory) {\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n }\n /** @nodoc */\n ngDoCheck() {\n if (this._componentRef) {\n if (this.ngComponentOutletInputs) {\n for (const inputName of Object.keys(this.ngComponentOutletInputs)) {\n this._inputsUsed.set(inputName, true);\n }\n }\n this._applyInputStateDiff(this._componentRef);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n this._moduleRef?.destroy();\n }\n _applyInputStateDiff(componentRef) {\n for (const [inputName, touched] of this._inputsUsed) {\n if (!touched) {\n // The input that was previously active no longer exists and needs to be set to undefined.\n componentRef.setInput(inputName, undefined);\n this._inputsUsed.delete(inputName);\n }\n else {\n // Since touched is true, it can be asserted that the inputs object is not empty.\n componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);\n this._inputsUsed.set(inputName, false);\n }\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInputs: \"ngComponentOutletInputs\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, exportAs: [\"ngComponentOutlet\"], usesOnChanges: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n exportAs: 'ngComponentOutlet',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }], propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInputs: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @publicApi\n */\nclass NgForOfContext {\n $implicit;\n ngForOf;\n index;\n count;\n constructor(\n /** Reference to the current item from the collection. */\n $implicit, \n /**\n * The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe\n * (`userStreams | async`).\n */\n ngForOf, \n /** Returns an index of the current item in the collection. */\n index, \n /** Returns total amount of items in the collection. */\n count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n // Indicates whether this is the first item in the collection.\n get first() {\n return this.index === 0;\n }\n // Indicates whether this is the last item in the collection.\n get last() {\n return this.index === this.count - 1;\n }\n // Indicates whether an index of this item in the collection is even.\n get even() {\n return this.index % 2 === 0;\n }\n // Indicates whether an index of this item in the collection is odd.\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/directives/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/directives/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```html\n * ... \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```html\n * \n * ... \n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/directives/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```html\n * \n * {{i}}/{{users.length}}. {{user}} default \n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }], propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/directives/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```html\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```html\n * Content to render when condition is\n * true.
Content to render when condition is true.
\n * Content to render when condition is false. \n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```html\n *
\n * Content to render when condition is true. \n * Content to render when condition is false. \n * ```\n *\n * Form with storing the value locally:\n *\n * ```html\n * {{value}}
\n * Content to render when value is null. \n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```html\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```html\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n _viewContainer;\n _context = new NgIfContext();\n _thenTemplateRef = null;\n _elseTemplateRef = null;\n _thenViewRef = null;\n _elseViewRef = null;\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /** @internal */\n static ngIfUseIfTypeGuard;\n /**\n * Assert the correct type of the expression bound to the `ngIf` input within the template.\n *\n * The presence of this static field is a signal to the Ivy template type check compiler that\n * when the `NgIf` structural directive renders its template, the type of the expression bound\n * to `ngIf` should be narrowed in some way. For `NgIf`, the binding expression itself is used to\n * narrow its type, which allows the strictNullChecks feature of TypeScript to work with `NgIf`.\n */\n static ngTemplateGuard_ngIf;\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }], propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n $implicit = null;\n ngIf = null;\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n _viewContainerRef;\n _templateRef;\n _created = false;\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```html\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```html\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```html\n * \n * \n * ... \n * ... \n * ... \n * \n * ... \n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```html\n * \n * ... \n * ... \n * ... \n * \n * \n * \n * ... \n * \n * ```\n *\n * @publicApi\n * @see {@link NgSwitchCase}\n * @see {@link NgSwitchDefault}\n * @see [Structural Directives](guide/directives/structural-directives)\n *\n */\nclass NgSwitch {\n _defaultViews = [];\n _defaultUsed = false;\n _caseCount = 0;\n _lastCaseCheckIndex = 0;\n _lastCasesMatched = false;\n _ngSwitch;\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value === this._ngSwitch;\n this._lastCasesMatched ||= matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```html\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * As of Angular v17 the NgSwitch directive uses strict equality comparison (`===`) instead of\n * loose equality (`==`) to match different cases.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchDefault}\n *\n */\nclass NgSwitchCase {\n ngSwitch;\n _view;\n /**\n * Stores the HTML template to be selected on match.\n */\n ngSwitchCase;\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }], propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchCase}\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }] });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```html\n * \n * there is nothing \n * there is one \n * there are a few \n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n _localization;\n _activeView;\n _caseViews = {};\n constructor(_localization) {\n this._localization = _localization;\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n }]\n }], ctorParameters: () => [{ type: NgLocalization }], propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```html\n * \n * ... \n * ... \n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n value;\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }] });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```html\n * ... \n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```html\n * ... \n * ```\n *\n * For more simple use cases you can use the [style bindings](/guide/templates/binding#css-class-and-style-property-bindings) directly.\n * It doesn't require importing a directive.\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```html\n * ... \n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @see [Style bindings](/guide/templates/binding#css-class-and-style-property-bindings)\n *\n * @publicApi\n */\nclass NgStyle {\n _ngEl;\n _differs;\n _renderer;\n _ngStyle = null;\n _differ = null;\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\n static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"19.2.1\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }], propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```html\n * \n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see {@link getCurrencySymbol}\n * @see {@link formatCurrency}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * {@example common/pipes/ts/currency_pipe.ts region='CurrencyPipe'}\n *\n * @publicApi\n */\nclass CurrencyPipe {\n _locale;\n _defaultCurrencyCode;\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }] });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b \n * c \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n const supports = typeof value === 'string' || Array.isArray(value);\n if (!supports) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\n static ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\n static ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\n static ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"19.2.1\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('19.2.1');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n // De-sugared tree-shakable injection\n // See #23917\n /** @nocollapse */\n static ɵprov = /** @pureOrBreakMyCode */ /* @__PURE__ */ ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => typeof ngServerMode !== 'undefined' && ngServerMode\n ? new NullViewportScroller()\n : new BrowserViewportScroller(inject(DOCUMENT), window),\n });\n}\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n document;\n window;\n offset = () => [0, 0];\n constructor(document, window) {\n this.document = document;\n this.window = window;\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n return [this.window.scrollX, this.window.scrollY];\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n this.window.scrollTo(position[0], position[1]);\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n this.window.history.scrollRestoration = scrollRestoration;\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' &&\n document.body &&\n typeof document.body.attachShadow === 'function') {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * Value (out of 100) of the requested quality for placeholder images.\n */\nconst PLACEHOLDER_QUALITY = '20';\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? new URL(url).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken(ngDevMode ? 'ImageLoader' : '', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`/cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params += `,quality=${PLACEHOLDER_QUALITY}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl,\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode\n ? [\n 'https://res.cloudinary.com/mysite',\n 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com',\n ]\n : undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n // For a placeholder image, we use the lowest image setting available to reduce the load time\n // else we use the auto size\n const quality = config.isPlaceholder ? 'q_auto:low' : 'q_auto';\n let params = `f_auto,${quality}`;\n if (config.width) {\n params += `,w_${config.width}`;\n }\n if (config.loaderParams?.['rounded']) {\n params += `,r_max`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n const params = [];\n if (width) {\n params.push(`w-${width}`);\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params.push(`q-${PLACEHOLDER_QUALITY}`);\n }\n const urlSegments = params.length ? [path, `tr:${params.join(',')}`, src] : [path, src];\n const url = new URL(urlSegments.join('/'));\n return url.href;\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl,\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n return url.href;\n}\n\n/**\n * Name and URL tester for Netlify.\n */\nconst netlifyLoaderInfo = {\n name: 'Netlify',\n testUrl: isNetlifyUrl,\n};\nconst NETLIFY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.netlify\\.app\\/.+/;\n/**\n * Tests whether a URL is from a Netlify site. This won't catch sites with a custom domain,\n * but it's a good start for sites in development. This is only used to warn users who haven't\n * configured an image loader.\n */\nfunction isNetlifyUrl(url) {\n return NETLIFY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Netlify and turns it into an Angular provider.\n *\n * @param path optional URL of the desired Netlify site. Defaults to the current site.\n * @returns Set of providers to configure the Netlify loader.\n *\n * @publicApi\n */\nfunction provideNetlifyLoader(path) {\n if (path && !isValidPath(path)) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply either the full URL to the Netlify site, or leave it empty to use the current site.`);\n }\n if (path) {\n const url = new URL(path);\n path = url.origin;\n }\n const loaderFn = (config) => {\n return createNetlifyUrl(config, path);\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n}\nconst validParams = new Map([\n ['height', 'h'],\n ['fit', 'fit'],\n ['quality', 'q'],\n ['q', 'q'],\n ['position', 'position'],\n]);\nfunction createNetlifyUrl(config, path) {\n // Note: `path` can be undefined, in which case we use a fake one to construct a `URL` instance.\n const url = new URL(path ?? 'https://a/');\n url.pathname = '/.netlify/images';\n if (!isAbsoluteUrl(config.src) && !config.src.startsWith('/')) {\n config.src = '/' + config.src;\n }\n url.searchParams.set('url', config.src);\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n // If the quality is specified in the loader config - always use provided value.\n const configQuality = config.loaderParams?.['quality'] ?? config.loaderParams?.['q'];\n if (config.isPlaceholder && !configQuality) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n for (const [param, value] of Object.entries(config.loaderParams ?? {})) {\n if (validParams.has(param)) {\n url.searchParams.set(validParams.get(param), value.toString());\n }\n else {\n if (ngDevMode) {\n console.warn(ɵformatRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, `The Netlify image loader has detected an \\`(\n TSpecRoute_getMyConnectedAccounts()\n );\n }\n\n public loginToConnectedAccount(params: {\n body: TSpecBodyLoginToConnectedAccount;\n }) {\n return this._httpClient.post<{\n authToken: AuthToken;\n user: UserModel;\n }>(TSpecRoute_loginToConnectedAccount(), params.body);\n }\n\n public removeMyConnectedAccount(params: {\n query: TSpecQueryRemoveMyConnectedAccount;\n }) {\n return this._httpClient.delete(\n TSpecRoute_removeMyConnectedAccount(),\n { params: { ...params.query } }\n );\n }\n\n public getConnectedAccountsGroups() {\n return this._httpClient.get<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n >(TSpecRoute_getConnectedAccountsGroups());\n }\n\n public removeConnectedAccountFromGroup(params: {\n query: TSpecQueryRemoveConnectedAccountFromGroup;\n }) {\n return this._httpClient.delete<\n MongoStoredObject<{ accounts: ConnectedAccountModel[] }>[]\n >(TSpecRoute_removeConnectedAccountFromGroup(), {\n params: { ...params.query }\n });\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getMyConnectedAccounts = () => \"/connected-accounts\";\n\nexport type TSpecHandler_getMyConnectedAccounts = RequestHandler;\n\nexport interface TSpecPathGetMyConnectedAccounts { }\n\nexport interface TSpecBodyGetMyConnectedAccounts {}\n\nexport interface TSpecQueryGetMyConnectedAccounts {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_loginToConnectedAccount = () => \"/connected-accounts/login\";\n\nexport type TSpecHandler_loginToConnectedAccount = RequestHandler;\n\nexport interface TSpecPathLoginToConnectedAccount { }\n\nexport interface TSpecBodyLoginToConnectedAccount {\n userId: string;\n}\n\nexport interface TSpecQueryLoginToConnectedAccount {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_removeMyConnectedAccount = () => \"/connected-accounts\";\n\nexport type TSpecHandler_removeMyConnectedAccount = RequestHandler;\n\nexport interface TSpecPathRemoveMyConnectedAccount { }\n\nexport interface TSpecBodyRemoveMyConnectedAccount {}\n\nexport interface TSpecQueryRemoveMyConnectedAccount {\n userId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getConnectedAccountsGroups = () => \"/connected-accounts/groups\";\n\nexport type TSpecHandler_getConnectedAccountsGroups = RequestHandler;\n\nexport interface TSpecPathGetConnectedAccountsGroups { }\n\nexport interface TSpecBodyGetConnectedAccountsGroups {}\n\nexport interface TSpecQueryGetConnectedAccountsGroups {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_removeConnectedAccountFromGroup = () => \"/connected-accounts/groups\";\n\nexport type TSpecHandler_removeConnectedAccountFromGroup = RequestHandler;\n\nexport interface TSpecPathRemoveConnectedAccountFromGroup { }\n\nexport interface TSpecBodyRemoveConnectedAccountFromGroup {}\n\nexport interface TSpecQueryRemoveConnectedAccountFromGroup {\n groupId: string;\n userId: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { d as doc } from './index-a5d50daf.js';\nimport { MENU_BACK_BUTTON_PRIORITY } from './hardware-back-button-06ef3c3e.js';\nimport { p as printIonWarning } from './index-9b0d46f4.js';\nimport { c as componentOnReady } from './helpers-da915de8.js';\nimport { b as getIonMode } from './ionic-global-c81d82ab.js';\nimport { c as createAnimation } from './animation-eab5a4ca.js';\n\n/**\n * baseAnimation\n * Base class which is extended by the various types. Each\n * type will provide their own animations for open and close\n * and registers itself with Menu.\n */\nconst baseAnimation = (isIos) => {\n // https://material.io/guidelines/motion/movement.html#movement-movement-in-out-of-screen-bounds\n // https://material.io/guidelines/motion/duration-easing.html#duration-easing-natural-easing-curves\n /**\n * \"Apply the sharp curve to items temporarily leaving the screen that may return\n * from the same exit point. When they return, use the deceleration curve. On mobile,\n * this transition typically occurs over 300ms\" -- MD Motion Guide\n */\n return createAnimation().duration(isIos ? 400 : 300);\n};\n\n/**\n * Menu Overlay Type\n * The menu slides over the content. The content\n * itself, which is under the menu, does not move.\n */\nconst menuOverlayAnimation = (menu) => {\n let closedX;\n let openedX;\n const width = menu.width + 8;\n const menuAnimation = createAnimation();\n const backdropAnimation = createAnimation();\n if (menu.isEndSide) {\n // right side\n closedX = width + 'px';\n openedX = '0px';\n }\n else {\n // left side\n closedX = -width + 'px';\n openedX = '0px';\n }\n menuAnimation.addElement(menu.menuInnerEl).fromTo('transform', `translateX(${closedX})`, `translateX(${openedX})`);\n const mode = getIonMode(menu);\n const isIos = mode === 'ios';\n const opacity = isIos ? 0.2 : 0.25;\n backdropAnimation.addElement(menu.backdropEl).fromTo('opacity', 0.01, opacity);\n return baseAnimation(isIos).addAnimation([menuAnimation, backdropAnimation]);\n};\n\n/**\n * Menu Push Type\n * The content slides over to reveal the menu underneath.\n * The menu itself also slides over to reveal its bad self.\n */\nconst menuPushAnimation = (menu) => {\n let contentOpenedX;\n let menuClosedX;\n const mode = getIonMode(menu);\n const width = menu.width;\n if (menu.isEndSide) {\n contentOpenedX = -width + 'px';\n menuClosedX = width + 'px';\n }\n else {\n contentOpenedX = width + 'px';\n menuClosedX = -width + 'px';\n }\n const menuAnimation = createAnimation()\n .addElement(menu.menuInnerEl)\n .fromTo('transform', `translateX(${menuClosedX})`, 'translateX(0px)');\n const contentAnimation = createAnimation()\n .addElement(menu.contentEl)\n .fromTo('transform', 'translateX(0px)', `translateX(${contentOpenedX})`);\n const backdropAnimation = createAnimation().addElement(menu.backdropEl).fromTo('opacity', 0.01, 0.32);\n return baseAnimation(mode === 'ios').addAnimation([menuAnimation, contentAnimation, backdropAnimation]);\n};\n\n/**\n * Menu Reveal Type\n * The content slides over to reveal the menu underneath.\n * The menu itself, which is under the content, does not move.\n */\nconst menuRevealAnimation = (menu) => {\n const mode = getIonMode(menu);\n const openedX = menu.width * (menu.isEndSide ? -1 : 1) + 'px';\n const contentOpen = createAnimation()\n .addElement(menu.contentEl) // REVIEW\n .fromTo('transform', 'translateX(0px)', `translateX(${openedX})`);\n return baseAnimation(mode === 'ios').addAnimation(contentOpen);\n};\n\nconst createMenuController = () => {\n const menuAnimations = new Map();\n const menus = [];\n const open = async (menu) => {\n const menuEl = await get(menu, true);\n if (menuEl) {\n return menuEl.open();\n }\n return false;\n };\n const close = async (menu) => {\n const menuEl = await (menu !== undefined ? get(menu, true) : getOpen());\n if (menuEl !== undefined) {\n return menuEl.close();\n }\n return false;\n };\n const toggle = async (menu) => {\n const menuEl = await get(menu, true);\n if (menuEl) {\n return menuEl.toggle();\n }\n return false;\n };\n const enable = async (shouldEnable, menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n menuEl.disabled = !shouldEnable;\n }\n return menuEl;\n };\n const swipeGesture = async (shouldEnable, menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n menuEl.swipeGesture = shouldEnable;\n }\n return menuEl;\n };\n const isOpen = async (menu) => {\n if (menu != null) {\n const menuEl = await get(menu);\n // eslint-disable-next-line @typescript-eslint/prefer-optional-chain\n return menuEl !== undefined && menuEl.isOpen();\n }\n else {\n const menuEl = await getOpen();\n return menuEl !== undefined;\n }\n };\n const isEnabled = async (menu) => {\n const menuEl = await get(menu);\n if (menuEl) {\n return !menuEl.disabled;\n }\n return false;\n };\n /**\n * Finds and returns the menu specified by \"menu\" if registered.\n * @param menu - The side or ID of the desired menu\n * @param logOnMultipleSideMenus - If true, this function will log a warning\n * if \"menu\" is a side but multiple menus on the same side were found. Since this function\n * is used in multiple places, we default this log to false so that the calling\n * functions can choose whether or not it is appropriate to log this warning.\n */\n const get = async (menu, logOnMultipleSideMenus = false) => {\n await waitUntilReady();\n if (menu === 'start' || menu === 'end') {\n // there could be more than one menu on the same side\n // so first try to get the enabled one\n const menuRefs = menus.filter((m) => m.side === menu && !m.disabled);\n if (menuRefs.length >= 1) {\n if (menuRefs.length > 1 && logOnMultipleSideMenus) {\n printIonWarning(`menuController queried for a menu on the \"${menu}\" side, but ${menuRefs.length} menus were found. The first menu reference will be used. If this is not the behavior you want then pass the ID of the menu instead of its side.`, menuRefs.map((m) => m.el));\n }\n return menuRefs[0].el;\n }\n // didn't find a menu side that is enabled\n // so try to get the first menu side found\n const sideMenuRefs = menus.filter((m) => m.side === menu);\n if (sideMenuRefs.length >= 1) {\n if (sideMenuRefs.length > 1 && logOnMultipleSideMenus) {\n printIonWarning(`menuController queried for a menu on the \"${menu}\" side, but ${sideMenuRefs.length} menus were found. The first menu reference will be used. If this is not the behavior you want then pass the ID of the menu instead of its side.`, sideMenuRefs.map((m) => m.el));\n }\n return sideMenuRefs[0].el;\n }\n }\n else if (menu != null) {\n // the menuId was not left or right\n // so try to get the menu by its \"id\"\n return find((m) => m.menuId === menu);\n }\n // return the first enabled menu\n const menuEl = find((m) => !m.disabled);\n if (menuEl) {\n return menuEl;\n }\n // get the first menu in the array, if one exists\n return menus.length > 0 ? menus[0].el : undefined;\n };\n /**\n * Get the instance of the opened menu. Returns `null` if a menu is not found.\n */\n const getOpen = async () => {\n await waitUntilReady();\n return _getOpenSync();\n };\n /**\n * Get all menu instances.\n */\n const getMenus = async () => {\n await waitUntilReady();\n return getMenusSync();\n };\n /**\n * Get whether or not a menu is animating. Returns `true` if any\n * menu is currently animating.\n */\n const isAnimating = async () => {\n await waitUntilReady();\n return isAnimatingSync();\n };\n const registerAnimation = (name, animation) => {\n menuAnimations.set(name, animation);\n };\n const _register = (menu) => {\n if (menus.indexOf(menu) < 0) {\n menus.push(menu);\n }\n };\n const _unregister = (menu) => {\n const index = menus.indexOf(menu);\n if (index > -1) {\n menus.splice(index, 1);\n }\n };\n const _setOpen = async (menu, shouldOpen, animated, role) => {\n if (isAnimatingSync()) {\n return false;\n }\n if (shouldOpen) {\n const openedMenu = await getOpen();\n if (openedMenu && menu.el !== openedMenu) {\n await openedMenu.setOpen(false, false);\n }\n }\n return menu._setOpen(shouldOpen, animated, role);\n };\n const _createAnimation = (type, menuCmp) => {\n const animationBuilder = menuAnimations.get(type); // TODO(FW-2832): type\n if (!animationBuilder) {\n throw new Error('animation not registered');\n }\n const animation = animationBuilder(menuCmp);\n return animation;\n };\n const _getOpenSync = () => {\n return find((m) => m._isOpen);\n };\n const getMenusSync = () => {\n return menus.map((menu) => menu.el);\n };\n const isAnimatingSync = () => {\n return menus.some((menu) => menu.isAnimating);\n };\n const find = (predicate) => {\n const instance = menus.find(predicate);\n if (instance !== undefined) {\n return instance.el;\n }\n return undefined;\n };\n const waitUntilReady = () => {\n return Promise.all(Array.from(document.querySelectorAll('ion-menu')).map((menu) => new Promise((resolve) => componentOnReady(menu, resolve))));\n };\n registerAnimation('reveal', menuRevealAnimation);\n registerAnimation('push', menuPushAnimation);\n registerAnimation('overlay', menuOverlayAnimation);\n doc === null || doc === void 0 ? void 0 : doc.addEventListener('ionBackButton', (ev) => {\n const openMenu = _getOpenSync();\n if (openMenu) {\n ev.detail.register(MENU_BACK_BUTTON_PRIORITY, () => {\n return openMenu.close();\n });\n }\n });\n return {\n registerAnimation,\n get,\n getMenus,\n getOpen,\n isEnabled,\n swipeGesture,\n isAnimating,\n isOpen,\n enable,\n toggle,\n close,\n open,\n _getOpenSync,\n _createAnimation,\n _register,\n _unregister,\n _setOpen,\n };\n};\nconst menuController = /*@__PURE__*/ createMenuController();\n\nexport { menuController as m };\n","import { __asyncGenerator, __await } from \"tslib\";\nimport { isFunction } from './isFunction';\nexport function readableStreamLikeToAsyncGenerator(readableStream) {\n return __asyncGenerator(this, arguments, function* readableStreamLikeToAsyncGenerator_1() {\n const reader = readableStream.getReader();\n try {\n while (true) {\n const { value, done } = yield __await(reader.read());\n if (done) {\n return yield __await(void 0);\n }\n yield yield __await(value);\n }\n }\n finally {\n reader.releaseLock();\n }\n });\n}\nexport function isReadableStreamLike(obj) {\n return isFunction(obj === null || obj === void 0 ? void 0 : obj.getReader);\n}\n","import toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name getDay\n * @category Weekday Helpers\n * @summary Get the day of the week of the given date.\n *\n * @description\n * Get the day of the week of the given date.\n *\n * @param {Date|Number} date - the given date\n * @returns {0|1|2|3|4|5|6} the day of week, 0 represents Sunday\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Which day of the week is 29 February 2012?\n * const result = getDay(new Date(2012, 1, 29))\n * //=> 3\n */\nexport default function getDay(dirtyDate) {\n requiredArgs(1, arguments);\n var date = toDate(dirtyDate);\n var day = date.getDay();\n return day;\n}","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { i as initialize } from './ionic-global-c81d82ab.js';\n\nconst globalScripts = initialize;\n\nexport { globalScripts as g };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { b as bootstrapLazy } from './index-28849c61.js';\nexport { s as setNonce } from './index-28849c61.js';\nimport { g as globalScripts } from './app-globals-5dbb61a5.js';\nimport './ionic-global-c81d82ab.js';\n\nconst defineCustomElements = async (win, options) => {\n if (typeof window === 'undefined') return undefined;\n await globalScripts();\n return bootstrapLazy(JSON.parse(\"[[\\\"ion-menu_3\\\",[[33,\\\"ion-menu-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"type\\\":[1],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]],[33,\\\"ion-menu\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"menuId\\\":[513,\\\"menu-id\\\"],\\\"type\\\":[1025],\\\"disabled\\\":[1028],\\\"side\\\":[513],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"maxEdgeStart\\\":[2,\\\"max-edge-start\\\"],\\\"isPaneVisible\\\":[32],\\\"isEndSide\\\":[32],\\\"isOpen\\\":[64],\\\"isActive\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"toggle\\\":[64],\\\"setOpen\\\":[64]},[[16,\\\"ionSplitPaneVisible\\\",\\\"onSplitPaneChanged\\\"],[2,\\\"click\\\",\\\"onBackdropClick\\\"]],{\\\"type\\\":[\\\"typeChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"side\\\":[\\\"sideChanged\\\"],\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"]}],[1,\\\"ion-menu-toggle\\\",{\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]]]],[\\\"ion-input-password-toggle\\\",[[33,\\\"ion-input-password-toggle\\\",{\\\"color\\\":[513],\\\"showIcon\\\":[1,\\\"show-icon\\\"],\\\"hideIcon\\\":[1,\\\"hide-icon\\\"],\\\"type\\\":[1025]},null,{\\\"type\\\":[\\\"onTypeChange\\\"]}]]],[\\\"ion-fab_3\\\",[[33,\\\"ion-fab-button\\\",{\\\"color\\\":[513],\\\"activated\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1],\\\"show\\\":[4],\\\"translucent\\\":[4],\\\"type\\\":[1],\\\"size\\\":[1],\\\"closeIcon\\\":[1,\\\"close-icon\\\"]}],[1,\\\"ion-fab\\\",{\\\"horizontal\\\":[1],\\\"vertical\\\":[1],\\\"edge\\\":[4],\\\"activated\\\":[1028],\\\"close\\\":[64],\\\"toggle\\\":[64]},null,{\\\"activated\\\":[\\\"activatedChanged\\\"]}],[1,\\\"ion-fab-list\\\",{\\\"activated\\\":[4],\\\"side\\\":[1]},null,{\\\"activated\\\":[\\\"activatedChanged\\\"]}]]],[\\\"ion-refresher_2\\\",[[0,\\\"ion-refresher-content\\\",{\\\"pullingIcon\\\":[1025,\\\"pulling-icon\\\"],\\\"pullingText\\\":[1,\\\"pulling-text\\\"],\\\"refreshingSpinner\\\":[1025,\\\"refreshing-spinner\\\"],\\\"refreshingText\\\":[1,\\\"refreshing-text\\\"]}],[32,\\\"ion-refresher\\\",{\\\"pullMin\\\":[2,\\\"pull-min\\\"],\\\"pullMax\\\":[2,\\\"pull-max\\\"],\\\"closeDuration\\\":[1,\\\"close-duration\\\"],\\\"snapbackDuration\\\":[1,\\\"snapback-duration\\\"],\\\"pullFactor\\\":[2,\\\"pull-factor\\\"],\\\"disabled\\\":[4],\\\"nativeRefresher\\\":[32],\\\"state\\\":[32],\\\"complete\\\":[64],\\\"cancel\\\":[64],\\\"getProgress\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-back-button\\\",[[33,\\\"ion-back-button\\\",{\\\"color\\\":[513],\\\"defaultHref\\\":[1025,\\\"default-href\\\"],\\\"disabled\\\":[516],\\\"icon\\\":[1],\\\"text\\\":[1],\\\"type\\\":[1],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-toast\\\",[[33,\\\"ion-toast\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"color\\\":[513],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"header\\\":[1],\\\"layout\\\":[1],\\\"message\\\":[1],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"position\\\":[1],\\\"positionAnchor\\\":[1,\\\"position-anchor\\\"],\\\"buttons\\\":[16],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"icon\\\":[1],\\\"htmlAttributes\\\":[16],\\\"swipeGesture\\\":[1,\\\"swipe-gesture\\\"],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"revealContentToScreenReader\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-card_5\\\",[[33,\\\"ion-card\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"type\\\":[1],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}],[32,\\\"ion-card-content\\\"],[33,\\\"ion-card-header\\\",{\\\"color\\\":[513],\\\"translucent\\\":[4]}],[33,\\\"ion-card-subtitle\\\",{\\\"color\\\":[513]}],[33,\\\"ion-card-title\\\",{\\\"color\\\":[513]}]]],[\\\"ion-item-option_3\\\",[[33,\\\"ion-item-option\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"expandable\\\":[4],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"target\\\":[1],\\\"type\\\":[1]}],[32,\\\"ion-item-options\\\",{\\\"side\\\":[1],\\\"fireSwipeEvent\\\":[64]}],[0,\\\"ion-item-sliding\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"getOpenAmount\\\":[64],\\\"getSlidingRatio\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"closeOpened\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-accordion_2\\\",[[49,\\\"ion-accordion\\\",{\\\"value\\\":[1],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"toggleIcon\\\":[1,\\\"toggle-icon\\\"],\\\"toggleIconSlot\\\":[1,\\\"toggle-icon-slot\\\"],\\\"state\\\":[32],\\\"isNext\\\":[32],\\\"isPrevious\\\":[32]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[33,\\\"ion-accordion-group\\\",{\\\"animated\\\":[4],\\\"multiple\\\":[4],\\\"value\\\":[1025],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"expand\\\":[1],\\\"requestAccordionToggle\\\":[64],\\\"getAccordions\\\":[64]},[[0,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"value\\\":[\\\"valueChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"readonly\\\":[\\\"readonlyChanged\\\"]}]]],[\\\"ion-infinite-scroll_2\\\",[[32,\\\"ion-infinite-scroll-content\\\",{\\\"loadingSpinner\\\":[1025,\\\"loading-spinner\\\"],\\\"loadingText\\\":[1,\\\"loading-text\\\"]}],[0,\\\"ion-infinite-scroll\\\",{\\\"threshold\\\":[1],\\\"disabled\\\":[4],\\\"position\\\":[1],\\\"isLoading\\\":[32],\\\"complete\\\":[64]},null,{\\\"threshold\\\":[\\\"thresholdChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-reorder_2\\\",[[33,\\\"ion-reorder\\\",null,[[2,\\\"click\\\",\\\"onClick\\\"]]],[0,\\\"ion-reorder-group\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"complete\\\":[64]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-segment_2\\\",[[33,\\\"ion-segment-button\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"disabled\\\":[1028],\\\"layout\\\":[1],\\\"type\\\":[1],\\\"value\\\":[8],\\\"checked\\\":[32],\\\"setFocus\\\":[64]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[33,\\\"ion-segment\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"scrollable\\\":[4],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"value\\\":[1032],\\\"selectOnFocus\\\":[4,\\\"select-on-focus\\\"],\\\"activated\\\":[32]},[[16,\\\"ionSegmentViewScroll\\\",\\\"handleSegmentViewScroll\\\"],[0,\\\"keydown\\\",\\\"onKeyDown\\\"]],{\\\"color\\\":[\\\"colorChanged\\\"],\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-chip\\\",[[33,\\\"ion-chip\\\",{\\\"color\\\":[513],\\\"outline\\\":[4],\\\"disabled\\\":[4]}]]],[\\\"ion-input\\\",[[38,\\\"ion-input\\\",{\\\"color\\\":[513],\\\"autocapitalize\\\":[1],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"autofocus\\\":[4],\\\"clearInput\\\":[4,\\\"clear-input\\\"],\\\"clearInputIcon\\\":[1,\\\"clear-input-icon\\\"],\\\"clearOnEdit\\\":[4,\\\"clear-on-edit\\\"],\\\"counter\\\":[4],\\\"counterFormatter\\\":[16],\\\"debounce\\\":[2],\\\"disabled\\\":[516],\\\"enterkeyhint\\\":[1],\\\"errorText\\\":[1,\\\"error-text\\\"],\\\"fill\\\":[1],\\\"inputmode\\\":[1],\\\"helperText\\\":[1,\\\"helper-text\\\"],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"max\\\":[8],\\\"maxlength\\\":[2],\\\"min\\\":[8],\\\"minlength\\\":[2],\\\"multiple\\\":[4],\\\"name\\\":[1],\\\"pattern\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[516],\\\"required\\\":[4],\\\"shape\\\":[1],\\\"spellcheck\\\":[4],\\\"step\\\":[1],\\\"type\\\":[1],\\\"value\\\":[1032],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"type\\\":[\\\"onTypeChange\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-searchbar\\\",[[34,\\\"ion-searchbar\\\",{\\\"color\\\":[513],\\\"animated\\\":[4],\\\"autocapitalize\\\":[1],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"cancelButtonIcon\\\":[1,\\\"cancel-button-icon\\\"],\\\"cancelButtonText\\\":[1,\\\"cancel-button-text\\\"],\\\"clearIcon\\\":[1,\\\"clear-icon\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"maxlength\\\":[2],\\\"minlength\\\":[2],\\\"name\\\":[1],\\\"placeholder\\\":[1],\\\"searchIcon\\\":[1,\\\"search-icon\\\"],\\\"showCancelButton\\\":[1,\\\"show-cancel-button\\\"],\\\"showClearButton\\\":[1,\\\"show-clear-button\\\"],\\\"spellcheck\\\":[4],\\\"type\\\":[1],\\\"value\\\":[1025],\\\"focused\\\":[32],\\\"noAnimate\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"lang\\\":[\\\"onLangChanged\\\"],\\\"dir\\\":[\\\"onDirChanged\\\"],\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"],\\\"showCancelButton\\\":[\\\"showCancelButtonChanged\\\"]}]]],[\\\"ion-toggle\\\",[[33,\\\"ion-toggle\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[1],\\\"enableOnOffLabels\\\":[4,\\\"enable-on-off-labels\\\"],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"activated\\\":[32]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}]]],[\\\"ion-nav_2\\\",[[1,\\\"ion-nav\\\",{\\\"delegate\\\":[16],\\\"swipeGesture\\\":[1028,\\\"swipe-gesture\\\"],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"rootParams\\\":[16],\\\"root\\\":[1],\\\"push\\\":[64],\\\"insert\\\":[64],\\\"insertPages\\\":[64],\\\"pop\\\":[64],\\\"popTo\\\":[64],\\\"popToRoot\\\":[64],\\\"removeIndex\\\":[64],\\\"setRoot\\\":[64],\\\"setPages\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64],\\\"getActive\\\":[64],\\\"getByIndex\\\":[64],\\\"canGoBack\\\":[64],\\\"getPrevious\\\":[64],\\\"getLength\\\":[64]},null,{\\\"swipeGesture\\\":[\\\"swipeGestureChanged\\\"],\\\"root\\\":[\\\"rootChanged\\\"]}],[0,\\\"ion-nav-link\\\",{\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-tab_2\\\",[[1,\\\"ion-tab\\\",{\\\"active\\\":[1028],\\\"delegate\\\":[16],\\\"tab\\\":[1],\\\"component\\\":[1],\\\"setActive\\\":[64]},null,{\\\"active\\\":[\\\"changeActive\\\"]}],[1,\\\"ion-tabs\\\",{\\\"useRouter\\\":[1028,\\\"use-router\\\"],\\\"selectedTab\\\":[32],\\\"select\\\":[64],\\\"getTab\\\":[64],\\\"getSelected\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]}]]],[\\\"ion-textarea\\\",[[38,\\\"ion-textarea\\\",{\\\"color\\\":[513],\\\"autocapitalize\\\":[1],\\\"autofocus\\\":[4],\\\"clearOnEdit\\\":[4,\\\"clear-on-edit\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"fill\\\":[1],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"maxlength\\\":[2],\\\"minlength\\\":[2],\\\"name\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[4],\\\"required\\\":[4],\\\"spellcheck\\\":[4],\\\"cols\\\":[514],\\\"rows\\\":[2],\\\"wrap\\\":[1],\\\"autoGrow\\\":[516,\\\"auto-grow\\\"],\\\"value\\\":[1025],\\\"counter\\\":[4],\\\"counterFormatter\\\":[16],\\\"errorText\\\":[1,\\\"error-text\\\"],\\\"helperText\\\":[1,\\\"helper-text\\\"],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"shape\\\":[1],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-backdrop\\\",[[33,\\\"ion-backdrop\\\",{\\\"visible\\\":[4],\\\"tappable\\\":[4],\\\"stopPropagation\\\":[4,\\\"stop-propagation\\\"]},[[2,\\\"click\\\",\\\"onMouseDown\\\"]]]]],[\\\"ion-loading\\\",[[34,\\\"ion-loading\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"message\\\":[1],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"spinner\\\":[1025],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-breadcrumb_2\\\",[[33,\\\"ion-breadcrumb\\\",{\\\"collapsed\\\":[4],\\\"last\\\":[4],\\\"showCollapsedIndicator\\\":[4,\\\"show-collapsed-indicator\\\"],\\\"color\\\":[1],\\\"active\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"separator\\\":[4],\\\"target\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}],[33,\\\"ion-breadcrumbs\\\",{\\\"color\\\":[513],\\\"maxItems\\\":[2,\\\"max-items\\\"],\\\"itemsBeforeCollapse\\\":[2,\\\"items-before-collapse\\\"],\\\"itemsAfterCollapse\\\":[2,\\\"items-after-collapse\\\"],\\\"collapsed\\\":[32],\\\"activeChanged\\\":[32]},[[0,\\\"collapsedClick\\\",\\\"onCollapsedClick\\\"]],{\\\"maxItems\\\":[\\\"maxItemsChanged\\\"],\\\"itemsBeforeCollapse\\\":[\\\"maxItemsChanged\\\"],\\\"itemsAfterCollapse\\\":[\\\"maxItemsChanged\\\"]}]]],[\\\"ion-tab-bar_2\\\",[[33,\\\"ion-tab-button\\\",{\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"layout\\\":[1025],\\\"selected\\\":[1028],\\\"tab\\\":[1],\\\"target\\\":[1]},[[8,\\\"ionTabBarChanged\\\",\\\"onTabBarChanged\\\"]]],[33,\\\"ion-tab-bar\\\",{\\\"color\\\":[513],\\\"selectedTab\\\":[1,\\\"selected-tab\\\"],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]},null,{\\\"selectedTab\\\":[\\\"selectedTabChanged\\\"]}]]],[\\\"ion-datetime-button\\\",[[33,\\\"ion-datetime-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[516],\\\"datetime\\\":[1],\\\"datetimePresentation\\\":[32],\\\"dateText\\\":[32],\\\"timeText\\\":[32],\\\"datetimeActive\\\":[32],\\\"selectedButton\\\":[32]}]]],[\\\"ion-route_4\\\",[[0,\\\"ion-route\\\",{\\\"url\\\":[1],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"beforeLeave\\\":[16],\\\"beforeEnter\\\":[16]},null,{\\\"url\\\":[\\\"onUpdate\\\"],\\\"component\\\":[\\\"onUpdate\\\"],\\\"componentProps\\\":[\\\"onComponentProps\\\"]}],[0,\\\"ion-route-redirect\\\",{\\\"from\\\":[1],\\\"to\\\":[1]},null,{\\\"from\\\":[\\\"propDidChange\\\"],\\\"to\\\":[\\\"propDidChange\\\"]}],[0,\\\"ion-router\\\",{\\\"root\\\":[1],\\\"useHash\\\":[4,\\\"use-hash\\\"],\\\"canTransition\\\":[64],\\\"push\\\":[64],\\\"back\\\":[64],\\\"printDebug\\\":[64],\\\"navChanged\\\":[64]},[[8,\\\"popstate\\\",\\\"onPopState\\\"],[4,\\\"ionBackButton\\\",\\\"onBackButton\\\"]]],[1,\\\"ion-router-link\\\",{\\\"color\\\":[513],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}]]],[\\\"ion-avatar_3\\\",[[33,\\\"ion-avatar\\\"],[33,\\\"ion-badge\\\",{\\\"color\\\":[513]}],[1,\\\"ion-thumbnail\\\"]]],[\\\"ion-col_3\\\",[[1,\\\"ion-col\\\",{\\\"offset\\\":[1],\\\"offsetXs\\\":[1,\\\"offset-xs\\\"],\\\"offsetSm\\\":[1,\\\"offset-sm\\\"],\\\"offsetMd\\\":[1,\\\"offset-md\\\"],\\\"offsetLg\\\":[1,\\\"offset-lg\\\"],\\\"offsetXl\\\":[1,\\\"offset-xl\\\"],\\\"pull\\\":[1],\\\"pullXs\\\":[1,\\\"pull-xs\\\"],\\\"pullSm\\\":[1,\\\"pull-sm\\\"],\\\"pullMd\\\":[1,\\\"pull-md\\\"],\\\"pullLg\\\":[1,\\\"pull-lg\\\"],\\\"pullXl\\\":[1,\\\"pull-xl\\\"],\\\"push\\\":[1],\\\"pushXs\\\":[1,\\\"push-xs\\\"],\\\"pushSm\\\":[1,\\\"push-sm\\\"],\\\"pushMd\\\":[1,\\\"push-md\\\"],\\\"pushLg\\\":[1,\\\"push-lg\\\"],\\\"pushXl\\\":[1,\\\"push-xl\\\"],\\\"size\\\":[1],\\\"sizeXs\\\":[1,\\\"size-xs\\\"],\\\"sizeSm\\\":[1,\\\"size-sm\\\"],\\\"sizeMd\\\":[1,\\\"size-md\\\"],\\\"sizeLg\\\":[1,\\\"size-lg\\\"],\\\"sizeXl\\\":[1,\\\"size-xl\\\"]},[[9,\\\"resize\\\",\\\"onResize\\\"]]],[1,\\\"ion-grid\\\",{\\\"fixed\\\":[4]}],[1,\\\"ion-row\\\"]]],[\\\"ion-img\\\",[[1,\\\"ion-img\\\",{\\\"alt\\\":[1],\\\"src\\\":[1],\\\"loadSrc\\\":[32],\\\"loadError\\\":[32]},null,{\\\"src\\\":[\\\"srcChanged\\\"]}]]],[\\\"ion-progress-bar\\\",[[33,\\\"ion-progress-bar\\\",{\\\"type\\\":[1],\\\"reversed\\\":[4],\\\"value\\\":[2],\\\"buffer\\\":[2],\\\"color\\\":[513]}]]],[\\\"ion-range\\\",[[33,\\\"ion-range\\\",{\\\"color\\\":[513],\\\"debounce\\\":[2],\\\"name\\\":[1],\\\"label\\\":[1],\\\"dualKnobs\\\":[4,\\\"dual-knobs\\\"],\\\"min\\\":[2],\\\"max\\\":[2],\\\"pin\\\":[4],\\\"pinFormatter\\\":[16],\\\"snaps\\\":[4],\\\"step\\\":[2],\\\"ticks\\\":[4],\\\"activeBarStart\\\":[1026,\\\"active-bar-start\\\"],\\\"disabled\\\":[4],\\\"value\\\":[1026],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"ratioA\\\":[32],\\\"ratioB\\\":[32],\\\"pressedKnob\\\":[32]},null,{\\\"debounce\\\":[\\\"debounceChanged\\\"],\\\"min\\\":[\\\"minChanged\\\"],\\\"max\\\":[\\\"maxChanged\\\"],\\\"activeBarStart\\\":[\\\"activeBarStartChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-segment-content\\\",[[1,\\\"ion-segment-content\\\"]]],[\\\"ion-segment-view\\\",[[33,\\\"ion-segment-view\\\",{\\\"disabled\\\":[4],\\\"isManualScroll\\\":[32],\\\"setContent\\\":[64]},[[1,\\\"scroll\\\",\\\"handleScroll\\\"],[1,\\\"touchstart\\\",\\\"handleScrollStart\\\"],[1,\\\"touchend\\\",\\\"handleTouchEnd\\\"]]]]],[\\\"ion-split-pane\\\",[[33,\\\"ion-split-pane\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"disabled\\\":[4],\\\"when\\\":[8],\\\"visible\\\":[32],\\\"isVisible\\\":[64]},null,{\\\"visible\\\":[\\\"visibleChanged\\\"],\\\"disabled\\\":[\\\"updateState\\\"],\\\"when\\\":[\\\"updateState\\\"]}]]],[\\\"ion-text\\\",[[1,\\\"ion-text\\\",{\\\"color\\\":[513]}]]],[\\\"ion-select-modal\\\",[[34,\\\"ion-select-modal\\\",{\\\"header\\\":[1],\\\"multiple\\\":[4],\\\"options\\\":[16]}]]],[\\\"ion-datetime_3\\\",[[33,\\\"ion-datetime\\\",{\\\"color\\\":[1],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"formatOptions\\\":[16],\\\"readonly\\\":[4],\\\"isDateEnabled\\\":[16],\\\"min\\\":[1025],\\\"max\\\":[1025],\\\"presentation\\\":[1],\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"doneText\\\":[1,\\\"done-text\\\"],\\\"clearText\\\":[1,\\\"clear-text\\\"],\\\"yearValues\\\":[8,\\\"year-values\\\"],\\\"monthValues\\\":[8,\\\"month-values\\\"],\\\"dayValues\\\":[8,\\\"day-values\\\"],\\\"hourValues\\\":[8,\\\"hour-values\\\"],\\\"minuteValues\\\":[8,\\\"minute-values\\\"],\\\"locale\\\":[1],\\\"firstDayOfWeek\\\":[2,\\\"first-day-of-week\\\"],\\\"titleSelectedDatesFormatter\\\":[16],\\\"multiple\\\":[4],\\\"highlightedDates\\\":[16],\\\"value\\\":[1025],\\\"showDefaultTitle\\\":[4,\\\"show-default-title\\\"],\\\"showDefaultButtons\\\":[4,\\\"show-default-buttons\\\"],\\\"showClearButton\\\":[4,\\\"show-clear-button\\\"],\\\"showDefaultTimeLabel\\\":[4,\\\"show-default-time-label\\\"],\\\"hourCycle\\\":[1,\\\"hour-cycle\\\"],\\\"size\\\":[1],\\\"preferWheel\\\":[4,\\\"prefer-wheel\\\"],\\\"showMonthAndYear\\\":[32],\\\"activeParts\\\":[32],\\\"workingParts\\\":[32],\\\"isTimePopoverOpen\\\":[32],\\\"forceRenderDate\\\":[32],\\\"confirm\\\":[64],\\\"reset\\\":[64],\\\"cancel\\\":[64]},null,{\\\"formatOptions\\\":[\\\"formatOptionsChanged\\\"],\\\"disabled\\\":[\\\"disabledChanged\\\"],\\\"min\\\":[\\\"minChanged\\\"],\\\"max\\\":[\\\"maxChanged\\\"],\\\"presentation\\\":[\\\"presentationChanged\\\"],\\\"yearValues\\\":[\\\"yearValuesChanged\\\"],\\\"monthValues\\\":[\\\"monthValuesChanged\\\"],\\\"dayValues\\\":[\\\"dayValuesChanged\\\"],\\\"hourValues\\\":[\\\"hourValuesChanged\\\"],\\\"minuteValues\\\":[\\\"minuteValuesChanged\\\"],\\\"value\\\":[\\\"valueChanged\\\"]}],[34,\\\"ion-picker-legacy\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"columns\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"getColumn\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}],[32,\\\"ion-picker-legacy-column\\\",{\\\"col\\\":[16]},null,{\\\"col\\\":[\\\"colChanged\\\"]}]]],[\\\"ion-action-sheet\\\",[[34,\\\"ion-action-sheet\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-alert\\\",[[34,\\\"ion-alert\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"buttons\\\":[16],\\\"inputs\\\":[1040],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"],\\\"buttons\\\":[\\\"buttonsChanged\\\"],\\\"inputs\\\":[\\\"inputsChanged\\\"]}]]],[\\\"ion-modal\\\",[[33,\\\"ion-modal\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"breakpoints\\\":[16],\\\"initialBreakpoint\\\":[2,\\\"initial-breakpoint\\\"],\\\"backdropBreakpoint\\\":[2,\\\"backdrop-breakpoint\\\"],\\\"handle\\\":[4],\\\"handleBehavior\\\":[1,\\\"handle-behavior\\\"],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"animated\\\":[4],\\\"presentingElement\\\":[16],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"focusTrap\\\":[4,\\\"focus-trap\\\"],\\\"canDismiss\\\":[4,\\\"can-dismiss\\\"],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"setCurrentBreakpoint\\\":[64],\\\"getCurrentBreakpoint\\\":[64]},null,{\\\"isOpen\\\":[\\\"onIsOpenChange\\\"],\\\"trigger\\\":[\\\"triggerChanged\\\"]}]]],[\\\"ion-picker\\\",[[33,\\\"ion-picker\\\",{\\\"exitInputMode\\\":[64]},[[1,\\\"touchstart\\\",\\\"preventTouchStartPropagation\\\"]]]]],[\\\"ion-picker-column\\\",[[1,\\\"ion-picker-column\\\",{\\\"disabled\\\":[4],\\\"value\\\":[1032],\\\"color\\\":[513],\\\"numericInput\\\":[4,\\\"numeric-input\\\"],\\\"ariaLabel\\\":[32],\\\"isActive\\\":[32],\\\"scrollActiveItemIntoView\\\":[64],\\\"setValue\\\":[64],\\\"setFocus\\\":[64]},null,{\\\"aria-label\\\":[\\\"ariaLabelChanged\\\"],\\\"value\\\":[\\\"valueChange\\\"]}]]],[\\\"ion-picker-column-option\\\",[[33,\\\"ion-picker-column-option\\\",{\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"color\\\":[513],\\\"ariaLabel\\\":[32]},null,{\\\"aria-label\\\":[\\\"onAriaLabelChange\\\"]}]]],[\\\"ion-popover\\\",[[33,\\\"ion-popover\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"delegate\\\":[16],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"event\\\":[8],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"triggerAction\\\":[1,\\\"trigger-action\\\"],\\\"trigger\\\":[1],\\\"size\\\":[1],\\\"dismissOnSelect\\\":[4,\\\"dismiss-on-select\\\"],\\\"reference\\\":[1],\\\"side\\\":[1],\\\"alignment\\\":[1025],\\\"arrow\\\":[4],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"keyboardEvents\\\":[4,\\\"keyboard-events\\\"],\\\"focusTrap\\\":[4,\\\"focus-trap\\\"],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"presented\\\":[32],\\\"presentFromTrigger\\\":[64],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"getParentPopover\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},null,{\\\"trigger\\\":[\\\"onTriggerChange\\\"],\\\"triggerAction\\\":[\\\"onTriggerChange\\\"],\\\"isOpen\\\":[\\\"onIsOpenChange\\\"]}]]],[\\\"ion-checkbox\\\",[[33,\\\"ion-checkbox\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"indeterminate\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"setFocus\\\":[64]}]]],[\\\"ion-item_8\\\",[[33,\\\"ion-item-divider\\\",{\\\"color\\\":[513],\\\"sticky\\\":[4]}],[32,\\\"ion-item-group\\\"],[33,\\\"ion-note\\\",{\\\"color\\\":[513]}],[1,\\\"ion-skeleton-text\\\",{\\\"animated\\\":[4]}],[38,\\\"ion-label\\\",{\\\"color\\\":[513],\\\"position\\\":[1],\\\"noAnimate\\\":[32]},null,{\\\"color\\\":[\\\"colorChanged\\\"],\\\"position\\\":[\\\"positionChanged\\\"]}],[33,\\\"ion-list-header\\\",{\\\"color\\\":[513],\\\"lines\\\":[1]}],[33,\\\"ion-item\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"detail\\\":[4],\\\"detailIcon\\\":[1,\\\"detail-icon\\\"],\\\"disabled\\\":[516],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"lines\\\":[1],\\\"routerAnimation\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"target\\\":[1],\\\"type\\\":[1],\\\"multipleInputs\\\":[32],\\\"focusable\\\":[32]},[[0,\\\"ionColor\\\",\\\"labelColorChanged\\\"],[0,\\\"ionStyle\\\",\\\"itemStyle\\\"]],{\\\"button\\\":[\\\"buttonChanged\\\"]}],[32,\\\"ion-list\\\",{\\\"lines\\\":[1],\\\"inset\\\":[4],\\\"closeSlidingItems\\\":[64]}]]],[\\\"ion-app_8\\\",[[0,\\\"ion-app\\\",{\\\"setFocus\\\":[64]}],[36,\\\"ion-footer\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]}],[1,\\\"ion-router-outlet\\\",{\\\"mode\\\":[1025],\\\"delegate\\\":[16],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"swipeHandler\\\":[16],\\\"commit\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]},null,{\\\"swipeHandler\\\":[\\\"swipeHandlerChanged\\\"]}],[1,\\\"ion-content\\\",{\\\"color\\\":[513],\\\"fullscreen\\\":[4],\\\"fixedSlotPlacement\\\":[1,\\\"fixed-slot-placement\\\"],\\\"forceOverscroll\\\":[1028,\\\"force-overscroll\\\"],\\\"scrollX\\\":[4,\\\"scroll-x\\\"],\\\"scrollY\\\":[4,\\\"scroll-y\\\"],\\\"scrollEvents\\\":[4,\\\"scroll-events\\\"],\\\"getScrollElement\\\":[64],\\\"getBackgroundElement\\\":[64],\\\"scrollToTop\\\":[64],\\\"scrollToBottom\\\":[64],\\\"scrollByPoint\\\":[64],\\\"scrollToPoint\\\":[64]},[[9,\\\"resize\\\",\\\"onResize\\\"]]],[36,\\\"ion-header\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4]}],[33,\\\"ion-title\\\",{\\\"color\\\":[513],\\\"size\\\":[1]},null,{\\\"size\\\":[\\\"sizeChanged\\\"]}],[33,\\\"ion-toolbar\\\",{\\\"color\\\":[513]},[[0,\\\"ionStyle\\\",\\\"childrenStyle\\\"]]],[38,\\\"ion-buttons\\\",{\\\"collapse\\\":[4]}]]],[\\\"ion-select_3\\\",[[33,\\\"ion-select\\\",{\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"color\\\":[513],\\\"compareWith\\\":[1,\\\"compare-with\\\"],\\\"disabled\\\":[4],\\\"fill\\\":[1],\\\"interface\\\":[1],\\\"interfaceOptions\\\":[8,\\\"interface-options\\\"],\\\"justify\\\":[1],\\\"label\\\":[1],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"multiple\\\":[4],\\\"name\\\":[1],\\\"okText\\\":[1,\\\"ok-text\\\"],\\\"placeholder\\\":[1],\\\"selectedText\\\":[1,\\\"selected-text\\\"],\\\"toggleIcon\\\":[1,\\\"toggle-icon\\\"],\\\"expandedIcon\\\":[1,\\\"expanded-icon\\\"],\\\"shape\\\":[1],\\\"value\\\":[1032],\\\"isExpanded\\\":[32],\\\"open\\\":[64]},null,{\\\"disabled\\\":[\\\"styleChanged\\\"],\\\"isExpanded\\\":[\\\"styleChanged\\\"],\\\"placeholder\\\":[\\\"styleChanged\\\"],\\\"value\\\":[\\\"styleChanged\\\"]}],[1,\\\"ion-select-option\\\",{\\\"disabled\\\":[4],\\\"value\\\":[8]}],[34,\\\"ion-select-popover\\\",{\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"multiple\\\":[4],\\\"options\\\":[16]}]]],[\\\"ion-spinner\\\",[[1,\\\"ion-spinner\\\",{\\\"color\\\":[513],\\\"duration\\\":[2],\\\"name\\\":[1],\\\"paused\\\":[4]}]]],[\\\"ion-radio_2\\\",[[33,\\\"ion-radio\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"labelPlacement\\\":[1,\\\"label-placement\\\"],\\\"justify\\\":[1],\\\"alignment\\\":[1],\\\"checked\\\":[32],\\\"buttonTabindex\\\":[32],\\\"setFocus\\\":[64],\\\"setButtonTabindex\\\":[64]},null,{\\\"value\\\":[\\\"valueChanged\\\"]}],[0,\\\"ion-radio-group\\\",{\\\"allowEmptySelection\\\":[4,\\\"allow-empty-selection\\\"],\\\"compareWith\\\":[1,\\\"compare-with\\\"],\\\"name\\\":[1],\\\"value\\\":[1032],\\\"setFocus\\\":[64]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]],{\\\"value\\\":[\\\"valueChanged\\\"]}]]],[\\\"ion-ripple-effect\\\",[[1,\\\"ion-ripple-effect\\\",{\\\"type\\\":[1],\\\"addRipple\\\":[64]}]]],[\\\"ion-button_2\\\",[[33,\\\"ion-button\\\",{\\\"color\\\":[513],\\\"buttonType\\\":[1025,\\\"button-type\\\"],\\\"disabled\\\":[516],\\\"expand\\\":[513],\\\"fill\\\":[1537],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"shape\\\":[513],\\\"size\\\":[513],\\\"strong\\\":[4],\\\"target\\\":[1],\\\"type\\\":[1],\\\"form\\\":[1],\\\"isCircle\\\":[32]},null,{\\\"disabled\\\":[\\\"disabledChanged\\\"]}],[1,\\\"ion-icon\\\",{\\\"mode\\\":[1025],\\\"color\\\":[1],\\\"ios\\\":[1],\\\"md\\\":[1],\\\"flipRtl\\\":[4,\\\"flip-rtl\\\"],\\\"name\\\":[513],\\\"src\\\":[1],\\\"icon\\\":[8],\\\"size\\\":[1],\\\"lazy\\\":[4],\\\"sanitize\\\":[4],\\\"svgContent\\\":[32],\\\"isVisible\\\":[32]},null,{\\\"name\\\":[\\\"loadIcon\\\"],\\\"src\\\":[\\\"loadIcon\\\"],\\\"icon\\\":[\\\"loadIcon\\\"],\\\"ios\\\":[\\\"loadIcon\\\"],\\\"md\\\":[\\\"loadIcon\\\"]}]]]]\"), options);\n};\n\nexport { defineCustomElements };\n","import * as i0 from '@angular/core';\nimport { Directive, HostListener, Component, ChangeDetectionStrategy, ViewContainerRef, Attribute, Optional, SkipSelf, ViewChild, ContentChild, ContentChildren, forwardRef, Injectable, inject, Injector, EnvironmentInjector, APP_INITIALIZER, NgZone, NgModule } from '@angular/core';\nimport { NG_VALUE_ACCESSOR, NG_VALIDATORS, MaxValidator, MinValidator } from '@angular/forms';\nimport * as i2$1 from '@ionic/angular/common';\nimport { ValueAccessor, setIonicClasses, IonRouterOutlet as IonRouterOutlet$1, IonTabs as IonTabs$1, IonBackButton as IonBackButton$1, IonNav as IonNav$1, RouterLinkDelegateDirective as RouterLinkDelegateDirective$1, RouterLinkWithHrefDelegateDirective as RouterLinkWithHrefDelegateDirective$1, IonModal as IonModal$1, IonPopover as IonPopover$1, OverlayBaseController, MenuController as MenuController$1, AngularDelegate, raf, ConfigToken, provideComponentInputBinding } from '@ionic/angular/common';\nexport { AngularDelegate, Config, DomController, IonicRouteStrategy, NavController, NavParams, Platform } from '@ionic/angular/common';\nimport { __decorate } from 'tslib';\nimport { fromEvent } from 'rxjs';\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, CommonModule } from '@angular/common';\nimport * as i2 from '@angular/router';\nimport { alertController, createAnimation, getTimeGivenProgression, actionSheetController, createGesture, loadingController, menuController, modalController, pickerController, popoverController, toastController, setupConfig } from '@ionic/core';\nexport { IonicSafeString, IonicSlides, createAnimation, createGesture, getIonPageElement, getPlatforms, getTimeGivenProgression, iosTransitionAnimation, isPlatform, mdTransitionAnimation, openURL } from '@ionic/core';\nimport { applyPolyfills, defineCustomElements } from '@ionic/core/loader';\n\nclass BooleanValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n writeValue(value) {\n this.elementRef.nativeElement.checked = this.lastValue = value;\n setIonicClasses(this.elementRef);\n }\n _handleIonChange(el) {\n this.handleValueChange(el, el.checked);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BooleanValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: BooleanValueAccessorDirective, selector: \"ion-checkbox,ion-toggle\", host: { listeners: { \"ionChange\": \"_handleIonChange($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: BooleanValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BooleanValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-checkbox,ion-toggle',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: BooleanValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleIonChange: [{\n type: HostListener,\n args: ['ionChange', ['$event.target']]\n }] } });\n\nclass NumericValueAccessorDirective extends ValueAccessor {\n el;\n constructor(injector, el) {\n super(injector, el);\n this.el = el;\n }\n handleInputEvent(el) {\n this.handleValueChange(el, el.value);\n }\n registerOnChange(fn) {\n if (this.el.nativeElement.tagName === 'ION-INPUT') {\n super.registerOnChange((value) => {\n fn(value === '' ? null : parseFloat(value));\n });\n }\n else {\n super.registerOnChange(fn);\n }\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NumericValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NumericValueAccessorDirective, selector: \"ion-input[type=number],ion-range\", host: { listeners: { \"ionInput\": \"handleInputEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: NumericValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NumericValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input[type=number],ion-range',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: NumericValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { handleInputEvent: [{\n type: HostListener,\n args: ['ionInput', ['$event.target']]\n }] } });\n\nclass SelectValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n _handleChangeEvent(el) {\n this.handleValueChange(el, el.value);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SelectValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: SelectValueAccessorDirective, selector: \"ion-select, ion-radio-group, ion-segment, ion-datetime\", host: { listeners: { \"ionChange\": \"_handleChangeEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: SelectValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SelectValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n /* tslint:disable-next-line:directive-selector */\n selector: 'ion-select, ion-radio-group, ion-segment, ion-datetime',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: SelectValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleChangeEvent: [{\n type: HostListener,\n args: ['ionChange', ['$event.target']]\n }] } });\n\nclass TextValueAccessorDirective extends ValueAccessor {\n constructor(injector, el) {\n super(injector, el);\n }\n _handleInputEvent(el) {\n this.handleValueChange(el, el.value);\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TextValueAccessorDirective, deps: [{ token: i0.Injector }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\n /** @nocollapse */ static ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: TextValueAccessorDirective, selector: \"ion-input:not([type=number]),ion-textarea,ion-searchbar\", host: { listeners: { \"ionInput\": \"_handleInputEvent($event.target)\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: TextValueAccessorDirective,\n multi: true,\n },\n ], usesInheritance: true, ngImport: i0 });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TextValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n selector: 'ion-input:not([type=number]),ion-textarea,ion-searchbar',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: TextValueAccessorDirective,\n multi: true,\n },\n ],\n }]\n }], ctorParameters: function () { return [{ type: i0.Injector }, { type: i0.ElementRef }]; }, propDecorators: { _handleInputEvent: [{\n type: HostListener,\n args: ['ionInput', ['$event.target']]\n }] } });\n\n/* eslint-disable */\n/* tslint:disable */\nconst proxyInputs = (Cmp, inputs) => {\n const Prototype = Cmp.prototype;\n inputs.forEach((item) => {\n Object.defineProperty(Prototype, item, {\n get() {\n return this.el[item];\n },\n set(val) {\n this.z.runOutsideAngular(() => (this.el[item] = val));\n },\n /**\n * In the event that proxyInputs is called\n * multiple times re-defining these inputs\n * will cause an error to be thrown. As a result\n * we set configurable: true to indicate these\n * properties can be changed.\n */\n configurable: true,\n });\n });\n};\nconst proxyMethods = (Cmp, methods) => {\n const Prototype = Cmp.prototype;\n methods.forEach((methodName) => {\n Prototype[methodName] = function () {\n const args = arguments;\n return this.z.runOutsideAngular(() => this.el[methodName].apply(this.el, args));\n };\n });\n};\nconst proxyOutputs = (instance, el, events) => {\n events.forEach((eventName) => (instance[eventName] = fromEvent(el, eventName)));\n};\nconst defineCustomElement = (tagName, customElement) => {\n if (customElement !== undefined && typeof customElements !== 'undefined' && !customElements.get(tagName)) {\n customElements.define(tagName, customElement);\n }\n};\n// tslint:disable-next-line: only-arrow-functions\nfunction ProxyCmp(opts) {\n const decorator = function (cls) {\n const { defineCustomElementFn, inputs, methods } = opts;\n if (defineCustomElementFn !== undefined) {\n defineCustomElementFn();\n }\n if (inputs) {\n proxyInputs(cls, inputs);\n }\n if (methods) {\n proxyMethods(cls, methods);\n }\n return cls;\n };\n return decorator;\n}\n\nlet IonAccordion = class IonAccordion {\n z;\n el;\n constructor(c, r, z) {\n this.z = z;\n c.detach();\n this.el = r.nativeElement;\n }\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonAccordion, deps: [{ token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonAccordion, selector: \"ion-accordion\", inputs: { disabled: \"disabled\", mode: \"mode\", readonly: \"readonly\", toggleIcon: \"toggleIcon\", toggleIconSlot: \"toggleIconSlot\", value: \"value\" }, ngImport: i0, template: '\n \n 0\" select=\"ion-tab\"> \n
\n \n \n 0\" select=\"ion-tab\"> \n
\n \n
`, isInline: true, dependencies: [{ kind: \"directive\", type: i1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i1.NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: [\"ngTemplateOutletContext\", \"ngTemplateOutlet\", \"ngTemplateOutletInjector\"] }], changeDetection: i0.ChangeDetectionStrategy.OnPush });\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonModal, decorators: [{\n type: Component,\n args: [{\n selector: 'ion-modal',\n changeDetection: ChangeDetectionStrategy.OnPush,\n template: `\n
`,\n }]\n }] });\n\nclass IonPopover extends IonPopover$1 {\n /** @nocollapse */ static ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: IonPopover, deps: null, target: i0.ɵɵFactoryTarget.Component });\n /** @nocollapse */ static ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"16.2.12\", type: IonPopover, selector: \"ion-popover\", usesInheritance: true, ngImport: i0, template: `\n \n Values \n \n \n \n \n \n \n\n\n \n\n\n \n \n \n \n","import { Component } from '@angular/core';\nimport { ModalClass } from '@core/class/modal.class';\nimport { ModalController } from '@ionic/angular';\n\n@Component({\n selector: 'app-values-modal',\n templateUrl: './values-modal.component.html',\n standalone: false\n})\nexport class ValuesModalComponent extends ModalClass {\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n protected close() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterBehaviors',\n standalone: true\n})\nexport class FilterBehaviorsPipe implements PipeTransform {\n public transform(\n items: MongoStoredObject[],\n filter: string\n ): MongoStoredObject[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n Select Value \n \n \n Learn More\n \n \n \n \n \n \n\n\n \n\n\n \n \n \n \n \n \n \n\n\n \n \n \n {{ behavior.name }}\n \n \n \n \n","import { AfterViewInit, Component, Input, ViewChild } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport { showModal } from '@app/utils/modal';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalClass } from '@core/class/modal.class';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { BehaviorApiService } from '@core/service/api/behavior.api.service';\nimport { TenantService } from '@core/service/tenant.service';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { IonModal } from '@ionic/angular/common';\nimport { take } from 'rxjs';\nimport { ValuesModalComponent } from '../values-modal/values-modal.component';\nimport { FilterBehaviorsPipe } from './filter-behaviors.pipe';\n\n@Component({\n selector: 'app-behavior-selector-modal',\n templateUrl: './behavior-selector-modal.component.html',\n standalone: false\n})\nexport class BehaviorSelectorModalComponent\n extends ModalClass\n implements AfterViewInit\n{\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n @ViewChild('learnMoreModal')\n public learnMoreModal!: IonModal;\n\n protected selectedBehaviorId: ObjectId;\n protected filter = '';\n protected behaviors: BehaviorModel[];\n protected isLoading = true;\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _behaviorApiService: BehaviorApiService,\n private readonly _tenantService: TenantService,\n private readonly _authenticationService: AuthenticationService\n ) {\n super();\n\n this._tenantService.tenant$.pipe(take(1)).subscribe((tenant) => {\n this._behaviorApiService\n .getNonSysGenBehaviors({\n path: { tenantId: tenant._id }\n })\n .subscribe((behaviorData) => {\n this.behaviors = behaviorData.filter(\n ({ isSystemGenerated, eligible }) =>\n isSystemGenerated === false &&\n (eligible.length === 0 ||\n eligible.find((e) =>\n this._authenticationService.user.roles.includes(e)\n ))\n );\n this.isLoading = false;\n });\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(_: number, item: BehaviorModel) {\n return item._id;\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n this._modalCtrl.dismiss(\n this.behaviors.find((t) => t._id === this.selectedBehaviorId),\n 'confirm',\n this._modalName\n );\n }\n\n protected itemClick(value: ObjectId) {\n this.selectedBehaviorId = value;\n this.confirmChanges();\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const behaviors = new FilterBehaviorsPipe().transform(\n this.behaviors,\n this.filter\n );\n\n if (behaviors.length > 0) {\n return behaviors[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n this.selectedBehaviorId = first._id;\n\n this.confirmChanges();\n }\n }\n\n protected async learnMore() {\n await showModal({ component: ValuesModalComponent }, this._modalCtrl, {\n parentModalName: this._modalName\n });\n }\n}\n","\n \n \n \n \n \n\n \n {{ createMode ? 'Send Recognition' : 'Edit Recognition' }}\n \n \n \n\n\n \n\n\n \n \n \n Recipient \n \n {{\n currentUser\n ? currentUser.firstName + ' ' + currentUser.lastName\n : 'Select Recipient'\n }}\n \n \n \n Value \n \n {{\n lastSelectedBehavior ? lastSelectedBehavior.name : 'Select Value'\n }}\n \n \n \n\n \n \n \n \n\n \n \n \n Private \n \n \n \n \n \n Submit\n \n
\n \n \n","import { Component, Input, OnInit, ViewChild } from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { ObjectId } from '@app/types/object-id';\nimport {\n showBehaviorSelectorModal,\n showUserSelectorModal\n} from '@app/utils/modal';\nimport { AuthenticationService } from '@core/authentication/authentication.service';\nimport { ModalClass } from '@core/class/modal.class';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { UserModel } from '@core/model/user.model';\nimport { UserListService } from '@core/service/user-list.service';\nimport { IonTextarea, ModalController } from '@ionic/angular';\nimport fastDeepEqual from 'fast-deep-equal';\n\nexport interface IEditRecognitionModalResult {\n recognition: {\n userId: string;\n behaviorId: string;\n description: string;\n isPrivate: boolean;\n };\n behavior: BehaviorModel;\n}\n\nexport interface IEditRecognitionModalInitialData {\n userId: ObjectId;\n behaviorId: ObjectId;\n description: string;\n isPrivate: boolean;\n}\n\nexport interface IEditRecognitionModalProps {\n initialData?: IEditRecognitionModalInitialData;\n createMode?: boolean;\n}\n\n@Component({\n selector: 'app-edit-recognition-modal',\n templateUrl: './edit-recognition-modal.component.html',\n standalone: false\n})\nexport class EditRecognitionModalComponent\n extends ModalClass\n implements OnInit\n{\n @Input()\n public readonly initialData?: IEditRecognitionModalInitialData;\n\n @Input()\n public readonly createMode?: boolean = false;\n\n @ViewChild('commentTextarea')\n public commentTextarea!: IonTextarea;\n\n protected form = new FormGroup({\n userId: new FormControl(null, Validators.required),\n behaviorId: new FormControl(null, Validators.required),\n description: new FormControl('', Validators.required),\n isPrivate: new FormControl(false)\n });\n protected allUsers: UserModel[] = [];\n protected lastSelectedBehavior: BehaviorModel = null;\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _userListService: UserListService,\n private readonly _authenticationService: AuthenticationService\n ) {\n super();\n }\n\n public ngOnInit(): void {\n if (this.initialData) {\n this.form.reset({\n userId: this.initialData.userId,\n behaviorId: this.initialData.behaviorId,\n description: this.initialData.description,\n isPrivate: this.initialData.isPrivate\n });\n }\n\n this._userListService.users$.subscribe((users) => {\n this.allUsers = users.filter(\n (user) =>\n user._id.toString() !==\n this._authenticationService.user._id.toString()\n );\n\n if (this.createMode) {\n this.selectUser();\n }\n });\n }\n\n protected get canSave() {\n if (this.createMode) {\n return (\n this.form.get('userId').value &&\n this.form.get('behaviorId').value &&\n this.form.get('description').value\n );\n } else {\n return (\n this.form.get('userId').value &&\n this.form.get('behaviorId').value &&\n this.form.get('description').value &&\n !fastDeepEqual(this.initialData, {\n userId: this.form.get('userId').value,\n behaviorId: this.form.get('behaviorId').value,\n description: this.form.get('description').value,\n isPrivate: this.form.get('isPrivate').value\n })\n );\n }\n }\n\n protected get selectedUserIds(): ObjectId[] {\n return [this.form.get('userId').value];\n }\n\n protected get currentUser(): UserModel | null {\n const user = this.allUsers.find(\n (user) => user._id === this.form.get('userId').value\n );\n return user;\n }\n\n protected get privateInfo() {\n if (this.form.get('isPrivate').value) {\n return {\n description: this.currentUser\n ? `Only visible to you, ${this.currentUser.firstName}, and administrators`\n : 'Only visible to you and administrators'\n };\n } else {\n return {\n description: 'Visible to everyone in your company'\n };\n }\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onSaveClick(): void {\n const result: IEditRecognitionModalResult = {\n recognition: {\n userId: this.form.get('userId').value,\n behaviorId: this.form.get('behaviorId').value,\n description: this.form.get('description').value,\n isPrivate: this.form.get('isPrivate').value\n },\n behavior: this.lastSelectedBehavior\n };\n\n this._modalCtrl.dismiss(result, 'confirm', this._modalName);\n }\n\n protected async selectUser() {\n const { success, selectedUsers } = await showUserSelectorModal(\n {\n users: this.allUsers,\n recipients: this.selectedUserIds,\n focusSearchbar: true,\n title: 'Select Recipient'\n },\n this._modalCtrl,\n { parentModalName: this._modalName }\n );\n\n if (success) {\n this.form.controls.userId.setValue(selectedUsers[0]);\n\n if (this.createMode && !this.form.controls.behaviorId.value) {\n this.selectBehavior();\n }\n }\n }\n\n protected async selectBehavior() {\n const { success, selectedBehavior } = await showBehaviorSelectorModal(\n {\n focusSearchbar: true\n },\n this._modalCtrl,\n { parentModalName: this._modalName }\n );\n\n if (success) {\n this.form.controls.behaviorId.setValue(selectedBehavior._id);\n this.lastSelectedBehavior = selectedBehavior;\n\n if (this.createMode && !this.form.controls.description.value) {\n setTimeout(() => {\n this.commentTextarea.setFocus();\n }, 600);\n }\n }\n }\n}\n","\n \n {{ title }} \n \n \n \n \n \n \n\n\n \n\n\n \n \n \n \n \n {{ option[1] }}\n \n \n \n \n\n \n \n\n \n \n {{ buttonText }}\n \n
\n \n \n","import {\n ChangeDetectionStrategy,\n ChangeDetectorRef,\n Component,\n Input,\n OnDestroy\n} from '@angular/core';\nimport { FormControl, FormGroup, Validators } from '@angular/forms';\nimport { RangePresets } from '@app/types/range-presets';\nimport { DateInterval } from '@backend/types/date-interval';\nimport { ModalClass } from '@core/class/modal.class';\nimport { HapticsService } from '@core/service/haptics.service';\nimport { InsightsDateRangeHelperService } from '@core/service/insights-date-range-helper.service';\nimport { ModalController } from '@ionic/angular';\nimport { endOfDay, startOfDay } from 'date-fns';\nimport { Subscription, filter, switchMap } from 'rxjs';\n\n@Component({\n selector: 'app-insights-range-modal',\n templateUrl: 'insights-range-modal.component.html',\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class InsightsRangeModalComponent\n extends ModalClass\n implements OnDestroy\n{\n @Input()\n public readonly buttonText?: string = 'Apply';\n\n @Input()\n public readonly title?: string = 'Date Range';\n\n protected rangePresets = [\n [RangePresets.ThisPayPeriod, 'This Pay Period'],\n [RangePresets.LastPayPeriod, 'Last Pay Period'],\n [RangePresets.Today, 'Today'],\n [RangePresets.Yesterday, 'Yesterday'],\n [RangePresets.Last7Days, 'Last 7 Days'],\n [RangePresets.Last30Days, 'Last 30 Days'],\n [RangePresets.Last90Days, 'Last 90 Days'],\n [RangePresets.LastMonth, 'Last Month'],\n [RangePresets.ThisYear, 'This Year'],\n [RangePresets.LastYear, 'Last Year'],\n [RangePresets.AllTime, 'All Time'],\n [RangePresets.Custom, 'Custom']\n ];\n\n public set range(value: DateInterval) {\n this.form.reset(value, { emitEvent: false });\n this._rangeHelper.detectPreset(value).subscribe({\n next: (preset) => {\n this.selectedPreset = preset;\n this._cdr.markForCheck();\n },\n error: (e) => console.log('error detecting preset', e)\n });\n }\n protected selectedPreset: RangePresets;\n public form = new FormGroup({\n start: new FormControl(null, Validators.required),\n end: new FormControl(null, Validators.required)\n });\n\n private _subscriptions = new Subscription();\n\n public constructor(\n private readonly _modalCtrl: ModalController,\n private readonly _rangeHelper: InsightsDateRangeHelperService,\n private readonly _cdr: ChangeDetectorRef,\n private readonly _hapticsService: HapticsService\n ) {\n super();\n\n this._subscriptions.add(\n this.form.valueChanges\n .pipe(\n filter(\n ({ start, end }) =>\n start !== null && end !== null && start.getTime() > end.getTime()\n )\n )\n .subscribe(({ start, end }) => {\n this.form.setValue({ start: startOfDay(end), end: endOfDay(start) });\n this.form.updateValueAndValidity();\n })\n );\n this._subscriptions.add(\n this.form.valueChanges\n .pipe(\n filter(\n (range): range is DateInterval =>\n range.start !== null && range.end !== null\n ),\n switchMap((range) => this._rangeHelper.detectPreset(range))\n )\n .subscribe((preset) => {\n this.selectedPreset = preset;\n })\n );\n }\n\n public ngOnDestroy(): void {\n this._subscriptions.unsubscribe();\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onModelSelect(preset: RangePresets): void {\n this._hapticsService.hapticsImpact();\n\n if (preset !== RangePresets.Custom) {\n this._rangeHelper.getIntervalFromPreset(preset).subscribe((range) => {\n this.form.setValue(range);\n this.form.updateValueAndValidity();\n this.submit();\n });\n }\n }\n\n protected submit(): void {\n this._modalCtrl.dismiss(this.form.value, 'confirm', this._modalName);\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterTasks',\n standalone: true\n})\nexport class FilterTasksPipe implements PipeTransform {\n public transform(\n items: {\n id: ObjectId;\n name: string;\n checked: boolean;\n isDeleted: boolean;\n }[],\n filter: string\n ): { id: ObjectId; name: string; checked: boolean; isDeleted: boolean }[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n {{ title.toLowerCase() }} \n \n \n Done\n \n \n \n \n \n \n\n\n \n\n\n \n \n \n 0\"\n (ionChange)=\"allTasksChange($event)\"\n appHaptics\n [disableHaptics]=\"filter.length > 0\"\n >\n All Tasks \n \n \n \n \n \n {{ task.name }}\n \n \n Archived\n \n \n \n \n {{ task.name }}\n \n \n Archived\n \n \n \n \n\n \n \n \n \n\n\n \n","import {\n AfterViewInit,\n Component,\n Input,\n OnInit,\n ViewChild\n} from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { ObjectId } from '@app/types/object-id';\nimport { TaskDto } from '@app/types/task-dto';\nimport { ModalClass } from '@core/class/modal.class';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { FilterTasksPipe } from './filter-tasks.pipe';\n\n@Component({\n selector: 'app-task-selector-modal',\n templateUrl: './task-selector-modal.component.html',\n styleUrls: ['./task-selector-modal.component.scss'],\n standalone: false\n})\nexport class TaskSelectorModalComponent\n extends ModalClass\n implements OnInit, AfterViewInit\n{\n @Input()\n public set selectedTasks(value: ObjectId[]) {\n this.originalSelectedTasks = value;\n }\n\n @Input()\n public readonly title?: string = 'Tasks';\n\n @Input()\n public readonly tasks: MongoStoredObject[];\n\n @Input()\n public readonly hiddenTasks: ObjectId[] = [];\n\n @Input()\n public readonly multiple?: boolean = false;\n\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @Input()\n public readonly emptyText?: string = 'No Tasks';\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n protected originalSelectedTasks: ObjectId[] = [];\n public selected: {\n id: ObjectId;\n name: string;\n checked: boolean;\n isDeleted: boolean;\n }[] = [];\n public filter = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n protected get isAllChecked(): boolean {\n return (\n this.selected.filter((item) => item.checked).length ===\n this.tasks.length && this.tasks.length > 0\n );\n }\n\n protected get isIndeterminate(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n return checkedItems.length > 0 && checkedItems.length < this.tasks.length;\n }\n\n protected get canSave(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n\n if (checkedItems.length !== this.originalSelectedTasks.length) {\n return true;\n }\n\n return !this.originalSelectedTasks.reduce((prev, cur) => {\n if (prev === false) return false;\n return !!checkedItems.find((item) => item.id === cur);\n }, true);\n }\n\n public ngOnInit(): void {\n this.selected = this.tasks\n .map((task) => ({\n id: task._id,\n name: task.title,\n checked: this.originalSelectedTasks.includes(task._id),\n isDeleted: task.isDeleted\n }))\n .sort((a, b) => {\n const aChecked = a.checked;\n const bChecked = b.checked;\n if (aChecked && !bChecked) {\n return -1;\n }\n if (!aChecked && bChecked) {\n return 1;\n }\n return 0;\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(\n _: number,\n item: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }\n ) {\n return item.id;\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n const checkedItems = this.selected\n .filter((i) => i.checked)\n .map((i) => i.id);\n this._modalCtrl.dismiss(checkedItems, 'confirm', this._modalName);\n }\n\n protected checkboxClick(event: any, value: ObjectId) {\n event.preventDefault();\n\n if (this.multiple) {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value ? !item.checked : item.checked\n }));\n } else {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value\n }));\n\n this.confirmChanges();\n }\n }\n\n protected allTasksChange(event: any): void {\n const {\n detail: { checked }\n }: { detail: { checked: boolean } } = event;\n\n this.selected = this.selected.map((item) => ({\n ...item,\n checked\n }));\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected isTaskHidden(taskId: ObjectId) {\n return this.hiddenTasks.includes(taskId);\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const tasks = new FilterTasksPipe()\n .transform(this.selected, this.filter)\n .filter((task) => !this.isTaskHidden(task.id));\n\n if (tasks.length > 0) {\n return tasks[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n if (this.multiple) {\n first.checked = !first.checked;\n } else {\n this.selected = this.selected.map((task) => ({\n ...task,\n checked: task.id === first.id\n }));\n\n this.confirmChanges();\n }\n }\n }\n}\n","import { Pipe, PipeTransform } from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport FuzzySearch from 'fuzzy-search';\n\n@Pipe({\n name: 'filterUsers',\n standalone: true\n})\nexport class FilterUsersPipe implements PipeTransform {\n public transform(\n items: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[],\n filter: string\n ): {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[] {\n if (filter.length === 0) {\n return items;\n }\n const searcher = new FuzzySearch(items, ['name'], {\n caseSensitive: false\n });\n return searcher.search(filter);\n }\n}\n","\n \n \n \n Cancel\n \n \n {{ title }} \n \n \n {{ doneBtnText }}\n \n \n \n \n \n \n\n\n \n\n\n \n \n \n 0\"\n (ionChange)=\"allUsersChange($event)\"\n appHaptics\n [disableHaptics]=\"filter.length > 0\"\n >\n All Users\n \n \n \n \n {{ recipient.name }}\n \n \n \n {{ recipient.name }}\n \n \n \n \n \n \n","import {\n AfterViewInit,\n Component,\n Input,\n OnInit,\n ViewChild\n} from '@angular/core';\nimport { ObjectId } from '@app/types/object-id';\nimport { ModalClass } from '@core/class/modal.class';\nimport { UserModel, UserNameModel } from '@core/model/user.model';\nimport { IonSearchbar, ModalController } from '@ionic/angular';\nimport { FilterUsersPipe } from './filter-users.pipe';\n\n@Component({\n selector: 'app-user-selector-modal',\n templateUrl: './user-selector-modal.component.html',\n standalone: false\n})\nexport class UserSelectorModalComponent\n extends ModalClass\n implements OnInit, AfterViewInit\n{\n @Input()\n public set recipients(value: ObjectId[]) {\n this.originalRecipients = value;\n }\n\n @Input()\n public readonly hideSelectAllButton?: boolean = false;\n\n @Input()\n public readonly title?: string = 'Recipients';\n\n @Input()\n public readonly users: (UserModel | UserNameModel)[];\n\n @Input()\n public readonly hiddenUsers: string[] = [];\n\n @Input()\n public readonly multiple?: boolean = false;\n\n @Input()\n public readonly focusSearchbar?: boolean = false;\n\n @Input()\n public readonly doneBtnText?: string = 'Done';\n\n @ViewChild('ionSearchbar')\n public ionSearchbar!: IonSearchbar;\n\n protected originalRecipients: ObjectId[] = [];\n public selected: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }[] = [];\n public filter = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n public ngOnInit(): void {\n this.selected = this.users\n .map((user) => ({\n id: user._id,\n name: `${user.firstName} ${user.lastName}`,\n checked: this.originalRecipients.includes(user._id)\n }))\n .sort((a, b) => {\n const aChecked = a.checked;\n const bChecked = b.checked;\n if (aChecked && !bChecked) {\n return -1;\n }\n if (!aChecked && bChecked) {\n return 1;\n }\n return 0;\n });\n }\n\n public ngAfterViewInit(): void {\n if (this.focusSearchbar) {\n setTimeout(() => {\n this.ionSearchbar.setFocus();\n }, 600);\n }\n }\n\n protected trackItems(\n _: number,\n item: {\n id: ObjectId;\n name: string;\n checked: boolean;\n }\n ) {\n return item.id;\n }\n\n protected get isAllChecked(): boolean {\n return (\n this.selected.filter((item) => item.checked).length ===\n this.users.length && this.users.length > 0\n );\n }\n\n protected get isIndeterminate(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n return checkedItems.length > 0 && checkedItems.length < this.users.length;\n }\n\n protected get canSave(): boolean {\n const checkedItems = this.selected.filter((i) => i.checked);\n\n if (checkedItems.length !== this.originalRecipients.length) {\n return true;\n }\n\n return !this.originalRecipients.reduce((prev, cur) => {\n if (prev === false) return false;\n return !!checkedItems.find((item) => item.id === cur);\n }, true);\n }\n\n protected cancelChanges() {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected confirmChanges() {\n const checkedItems = this.selected\n .filter((i) => i.checked)\n .map((i) => i.id);\n this._modalCtrl.dismiss(checkedItems, 'confirm', this._modalName);\n }\n\n protected checkboxClick(event: any, value: ObjectId) {\n event.preventDefault();\n\n if (this.multiple) {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value ? !item.checked : item.checked\n }));\n } else {\n this.selected = this.selected.map((item) => ({\n ...item,\n checked: item.id === value\n }));\n\n this.confirmChanges();\n }\n }\n\n protected allUsersChange(event: any): void {\n const {\n detail: { checked }\n }: { detail: { checked: boolean } } = event;\n\n this.selected = this.selected.map((item) => ({\n ...item,\n checked\n }));\n }\n\n protected searchbarInput(event: any): void {\n this.filter = event.detail.value;\n }\n\n protected isUserHidden(userId: string) {\n return this.hiddenUsers.includes(userId);\n }\n\n protected getFirst() {\n if (!this.filter) return null;\n\n const users = new FilterUsersPipe()\n .transform(this.selected, this.filter)\n .filter((user) => !this.isUserHidden(user.id));\n\n if (users.length > 0) {\n return users[0];\n }\n\n return null;\n }\n\n protected selectFirst() {\n const first = this.getFirst();\n\n if (first) {\n if (this.multiple) {\n first.checked = !first.checked;\n } else {\n this.selected = this.selected.map((user) => ({\n ...user,\n checked: user.id === first.id\n }));\n\n this.confirmChanges();\n }\n }\n }\n}\n","\n \n \n \n {{ cancelBtnText }}\n \n \n {{ title }} \n \n \n {{ saveBtnText }}\n \n \n \n \n {{ info.start }}
\n {{ info.end }}
\n \n \n\n\n \n\n\n \n \n \n","import {\n ChangeDetectionStrategy,\n Component,\n Input,\n OnInit\n} from '@angular/core';\nimport { ModalClass } from '@core/class/modal.class';\nimport { ModalController } from '@ionic/angular';\n\n@Component({\n selector: 'app-wysiwyg-modal',\n templateUrl: './wysiwyg-modal.component.html',\n styleUrls: ['./wysiwyg-modal.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: false\n})\nexport class WysiwygModalComponent extends ModalClass implements OnInit {\n @Input()\n public readonly mode?: 'view' | 'edit' = 'edit';\n\n @Input()\n public readonly body?: string = '';\n\n @Input()\n public readonly bodyPlaceholder?: string = 'Body';\n\n @Input()\n public readonly disableAttachments?: boolean = false;\n\n @Input()\n public readonly saveBtnText?: string = 'Done';\n\n @Input()\n public readonly cancelBtnText?: string = 'Cancel';\n\n @Input()\n public readonly dismissable?: boolean = true;\n\n @Input()\n public readonly title?: string = '';\n\n @Input()\n public readonly info?: { start?: string; end?: string };\n\n @Input()\n public readonly toolbarMode?: 'full' | 'image-only' = 'full';\n\n @Input()\n public readonly allowEmptyValue?: boolean = false;\n\n protected value = '';\n\n public constructor(private readonly _modalCtrl: ModalController) {\n super();\n }\n\n public ngOnInit(): void {\n this.value = this.body;\n }\n\n protected onCloseClick(): void {\n this._modalCtrl.dismiss(null, 'cancel', this._modalName);\n }\n\n protected onSaveClick(): void {\n this._modalCtrl.dismiss(this.value, 'confirm', this._modalName);\n }\n}\n","import { BehaviorSelectorModalComponent } from '@app/modals/behavior-selector-modal/behavior-selector-modal.component';\nimport {\n EditRecognitionModalComponent,\n IEditRecognitionModalProps,\n IEditRecognitionModalResult\n} from '@app/modals/edit-recognition-modal/edit-recognition-modal.component';\nimport { InsightsRangeModalComponent } from '@app/modals/insights-range-modal/insights-range-modal.component';\nimport { TaskSelectorModalComponent } from '@app/modals/task-selector-modal/task-selector-modal.component';\nimport { UserSelectorModalComponent } from '@app/modals/user-selector-modal/user-selector-modal.component';\nimport { WysiwygModalComponent } from '@app/modals/wysiwyg-modal/wysiwyg-modal.component';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { ObjectId } from '@app/types/object-id';\nimport { TaskDto } from '@app/types/task-dto';\nimport { DateInterval } from '@backend/types/date-interval';\nimport { BehaviorModel } from '@core/model/behavior.model';\nimport { UserModel, UserNameModel } from '@core/model/user.model';\nimport { ActionSheetController, ModalController } from '@ionic/angular';\nimport { ComponentProps, ComponentRef } from '@ionic/core';\nimport { isMobile } from './is-mobile';\n\nexport interface IModalOptions {\n parentModalName?: string;\n useTopModalAsParent?: boolean;\n canDismiss?: boolean | ((data: T, role: string) => Promise);\n backdropDismiss?: boolean;\n onDidDismiss?: () => void;\n}\n\nexport const showModal = async (\n params: {\n component: ComponentRef;\n props?: ComponentProps;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n role: string;\n data: T;\n}> => {\n const isM = isMobile();\n const modalName = (params.component as any).name;\n\n const exists = document.getElementById(modalName);\n if (exists) return;\n\n let parentModalName = options?.parentModalName;\n\n if (options?.useTopModalAsParent) {\n const topModal = await modalCtrl.getTop();\n if (topModal) {\n parentModalName = topModal.id;\n }\n }\n\n const modal = await modalCtrl.create({\n id: modalName,\n cssClass: isM ? undefined : 'modal-auto-height',\n component: params.component,\n componentProps: params.props,\n handle: false,\n presentingElement: isM\n ? parentModalName\n ? document.getElementById(parentModalName)\n : document.querySelector('ion-split-pane')\n : undefined,\n canDismiss: options?.canDismiss,\n backdropDismiss: options?.backdropDismiss\n });\n modal.present();\n\n const { role, data } = await modal.onWillDismiss();\n\n modal.onDidDismiss().then(() => {\n if (options?.onDidDismiss) {\n options.onDidDismiss();\n }\n });\n\n return {\n role,\n data\n };\n};\n\nexport const showUserSelectorModal = async (\n modalProps: {\n recipients?: ObjectId[];\n hideSelectAllButton?: boolean;\n title?: string;\n users: (UserModel | UserNameModel)[];\n hiddenUsers?: (ObjectId | string)[];\n multiple?: boolean;\n focusSearchbar?: boolean;\n doneBtnText?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedUsers: ObjectId[];\n}> => {\n const { role, data } = await showModal(\n {\n component: UserSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedUsers: data };\n }\n\n return { success: false, selectedUsers: [] };\n};\n\nexport const showTaskSelectorModal = async (\n modalProps: {\n selectedTasks?: ObjectId[];\n title?: string;\n tasks: MongoStoredObject[];\n hiddenTasks?: ObjectId[];\n multiple?: boolean;\n focusSearchbar?: boolean;\n emptyText?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedTasks: ObjectId[];\n}> => {\n const { role, data } = await showModal(\n {\n component: TaskSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedTasks: data };\n }\n\n return { success: false, selectedTasks: [] };\n};\n\nexport const showBehaviorSelectorModal = async (\n modalProps: {\n behaviors?: BehaviorModel[];\n focusSearchbar?: boolean;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n selectedBehavior: BehaviorModel;\n}> => {\n const { role, data } = await showModal(\n {\n component: BehaviorSelectorModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, selectedBehavior: data };\n }\n\n return { success: false, selectedBehavior: null };\n};\n\nexport const showWysiwygModal = async (\n modalProps: {\n mode?: 'view' | 'edit';\n body?: string;\n bodyPlaceholder?: string;\n disableAttachments?: boolean;\n saveBtnText?: string;\n cancelBtnText?: string;\n dismissable?: boolean;\n title?: string;\n info?: { start?: string; end?: string };\n toolbarMode?: 'full' | 'image-only';\n allowEmptyValue?: boolean;\n },\n modalCtrl: ModalController,\n options?: Omit, 'canDismiss' | 'backdropDismiss'>\n): Promise<{\n success: boolean;\n body: string;\n}> => {\n const { role, data } = await showModal(\n {\n component: WysiwygModalComponent,\n props: modalProps\n },\n modalCtrl,\n {\n ...options,\n canDismiss:\n typeof modalProps.dismissable === 'boolean' && !modalProps.dismissable\n ? async (_, role) => role === 'confirm'\n : true,\n backdropDismiss:\n typeof modalProps.dismissable === 'boolean'\n ? modalProps.dismissable\n : true\n }\n );\n\n if (role === 'confirm') {\n return { success: true, body: data };\n }\n\n return { success: false, body: '' };\n};\n\nexport const showDateRangeModal = async (\n modalProps: {\n range: DateInterval;\n buttonText?: string;\n title?: string;\n },\n modalCtrl: ModalController,\n options?: IModalOptions\n): Promise<{\n success: boolean;\n range: DateInterval;\n}> => {\n const { role, data } = await showModal(\n {\n component: InsightsRangeModalComponent,\n props: modalProps\n },\n modalCtrl,\n options\n );\n\n if (role === 'confirm') {\n return { success: true, range: data };\n }\n\n return { success: false, range: null };\n};\n\nexport const showEditRecognitionModal = async (\n modalProps: IEditRecognitionModalProps,\n modalCtrl: ModalController,\n actionSheetCtrl: ActionSheetController,\n options?: Omit, 'canDismiss' | 'backdropDismiss'>\n) => {\n const { role, data } = await showModal(\n {\n component: EditRecognitionModalComponent,\n props: modalProps\n },\n modalCtrl,\n {\n ...options,\n canDismiss: async (_, r) => {\n if (r === 'cancel' || r === 'gesture' || r === 'backdrop') {\n const actionSheet = await actionSheetCtrl.create({\n header: 'Unsaved content',\n subHeader:\n 'Are you sure you want to discard your work and close the editor?',\n buttons: [\n {\n role: 'destructive',\n text: 'Discard and close'\n },\n {\n role: 'cancel',\n text: 'Continue editing'\n }\n ]\n });\n\n actionSheet.present();\n\n const { role } = await actionSheet.onWillDismiss();\n\n return role === 'destructive';\n }\n\n return true;\n }\n }\n );\n\n if (role === 'confirm') {\n return {\n success: true,\n recognition: data.recognition,\n behavior: data.behavior\n };\n }\n\n return { success: false, recognition: null, behavior: null };\n};\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport {\n TSpecPathAcknowledgeAnnouncement,\n TSpecRoute_acknowledgeAnnouncement\n} from '@backend/types/generated/Announcements/acknowledgeAnnouncement';\nimport {\n TSpecPathDeleteAnnouncement,\n TSpecRoute_deleteAnnouncement\n} from '@backend/types/generated/Announcements/deleteAnnouncement';\nimport {\n TSpecBodyEditAnnouncement,\n TSpecPathEditAnnouncement,\n TSpecRoute_editAnnouncement\n} from '@backend/types/generated/Announcements/editAnnouncement';\nimport {\n TSpecQueryGetAllAnnouncements,\n TSpecRoute_getAllAnnouncements\n} from '@backend/types/generated/Announcements/getAllAnnouncements';\nimport {\n TSpecPathGetAnnouncement,\n TSpecRoute_getAnnouncement\n} from '@backend/types/generated/Announcements/getAnnouncement';\nimport { TSpecRoute_getCriticalUnacknowledgedAnnouncements } from '@backend/types/generated/Announcements/getCriticalUnacknowledgedAnnouncements';\nimport {\n TSpecPathGetThreadOfAnnouncement,\n TSpecRoute_getThreadOfAnnouncement\n} from '@backend/types/generated/Announcements/getThreadOfAnnouncement';\nimport { TSpecRoute_getUnacknowledgedCount } from '@backend/types/generated/Announcements/getUnacknowledgedCount';\nimport {\n TSpecBodyPublishAnnouncement,\n TSpecRoute_publishAnnouncement\n} from '@backend/types/generated/Announcements/publishAnnouncement';\nimport {\n TSpecPathReadAnnouncement,\n TSpecRoute_readAnnouncement\n} from '@backend/types/generated/Announcements/readAnnouncement';\nimport {\n TSpecBodyRespondToAnnouncement,\n TSpecPathRespondToAnnouncement,\n TSpecRoute_respondToAnnouncement\n} from '@backend/types/generated/Announcements/respondToAnnouncement';\nimport { AnnouncementModel } from '@core/model/announcement.model';\nimport { Observable } from 'rxjs';\n\n@Injectable()\nexport class AnnouncementApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public getUnacknowledgedCount(): Observable<{\n unacknowledgedCount: number;\n }> {\n return this._httpClient.get<{ unacknowledgedCount: number }>(\n TSpecRoute_getUnacknowledgedCount()\n );\n }\n\n public getCriticalUnacknowledgedAnnouncements(): Observable<{\n items: AnnouncementModel[];\n count: number;\n totalCount: number;\n }> {\n return this._httpClient.get<{\n items: AnnouncementModel[];\n count: number;\n totalCount: number;\n }>(TSpecRoute_getCriticalUnacknowledgedAnnouncements());\n }\n\n public getAllAnnouncements(params: {\n query: TSpecQueryGetAllAnnouncements;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getAllAnnouncements(),\n { params: { ...params.query } }\n );\n }\n\n public getAnnouncement(params: {\n path: TSpecPathGetAnnouncement;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getAnnouncement(params.path)\n );\n }\n\n public publishAnnouncement(params: { body: TSpecBodyPublishAnnouncement }) {\n return this._httpClient.post(TSpecRoute_publishAnnouncement(), params.body);\n }\n\n public editAnnouncement(params: {\n path: TSpecPathEditAnnouncement;\n body: TSpecBodyEditAnnouncement;\n }) {\n return this._httpClient.patch(\n TSpecRoute_editAnnouncement(params.path),\n params.body\n );\n }\n\n public readAnnouncement(params: { path: TSpecPathReadAnnouncement }) {\n return this._httpClient.post(TSpecRoute_readAnnouncement(params.path), {});\n }\n\n public acknowledgeAnnouncement(params: {\n path: TSpecPathAcknowledgeAnnouncement;\n }) {\n return this._httpClient.post(\n TSpecRoute_acknowledgeAnnouncement(params.path),\n {}\n );\n }\n\n public deleteAnnouncement(params: { path: TSpecPathDeleteAnnouncement }) {\n return this._httpClient.delete(TSpecRoute_deleteAnnouncement(params.path));\n }\n\n public respondToAnnouncement(params: {\n path: TSpecPathRespondToAnnouncement;\n body: TSpecBodyRespondToAnnouncement;\n }): Observable {\n return this._httpClient.post(\n TSpecRoute_respondToAnnouncement(params.path),\n params.body\n );\n }\n\n public getThreadOfAnnouncement(params: {\n path: TSpecPathGetThreadOfAnnouncement;\n }): Observable {\n return this._httpClient.get(\n TSpecRoute_getThreadOfAnnouncement(params.path)\n );\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getUnacknowledgedCount = () => \"/announcements/unacknowledged-count\";\n\nexport type TSpecHandler_getUnacknowledgedCount = RequestHandler;\n\nexport interface TSpecPathGetUnacknowledgedCount { }\n\nexport interface TSpecBodyGetUnacknowledgedCount {}\n\nexport interface TSpecQueryGetUnacknowledgedCount {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getCriticalUnacknowledgedAnnouncements = () => \"/announcements/critical-unacknowledged\";\n\nexport type TSpecHandler_getCriticalUnacknowledgedAnnouncements = RequestHandler;\n\nexport interface TSpecPathGetCriticalUnacknowledgedAnnouncements { }\n\nexport interface TSpecBodyGetCriticalUnacknowledgedAnnouncements {}\n\nexport interface TSpecQueryGetCriticalUnacknowledgedAnnouncements {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllAnnouncements = () => \"/announcements\";\n\nexport type TSpecHandler_getAllAnnouncements = RequestHandler;\n\nexport interface TSpecPathGetAllAnnouncements { }\n\nexport interface TSpecBodyGetAllAnnouncements {}\n\nexport interface TSpecQueryGetAllAnnouncements {\n page?: string;\n limit?: string;\n searchTerm?: string;\n showRewardReports?: boolean;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAnnouncement = (path: TSpecPathGetAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getAnnouncement = RequestHandler;\n\nexport interface TSpecPathGetAnnouncement { id: string; }\n\nexport interface TSpecBodyGetAnnouncement {}\n\nexport interface TSpecQueryGetAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_publishAnnouncement = () => \"/announcements\";\n\nexport type TSpecHandler_publishAnnouncement = RequestHandler;\n\nexport interface TSpecPathPublishAnnouncement { }\n\nexport interface TSpecBodyPublishAnnouncement {\n title: string;\n body: string;\n recipients: {\n id: string;\n }[];\n isCritical: boolean;\n attachments: string[];\n}\n\nexport interface TSpecQueryPublishAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_editAnnouncement = (path: TSpecPathEditAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_editAnnouncement = RequestHandler;\n\nexport interface TSpecPathEditAnnouncement { id: string; }\n\nexport interface TSpecBodyEditAnnouncement {\n title: string;\n body: string;\n isCritical: boolean;\n recipients: {\n id: string;\n }[];\n attachments: string[];\n keepStats?: boolean;\n}\n\nexport interface TSpecQueryEditAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_readAnnouncement = (path: TSpecPathReadAnnouncement) => {\n let res = \"/announcements/:id/read\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_readAnnouncement = RequestHandler;\n\nexport interface TSpecPathReadAnnouncement { id: string; }\n\nexport interface TSpecBodyReadAnnouncement {}\n\nexport interface TSpecQueryReadAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_acknowledgeAnnouncement = (path: TSpecPathAcknowledgeAnnouncement) => {\n let res = \"/announcements/:id/acknowledge\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_acknowledgeAnnouncement = RequestHandler;\n\nexport interface TSpecPathAcknowledgeAnnouncement { id: string; }\n\nexport interface TSpecBodyAcknowledgeAnnouncement {}\n\nexport interface TSpecQueryAcknowledgeAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteAnnouncement = (path: TSpecPathDeleteAnnouncement) => {\n let res = \"/announcements/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteAnnouncement = RequestHandler;\n\nexport interface TSpecPathDeleteAnnouncement { id: string; }\n\nexport interface TSpecBodyDeleteAnnouncement {}\n\nexport interface TSpecQueryDeleteAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_respondToAnnouncement = (path: TSpecPathRespondToAnnouncement) => {\n let res = \"/announcements/:id/respond\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_respondToAnnouncement = RequestHandler;\n\nexport interface TSpecPathRespondToAnnouncement { id: string; }\n\nexport interface TSpecBodyRespondToAnnouncement {\n body: string;\n}\n\nexport interface TSpecQueryRespondToAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getThreadOfAnnouncement = (path: TSpecPathGetThreadOfAnnouncement) => {\n let res = \"/announcements/:id/thread\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_getThreadOfAnnouncement = RequestHandler;\n\nexport interface TSpecPathGetThreadOfAnnouncement { id: string; }\n\nexport interface TSpecBodyGetThreadOfAnnouncement {}\n\nexport interface TSpecQueryGetThreadOfAnnouncement {\n AppVersion?: string;\n AppUser?: string;\n}\n","import toPropertyKey from \"./toPropertyKey.js\";\nfunction _defineProperty(e, r, t) {\n return (r = toPropertyKey(r)) in e ? Object.defineProperty(e, r, {\n value: t,\n enumerable: !0,\n configurable: !0,\n writable: !0\n }) : e[r] = t, e;\n}\nexport { _defineProperty as default };","export const config = {\n onUnhandledError: null,\n onStoppedNotification: null,\n Promise: undefined,\n useDeprecatedSynchronousErrorHandling: false,\n useDeprecatedNextContext: false,\n};\n","export const timeoutProvider = {\n setTimeout(handler, timeout, ...args) {\n const { delegate } = timeoutProvider;\n if (delegate === null || delegate === void 0 ? void 0 : delegate.setTimeout) {\n return delegate.setTimeout(handler, timeout, ...args);\n }\n return setTimeout(handler, timeout, ...args);\n },\n clearTimeout(handle) {\n const { delegate } = timeoutProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearTimeout) || clearTimeout)(handle);\n },\n delegate: undefined,\n};\n","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar _index = _interopRequireDefault(require(\"./_lib/formatDistance/index.js\"));\nvar _index2 = _interopRequireDefault(require(\"./_lib/formatLong/index.js\"));\nvar _index3 = _interopRequireDefault(require(\"./_lib/formatRelative/index.js\"));\nvar _index4 = _interopRequireDefault(require(\"./_lib/localize/index.js\"));\nvar _index5 = _interopRequireDefault(require(\"./_lib/match/index.js\"));\n/**\n * @type {Locale}\n * @category Locales\n * @summary English locale (United States).\n * @language English\n * @iso-639-2 eng\n * @author Sasha Koss [@kossnocorp]{@link https://github.com/kossnocorp}\n * @author Lesha Koss [@leshakoss]{@link https://github.com/leshakoss}\n */\nvar locale = {\n code: 'en-US',\n formatDistance: _index.default,\n formatLong: _index2.default,\n formatRelative: _index3.default,\n localize: _index4.default,\n match: _index5.default,\n options: {\n weekStartsOn: 0 /* Sunday */,\n firstWeekContainsDate: 1\n }\n};\nvar _default = locale;\nexports.default = _default;\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = toDate;\nvar _typeof2 = _interopRequireDefault(require(\"@babel/runtime/helpers/typeof\"));\nvar _index = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\n/**\n * @name toDate\n * @category Common Helpers\n * @summary Convert the given argument to an instance of Date.\n *\n * @description\n * Convert the given argument to an instance of Date.\n *\n * If the argument is an instance of Date, the function returns its clone.\n *\n * If the argument is a number, it is treated as a timestamp.\n *\n * If the argument is none of the above, the function returns Invalid Date.\n *\n * **Note**: *all* Date arguments passed to any *date-fns* function is processed by `toDate`.\n *\n * @param {Date|Number} argument - the value to convert\n * @returns {Date} the parsed date in the local time zone\n * @throws {TypeError} 1 argument required\n *\n * @example\n * // Clone the date:\n * const result = toDate(new Date(2014, 1, 11, 11, 30, 30))\n * //=> Tue Feb 11 2014 11:30:30\n *\n * @example\n * // Convert the timestamp to date:\n * const result = toDate(1392098430000)\n * //=> Tue Feb 11 2014 11:30:30\n */\nfunction toDate(argument) {\n (0, _index.default)(1, arguments);\n var argStr = Object.prototype.toString.call(argument);\n\n // Clone the date\n if (argument instanceof Date || (0, _typeof2.default)(argument) === 'object' && argStr === '[object Date]') {\n // Prevent the date to lose the milliseconds when passed to new Date() in IE10\n return new Date(argument.getTime());\n } else if (typeof argument === 'number' || argStr === '[object Number]') {\n return new Date(argument);\n } else {\n if ((typeof argument === 'string' || argStr === '[object String]') && typeof console !== 'undefined') {\n // eslint-disable-next-line no-console\n console.warn(\"Starting with v2.0.0-beta.1 date-fns doesn't accept strings as date arguments. Please use `parseISO` to parse strings. See: https://github.com/date-fns/date-fns/blob/master/docs/upgradeGuide.md#string-arguments\");\n // eslint-disable-next-line no-console\n console.warn(new Error().stack);\n }\n return new Date(NaN);\n }\n}\nmodule.exports = exports.default;","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\").default;\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = isDate;\nvar _typeof2 = _interopRequireDefault(require(\"@babel/runtime/helpers/typeof\"));\nvar _index = _interopRequireDefault(require(\"../_lib/requiredArgs/index.js\"));\n/**\n * @name isDate\n * @category Common Helpers\n * @summary Is the given value a date?\n *\n * @description\n * Returns true if the given value is an instance of Date. The function works for dates transferred across iframes.\n *\n * @param {*} value - the value to check\n * @returns {boolean} true if the given value is a date\n * @throws {TypeError} 1 arguments required\n *\n * @example\n * // For a valid date:\n * const result = isDate(new Date())\n * //=> true\n *\n * @example\n * // For an invalid date:\n * const result = isDate(new Date(NaN))\n * //=> true\n *\n * @example\n * // For some value:\n * const result = isDate('2014-02-31')\n * //=> false\n *\n * @example\n * // For an object:\n * const result = isDate({})\n * //=> false\n */\nfunction isDate(value) {\n (0, _index.default)(1, arguments);\n return value instanceof Date || (0, _typeof2.default)(value) === 'object' && Object.prototype.toString.call(value) === '[object Date]';\n}\nmodule.exports = exports.default;","import toDate from \"../../toDate/index.js\";\nimport requiredArgs from \"../requiredArgs/index.js\";\nexport default function startOfUTCISOWeek(dirtyDate) {\n requiredArgs(1, arguments);\n var weekStartsOn = 1;\n var date = toDate(dirtyDate);\n var day = date.getUTCDay();\n var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n date.setUTCDate(date.getUTCDate() - diff);\n date.setUTCHours(0, 0, 0, 0);\n return date;\n}","import { Injectable } from '@angular/core';\nimport { Observable, Subject, map, repeat, shareReplay, tap } from 'rxjs';\nimport { InstantFeedbackApiService } from './api/instantFeedback.api.service';\nimport { TSpecQueryGetInstantFeedbacks } from '@backend/types/generated/InstantFeedback/getInstantFeedbacks';\nimport { TSpecBodySendInstantFeedback } from '@backend/types/generated/InstantFeedback/sendInstantFeedback';\n\n@Injectable({ providedIn: 'root' })\nexport class InstantFeedbackService {\n public readonly pageSize = 20;\n\n private readonly _update$ = new Subject();\n\n public unreadCount$: Observable = this._api.getUnreadCount().pipe(\n map(({ unreadCount }) => unreadCount),\n repeat({ delay: () => this._update$ }),\n shareReplay({ refCount: true, bufferSize: 1 })\n );\n\n public constructor(private readonly _api: InstantFeedbackApiService) {}\n\n private _update() {\n this._update$.next();\n }\n\n public readInstantFeedback(instantFeedbackId: string) {\n return this._api\n .readInstantFeedback({ path: { id: instantFeedbackId } })\n .pipe(tap(() => this._update()));\n }\n\n public getInstantFeedbacks(query: TSpecQueryGetInstantFeedbacks) {\n return this._api.getInstantFeedbacks({ query });\n }\n\n public sendInstantFeedback(body: TSpecBodySendInstantFeedback) {\n return this._api\n .sendInstantFeedback({ body })\n .pipe(tap(() => this._update()));\n }\n}\n","import { config } from '../config';\nlet context = null;\nexport function errorContext(cb) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n const isRoot = !context;\n if (isRoot) {\n context = { errorThrown: false, error: null };\n }\n cb();\n if (isRoot) {\n const { errorThrown, error } = context;\n context = null;\n if (errorThrown) {\n throw error;\n }\n }\n }\n else {\n cb();\n }\n}\nexport function captureError(err) {\n if (config.useDeprecatedSynchronousErrorHandling && context) {\n context.errorThrown = true;\n context.error = err;\n }\n}\n","import { registerPlugin } from '@capacitor/core';\nconst Haptics = registerPlugin('Haptics', {\n web: () => import('./web').then(m => new m.HapticsWeb()),\n});\nexport * from './definitions';\nexport { Haptics };\n","import { startOfDay, addDays, endOfDay } from 'date-fns';\n\nexport function lastNDays(n: number) {\n const start = startOfDay(addDays(new Date(), -(n - 1)));\n const end = endOfDay(addDays(start, n - 1));\n return { start, end };\n}\n","import { executeSchedule } from '../util/executeSchedule';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function observeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n source.subscribe(createOperatorSubscriber(subscriber, (value) => executeSchedule(subscriber, scheduler, () => subscriber.next(value), delay), () => executeSchedule(subscriber, scheduler, () => subscriber.complete(), delay), (err) => executeSchedule(subscriber, scheduler, () => subscriber.error(err), delay)));\n });\n}\n","import { operate } from '../util/lift';\nexport function subscribeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n subscriber.add(scheduler.schedule(() => source.subscribe(subscriber), delay));\n });\n}\n","import { Observable } from '../Observable';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleAsyncIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable((subscriber) => {\n executeSchedule(subscriber, scheduler, () => {\n const iterator = input[Symbol.asyncIterator]();\n executeSchedule(subscriber, scheduler, () => {\n iterator.next().then((result) => {\n if (result.done) {\n subscriber.complete();\n }\n else {\n subscriber.next(result.value);\n }\n });\n }, 0, true);\n });\n });\n}\n","import { scheduled } from '../scheduled/scheduled';\nimport { innerFrom } from './innerFrom';\nexport function from(input, scheduler) {\n return scheduler ? scheduled(input, scheduler) : innerFrom(input);\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isReadableStreamLike } from '../util/isReadableStreamLike';\nimport { scheduleReadableStreamLike } from './scheduleReadableStreamLike';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n if (isAsyncIterable(input)) {\n return scheduleAsyncIterable(input, scheduler);\n }\n if (isIterable(input)) {\n return scheduleIterable(input, scheduler);\n }\n if (isReadableStreamLike(input)) {\n return scheduleReadableStreamLike(input, scheduler);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function scheduleObservable(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nexport function scheduleArray(input, scheduler) {\n return new Observable((subscriber) => {\n let i = 0;\n return scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n }\n else {\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n this.schedule();\n }\n }\n });\n });\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function schedulePromise(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from '../util/isFunction';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleIterable(input, scheduler) {\n return new Observable((subscriber) => {\n let iterator;\n executeSchedule(subscriber, scheduler, () => {\n iterator = input[Symbol_iterator]();\n executeSchedule(subscriber, scheduler, () => {\n let value;\n let done;\n try {\n ({ value, done } = iterator.next());\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n }\n }, 0, true);\n });\n return () => isFunction(iterator === null || iterator === void 0 ? void 0 : iterator.return) && iterator.return();\n });\n}\n","import { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nexport function scheduleReadableStreamLike(input, scheduler) {\n return scheduleAsyncIterable(readableStreamLikeToAsyncGenerator(input), scheduler);\n}\n","import { ChangeDetectionStrategy, Component, Input } from '@angular/core';\nimport { IonicModule } from '@ionic/angular';\nimport { CommonModule } from '@angular/common';\nimport { DirectivesModule } from '@app/modules/directives.module';\n\n@Component({\n selector: 'app-read-eye',\n templateUrl: './read-eye.component.html',\n styleUrls: ['./read-eye.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n imports: [CommonModule, IonicModule, DirectivesModule],\n standalone: true\n})\nexport class ReadEyeComponent {\n @Input()\n public readonly label: string;\n\n @Input()\n public readonly button?: boolean = false;\n}\n","\n \n {{ label }}\n \n\n","\n \n \n \n \n \n \n \n\n\n \n \n \n
\n
1\"\n >\n \n \n","import {\n Component,\n Input,\n ViewChild,\n ElementRef,\n AfterViewInit\n} from '@angular/core';\nimport { ModalController } from '@ionic/angular';\nimport { SwiperContainer } from 'swiper/element';\n\n@Component({\n selector: 'app-image-viewer-modal',\n templateUrl: './image-viewer-modal.component.html',\n styleUrls: ['./image-viewer-modal.component.scss'],\n standalone: false\n})\nexport class ImageViewerModalComponent implements AfterViewInit {\n @Input()\n public images: string[];\n\n @Input()\n public initialIndex: number;\n\n @ViewChild('swiper') swiper!: ElementRef;\n @ViewChild('swiperThumbs') swiperThumbs!: ElementRef;\n\n protected swiperConfig: any = {\n spaceBetween: 10\n };\n protected swiperThumbsConfig: any = {\n spaceBetween: 10,\n slidesPerView: 'auto',\n freeMode: true,\n watchSlidesProgress: true,\n centeredSlides: true\n };\n\n public constructor(private readonly _modalCtrl: ModalController) {}\n\n public ngAfterViewInit() {\n this.swiper.nativeElement.swiper.activeIndex = this.initialIndex;\n this.swiperThumbs.nativeElement.swiper.activeIndex = this.initialIndex;\n\n this.swiper.nativeElement.swiper.on(\n 'slideChange',\n (e: { activeIndex: number }) => {\n this.swiperThumbs.nativeElement.swiper.slideTo(e.activeIndex);\n }\n );\n this.swiper.nativeElement.swiper.on(\n 'zoomChange',\n (_: any, scale: number) => {\n this.swiper.nativeElement.swiper.allowTouchMove = scale === 1;\n }\n );\n\n this.swiperThumbs.nativeElement.swiper.on(\n 'touchEnd',\n (e: { activeIndex: number }) => {\n this.swiper.nativeElement.swiper.slideTo(e.activeIndex);\n }\n );\n }\n\n protected onThumbClick(index: number) {\n this.swiper.nativeElement.swiper.slideTo(index);\n }\n\n protected close() {\n this._modalCtrl.dismiss(null, 'destructive', 'image-viewer-modal');\n }\n}\n","import { Injectable } from '@angular/core';\nimport { ImageViewerModalComponent } from '@app/modules/image-viewer-modal/image-viewer-modal.component';\nimport { ModalController } from '@ionic/angular';\n\n@Injectable({ providedIn: 'root' })\nexport class ImageViewerService {\n public constructor(private readonly _modalCtrl: ModalController) {}\n\n public async viewImage(images: string[], initialIndex: number) {\n const modal = await this._modalCtrl.create({\n id: 'image-viewer-modal',\n component: ImageViewerModalComponent,\n handle: false,\n breakpoints: [0, 1],\n initialBreakpoint: 1,\n componentProps: {\n images,\n initialIndex\n },\n cssClass: 'fullscreen-modal'\n });\n modal.present();\n }\n}\n","import _typeof from \"./typeof.js\";\nimport toPrimitive from \"./toPrimitive.js\";\nfunction toPropertyKey(t) {\n var i = toPrimitive(t, \"string\");\n return \"symbol\" == _typeof(i) ? i : i + \"\";\n}\nexport { toPropertyKey as default };","import _typeof from \"./typeof.js\";\nfunction toPrimitive(t, r) {\n if (\"object\" != _typeof(t) || !t) return t;\n var e = t[Symbol.toPrimitive];\n if (void 0 !== e) {\n var i = e.call(t, r || \"default\");\n if (\"object\" != _typeof(i)) return i;\n throw new TypeError(\"@@toPrimitive must return a primitive value.\");\n }\n return (\"string\" === r ? String : Number)(t);\n}\nexport { toPrimitive as default };","const { isArray } = Array;\nconst { getPrototypeOf, prototype: objectProto, keys: getKeys } = Object;\nexport function argsArgArrayOrObject(args) {\n if (args.length === 1) {\n const first = args[0];\n if (isArray(first)) {\n return { args: first, keys: null };\n }\n if (isPOJO(first)) {\n const keys = getKeys(first);\n return {\n args: keys.map((key) => first[key]),\n keys,\n };\n }\n }\n return { args: args, keys: null };\n}\nfunction isPOJO(obj) {\n return obj && typeof obj === 'object' && getPrototypeOf(obj) === objectProto;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_updateBackdoorInfo = (path: TSpecPathUpdateBackdoorInfo) => {\n let res = \"/backdoor/info/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_updateBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathUpdateBackdoorInfo { id: string; }\n\nexport interface TSpecBodyUpdateBackdoorInfo {\n versionRange: string;\n title: string;\n message: string;\n links: {\n text?: string;\n url?: string;\n }[];\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n platformsToShow: EBackdoorInfoPlatform[];\n}\n\nexport enum EBackdoorInfoPlatform {\n web = \"web\",\n ios = \"ios\",\n android = \"android\"\n}\n\nexport interface TSpecQueryUpdateBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { MongoStoredObject } from '@app/types/mongo-stored-object';\nimport { IBackdoorEula } from '@backend/models/types/backdoor-eula';\nimport { IBackdoorInfo } from '@backend/models/types/backdoor-info';\nimport {\n TSpecBodyAcceptEula,\n TSpecPathAcceptEula,\n TSpecRoute_acceptEula\n} from '@backend/types/generated/Backdoor/acceptEula';\nimport {\n TSpecBodyAddBackdoorEula,\n TSpecRoute_addBackdoorEula\n} from '@backend/types/generated/Backdoor/addBackdoorEula';\nimport {\n TSpecBodyAddBackdoorInfo,\n TSpecRoute_addBackdoorInfo\n} from '@backend/types/generated/Backdoor/addBackdoorInfo';\nimport {\n TSpecPathDeleteBackdoorEula,\n TSpecRoute_deleteBackdoorEula\n} from '@backend/types/generated/Backdoor/deleteBackdoorEula';\nimport {\n TSpecPathDeleteBackdoorInfo,\n TSpecRoute_deleteBackdoorInfo\n} from '@backend/types/generated/Backdoor/deleteBackdoorInfo';\nimport { TSpecRoute_getAllBackdoorEulas } from '@backend/types/generated/Backdoor/getAllBackdoorEulas';\nimport { TSpecRoute_getAllBackdoorInfos } from '@backend/types/generated/Backdoor/getAllBackdoorInfos';\nimport {\n TSpecQueryGetBackdoorState,\n TSpecRoute_getBackdoorState\n} from '@backend/types/generated/Backdoor/getBackdoorState';\nimport {\n TSpecBodyUpdateBackdoorEula,\n TSpecPathUpdateBackdoorEula,\n TSpecRoute_updateBackdoorEula\n} from '@backend/types/generated/Backdoor/updateBackdoorEula';\nimport {\n TSpecBodyUpdateBackdoorInfo,\n TSpecPathUpdateBackdoorInfo,\n TSpecRoute_updateBackdoorInfo\n} from '@backend/types/generated/Backdoor/updateBackdoorInfo';\nimport { Observable } from 'rxjs';\n\n@Injectable()\nexport class BackdoorApiService {\n public constructor(private readonly _httpClient: HttpClient) {}\n\n public acceptEula(params: {\n path: TSpecPathAcceptEula;\n body: TSpecBodyAcceptEula;\n }): Observable {\n return this._httpClient.post(\n TSpecRoute_acceptEula(params.path),\n params.body\n );\n }\n\n public getBackdoorState(params: {\n query: TSpecQueryGetBackdoorState;\n }): Observable<{\n currentInfo: MongoStoredObject | null;\n currentEula: MongoStoredObject | null;\n isUserDeleted: boolean;\n }> {\n return this._httpClient.get<{\n currentInfo: MongoStoredObject | null;\n currentEula: MongoStoredObject | null;\n isUserDeleted: boolean;\n }>(TSpecRoute_getBackdoorState(), {\n params: { ...params.query }\n });\n }\n\n public getAllBackdoorInfos(): Observable[]> {\n return this._httpClient.get[]>(\n TSpecRoute_getAllBackdoorInfos()\n );\n }\n\n public getAllBackdoorEulas(): Observable[]> {\n return this._httpClient.get[]>(\n TSpecRoute_getAllBackdoorEulas()\n );\n }\n\n public addBackdoorInfo(params: {\n body: TSpecBodyAddBackdoorInfo;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_addBackdoorInfo(),\n params.body\n );\n }\n\n public addBackdoorEula(params: {\n body: TSpecBodyAddBackdoorEula;\n }): Observable> {\n return this._httpClient.post>(\n TSpecRoute_addBackdoorEula(),\n params.body\n );\n }\n\n public updateBackdoorInfo(params: {\n path: TSpecPathUpdateBackdoorInfo;\n body: TSpecBodyUpdateBackdoorInfo;\n }): Observable> {\n return this._httpClient.put>(\n TSpecRoute_updateBackdoorInfo(params.path),\n params.body\n );\n }\n\n public updateBackdoorEula(params: {\n path: TSpecPathUpdateBackdoorEula;\n body: TSpecBodyUpdateBackdoorEula;\n }): Observable> {\n return this._httpClient.put>(\n TSpecRoute_updateBackdoorEula(params.path),\n params.body\n );\n }\n\n public deleteBackdoorInfo(params: { path: TSpecPathDeleteBackdoorInfo }) {\n return this._httpClient.delete(TSpecRoute_deleteBackdoorInfo(params.path));\n }\n\n public deleteBackdoorEula(params: { path: TSpecPathDeleteBackdoorEula }) {\n return this._httpClient.delete(TSpecRoute_deleteBackdoorEula(params.path));\n }\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_acceptEula = (path: TSpecPathAcceptEula) => {\n let res = \"/backdoor/eula/:backdoorEulaId/accept\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_acceptEula = RequestHandler;\n\nexport interface TSpecPathAcceptEula { backdoorEulaId: string; }\n\nexport interface TSpecBodyAcceptEula {\n deviceId: string;\n deviceModel: string;\n deviceOperatingSystem: string;\n deviceOsVersion: string;\n deviceWebViewVersion: string;\n devicePlatform: string;\n}\n\nexport interface TSpecQueryAcceptEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getBackdoorState = () => \"/backdoor/current-info\";\n\nexport type TSpecHandler_getBackdoorState = RequestHandler;\n\nexport interface TSpecPathGetBackdoorState { }\n\nexport interface TSpecBodyGetBackdoorState {}\n\nexport interface TSpecQueryGetBackdoorState {\n version: string;\n platform?: string;\n manufacturer?: string;\n model?: string;\n osVersion?: string;\n operatingSystem?: string;\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllBackdoorInfos = () => \"/backdoor/info\";\n\nexport type TSpecHandler_getAllBackdoorInfos = RequestHandler;\n\nexport interface TSpecPathGetAllBackdoorInfos { }\n\nexport interface TSpecBodyGetAllBackdoorInfos {}\n\nexport interface TSpecQueryGetAllBackdoorInfos {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_getAllBackdoorEulas = () => \"/backdoor/eula\";\n\nexport type TSpecHandler_getAllBackdoorEulas = RequestHandler;\n\nexport interface TSpecPathGetAllBackdoorEulas { }\n\nexport interface TSpecBodyGetAllBackdoorEulas {}\n\nexport interface TSpecQueryGetAllBackdoorEulas {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_addBackdoorInfo = () => \"/backdoor/info\";\n\nexport type TSpecHandler_addBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathAddBackdoorInfo { }\n\nexport interface TSpecBodyAddBackdoorInfo {\n versionRange: string;\n title: string;\n message: string;\n links: {\n text?: string;\n url?: string;\n }[];\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n platformsToShow: EBackdoorInfoPlatform[];\n}\n\nexport enum EBackdoorInfoPlatform {\n web = \"web\",\n ios = \"ios\",\n android = \"android\"\n}\n\nexport interface TSpecQueryAddBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_addBackdoorEula = () => \"/backdoor/eula\";\n\nexport type TSpecHandler_addBackdoorEula = RequestHandler;\n\nexport interface TSpecPathAddBackdoorEula { }\n\nexport interface TSpecBodyAddBackdoorEula {\n title: string;\n iframeCode: string;\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n}\n\nexport interface TSpecQueryAddBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_updateBackdoorEula = (path: TSpecPathUpdateBackdoorEula) => {\n let res = \"/backdoor/eula/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_updateBackdoorEula = RequestHandler;\n\nexport interface TSpecPathUpdateBackdoorEula { id: string; }\n\nexport interface TSpecBodyUpdateBackdoorEula {\n title: string;\n iframeCode: string;\n canDismiss: boolean;\n tenantsToShow: string[];\n showToAllTenants: boolean;\n}\n\nexport interface TSpecQueryUpdateBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteBackdoorInfo = (path: TSpecPathDeleteBackdoorInfo) => {\n let res = \"/backdoor/info/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteBackdoorInfo = RequestHandler;\n\nexport interface TSpecPathDeleteBackdoorInfo { id: string; }\n\nexport interface TSpecBodyDeleteBackdoorInfo {}\n\nexport interface TSpecQueryDeleteBackdoorInfo {\n AppVersion?: string;\n AppUser?: string;\n}\n","// DO NOT MODIFY! THIS FILE IS AUTOGENERATED BY generate-endpoint-spec.util.ts\n\nimport { RequestHandler } from 'express';\n\nexport const TSpecRoute_deleteBackdoorEula = (path: TSpecPathDeleteBackdoorEula) => {\n let res = \"/backdoor/eula/:id\";\n Object.entries(path).map(([key, value]) => {\n res = res.replace(':' + key, value);\n });\n return res;\n};\n\nexport type TSpecHandler_deleteBackdoorEula = RequestHandler;\n\nexport interface TSpecPathDeleteBackdoorEula { id: string; }\n\nexport interface TSpecBodyDeleteBackdoorEula {}\n\nexport interface TSpecQueryDeleteBackdoorEula {\n AppVersion?: string;\n AppUser?: string;\n}\n","import * as i0 from '@angular/core';\nimport { Injectable, Inject, EventEmitter, forwardRef, Component, ViewEncapsulation, Input, HostBinding, Output, ViewChild, HostListener, SecurityContext, Attribute, ContentChild, NgModule } from '@angular/core';\nimport * as i1$1 from '@angular/common';\nimport { DOCUMENT, CommonModule } from '@angular/common';\nimport * as i1 from '@angular/common/http';\nimport * as i3 from '@angular/forms';\nimport { NG_VALUE_ACCESSOR, FormsModule, ReactiveFormsModule } from '@angular/forms';\nimport * as i2 from '@angular/platform-browser';\n\nclass AngularEditorService {\n constructor(http, doc) {\n this.http = http;\n this.doc = doc;\n /**\n * save selection when the editor is focussed out\n */\n this.saveSelection = () => {\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n if (sel.getRangeAt && sel.rangeCount) {\n this.savedSelection = sel.getRangeAt(0);\n this.selectedText = sel.toString();\n }\n }\n else if (this.doc.getSelection && this.doc.createRange) {\n this.savedSelection = document.createRange();\n }\n else {\n this.savedSelection = null;\n }\n };\n }\n /**\n * Executed command from editor header buttons exclude toggleEditorMode\n * @param command string from triggerCommand\n * @param value\n */\n executeCommand(command, value) {\n const commands = ['h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'p', 'pre'];\n if (commands.includes(command)) {\n this.doc.execCommand('formatBlock', false, command);\n return;\n }\n this.doc.execCommand(command, false, value);\n }\n /**\n * Create URL link\n * @param url string from UI prompt\n */\n createLink(url) {\n if (!url.includes('http')) {\n this.doc.execCommand('createlink', false, url);\n }\n else {\n const newUrl = '' + this.selectedText + ' ';\n this.insertHtml(newUrl);\n }\n }\n /**\n * insert color either font or background\n *\n * @param color color to be inserted\n * @param where where the color has to be inserted either text/background\n */\n insertColor(color, where) {\n const restored = this.restoreSelection();\n if (restored) {\n if (where === 'textColor') {\n this.doc.execCommand('foreColor', false, color);\n }\n else {\n this.doc.execCommand('hiliteColor', false, color);\n }\n }\n }\n /**\n * Set font name\n * @param fontName string\n */\n setFontName(fontName) {\n this.doc.execCommand('fontName', false, fontName);\n }\n /**\n * Set font size\n * @param fontSize string\n */\n setFontSize(fontSize) {\n this.doc.execCommand('fontSize', false, fontSize);\n }\n /**\n * Create raw HTML\n * @param html HTML string\n */\n insertHtml(html) {\n const isHTMLInserted = this.doc.execCommand('insertHTML', false, html);\n if (!isHTMLInserted) {\n throw new Error('Unable to perform the operation');\n }\n }\n /**\n * restore selection when the editor is focused in\n *\n * saved selection when the editor is focused out\n */\n restoreSelection() {\n if (this.savedSelection) {\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n sel.removeAllRanges();\n sel.addRange(this.savedSelection);\n return true;\n }\n else if (this.doc.getSelection /*&& this.savedSelection.select*/) {\n // this.savedSelection.select();\n return true;\n }\n }\n else {\n return false;\n }\n }\n /**\n * setTimeout used for execute 'saveSelection' method in next event loop iteration\n */\n executeInNextQueueIteration(callbackFn, timeout = 1e2) {\n setTimeout(callbackFn, timeout);\n }\n /** check any selection is made or not */\n checkSelection() {\n const selectedText = this.savedSelection.toString();\n if (selectedText.length === 0) {\n throw new Error('No Selection Made');\n }\n return true;\n }\n /**\n * Upload file to uploadUrl\n * @param file The file\n */\n uploadImage(file) {\n const uploadData = new FormData();\n uploadData.append('file', file, file.name);\n return this.http.post(this.uploadUrl, uploadData, {\n reportProgress: true,\n observe: 'events',\n withCredentials: this.uploadWithCredentials,\n });\n }\n /**\n * Insert image with Url\n * @param imageUrl The imageUrl.\n */\n insertImage(imageUrl) {\n this.doc.execCommand('insertImage', false, imageUrl);\n }\n setDefaultParagraphSeparator(separator) {\n this.doc.execCommand('defaultParagraphSeparator', false, separator);\n }\n createCustomClass(customClass) {\n let newTag = this.selectedText;\n if (customClass) {\n const tagName = customClass.tag ? customClass.tag : 'span';\n newTag = '<' + tagName + ' class=\"' + customClass.class + '\">' + this.selectedText + '';\n }\n this.insertHtml(newTag);\n }\n insertVideo(videoUrl) {\n if (videoUrl.match('www.youtube.com')) {\n this.insertYouTubeVideoTag(videoUrl);\n }\n if (videoUrl.match('vimeo.com')) {\n this.insertVimeoVideoTag(videoUrl);\n }\n }\n insertYouTubeVideoTag(videoUrl) {\n const id = videoUrl.split('v=')[1];\n const imageUrl = `https://img.youtube.com/vi/${id}/0.jpg`;\n const thumbnail = `\n `;\n this.insertHtml(thumbnail);\n }\n insertVimeoVideoTag(videoUrl) {\n const sub = this.http.get(`https://vimeo.com/api/oembed.json?url=${videoUrl}`).subscribe(data => {\n const imageUrl = data.thumbnail_url_with_play_button;\n const thumbnail = ``;\n this.insertHtml(thumbnail);\n sub.unsubscribe();\n });\n }\n nextNode(node) {\n if (node.hasChildNodes()) {\n return node.firstChild;\n }\n else {\n while (node && !node.nextSibling) {\n node = node.parentNode;\n }\n if (!node) {\n return null;\n }\n return node.nextSibling;\n }\n }\n getRangeSelectedNodes(range, includePartiallySelectedContainers) {\n let node = range.startContainer;\n const endNode = range.endContainer;\n let rangeNodes = [];\n // Special case for a range that is contained within a single node\n if (node === endNode) {\n rangeNodes = [node];\n }\n else {\n // Iterate nodes until we hit the end container\n while (node && node !== endNode) {\n rangeNodes.push(node = this.nextNode(node));\n }\n // Add partially selected nodes at the start of the range\n node = range.startContainer;\n while (node && node !== range.commonAncestorContainer) {\n rangeNodes.unshift(node);\n node = node.parentNode;\n }\n }\n // Add ancestors of the range container, if required\n if (includePartiallySelectedContainers) {\n node = range.commonAncestorContainer;\n while (node) {\n rangeNodes.push(node);\n node = node.parentNode;\n }\n }\n return rangeNodes;\n }\n getSelectedNodes() {\n const nodes = [];\n if (this.doc.getSelection) {\n const sel = this.doc.getSelection();\n for (let i = 0, len = sel.rangeCount; i < len; ++i) {\n nodes.push.apply(nodes, this.getRangeSelectedNodes(sel.getRangeAt(i), true));\n }\n }\n return nodes;\n }\n replaceWithOwnChildren(el) {\n const parent = el.parentNode;\n while (el.hasChildNodes()) {\n parent.insertBefore(el.firstChild, el);\n }\n parent.removeChild(el);\n }\n removeSelectedElements(tagNames) {\n const tagNamesArray = tagNames.toLowerCase().split(',');\n this.getSelectedNodes().forEach((node) => {\n if (node.nodeType === 1 &&\n tagNamesArray.indexOf(node.tagName.toLowerCase()) > -1) {\n // Remove the node and replace it with its children\n this.replaceWithOwnChildren(node);\n }\n });\n }\n}\nAngularEditorService.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService, deps: [{ token: i1.HttpClient }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nAngularEditorService.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorService, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i1.HttpClient }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\nconst angularEditorConfig = {\n editable: true,\n spellcheck: true,\n height: 'auto',\n minHeight: '0',\n maxHeight: 'auto',\n width: 'auto',\n minWidth: '0',\n translate: 'yes',\n enableToolbar: true,\n showToolbar: true,\n placeholder: 'Enter text here...',\n defaultParagraphSeparator: '',\n defaultFontName: '',\n defaultFontSize: '',\n fonts: [\n { class: 'arial', name: 'Arial' },\n { class: 'times-new-roman', name: 'Times New Roman' },\n { class: 'calibri', name: 'Calibri' },\n { class: 'comic-sans-ms', name: 'Comic Sans MS' }\n ],\n uploadUrl: 'v1/image',\n uploadWithCredentials: false,\n sanitize: true,\n toolbarPosition: 'top',\n outline: true,\n /*toolbarHiddenButtons: [\n ['bold', 'italic', 'underline', 'strikeThrough', 'superscript', 'subscript'],\n ['heading', 'fontName', 'fontSize', 'color'],\n ['justifyLeft', 'justifyCenter', 'justifyRight', 'justifyFull', 'indent', 'outdent'],\n ['cut', 'copy', 'delete', 'removeFormat', 'undo', 'redo'],\n ['paragraph', 'blockquote', 'removeBlockquote', 'horizontalLine', 'orderedList', 'unorderedList'],\n ['link', 'unlink', 'image', 'video']\n ]*/\n};\n\nfunction isDefined(value) {\n return value !== undefined && value !== null;\n}\n\nclass AeSelectComponent {\n constructor(elRef, r) {\n this.elRef = elRef;\n this.r = r;\n this.options = [];\n this.disabled = false;\n this.optionId = 0;\n this.opened = false;\n this.hidden = 'inline-block';\n // eslint-disable-next-line @angular-eslint/no-output-native, @angular-eslint/no-output-rename\n this.changeEvent = new EventEmitter();\n this.onChange = () => {\n };\n this.onTouched = () => {\n };\n }\n get label() {\n return this.selectedOption && this.selectedOption.hasOwnProperty('label') ? this.selectedOption.label : 'Select';\n }\n get value() {\n return this.selectedOption.value;\n }\n ngOnInit() {\n this.selectedOption = this.options[0];\n if (isDefined(this.isHidden) && this.isHidden) {\n this.hide();\n }\n }\n hide() {\n this.hidden = 'none';\n }\n optionSelect(option, event) {\n event.stopPropagation();\n this.setValue(option.value);\n this.onChange(this.selectedOption.value);\n this.changeEvent.emit(this.selectedOption.value);\n this.onTouched();\n this.opened = false;\n }\n toggleOpen(event) {\n // event.stopPropagation();\n if (this.disabled) {\n return;\n }\n this.opened = !this.opened;\n }\n onClick($event) {\n if (!this.elRef.nativeElement.contains($event.target)) {\n this.close();\n }\n }\n close() {\n this.opened = false;\n }\n get isOpen() {\n return this.opened;\n }\n writeValue(value) {\n if (!value || typeof value !== 'string') {\n return;\n }\n this.setValue(value);\n }\n setValue(value) {\n let index = 0;\n const selectedEl = this.options.find((el, i) => {\n index = i;\n return el.value === value;\n });\n if (selectedEl) {\n this.selectedOption = selectedEl;\n this.optionId = index;\n }\n }\n registerOnChange(fn) {\n this.onChange = fn;\n }\n registerOnTouched(fn) {\n this.onTouched = fn;\n }\n setDisabledState(isDisabled) {\n this.labelButton.nativeElement.disabled = isDisabled;\n const div = this.labelButton.nativeElement;\n const action = isDisabled ? 'addClass' : 'removeClass';\n this.r[action](div, 'disabled');\n this.disabled = isDisabled;\n }\n handleKeyDown($event) {\n if (!this.opened) {\n return;\n }\n // console.log($event.key);\n // if (KeyCode[$event.key]) {\n switch ($event.key) {\n case 'ArrowDown':\n this._handleArrowDown($event);\n break;\n case 'ArrowUp':\n this._handleArrowUp($event);\n break;\n case 'Space':\n this._handleSpace($event);\n break;\n case 'Enter':\n this._handleEnter($event);\n break;\n case 'Tab':\n this._handleTab($event);\n break;\n case 'Escape':\n this.close();\n $event.preventDefault();\n break;\n case 'Backspace':\n this._handleBackspace();\n break;\n }\n // } else if ($event.key && $event.key.length === 1) {\n // this._keyPress$.next($event.key.toLocaleLowerCase());\n // }\n }\n _handleArrowDown($event) {\n if (this.optionId < this.options.length - 1) {\n this.optionId++;\n }\n }\n _handleArrowUp($event) {\n if (this.optionId >= 1) {\n this.optionId--;\n }\n }\n _handleSpace($event) {\n }\n _handleEnter($event) {\n this.optionSelect(this.options[this.optionId], $event);\n }\n _handleTab($event) {\n }\n _handleBackspace() {\n }\n}\nAeSelectComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeSelectComponent, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Component });\nAeSelectComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AeSelectComponent, selector: \"ae-select\", inputs: { options: \"options\", isHidden: [\"hidden\", \"isHidden\"] }, outputs: { changeEvent: \"change\" }, host: { listeners: { \"document:click\": \"onClick($event)\", \"keydown\": \"handleKeyDown($event)\" }, properties: { \"style.display\": \"this.hidden\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AeSelectComponent),\n multi: true,\n }\n ], viewQueries: [{ propertyName: \"labelButton\", first: true, predicate: [\"labelButton\"], descendants: true, static: true }], ngImport: i0, template: \"\\n {{label}}\\n \\n \\n \\n \\n \\n \\n {{item.label}}\\n \\n No items for select \\n \\n \\n\", styles: [\".ae-font.ae-picker{color:#444;display:inline-block;float:left;width:100%;position:relative;vertical-align:middle}.ae-font .ae-picker-label{cursor:pointer;display:inline-block;height:100%;padding-left:8px;padding-right:10px;position:relative;width:100%;line-height:26px;vertical-align:middle;font-size:85%;text-align:left;background-color:#fff;min-width:2rem;float:left;border:1px solid #ddd;text-overflow:clip;overflow:hidden;white-space:nowrap}.ae-font .ae-picker-label:before{content:\\\"\\\";position:absolute;right:0;top:0;width:20px;height:100%;background:linear-gradient(to right,rgb(255,255,255),#ffffff 100%)}.ae-font .ae-picker-label:focus{outline:none}.ae-font .ae-picker-label:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.ae-font .ae-picker-label:hover:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.ae-font .ae-picker-label:disabled:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label svg{position:absolute;margin-top:-9px;right:0;top:50%;width:18px}.ae-font .ae-picker-label svg:not(:root){overflow:hidden}.ae-font .ae-picker-label svg .ae-stroke{fill:none;stroke:#444;stroke-linecap:round;stroke-linejoin:round;stroke-width:2}.ae-font .ae-picker-options{background-color:#fff;display:none;min-width:100%;position:absolute;white-space:nowrap;z-index:3;border:1px solid transparent;box-shadow:#0003 0 2px 8px}.ae-font .ae-picker-options .ae-picker-item{cursor:pointer;display:block;padding-bottom:5px;padding-top:5px;padding-left:5px;z-index:3;text-align:left;background-color:transparent;min-width:2rem;width:100%;border:0 solid #ddd}.ae-font .ae-picker-options .ae-picker-item.selected{color:#06c;background-color:#fff4c2}.ae-font .ae-picker-options .ae-picker-item.focused,.ae-font .ae-picker-options .ae-picker-item:hover{background-color:#fffa98}.ae-font.ae-expanded{display:block;margin-top:-1px;z-index:1}.ae-font.ae-expanded .ae-picker-label{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg .ae-stroke{stroke:#ccc}.ae-font.ae-expanded .ae-picker-options{display:block;margin-top:-1px;top:100%;z-index:3;border-color:#ccc}\\n\"], dependencies: [{ kind: \"directive\", type: i1$1.NgClass, selector: \"[ngClass]\", inputs: [\"class\", \"ngClass\"] }, { kind: \"directive\", type: i1$1.NgForOf, selector: \"[ngFor][ngForOf]\", inputs: [\"ngForOf\", \"ngForTrackBy\", \"ngForTemplate\"] }, { kind: \"directive\", type: i1$1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }], encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AeSelectComponent, decorators: [{\n type: Component,\n args: [{ selector: 'ae-select', encapsulation: ViewEncapsulation.None, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => AeSelectComponent),\n multi: true,\n }\n ], template: \"\\n {{label}}\\n \\n \\n \\n \\n \\n \\n {{item.label}}\\n \\n No items for select \\n \\n \\n\", styles: [\".ae-font.ae-picker{color:#444;display:inline-block;float:left;width:100%;position:relative;vertical-align:middle}.ae-font .ae-picker-label{cursor:pointer;display:inline-block;height:100%;padding-left:8px;padding-right:10px;position:relative;width:100%;line-height:26px;vertical-align:middle;font-size:85%;text-align:left;background-color:#fff;min-width:2rem;float:left;border:1px solid #ddd;text-overflow:clip;overflow:hidden;white-space:nowrap}.ae-font .ae-picker-label:before{content:\\\"\\\";position:absolute;right:0;top:0;width:20px;height:100%;background:linear-gradient(to right,rgb(255,255,255),#ffffff 100%)}.ae-font .ae-picker-label:focus{outline:none}.ae-font .ae-picker-label:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.ae-font .ae-picker-label:hover:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.ae-font .ae-picker-label:disabled:before{background:linear-gradient(to right,#f5f5f5 100%,#ffffff 100%)}.ae-font .ae-picker-label svg{position:absolute;margin-top:-9px;right:0;top:50%;width:18px}.ae-font .ae-picker-label svg:not(:root){overflow:hidden}.ae-font .ae-picker-label svg .ae-stroke{fill:none;stroke:#444;stroke-linecap:round;stroke-linejoin:round;stroke-width:2}.ae-font .ae-picker-options{background-color:#fff;display:none;min-width:100%;position:absolute;white-space:nowrap;z-index:3;border:1px solid transparent;box-shadow:#0003 0 2px 8px}.ae-font .ae-picker-options .ae-picker-item{cursor:pointer;display:block;padding-bottom:5px;padding-top:5px;padding-left:5px;z-index:3;text-align:left;background-color:transparent;min-width:2rem;width:100%;border:0 solid #ddd}.ae-font .ae-picker-options .ae-picker-item.selected{color:#06c;background-color:#fff4c2}.ae-font .ae-picker-options .ae-picker-item.focused,.ae-font .ae-picker-options .ae-picker-item:hover{background-color:#fffa98}.ae-font.ae-expanded{display:block;margin-top:-1px;z-index:1}.ae-font.ae-expanded .ae-picker-label{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg{color:#ccc;z-index:2}.ae-font.ae-expanded .ae-picker-label svg .ae-stroke{stroke:#ccc}.ae-font.ae-expanded .ae-picker-options{display:block;margin-top:-1px;top:100%;z-index:3;border-color:#ccc}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { options: [{\n type: Input\n }], isHidden: [{\n type: Input,\n args: ['hidden']\n }], hidden: [{\n type: HostBinding,\n args: ['style.display']\n }], changeEvent: [{\n type: Output,\n args: ['change']\n }], labelButton: [{\n type: ViewChild,\n args: ['labelButton', { static: true }]\n }], onClick: [{\n type: HostListener,\n args: ['document:click', ['$event']]\n }], handleKeyDown: [{\n type: HostListener,\n args: ['keydown', ['$event']]\n }] } });\n\nclass AngularEditorToolbarComponent {\n constructor(r, editorService, er, doc) {\n this.r = r;\n this.editorService = editorService;\n this.er = er;\n this.doc = doc;\n this.htmlMode = false;\n this.linkSelected = false;\n this.block = 'default';\n this.fontName = 'Times New Roman';\n this.fontSize = '3';\n this.headings = [\n {\n label: 'Heading 1',\n value: 'h1',\n },\n {\n label: 'Heading 2',\n value: 'h2',\n },\n {\n label: 'Heading 3',\n value: 'h3',\n },\n {\n label: 'Heading 4',\n value: 'h4',\n },\n {\n label: 'Heading 5',\n value: 'h5',\n },\n {\n label: 'Heading 6',\n value: 'h6',\n },\n {\n label: 'Heading 7',\n value: 'h7',\n },\n {\n label: 'Paragraph',\n value: 'p',\n },\n {\n label: 'Predefined',\n value: 'pre'\n },\n {\n label: 'Standard',\n value: 'div'\n },\n {\n label: 'default',\n value: 'default'\n }\n ];\n this.fontSizes = [\n {\n label: '1',\n value: '1',\n },\n {\n label: '2',\n value: '2',\n },\n {\n label: '3',\n value: '3',\n },\n {\n label: '4',\n value: '4',\n },\n {\n label: '5',\n value: '5',\n },\n {\n label: '6',\n value: '6',\n },\n {\n label: '7',\n value: '7',\n }\n ];\n this.customClassId = '-1';\n this.customClassList = [{ label: '', value: '' }];\n // uploadUrl: string;\n this.tagMap = {\n BLOCKQUOTE: 'indent',\n A: 'link'\n };\n this.select = ['H1', 'H2', 'H3', 'H4', 'H5', 'H6', 'P', 'PRE', 'DIV'];\n this.buttons = ['bold', 'italic', 'underline', 'strikeThrough', 'subscript', 'superscript', 'justifyLeft', 'justifyCenter',\n 'justifyRight', 'justifyFull', 'indent', 'outdent', 'insertUnorderedList', 'insertOrderedList', 'link'];\n this.fonts = [{ label: '', value: '' }];\n this.execute = new EventEmitter();\n }\n set customClasses(classes) {\n if (classes) {\n this._customClasses = classes;\n this.customClassList = this._customClasses.map((x, i) => ({ label: x.name, value: i.toString() }));\n this.customClassList.unshift({ label: 'Clear Class', value: '-1' });\n }\n }\n set defaultFontName(value) {\n if (value) {\n this.fontName = value;\n }\n }\n set defaultFontSize(value) {\n if (value) {\n this.fontSize = value;\n }\n }\n get isLinkButtonDisabled() {\n return this.htmlMode || !Boolean(this.editorService.selectedText);\n }\n /**\n * Trigger command from editor header buttons\n * @param command string from toolbar buttons\n */\n triggerCommand(command) {\n this.execute.emit(command);\n }\n /**\n * highlight editor buttons when cursor moved or positioning\n */\n triggerButtons() {\n if (!this.showToolbar) {\n return;\n }\n this.buttons.forEach(e => {\n const result = this.doc.queryCommandState(e);\n const elementById = this.doc.getElementById(e + '-' + this.id);\n if (result) {\n this.r.addClass(elementById, 'active');\n }\n else {\n this.r.removeClass(elementById, 'active');\n }\n });\n }\n /**\n * trigger highlight editor buttons when cursor moved or positioning in block\n */\n triggerBlocks(nodes) {\n if (!this.showToolbar) {\n return;\n }\n this.linkSelected = nodes.findIndex(x => x.nodeName === 'A') > -1;\n let found = false;\n this.select.forEach(y => {\n const node = nodes.find(x => x.nodeName === y);\n if (node !== undefined && y === node.nodeName) {\n if (found === false) {\n this.block = node.nodeName.toLowerCase();\n found = true;\n }\n }\n else if (found === false) {\n this.block = 'default';\n }\n });\n found = false;\n if (this._customClasses) {\n this._customClasses.forEach((y, index) => {\n const node = nodes.find(x => {\n if (x instanceof Element) {\n return x.className === y.class;\n }\n });\n if (node !== undefined) {\n if (found === false) {\n this.customClassId = index.toString();\n found = true;\n }\n }\n else if (found === false) {\n this.customClassId = '-1';\n }\n });\n }\n Object.keys(this.tagMap).map(e => {\n const elementById = this.doc.getElementById(this.tagMap[e] + '-' + this.id);\n const node = nodes.find(x => x.nodeName === e);\n if (node !== undefined && e === node.nodeName) {\n this.r.addClass(elementById, 'active');\n }\n else {\n this.r.removeClass(elementById, 'active');\n }\n });\n this.foreColour = this.doc.queryCommandValue('ForeColor');\n this.fontSize = this.doc.queryCommandValue('FontSize');\n this.fontName = this.doc.queryCommandValue('FontName').replace(/\"/g, '');\n this.backColor = this.doc.queryCommandValue('backColor');\n }\n /**\n * insert URL link\n */\n insertUrl() {\n let url = 'https:\\/\\/';\n const selection = this.editorService.savedSelection;\n if (selection && selection.commonAncestorContainer.parentElement.nodeName === 'A') {\n const parent = selection.commonAncestorContainer.parentElement;\n if (parent.href !== '') {\n url = parent.href;\n }\n }\n url = prompt('Insert URL link', url);\n if (url && url !== '' && url !== 'https://') {\n this.editorService.createLink(url);\n }\n }\n /**\n * insert Video link\n */\n insertVideo() {\n this.execute.emit('');\n const url = prompt('Insert Video link', `https://`);\n if (url && url !== '' && url !== `https://`) {\n this.editorService.insertVideo(url);\n }\n }\n /** insert color */\n insertColor(color, where) {\n this.editorService.insertColor(color, where);\n this.execute.emit('');\n }\n /**\n * set font Name/family\n * @param foreColor string\n */\n setFontName(foreColor) {\n this.editorService.setFontName(foreColor);\n this.execute.emit('');\n }\n /**\n * set font Size\n * @param fontSize string\n */\n setFontSize(fontSize) {\n this.editorService.setFontSize(fontSize);\n this.execute.emit('');\n }\n /**\n * toggle editor mode (WYSIWYG or SOURCE)\n * @param m boolean\n */\n setEditorMode(m) {\n const toggleEditorModeButton = this.doc.getElementById('toggleEditorMode' + '-' + this.id);\n if (m) {\n this.r.addClass(toggleEditorModeButton, 'active');\n }\n else {\n this.r.removeClass(toggleEditorModeButton, 'active');\n }\n this.htmlMode = m;\n }\n /**\n * Upload image when file is selected.\n */\n onFileChanged(event) {\n const file = event.target.files[0];\n if (file.type.includes('image/')) {\n if (this.upload) {\n this.upload(file).subscribe((response) => this.watchUploadImage(response, event));\n }\n else if (this.uploadUrl) {\n this.editorService.uploadImage(file).subscribe((response) => this.watchUploadImage(response, event));\n }\n else {\n const reader = new FileReader();\n reader.onload = (e) => {\n const fr = e.currentTarget;\n this.editorService.insertImage(fr.result.toString());\n };\n reader.readAsDataURL(file);\n }\n }\n }\n watchUploadImage(response, event) {\n const { imageUrl } = response.body;\n this.editorService.insertImage(imageUrl);\n event.srcElement.value = null;\n }\n /**\n * Set custom class\n */\n setCustomClass(classId) {\n if (classId === '-1') {\n this.execute.emit('clear');\n }\n else {\n this.editorService.createCustomClass(this._customClasses[+classId]);\n }\n }\n isButtonHidden(name) {\n if (!name) {\n return false;\n }\n if (!(this.hiddenButtons instanceof Array)) {\n return false;\n }\n let result;\n for (const arr of this.hiddenButtons) {\n if (arr instanceof Array) {\n result = arr.find(item => item === name);\n }\n if (result) {\n break;\n }\n }\n return result !== undefined;\n }\n focus() {\n this.execute.emit('focus');\n console.log('focused');\n }\n}\nAngularEditorToolbarComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorToolbarComponent, deps: [{ token: i0.Renderer2 }, { token: AngularEditorService }, { token: i0.ElementRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Component });\nAngularEditorToolbarComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.0.1\", type: AngularEditorToolbarComponent, selector: \"angular-editor-toolbar\", inputs: { id: \"id\", uploadUrl: \"uploadUrl\", upload: \"upload\", showToolbar: \"showToolbar\", fonts: \"fonts\", customClasses: \"customClasses\", defaultFontName: \"defaultFontName\", defaultFontSize: \"defaultFontSize\", hiddenButtons: \"hiddenButtons\" }, outputs: { execute: \"execute\" }, viewQueries: [{ propertyName: \"myInputFile\", first: true, predicate: [\"fileInput\"], descendants: true, static: true }], ngImport: i0, template: \"\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}\\n\"], dependencies: [{ kind: \"directive\", type: i1$1.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { kind: \"directive\", type: i3.NgControlStatus, selector: \"[formControlName],[ngModel],[formControl]\" }, { kind: \"directive\", type: i3.NgModel, selector: \"[ngModel]:not([formControlName]):not([formControl])\", inputs: [\"name\", \"disabled\", \"ngModel\", \"ngModelOptions\"], outputs: [\"ngModelChange\"], exportAs: [\"ngModel\"] }, { kind: \"component\", type: AeSelectComponent, selector: \"ae-select\", inputs: [\"options\", \"hidden\"], outputs: [\"change\"] }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.0.1\", ngImport: i0, type: AngularEditorToolbarComponent, decorators: [{\n type: Component,\n args: [{ selector: 'angular-editor-toolbar', template: \"\\n\", styles: [\"/*!\\n * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome\\n * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)\\n */@font-face{font-family:FontAwesome;src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?v=4.7.0);src:url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format(\\\"embedded-opentype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff2?v=4.7.0) format(\\\"woff2\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.woff?v=4.7.0) format(\\\"woff\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.ttf?v=4.7.0) format(\\\"truetype\\\"),url(https://netdna.bootstrapcdn.com/font-awesome/4.7.0/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular) format(\\\"svg\\\");font-weight:400;font-style:normal}.fa{display:inline-block;font: 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857em;text-align:center}.fa-ul{padding-left:0;margin-left:2.1428571429em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.1428571429em;width:2.1428571429em;top:.1428571429em;text-align:center}.fa-li.fa-lg{left:-1.8571428571em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0)}to{transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";transform:scaleX(-1)}.fa-flip-vertical{-ms-filter:\\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";transform:scaleY(-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:\\\"\\\\f000\\\"}.fa-music:before{content:\\\"\\\\f001\\\"}.fa-search:before{content:\\\"\\\\f002\\\"}.fa-envelope-o:before{content:\\\"\\\\f003\\\"}.fa-heart:before{content:\\\"\\\\f004\\\"}.fa-star:before{content:\\\"\\\\f005\\\"}.fa-star-o:before{content:\\\"\\\\f006\\\"}.fa-user:before{content:\\\"\\\\f007\\\"}.fa-film:before{content:\\\"\\\\f008\\\"}.fa-th-large:before{content:\\\"\\\\f009\\\"}.fa-th:before{content:\\\"\\\\f00a\\\"}.fa-th-list:before{content:\\\"\\\\f00b\\\"}.fa-check:before{content:\\\"\\\\f00c\\\"}.fa-remove:before,.fa-close:before,.fa-times:before{content:\\\"\\\\f00d\\\"}.fa-search-plus:before{content:\\\"\\\\f00e\\\"}.fa-search-minus:before{content:\\\"\\\\f010\\\"}.fa-power-off:before{content:\\\"\\\\f011\\\"}.fa-signal:before{content:\\\"\\\\f012\\\"}.fa-gear:before,.fa-cog:before{content:\\\"\\\\f013\\\"}.fa-trash-o:before{content:\\\"\\\\f014\\\"}.fa-home:before{content:\\\"\\\\f015\\\"}.fa-file-o:before{content:\\\"\\\\f016\\\"}.fa-clock-o:before{content:\\\"\\\\f017\\\"}.fa-road:before{content:\\\"\\\\f018\\\"}.fa-download:before{content:\\\"\\\\f019\\\"}.fa-arrow-circle-o-down:before{content:\\\"\\\\f01a\\\"}.fa-arrow-circle-o-up:before{content:\\\"\\\\f01b\\\"}.fa-inbox:before{content:\\\"\\\\f01c\\\"}.fa-play-circle-o:before{content:\\\"\\\\f01d\\\"}.fa-rotate-right:before,.fa-repeat:before{content:\\\"\\\\f01e\\\"}.fa-refresh:before{content:\\\"\\\\f021\\\"}.fa-list-alt:before{content:\\\"\\\\f022\\\"}.fa-lock:before{content:\\\"\\\\f023\\\"}.fa-flag:before{content:\\\"\\\\f024\\\"}.fa-headphones:before{content:\\\"\\\\f025\\\"}.fa-volume-off:before{content:\\\"\\\\f026\\\"}.fa-volume-down:before{content:\\\"\\\\f027\\\"}.fa-volume-up:before{content:\\\"\\\\f028\\\"}.fa-qrcode:before{content:\\\"\\\\f029\\\"}.fa-barcode:before{content:\\\"\\\\f02a\\\"}.fa-tag:before{content:\\\"\\\\f02b\\\"}.fa-tags:before{content:\\\"\\\\f02c\\\"}.fa-book:before{content:\\\"\\\\f02d\\\"}.fa-bookmark:before{content:\\\"\\\\f02e\\\"}.fa-print:before{content:\\\"\\\\f02f\\\"}.fa-camera:before{content:\\\"\\\\f030\\\"}.fa-font:before{content:\\\"\\\\f031\\\"}.fa-bold:before{content:\\\"\\\\f032\\\"}.fa-italic:before{content:\\\"\\\\f033\\\"}.fa-text-height:before{content:\\\"\\\\f034\\\"}.fa-text-width:before{content:\\\"\\\\f035\\\"}.fa-align-left:before{content:\\\"\\\\f036\\\"}.fa-align-center:before{content:\\\"\\\\f037\\\"}.fa-align-right:before{content:\\\"\\\\f038\\\"}.fa-align-justify:before{content:\\\"\\\\f039\\\"}.fa-list:before{content:\\\"\\\\f03a\\\"}.fa-dedent:before,.fa-outdent:before{content:\\\"\\\\f03b\\\"}.fa-indent:before{content:\\\"\\\\f03c\\\"}.fa-video-camera:before{content:\\\"\\\\f03d\\\"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:\\\"\\\\f03e\\\"}.fa-pencil:before{content:\\\"\\\\f040\\\"}.fa-map-marker:before{content:\\\"\\\\f041\\\"}.fa-adjust:before{content:\\\"\\\\f042\\\"}.fa-tint:before{content:\\\"\\\\f043\\\"}.fa-edit:before,.fa-pencil-square-o:before{content:\\\"\\\\f044\\\"}.fa-share-square-o:before{content:\\\"\\\\f045\\\"}.fa-check-square-o:before{content:\\\"\\\\f046\\\"}.fa-arrows:before{content:\\\"\\\\f047\\\"}.fa-step-backward:before{content:\\\"\\\\f048\\\"}.fa-fast-backward:before{content:\\\"\\\\f049\\\"}.fa-backward:before{content:\\\"\\\\f04a\\\"}.fa-play:before{content:\\\"\\\\f04b\\\"}.fa-pause:before{content:\\\"\\\\f04c\\\"}.fa-stop:before{content:\\\"\\\\f04d\\\"}.fa-forward:before{content:\\\"\\\\f04e\\\"}.fa-fast-forward:before{content:\\\"\\\\f050\\\"}.fa-step-forward:before{content:\\\"\\\\f051\\\"}.fa-eject:before{content:\\\"\\\\f052\\\"}.fa-chevron-left:before{content:\\\"\\\\f053\\\"}.fa-chevron-right:before{content:\\\"\\\\f054\\\"}.fa-plus-circle:before{content:\\\"\\\\f055\\\"}.fa-minus-circle:before{content:\\\"\\\\f056\\\"}.fa-times-circle:before{content:\\\"\\\\f057\\\"}.fa-check-circle:before{content:\\\"\\\\f058\\\"}.fa-question-circle:before{content:\\\"\\\\f059\\\"}.fa-info-circle:before{content:\\\"\\\\f05a\\\"}.fa-crosshairs:before{content:\\\"\\\\f05b\\\"}.fa-times-circle-o:before{content:\\\"\\\\f05c\\\"}.fa-check-circle-o:before{content:\\\"\\\\f05d\\\"}.fa-ban:before{content:\\\"\\\\f05e\\\"}.fa-arrow-left:before{content:\\\"\\\\f060\\\"}.fa-arrow-right:before{content:\\\"\\\\f061\\\"}.fa-arrow-up:before{content:\\\"\\\\f062\\\"}.fa-arrow-down:before{content:\\\"\\\\f063\\\"}.fa-mail-forward:before,.fa-share:before{content:\\\"\\\\f064\\\"}.fa-expand:before{content:\\\"\\\\f065\\\"}.fa-compress:before{content:\\\"\\\\f066\\\"}.fa-plus:before{content:\\\"\\\\f067\\\"}.fa-minus:before{content:\\\"\\\\f068\\\"}.fa-asterisk:before{content:\\\"\\\\f069\\\"}.fa-exclamation-circle:before{content:\\\"\\\\f06a\\\"}.fa-gift:before{content:\\\"\\\\f06b\\\"}.fa-leaf:before{content:\\\"\\\\f06c\\\"}.fa-fire:before{content:\\\"\\\\f06d\\\"}.fa-eye:before{content:\\\"\\\\f06e\\\"}.fa-eye-slash:before{content:\\\"\\\\f070\\\"}.fa-warning:before,.fa-exclamation-triangle:before{content:\\\"\\\\f071\\\"}.fa-plane:before{content:\\\"\\\\f072\\\"}.fa-calendar:before{content:\\\"\\\\f073\\\"}.fa-random:before{content:\\\"\\\\f074\\\"}.fa-comment:before{content:\\\"\\\\f075\\\"}.fa-magnet:before{content:\\\"\\\\f076\\\"}.fa-chevron-up:before{content:\\\"\\\\f077\\\"}.fa-chevron-down:before{content:\\\"\\\\f078\\\"}.fa-retweet:before{content:\\\"\\\\f079\\\"}.fa-shopping-cart:before{content:\\\"\\\\f07a\\\"}.fa-folder:before{content:\\\"\\\\f07b\\\"}.fa-folder-open:before{content:\\\"\\\\f07c\\\"}.fa-arrows-v:before{content:\\\"\\\\f07d\\\"}.fa-arrows-h:before{content:\\\"\\\\f07e\\\"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:\\\"\\\\f080\\\"}.fa-twitter-square:before{content:\\\"\\\\f081\\\"}.fa-facebook-square:before{content:\\\"\\\\f082\\\"}.fa-camera-retro:before{content:\\\"\\\\f083\\\"}.fa-key:before{content:\\\"\\\\f084\\\"}.fa-gears:before,.fa-cogs:before{content:\\\"\\\\f085\\\"}.fa-comments:before{content:\\\"\\\\f086\\\"}.fa-thumbs-o-up:before{content:\\\"\\\\f087\\\"}.fa-thumbs-o-down:before{content:\\\"\\\\f088\\\"}.fa-star-half:before{content:\\\"\\\\f089\\\"}.fa-heart-o:before{content:\\\"\\\\f08a\\\"}.fa-sign-out:before{content:\\\"\\\\f08b\\\"}.fa-linkedin-square:before{content:\\\"\\\\f08c\\\"}.fa-thumb-tack:before{content:\\\"\\\\f08d\\\"}.fa-external-link:before{content:\\\"\\\\f08e\\\"}.fa-sign-in:before{content:\\\"\\\\f090\\\"}.fa-trophy:before{content:\\\"\\\\f091\\\"}.fa-github-square:before{content:\\\"\\\\f092\\\"}.fa-upload:before{content:\\\"\\\\f093\\\"}.fa-lemon-o:before{content:\\\"\\\\f094\\\"}.fa-phone:before{content:\\\"\\\\f095\\\"}.fa-square-o:before{content:\\\"\\\\f096\\\"}.fa-bookmark-o:before{content:\\\"\\\\f097\\\"}.fa-phone-square:before{content:\\\"\\\\f098\\\"}.fa-twitter:before{content:\\\"\\\\f099\\\"}.fa-facebook-f:before,.fa-facebook:before{content:\\\"\\\\f09a\\\"}.fa-github:before{content:\\\"\\\\f09b\\\"}.fa-unlock:before{content:\\\"\\\\f09c\\\"}.fa-credit-card:before{content:\\\"\\\\f09d\\\"}.fa-feed:before,.fa-rss:before{content:\\\"\\\\f09e\\\"}.fa-hdd-o:before{content:\\\"\\\\f0a0\\\"}.fa-bullhorn:before{content:\\\"\\\\f0a1\\\"}.fa-bell:before{content:\\\"\\\\f0f3\\\"}.fa-certificate:before{content:\\\"\\\\f0a3\\\"}.fa-hand-o-right:before{content:\\\"\\\\f0a4\\\"}.fa-hand-o-left:before{content:\\\"\\\\f0a5\\\"}.fa-hand-o-up:before{content:\\\"\\\\f0a6\\\"}.fa-hand-o-down:before{content:\\\"\\\\f0a7\\\"}.fa-arrow-circle-left:before{content:\\\"\\\\f0a8\\\"}.fa-arrow-circle-right:before{content:\\\"\\\\f0a9\\\"}.fa-arrow-circle-up:before{content:\\\"\\\\f0aa\\\"}.fa-arrow-circle-down:before{content:\\\"\\\\f0ab\\\"}.fa-globe:before{content:\\\"\\\\f0ac\\\"}.fa-wrench:before{content:\\\"\\\\f0ad\\\"}.fa-tasks:before{content:\\\"\\\\f0ae\\\"}.fa-filter:before{content:\\\"\\\\f0b0\\\"}.fa-briefcase:before{content:\\\"\\\\f0b1\\\"}.fa-arrows-alt:before{content:\\\"\\\\f0b2\\\"}.fa-group:before,.fa-users:before{content:\\\"\\\\f0c0\\\"}.fa-chain:before,.fa-link:before{content:\\\"\\\\f0c1\\\"}.fa-cloud:before{content:\\\"\\\\f0c2\\\"}.fa-flask:before{content:\\\"\\\\f0c3\\\"}.fa-cut:before,.fa-scissors:before{content:\\\"\\\\f0c4\\\"}.fa-copy:before,.fa-files-o:before{content:\\\"\\\\f0c5\\\"}.fa-paperclip:before{content:\\\"\\\\f0c6\\\"}.fa-save:before,.fa-floppy-o:before{content:\\\"\\\\f0c7\\\"}.fa-square:before{content:\\\"\\\\f0c8\\\"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:\\\"\\\\f0c9\\\"}.fa-list-ul:before{content:\\\"\\\\f0ca\\\"}.fa-list-ol:before{content:\\\"\\\\f0cb\\\"}.fa-strikethrough:before{content:\\\"\\\\f0cc\\\"}.fa-underline:before{content:\\\"\\\\f0cd\\\"}.fa-table:before{content:\\\"\\\\f0ce\\\"}.fa-magic:before{content:\\\"\\\\f0d0\\\"}.fa-truck:before{content:\\\"\\\\f0d1\\\"}.fa-pinterest:before{content:\\\"\\\\f0d2\\\"}.fa-pinterest-square:before{content:\\\"\\\\f0d3\\\"}.fa-google-plus-square:before{content:\\\"\\\\f0d4\\\"}.fa-google-plus:before{content:\\\"\\\\f0d5\\\"}.fa-money:before{content:\\\"\\\\f0d6\\\"}.fa-caret-down:before{content:\\\"\\\\f0d7\\\"}.fa-caret-up:before{content:\\\"\\\\f0d8\\\"}.fa-caret-left:before{content:\\\"\\\\f0d9\\\"}.fa-caret-right:before{content:\\\"\\\\f0da\\\"}.fa-columns:before{content:\\\"\\\\f0db\\\"}.fa-unsorted:before,.fa-sort:before{content:\\\"\\\\f0dc\\\"}.fa-sort-down:before,.fa-sort-desc:before{content:\\\"\\\\f0dd\\\"}.fa-sort-up:before,.fa-sort-asc:before{content:\\\"\\\\f0de\\\"}.fa-envelope:before{content:\\\"\\\\f0e0\\\"}.fa-linkedin:before{content:\\\"\\\\f0e1\\\"}.fa-rotate-left:before,.fa-undo:before{content:\\\"\\\\f0e2\\\"}.fa-legal:before,.fa-gavel:before{content:\\\"\\\\f0e3\\\"}.fa-dashboard:before,.fa-tachometer:before{content:\\\"\\\\f0e4\\\"}.fa-comment-o:before{content:\\\"\\\\f0e5\\\"}.fa-comments-o:before{content:\\\"\\\\f0e6\\\"}.fa-flash:before,.fa-bolt:before{content:\\\"\\\\f0e7\\\"}.fa-sitemap:before{content:\\\"\\\\f0e8\\\"}.fa-umbrella:before{content:\\\"\\\\f0e9\\\"}.fa-paste:before,.fa-clipboard:before{content:\\\"\\\\f0ea\\\"}.fa-lightbulb-o:before{content:\\\"\\\\f0eb\\\"}.fa-exchange:before{content:\\\"\\\\f0ec\\\"}.fa-cloud-download:before{content:\\\"\\\\f0ed\\\"}.fa-cloud-upload:before{content:\\\"\\\\f0ee\\\"}.fa-user-md:before{content:\\\"\\\\f0f0\\\"}.fa-stethoscope:before{content:\\\"\\\\f0f1\\\"}.fa-suitcase:before{content:\\\"\\\\f0f2\\\"}.fa-bell-o:before{content:\\\"\\\\f0a2\\\"}.fa-coffee:before{content:\\\"\\\\f0f4\\\"}.fa-cutlery:before{content:\\\"\\\\f0f5\\\"}.fa-file-text-o:before{content:\\\"\\\\f0f6\\\"}.fa-building-o:before{content:\\\"\\\\f0f7\\\"}.fa-hospital-o:before{content:\\\"\\\\f0f8\\\"}.fa-ambulance:before{content:\\\"\\\\f0f9\\\"}.fa-medkit:before{content:\\\"\\\\f0fa\\\"}.fa-fighter-jet:before{content:\\\"\\\\f0fb\\\"}.fa-beer:before{content:\\\"\\\\f0fc\\\"}.fa-h-square:before{content:\\\"\\\\f0fd\\\"}.fa-plus-square:before{content:\\\"\\\\f0fe\\\"}.fa-angle-double-left:before{content:\\\"\\\\f100\\\"}.fa-angle-double-right:before{content:\\\"\\\\f101\\\"}.fa-angle-double-up:before{content:\\\"\\\\f102\\\"}.fa-angle-double-down:before{content:\\\"\\\\f103\\\"}.fa-angle-left:before{content:\\\"\\\\f104\\\"}.fa-angle-right:before{content:\\\"\\\\f105\\\"}.fa-angle-up:before{content:\\\"\\\\f106\\\"}.fa-angle-down:before{content:\\\"\\\\f107\\\"}.fa-desktop:before{content:\\\"\\\\f108\\\"}.fa-laptop:before{content:\\\"\\\\f109\\\"}.fa-tablet:before{content:\\\"\\\\f10a\\\"}.fa-mobile-phone:before,.fa-mobile:before{content:\\\"\\\\f10b\\\"}.fa-circle-o:before{content:\\\"\\\\f10c\\\"}.fa-quote-left:before{content:\\\"\\\\f10d\\\"}.fa-quote-right:before{content:\\\"\\\\f10e\\\"}.fa-spinner:before{content:\\\"\\\\f110\\\"}.fa-circle:before{content:\\\"\\\\f111\\\"}.fa-mail-reply:before,.fa-reply:before{content:\\\"\\\\f112\\\"}.fa-github-alt:before{content:\\\"\\\\f113\\\"}.fa-folder-o:before{content:\\\"\\\\f114\\\"}.fa-folder-open-o:before{content:\\\"\\\\f115\\\"}.fa-smile-o:before{content:\\\"\\\\f118\\\"}.fa-frown-o:before{content:\\\"\\\\f119\\\"}.fa-meh-o:before{content:\\\"\\\\f11a\\\"}.fa-gamepad:before{content:\\\"\\\\f11b\\\"}.fa-keyboard-o:before{content:\\\"\\\\f11c\\\"}.fa-flag-o:before{content:\\\"\\\\f11d\\\"}.fa-flag-checkered:before{content:\\\"\\\\f11e\\\"}.fa-terminal:before{content:\\\"\\\\f120\\\"}.fa-code:before{content:\\\"\\\\f121\\\"}.fa-mail-reply-all:before,.fa-reply-all:before{content:\\\"\\\\f122\\\"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:\\\"\\\\f123\\\"}.fa-location-arrow:before{content:\\\"\\\\f124\\\"}.fa-crop:before{content:\\\"\\\\f125\\\"}.fa-code-fork:before{content:\\\"\\\\f126\\\"}.fa-unlink:before,.fa-chain-broken:before{content:\\\"\\\\f127\\\"}.fa-question:before{content:\\\"\\\\f128\\\"}.fa-info:before{content:\\\"\\\\f129\\\"}.fa-exclamation:before{content:\\\"\\\\f12a\\\"}.fa-superscript:before{content:\\\"\\\\f12b\\\"}.fa-subscript:before{content:\\\"\\\\f12c\\\"}.fa-eraser:before{content:\\\"\\\\f12d\\\"}.fa-puzzle-piece:before{content:\\\"\\\\f12e\\\"}.fa-microphone:before{content:\\\"\\\\f130\\\"}.fa-microphone-slash:before{content:\\\"\\\\f131\\\"}.fa-shield:before{content:\\\"\\\\f132\\\"}.fa-calendar-o:before{content:\\\"\\\\f133\\\"}.fa-fire-extinguisher:before{content:\\\"\\\\f134\\\"}.fa-rocket:before{content:\\\"\\\\f135\\\"}.fa-maxcdn:before{content:\\\"\\\\f136\\\"}.fa-chevron-circle-left:before{content:\\\"\\\\f137\\\"}.fa-chevron-circle-right:before{content:\\\"\\\\f138\\\"}.fa-chevron-circle-up:before{content:\\\"\\\\f139\\\"}.fa-chevron-circle-down:before{content:\\\"\\\\f13a\\\"}.fa-html5:before{content:\\\"\\\\f13b\\\"}.fa-css3:before{content:\\\"\\\\f13c\\\"}.fa-anchor:before{content:\\\"\\\\f13d\\\"}.fa-unlock-alt:before{content:\\\"\\\\f13e\\\"}.fa-bullseye:before{content:\\\"\\\\f140\\\"}.fa-ellipsis-h:before{content:\\\"\\\\f141\\\"}.fa-ellipsis-v:before{content:\\\"\\\\f142\\\"}.fa-rss-square:before{content:\\\"\\\\f143\\\"}.fa-play-circle:before{content:\\\"\\\\f144\\\"}.fa-ticket:before{content:\\\"\\\\f145\\\"}.fa-minus-square:before{content:\\\"\\\\f146\\\"}.fa-minus-square-o:before{content:\\\"\\\\f147\\\"}.fa-level-up:before{content:\\\"\\\\f148\\\"}.fa-level-down:before{content:\\\"\\\\f149\\\"}.fa-check-square:before{content:\\\"\\\\f14a\\\"}.fa-pencil-square:before{content:\\\"\\\\f14b\\\"}.fa-external-link-square:before{content:\\\"\\\\f14c\\\"}.fa-share-square:before{content:\\\"\\\\f14d\\\"}.fa-compass:before{content:\\\"\\\\f14e\\\"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:\\\"\\\\f150\\\"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:\\\"\\\\f151\\\"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:\\\"\\\\f152\\\"}.fa-euro:before,.fa-eur:before{content:\\\"\\\\f153\\\"}.fa-gbp:before{content:\\\"\\\\f154\\\"}.fa-dollar:before,.fa-usd:before{content:\\\"\\\\f155\\\"}.fa-rupee:before,.fa-inr:before{content:\\\"\\\\f156\\\"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:\\\"\\\\f157\\\"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:\\\"\\\\f158\\\"}.fa-won:before,.fa-krw:before{content:\\\"\\\\f159\\\"}.fa-bitcoin:before,.fa-btc:before{content:\\\"\\\\f15a\\\"}.fa-file:before{content:\\\"\\\\f15b\\\"}.fa-file-text:before{content:\\\"\\\\f15c\\\"}.fa-sort-alpha-asc:before{content:\\\"\\\\f15d\\\"}.fa-sort-alpha-desc:before{content:\\\"\\\\f15e\\\"}.fa-sort-amount-asc:before{content:\\\"\\\\f160\\\"}.fa-sort-amount-desc:before{content:\\\"\\\\f161\\\"}.fa-sort-numeric-asc:before{content:\\\"\\\\f162\\\"}.fa-sort-numeric-desc:before{content:\\\"\\\\f163\\\"}.fa-thumbs-up:before{content:\\\"\\\\f164\\\"}.fa-thumbs-down:before{content:\\\"\\\\f165\\\"}.fa-youtube-square:before{content:\\\"\\\\f166\\\"}.fa-youtube:before{content:\\\"\\\\f167\\\"}.fa-xing:before{content:\\\"\\\\f168\\\"}.fa-xing-square:before{content:\\\"\\\\f169\\\"}.fa-youtube-play:before{content:\\\"\\\\f16a\\\"}.fa-dropbox:before{content:\\\"\\\\f16b\\\"}.fa-stack-overflow:before{content:\\\"\\\\f16c\\\"}.fa-instagram:before{content:\\\"\\\\f16d\\\"}.fa-flickr:before{content:\\\"\\\\f16e\\\"}.fa-adn:before{content:\\\"\\\\f170\\\"}.fa-bitbucket:before{content:\\\"\\\\f171\\\"}.fa-bitbucket-square:before{content:\\\"\\\\f172\\\"}.fa-tumblr:before{content:\\\"\\\\f173\\\"}.fa-tumblr-square:before{content:\\\"\\\\f174\\\"}.fa-long-arrow-down:before{content:\\\"\\\\f175\\\"}.fa-long-arrow-up:before{content:\\\"\\\\f176\\\"}.fa-long-arrow-left:before{content:\\\"\\\\f177\\\"}.fa-long-arrow-right:before{content:\\\"\\\\f178\\\"}.fa-apple:before{content:\\\"\\\\f179\\\"}.fa-windows:before{content:\\\"\\\\f17a\\\"}.fa-android:before{content:\\\"\\\\f17b\\\"}.fa-linux:before{content:\\\"\\\\f17c\\\"}.fa-dribbble:before{content:\\\"\\\\f17d\\\"}.fa-skype:before{content:\\\"\\\\f17e\\\"}.fa-foursquare:before{content:\\\"\\\\f180\\\"}.fa-trello:before{content:\\\"\\\\f181\\\"}.fa-female:before{content:\\\"\\\\f182\\\"}.fa-male:before{content:\\\"\\\\f183\\\"}.fa-gittip:before,.fa-gratipay:before{content:\\\"\\\\f184\\\"}.fa-sun-o:before{content:\\\"\\\\f185\\\"}.fa-moon-o:before{content:\\\"\\\\f186\\\"}.fa-archive:before{content:\\\"\\\\f187\\\"}.fa-bug:before{content:\\\"\\\\f188\\\"}.fa-vk:before{content:\\\"\\\\f189\\\"}.fa-weibo:before{content:\\\"\\\\f18a\\\"}.fa-renren:before{content:\\\"\\\\f18b\\\"}.fa-pagelines:before{content:\\\"\\\\f18c\\\"}.fa-stack-exchange:before{content:\\\"\\\\f18d\\\"}.fa-arrow-circle-o-right:before{content:\\\"\\\\f18e\\\"}.fa-arrow-circle-o-left:before{content:\\\"\\\\f190\\\"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:\\\"\\\\f191\\\"}.fa-dot-circle-o:before{content:\\\"\\\\f192\\\"}.fa-wheelchair:before{content:\\\"\\\\f193\\\"}.fa-vimeo-square:before{content:\\\"\\\\f194\\\"}.fa-turkish-lira:before,.fa-try:before{content:\\\"\\\\f195\\\"}.fa-plus-square-o:before{content:\\\"\\\\f196\\\"}.fa-space-shuttle:before{content:\\\"\\\\f197\\\"}.fa-slack:before{content:\\\"\\\\f198\\\"}.fa-envelope-square:before{content:\\\"\\\\f199\\\"}.fa-wordpress:before{content:\\\"\\\\f19a\\\"}.fa-openid:before{content:\\\"\\\\f19b\\\"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:\\\"\\\\f19c\\\"}.fa-mortar-board:before,.fa-graduation-cap:before{content:\\\"\\\\f19d\\\"}.fa-yahoo:before{content:\\\"\\\\f19e\\\"}.fa-google:before{content:\\\"\\\\f1a0\\\"}.fa-reddit:before{content:\\\"\\\\f1a1\\\"}.fa-reddit-square:before{content:\\\"\\\\f1a2\\\"}.fa-stumbleupon-circle:before{content:\\\"\\\\f1a3\\\"}.fa-stumbleupon:before{content:\\\"\\\\f1a4\\\"}.fa-delicious:before{content:\\\"\\\\f1a5\\\"}.fa-digg:before{content:\\\"\\\\f1a6\\\"}.fa-pied-piper-pp:before{content:\\\"\\\\f1a7\\\"}.fa-pied-piper-alt:before{content:\\\"\\\\f1a8\\\"}.fa-drupal:before{content:\\\"\\\\f1a9\\\"}.fa-joomla:before{content:\\\"\\\\f1aa\\\"}.fa-language:before{content:\\\"\\\\f1ab\\\"}.fa-fax:before{content:\\\"\\\\f1ac\\\"}.fa-building:before{content:\\\"\\\\f1ad\\\"}.fa-child:before{content:\\\"\\\\f1ae\\\"}.fa-paw:before{content:\\\"\\\\f1b0\\\"}.fa-spoon:before{content:\\\"\\\\f1b1\\\"}.fa-cube:before{content:\\\"\\\\f1b2\\\"}.fa-cubes:before{content:\\\"\\\\f1b3\\\"}.fa-behance:before{content:\\\"\\\\f1b4\\\"}.fa-behance-square:before{content:\\\"\\\\f1b5\\\"}.fa-steam:before{content:\\\"\\\\f1b6\\\"}.fa-steam-square:before{content:\\\"\\\\f1b7\\\"}.fa-recycle:before{content:\\\"\\\\f1b8\\\"}.fa-automobile:before,.fa-car:before{content:\\\"\\\\f1b9\\\"}.fa-cab:before,.fa-taxi:before{content:\\\"\\\\f1ba\\\"}.fa-tree:before{content:\\\"\\\\f1bb\\\"}.fa-spotify:before{content:\\\"\\\\f1bc\\\"}.fa-deviantart:before{content:\\\"\\\\f1bd\\\"}.fa-soundcloud:before{content:\\\"\\\\f1be\\\"}.fa-database:before{content:\\\"\\\\f1c0\\\"}.fa-file-pdf-o:before{content:\\\"\\\\f1c1\\\"}.fa-file-word-o:before{content:\\\"\\\\f1c2\\\"}.fa-file-excel-o:before{content:\\\"\\\\f1c3\\\"}.fa-file-powerpoint-o:before{content:\\\"\\\\f1c4\\\"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:\\\"\\\\f1c5\\\"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:\\\"\\\\f1c6\\\"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:\\\"\\\\f1c7\\\"}.fa-file-movie-o:before,.fa-file-video-o:before{content:\\\"\\\\f1c8\\\"}.fa-file-code-o:before{content:\\\"\\\\f1c9\\\"}.fa-vine:before{content:\\\"\\\\f1ca\\\"}.fa-codepen:before{content:\\\"\\\\f1cb\\\"}.fa-jsfiddle:before{content:\\\"\\\\f1cc\\\"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:\\\"\\\\f1cd\\\"}.fa-circle-o-notch:before{content:\\\"\\\\f1ce\\\"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:\\\"\\\\f1d0\\\"}.fa-ge:before,.fa-empire:before{content:\\\"\\\\f1d1\\\"}.fa-git-square:before{content:\\\"\\\\f1d2\\\"}.fa-git:before{content:\\\"\\\\f1d3\\\"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:\\\"\\\\f1d4\\\"}.fa-tencent-weibo:before{content:\\\"\\\\f1d5\\\"}.fa-qq:before{content:\\\"\\\\f1d6\\\"}.fa-wechat:before,.fa-weixin:before{content:\\\"\\\\f1d7\\\"}.fa-send:before,.fa-paper-plane:before{content:\\\"\\\\f1d8\\\"}.fa-send-o:before,.fa-paper-plane-o:before{content:\\\"\\\\f1d9\\\"}.fa-history:before{content:\\\"\\\\f1da\\\"}.fa-circle-thin:before{content:\\\"\\\\f1db\\\"}.fa-header:before{content:\\\"\\\\f1dc\\\"}.fa-paragraph:before{content:\\\"\\\\f1dd\\\"}.fa-sliders:before{content:\\\"\\\\f1de\\\"}.fa-share-alt:before{content:\\\"\\\\f1e0\\\"}.fa-share-alt-square:before{content:\\\"\\\\f1e1\\\"}.fa-bomb:before{content:\\\"\\\\f1e2\\\"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:\\\"\\\\f1e3\\\"}.fa-tty:before{content:\\\"\\\\f1e4\\\"}.fa-binoculars:before{content:\\\"\\\\f1e5\\\"}.fa-plug:before{content:\\\"\\\\f1e6\\\"}.fa-slideshare:before{content:\\\"\\\\f1e7\\\"}.fa-twitch:before{content:\\\"\\\\f1e8\\\"}.fa-yelp:before{content:\\\"\\\\f1e9\\\"}.fa-newspaper-o:before{content:\\\"\\\\f1ea\\\"}.fa-wifi:before{content:\\\"\\\\f1eb\\\"}.fa-calculator:before{content:\\\"\\\\f1ec\\\"}.fa-paypal:before{content:\\\"\\\\f1ed\\\"}.fa-google-wallet:before{content:\\\"\\\\f1ee\\\"}.fa-cc-visa:before{content:\\\"\\\\f1f0\\\"}.fa-cc-mastercard:before{content:\\\"\\\\f1f1\\\"}.fa-cc-discover:before{content:\\\"\\\\f1f2\\\"}.fa-cc-amex:before{content:\\\"\\\\f1f3\\\"}.fa-cc-paypal:before{content:\\\"\\\\f1f4\\\"}.fa-cc-stripe:before{content:\\\"\\\\f1f5\\\"}.fa-bell-slash:before{content:\\\"\\\\f1f6\\\"}.fa-bell-slash-o:before{content:\\\"\\\\f1f7\\\"}.fa-trash:before{content:\\\"\\\\f1f8\\\"}.fa-copyright:before{content:\\\"\\\\f1f9\\\"}.fa-at:before{content:\\\"\\\\f1fa\\\"}.fa-eyedropper:before{content:\\\"\\\\f1fb\\\"}.fa-paint-brush:before{content:\\\"\\\\f1fc\\\"}.fa-birthday-cake:before{content:\\\"\\\\f1fd\\\"}.fa-area-chart:before{content:\\\"\\\\f1fe\\\"}.fa-pie-chart:before{content:\\\"\\\\f200\\\"}.fa-line-chart:before{content:\\\"\\\\f201\\\"}.fa-lastfm:before{content:\\\"\\\\f202\\\"}.fa-lastfm-square:before{content:\\\"\\\\f203\\\"}.fa-toggle-off:before{content:\\\"\\\\f204\\\"}.fa-toggle-on:before{content:\\\"\\\\f205\\\"}.fa-bicycle:before{content:\\\"\\\\f206\\\"}.fa-bus:before{content:\\\"\\\\f207\\\"}.fa-ioxhost:before{content:\\\"\\\\f208\\\"}.fa-angellist:before{content:\\\"\\\\f209\\\"}.fa-cc:before{content:\\\"\\\\f20a\\\"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:\\\"\\\\f20b\\\"}.fa-meanpath:before{content:\\\"\\\\f20c\\\"}.fa-buysellads:before{content:\\\"\\\\f20d\\\"}.fa-connectdevelop:before{content:\\\"\\\\f20e\\\"}.fa-dashcube:before{content:\\\"\\\\f210\\\"}.fa-forumbee:before{content:\\\"\\\\f211\\\"}.fa-leanpub:before{content:\\\"\\\\f212\\\"}.fa-sellsy:before{content:\\\"\\\\f213\\\"}.fa-shirtsinbulk:before{content:\\\"\\\\f214\\\"}.fa-simplybuilt:before{content:\\\"\\\\f215\\\"}.fa-skyatlas:before{content:\\\"\\\\f216\\\"}.fa-cart-plus:before{content:\\\"\\\\f217\\\"}.fa-cart-arrow-down:before{content:\\\"\\\\f218\\\"}.fa-diamond:before{content:\\\"\\\\f219\\\"}.fa-ship:before{content:\\\"\\\\f21a\\\"}.fa-user-secret:before{content:\\\"\\\\f21b\\\"}.fa-motorcycle:before{content:\\\"\\\\f21c\\\"}.fa-street-view:before{content:\\\"\\\\f21d\\\"}.fa-heartbeat:before{content:\\\"\\\\f21e\\\"}.fa-venus:before{content:\\\"\\\\f221\\\"}.fa-mars:before{content:\\\"\\\\f222\\\"}.fa-mercury:before{content:\\\"\\\\f223\\\"}.fa-intersex:before,.fa-transgender:before{content:\\\"\\\\f224\\\"}.fa-transgender-alt:before{content:\\\"\\\\f225\\\"}.fa-venus-double:before{content:\\\"\\\\f226\\\"}.fa-mars-double:before{content:\\\"\\\\f227\\\"}.fa-venus-mars:before{content:\\\"\\\\f228\\\"}.fa-mars-stroke:before{content:\\\"\\\\f229\\\"}.fa-mars-stroke-v:before{content:\\\"\\\\f22a\\\"}.fa-mars-stroke-h:before{content:\\\"\\\\f22b\\\"}.fa-neuter:before{content:\\\"\\\\f22c\\\"}.fa-genderless:before{content:\\\"\\\\f22d\\\"}.fa-facebook-official:before{content:\\\"\\\\f230\\\"}.fa-pinterest-p:before{content:\\\"\\\\f231\\\"}.fa-whatsapp:before{content:\\\"\\\\f232\\\"}.fa-server:before{content:\\\"\\\\f233\\\"}.fa-user-plus:before{content:\\\"\\\\f234\\\"}.fa-user-times:before{content:\\\"\\\\f235\\\"}.fa-hotel:before,.fa-bed:before{content:\\\"\\\\f236\\\"}.fa-viacoin:before{content:\\\"\\\\f237\\\"}.fa-train:before{content:\\\"\\\\f238\\\"}.fa-subway:before{content:\\\"\\\\f239\\\"}.fa-medium:before{content:\\\"\\\\f23a\\\"}.fa-yc:before,.fa-y-combinator:before{content:\\\"\\\\f23b\\\"}.fa-optin-monster:before{content:\\\"\\\\f23c\\\"}.fa-opencart:before{content:\\\"\\\\f23d\\\"}.fa-expeditedssl:before{content:\\\"\\\\f23e\\\"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:\\\"\\\\f240\\\"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:\\\"\\\\f241\\\"}.fa-battery-2:before,.fa-battery-half:before{content:\\\"\\\\f242\\\"}.fa-battery-1:before,.fa-battery-quarter:before{content:\\\"\\\\f243\\\"}.fa-battery-0:before,.fa-battery-empty:before{content:\\\"\\\\f244\\\"}.fa-mouse-pointer:before{content:\\\"\\\\f245\\\"}.fa-i-cursor:before{content:\\\"\\\\f246\\\"}.fa-object-group:before{content:\\\"\\\\f247\\\"}.fa-object-ungroup:before{content:\\\"\\\\f248\\\"}.fa-sticky-note:before{content:\\\"\\\\f249\\\"}.fa-sticky-note-o:before{content:\\\"\\\\f24a\\\"}.fa-cc-jcb:before{content:\\\"\\\\f24b\\\"}.fa-cc-diners-club:before{content:\\\"\\\\f24c\\\"}.fa-clone:before{content:\\\"\\\\f24d\\\"}.fa-balance-scale:before{content:\\\"\\\\f24e\\\"}.fa-hourglass-o:before{content:\\\"\\\\f250\\\"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:\\\"\\\\f251\\\"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:\\\"\\\\f252\\\"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:\\\"\\\\f253\\\"}.fa-hourglass:before{content:\\\"\\\\f254\\\"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:\\\"\\\\f255\\\"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:\\\"\\\\f256\\\"}.fa-hand-scissors-o:before{content:\\\"\\\\f257\\\"}.fa-hand-lizard-o:before{content:\\\"\\\\f258\\\"}.fa-hand-spock-o:before{content:\\\"\\\\f259\\\"}.fa-hand-pointer-o:before{content:\\\"\\\\f25a\\\"}.fa-hand-peace-o:before{content:\\\"\\\\f25b\\\"}.fa-trademark:before{content:\\\"\\\\f25c\\\"}.fa-registered:before{content:\\\"\\\\f25d\\\"}.fa-creative-commons:before{content:\\\"\\\\f25e\\\"}.fa-gg:before{content:\\\"\\\\f260\\\"}.fa-gg-circle:before{content:\\\"\\\\f261\\\"}.fa-tripadvisor:before{content:\\\"\\\\f262\\\"}.fa-odnoklassniki:before{content:\\\"\\\\f263\\\"}.fa-odnoklassniki-square:before{content:\\\"\\\\f264\\\"}.fa-get-pocket:before{content:\\\"\\\\f265\\\"}.fa-wikipedia-w:before{content:\\\"\\\\f266\\\"}.fa-safari:before{content:\\\"\\\\f267\\\"}.fa-chrome:before{content:\\\"\\\\f268\\\"}.fa-firefox:before{content:\\\"\\\\f269\\\"}.fa-opera:before{content:\\\"\\\\f26a\\\"}.fa-internet-explorer:before{content:\\\"\\\\f26b\\\"}.fa-tv:before,.fa-television:before{content:\\\"\\\\f26c\\\"}.fa-contao:before{content:\\\"\\\\f26d\\\"}.fa-500px:before{content:\\\"\\\\f26e\\\"}.fa-amazon:before{content:\\\"\\\\f270\\\"}.fa-calendar-plus-o:before{content:\\\"\\\\f271\\\"}.fa-calendar-minus-o:before{content:\\\"\\\\f272\\\"}.fa-calendar-times-o:before{content:\\\"\\\\f273\\\"}.fa-calendar-check-o:before{content:\\\"\\\\f274\\\"}.fa-industry:before{content:\\\"\\\\f275\\\"}.fa-map-pin:before{content:\\\"\\\\f276\\\"}.fa-map-signs:before{content:\\\"\\\\f277\\\"}.fa-map-o:before{content:\\\"\\\\f278\\\"}.fa-map:before{content:\\\"\\\\f279\\\"}.fa-commenting:before{content:\\\"\\\\f27a\\\"}.fa-commenting-o:before{content:\\\"\\\\f27b\\\"}.fa-houzz:before{content:\\\"\\\\f27c\\\"}.fa-vimeo:before{content:\\\"\\\\f27d\\\"}.fa-black-tie:before{content:\\\"\\\\f27e\\\"}.fa-fonticons:before{content:\\\"\\\\f280\\\"}.fa-reddit-alien:before{content:\\\"\\\\f281\\\"}.fa-edge:before{content:\\\"\\\\f282\\\"}.fa-credit-card-alt:before{content:\\\"\\\\f283\\\"}.fa-codiepie:before{content:\\\"\\\\f284\\\"}.fa-modx:before{content:\\\"\\\\f285\\\"}.fa-fort-awesome:before{content:\\\"\\\\f286\\\"}.fa-usb:before{content:\\\"\\\\f287\\\"}.fa-product-hunt:before{content:\\\"\\\\f288\\\"}.fa-mixcloud:before{content:\\\"\\\\f289\\\"}.fa-scribd:before{content:\\\"\\\\f28a\\\"}.fa-pause-circle:before{content:\\\"\\\\f28b\\\"}.fa-pause-circle-o:before{content:\\\"\\\\f28c\\\"}.fa-stop-circle:before{content:\\\"\\\\f28d\\\"}.fa-stop-circle-o:before{content:\\\"\\\\f28e\\\"}.fa-shopping-bag:before{content:\\\"\\\\f290\\\"}.fa-shopping-basket:before{content:\\\"\\\\f291\\\"}.fa-hashtag:before{content:\\\"\\\\f292\\\"}.fa-bluetooth:before{content:\\\"\\\\f293\\\"}.fa-bluetooth-b:before{content:\\\"\\\\f294\\\"}.fa-percent:before{content:\\\"\\\\f295\\\"}.fa-gitlab:before{content:\\\"\\\\f296\\\"}.fa-wpbeginner:before{content:\\\"\\\\f297\\\"}.fa-wpforms:before{content:\\\"\\\\f298\\\"}.fa-envira:before{content:\\\"\\\\f299\\\"}.fa-universal-access:before{content:\\\"\\\\f29a\\\"}.fa-wheelchair-alt:before{content:\\\"\\\\f29b\\\"}.fa-question-circle-o:before{content:\\\"\\\\f29c\\\"}.fa-blind:before{content:\\\"\\\\f29d\\\"}.fa-audio-description:before{content:\\\"\\\\f29e\\\"}.fa-volume-control-phone:before{content:\\\"\\\\f2a0\\\"}.fa-braille:before{content:\\\"\\\\f2a1\\\"}.fa-assistive-listening-systems:before{content:\\\"\\\\f2a2\\\"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:\\\"\\\\f2a3\\\"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:\\\"\\\\f2a4\\\"}.fa-glide:before{content:\\\"\\\\f2a5\\\"}.fa-glide-g:before{content:\\\"\\\\f2a6\\\"}.fa-signing:before,.fa-sign-language:before{content:\\\"\\\\f2a7\\\"}.fa-low-vision:before{content:\\\"\\\\f2a8\\\"}.fa-viadeo:before{content:\\\"\\\\f2a9\\\"}.fa-viadeo-square:before{content:\\\"\\\\f2aa\\\"}.fa-snapchat:before{content:\\\"\\\\f2ab\\\"}.fa-snapchat-ghost:before{content:\\\"\\\\f2ac\\\"}.fa-snapchat-square:before{content:\\\"\\\\f2ad\\\"}.fa-pied-piper:before{content:\\\"\\\\f2ae\\\"}.fa-first-order:before{content:\\\"\\\\f2b0\\\"}.fa-yoast:before{content:\\\"\\\\f2b1\\\"}.fa-themeisle:before{content:\\\"\\\\f2b2\\\"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:\\\"\\\\f2b3\\\"}.fa-fa:before,.fa-font-awesome:before{content:\\\"\\\\f2b4\\\"}.fa-handshake-o:before{content:\\\"\\\\f2b5\\\"}.fa-envelope-open:before{content:\\\"\\\\f2b6\\\"}.fa-envelope-open-o:before{content:\\\"\\\\f2b7\\\"}.fa-linode:before{content:\\\"\\\\f2b8\\\"}.fa-address-book:before{content:\\\"\\\\f2b9\\\"}.fa-address-book-o:before{content:\\\"\\\\f2ba\\\"}.fa-vcard:before,.fa-address-card:before{content:\\\"\\\\f2bb\\\"}.fa-vcard-o:before,.fa-address-card-o:before{content:\\\"\\\\f2bc\\\"}.fa-user-circle:before{content:\\\"\\\\f2bd\\\"}.fa-user-circle-o:before{content:\\\"\\\\f2be\\\"}.fa-user-o:before{content:\\\"\\\\f2c0\\\"}.fa-id-badge:before{content:\\\"\\\\f2c1\\\"}.fa-drivers-license:before,.fa-id-card:before{content:\\\"\\\\f2c2\\\"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:\\\"\\\\f2c3\\\"}.fa-quora:before{content:\\\"\\\\f2c4\\\"}.fa-free-code-camp:before{content:\\\"\\\\f2c5\\\"}.fa-telegram:before{content:\\\"\\\\f2c6\\\"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:\\\"\\\\f2c7\\\"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:\\\"\\\\f2c8\\\"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:\\\"\\\\f2c9\\\"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:\\\"\\\\f2ca\\\"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:\\\"\\\\f2cb\\\"}.fa-shower:before{content:\\\"\\\\f2cc\\\"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:\\\"\\\\f2cd\\\"}.fa-podcast:before{content:\\\"\\\\f2ce\\\"}.fa-window-maximize:before{content:\\\"\\\\f2d0\\\"}.fa-window-minimize:before{content:\\\"\\\\f2d1\\\"}.fa-window-restore:before{content:\\\"\\\\f2d2\\\"}.fa-times-rectangle:before,.fa-window-close:before{content:\\\"\\\\f2d3\\\"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:\\\"\\\\f2d4\\\"}.fa-bandcamp:before{content:\\\"\\\\f2d5\\\"}.fa-grav:before{content:\\\"\\\\f2d6\\\"}.fa-etsy:before{content:\\\"\\\\f2d7\\\"}.fa-imdb:before{content:\\\"\\\\f2d8\\\"}.fa-ravelry:before{content:\\\"\\\\f2d9\\\"}.fa-eercast:before{content:\\\"\\\\f2da\\\"}.fa-microchip:before{content:\\\"\\\\f2db\\\"}.fa-snowflake-o:before{content:\\\"\\\\f2dc\\\"}.fa-superpowers:before{content:\\\"\\\\f2dd\\\"}.fa-wpexplorer:before{content:\\\"\\\\f2de\\\"}.fa-meetup:before{content:\\\"\\\\f2e0\\\"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}a{cursor:pointer}.angular-editor-textarea{min-height:150px;overflow:auto;margin-top:5px;resize:vertical}.angular-editor-textarea:after{content:\\\"\\\";position:absolute;bottom:0;right:0;display:block;width:8px;height:8px;cursor:nwse-resize;background-color:#ffffff80}.angular-editor-toolbar{font:100 14px/15px Roboto,Arial,sans-serif;background-color:#f5f5f5;font-size:.8rem;padding:.2rem;border:1px solid #ddd}.angular-editor-toolbar .angular-editor-toolbar-set{display:none;margin-right:5px;vertical-align:baseline}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button{background-color:#fff;vertical-align:middle;border:1px solid #ddd;padding:.4rem;min-width:2rem;float:left}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:focus,.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.focus{outline:0}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label{pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.foreground :after{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button:disabled>.color-label.background{background:#555555}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active{background:#fff5b9}.angular-editor-toolbar .angular-editor-toolbar-set .angular-editor-button.active:hover{background-color:#fffa98}.angular-editor-toolbar .angular-editor-toolbar-set select{font-size:11px;width:90px;vertical-align:middle;background-color:transparent;border:.5px solid rgba(255,255,255,0);border-radius:5px;outline:none;padding:.4rem;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-heading optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .default{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h1{font-size:24px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h2{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h3{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h4{font-size:15px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h5{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .h6{font-size:13px}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .div,.angular-editor-toolbar .angular-editor-toolbar-set .select-heading .pre{font-size:12px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-heading:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size{display:inline-block;width:50px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size option{border:1px solid;background-color:#fff}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size1{font-size:10px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size2{font-size:12px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size3{font-size:14px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size4{font-size:16px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size5{font-size:18px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size6{font-size:20px}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size .size7{font-size:22px}}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-font-size:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style{display:inline-block;width:90px}@supports not (-moz-appearance: none){.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style optgroup{font-size:12px;background-color:#f4f4f4;padding:5px}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style option{border:1px solid;background-color:#fff}}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:disabled{background-color:#f5f5f5;pointer-events:none;cursor:not-allowed}.angular-editor-toolbar .angular-editor-toolbar-set .select-custom-style:hover{cursor:pointer;background-color:#f1f1f1;transition:.2s ease}.angular-editor-toolbar .angular-editor-toolbar-set .color-label{position:relative;cursor:pointer}.angular-editor-toolbar .angular-editor-toolbar-set .background{font-size:smaller;background:#1b1b1b;color:#fff;padding:3px}.angular-editor-toolbar .angular-editor-toolbar-set .foreground :after{position:absolute;content:\\\"\\\";left:-1px;top:auto;bottom:-3px;right:auto;width:15px;height:2px;z-index:0;background:#1b1b1b}.angular-editor-toolbar .angular-editor-toolbar-set:not([style*=\\\"display:none\\\"]):not([style*=\\\"display: none\\\"]){display:inline-block}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.Renderer2 }, { type: AngularEditorService }, { type: i0.ElementRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { id: [{\n type: Input\n }], uploadUrl: [{\n type: Input\n }], upload: [{\n type: Input\n }], showToolbar: [{\n type: Input\n }], fonts: [{\n type: Input\n }], customClasses: [{\n type: Input\n }], defaultFontName: [{\n type: Input\n }], defaultFontSize: [{\n type: Input\n }], hiddenButtons: [{\n type: Input\n }], execute: [{\n type: Output\n }], myInputFile: [{\n type: ViewChild,\n args: ['fileInput', { static: true }]\n }] } });\n\nclass AngularEditorComponent {\n constructor(r, editorService, doc, sanitizer, cdRef, defaultTabIndex, autoFocus) {\n this.r = r;\n this.editorService = editorService;\n this.doc = doc;\n this.sanitizer = sanitizer;\n this.cdRef = cdRef;\n this.autoFocus = autoFocus;\n this.modeVisual = true;\n this.showPlaceholder = false;\n this.disabled = false;\n this.focused = false;\n this.touched = false;\n this.changed = false;\n this.id = '';\n this.config = angularEditorConfig;\n this.placeholder = '';\n this.executeCommandFn = this.executeCommand.bind(this);\n this.viewMode = new EventEmitter();\n /** emits `blur` event when focused out from the textarea */\n // eslint-disable-next-line @angular-eslint/no-output-native, @angular-eslint/no-output-rename\n this.blurEvent = new EventEmitter();\n /** emits `focus` event when focused in to the textarea */\n // eslint-disable-next-line @angular-eslint/no-output-rename, @angular-eslint/no-output-native\n this.focusEvent = new EventEmitter();\n this.tabindex = -1;\n const parsedTabIndex = Number(defaultTabIndex);\n this.tabIndex = (parsedTabIndex || parsedTabIndex === 0) ? parsedTabIndex : null;\n }\n onFocus() {\n this.focus();\n }\n ngOnInit() {\n this.config.toolbarPosition = this.config.toolbarPosition ? this.config.toolbarPosition : angularEditorConfig.toolbarPosition;\n }\n ngAfterViewInit() {\n if (isDefined(this.autoFocus)) {\n this.focus();\n }\n }\n onPaste(event) {\n if (this.config.rawPaste) {\n event.preventDefault();\n const text = event.clipboardData.getData('text/plain');\n document.execCommand('insertHTML', false, text);\n return text;\n }\n }\n /**\n * Executed command from editor header buttons\n * @param command string from triggerCommand\n * @param value\n */\n executeCommand(command, value) {\n this.focus();\n if (command === 'focus') {\n return;\n }\n if (command === 'toggleEditorMode') {\n this.toggleEditorMode(this.modeVisual);\n }\n else if (command !== '') {\n if (command === 'clear') {\n this.editorService.removeSelectedElements(this.getCustomTags());\n this.onContentChange(this.textArea.nativeElement);\n }\n else if (command === 'default') {\n this.editorService.removeSelectedElements('h1,h2,h3,h4,h5,h6,p,pre');\n this.onContentChange(this.textArea.nativeElement);\n }\n else {\n this.editorService.executeCommand(command, value);\n }\n this.exec();\n }\n }\n /**\n * focus event\n */\n onTextAreaFocus(event) {\n if (this.focused) {\n event.stopPropagation();\n return;\n }\n this.focused = true;\n this.focusEvent.emit(event);\n if (!this.touched || !this.changed) {\n this.editorService.executeInNextQueueIteration(() => {\n this.configure();\n this.touched = true;\n });\n }\n }\n /**\n * @description fires when cursor leaves textarea\n */\n onTextAreaMouseOut(event) {\n this.editorService.saveSelection();\n }\n /**\n * blur event\n */\n onTextAreaBlur(event) {\n /**\n * save selection if focussed out\n */\n this.editorService.executeInNextQueueIteration(this.editorService.saveSelection);\n if (typeof this.onTouched === 'function') {\n this.onTouched();\n }\n if (event.relatedTarget !== null) {\n const parent = event.relatedTarget.parentElement;\n if (!parent.classList.contains('angular-editor-toolbar-set') && !parent.classList.contains('ae-picker')) {\n this.blurEvent.emit(event);\n this.focused = false;\n }\n }\n }\n /**\n * focus the text area when the editor is focused\n */\n focus() {\n if (this.modeVisual) {\n this.textArea.nativeElement.focus();\n }\n else {\n const sourceText = this.doc.getElementById('sourceText' + this.id);\n sourceText.focus();\n this.focused = true;\n }\n }\n /**\n * Executed from the contenteditable section while the input property changes\n * @param element html element from contenteditable\n */\n onContentChange(element) {\n let html = '';\n if (this.modeVisual) {\n html = element.innerHTML;\n }\n else {\n html = element.innerText;\n }\n if ((!html || html === '\\n \\n \\n \\n \\n\\n \\n \\n